This page is part of the FHIR Specification (v1.8.0: STU 3 Draft). The current version which supercedes this version is 5.0.0. For a full list of available versions, see the Directory of published versions . Page versions: R5 R4B R4 R3
This is a value set defined by the FHIR project.
Summary
Defining URL: | http://hl7.org/fhir/ValueSet/allergyintolerance-code |
Name: | AllergyIntolerance Substance/Product, Condition and Negation Codes |
Definition: | This value set includes concept codes for specific substances/pharmaceutical products, allergy or intolerance conditions, and negation/exclusion codes to specify the absence of specific types of allergies or intolerances. |
Committee: | Patient Care Work Group |
OID: | 2.16.840.1.113883.4.642.2.935 (for OID based terminology systems) |
Copyright: | This value set includes content from SNOMED CT, which is copyright © 2002+ International Health Terminology Standards Development Organisation (IHTSDO), and distributed by agreement between IHTSDO and HL7. Implementer use of SNOMED CT is not covered by this agreement. |
Source Resource | XML / JSON |
This value set is used in the following places:
This value set includes codes from the following code systems:
This expansion generated 06 Dec 2016
This value set has >1000 codes in it. In order to keep the publication size manageable, only a selection (1000 codes) of the whole set of codes is shown
All codes from system http://snomed.info/sct
Code | Display | Definition |
102002 | Hemoglobin Okaloosa | |
120006 | Ornithine racemase | |
125001 | Ferrous sulfate Fe^59^ | |
126000 | Galactosyl-N-acetylglucosaminylgalactosylglucosylceramide alpha-galactosyltransferase | |
130002 | Hemoglobin Hopkins-II | |
131003 | Dolichyl-phosphate mannosyltransferase | |
159002 | Ferrocyanide salt | |
164003 | Phosphoenolpyruvate-protein phosphotransferase | |
178002 | Uridine diphosphate galactose | |
186002 | HLA-Cw9 antigen | |
187006 | Cyanocobalamin Co^57^ | |
200001 | Berberine | |
217008 | Blood group antigen IH | |
231008 | 3-Hydroxyisobutyrate dehydrogenase | |
238002 | Heptachlor | |
261000 | Codeine phosphate | |
296000 | Coumachlor | |
322006 | Octylphenoxy P.H. ethanol | |
327000 | ^76^Arsenic | |
329002 | ^127^Antimony | |
336001 | Fibrinogen Tokyo II | |
340005 | Enzyme variant | |
363000 | Fibrinogen San Juan | |
370000 | beta>2S< Glycoprotein | |
371001 | Acylcarnitine hydrolase | |
377002 | Sparteine | |
392001 | ^151^Gadolinium | |
395004 | Immunoglobulin pentamer | |
412004 | Ribose-5-phosphate isomerase | |
424006 | Citramalyl-CoA lyase | |
425007 | Hemoglobin Nagoya | |
432003 | Carminic acid stain (substance) | |
438004 | 2-Hydroxyglutarate dehydrogenase | |
462009 | Urease (ATP-hydrolysing) | |
472007 | Vegetable textile fiber | |
476005 | Lymphocyte antigen CD1b | |
498001 | Nitrilase | |
501001 | Blood group antibody Sf^a^ | |
505005 | Blood group antibody M' | |
506006 | 3-Oxosteroid delta^1^-dehydrogenase | |
515004 | Blood group antigen Giaigue | |
519005 | Free protein S | |
521000 | ^197^Mercury | |
529003 | Guanosine | |
538001 | 2,3-Dihydroxybenzoate 3,4-dioxygenase | |
566009 | Acrosin | |
576007 | Blood group antibody Duck | |
578008 | Hemoglobin Jianghua | |
584006 | Blood group antibody Wr^b^ | |
585007 | Substance P | |
591009 | 2-Oxoisovalerate dehydrogenase (acylating) | |
593007 | Blood group antibody Holmes | |
594001 | 2-Oxoglutarate synthase | |
597008 | ^247^Californium | |
604000 | Plant sapogenin glycoside | |
611001 | Hippurate hydrolase | |
620005 | Trichlorophenol | |
648005 | Oil of calamus | |
662003 | Aeromonas proteolytica aminopeptidase | |
668004 | ^185^Osmium | |
683009 | Mercuric acetate | |
686001 | Plastoquinol-plastocyanin reductase | |
693002 | Trichothecenes | |
698006 | Erythromycin lactobionate | |
699003 | Coal tar extract | |
704006 | Blood group antigen Rx | |
732002 | N-valeraldehyde | |
735000 | Blood group antigen Jobbins | |
747006 | Oxamniquine | |
773001 | Hemoglobin M-Iwate | |
785009 | Dextranase | |
804003 | Creosotic acid | |
819002 | Lytic antibody | |
850000 | Stizolobate synthase | |
859004 | Peptide-N^4^-(N-acetyl-b-glucosaminyl) asparagine amidase | |
860009 | Immunoglobulin, aggregated | |
873008 | Urethan | |
876000 | Blood group antigen D | |
877009 | Carboxypeptidase A | |
889006 | (Acetyl-CoA carboxylase) kinase | |
896008 | Ice | |
905001 | o-Dihydroxycoumarin O^7^-glucosyltransferase | |
923009 | Complement component C2 | |
925002 | Sodium iodipamide | |
963005 | Pyridoxine 4-dehydrogenase | |
974001 | Adenosylmethionine decarboxylase | |
979006 | Carbamate kinase (substance) | |
993004 | Palladium compound | |
1002007 | Mannotetraose 2-alpha-N-acetylglucosaminyltransferase | |
1010008 | N-Acetylneuraminate monooxygenase | |
1018001 | Nornicotine | |
1025008 | ^93^Molybdenum | |
1047008 | Guanine deaminase | |
1050006 | Melilotate 3-monooxygenase | |
1057009 | Phosphate salt | |
1065007 | E. coli periplasmic proteinase | |
1080001 | ^202^Thallium | |
1091008 | Coagulation factor inhibitor | |
1097007 | Blood group antigen M^A^ | |
1105007 | Isochorismate synthase | |
1113008 | Pancreatic ribonuclease | |
1137008 | ^240^Uranium | |
1149009 | Hemoglobin Barcelona | |
1160000 | Antibody to antigen in Lutheran blood group system | |
1166006 | Titanium | |
1169004 | Hemoglobin Gower-2 | |
1171004 | Fibrinogen Kawaguchi | |
1185009 | Hemoglobin Roseau-Pointe à Pitre | |
1189003 | Hemoglobin F-M-Osaka | |
1190007 | Mephenoxalone | |
1219001 | Diethyl xanthogen disulfide | |
1223009 | Blood group antigen Marks | |
1244009 | Fibrinogen Madrid I | |
1248007 | Leucostoma neutral proteinase | |
1269009 | Amikacin sulfate | |
1272002 | Pteridine oxidase | |
1273007 | Blood group antibody Evelyn | |
1313002 | Nitrate reductase (cytochrome) | |
1319003 | Blood group antibody K18 | |
1320009 | Hemoglobin Manitoba | |
1325004 | Metocurine iodide | |
1331001 | Methamidophos | |
1334009 | Estradiol receptor | |
1336006 | 11-Deoxycorticosterone | |
1341003 | Hemoglobin Ta-li | |
1346008 | Blue shade eosin stain (substance) | |
1355006 | Coagulation factor IX Oxford 3 variant | |
1368003 | ^131^Iodine | |
1371006 | Blood group antigen Big | |
1373009 | ^93^Zirconium | |
1381005 | ^126^Iodine | |
1394007 | Iron pentacarbonyl | |
1396009 | Actinium | |
1405004 | Blood group antibody M^e^ | |
1408002 | Blood group antibody 1123K | |
1416006 | Radium compound | |
1450002 | Methylparafynol (substance) | |
1466000 | Cyclomaltodextrinase | |
1471007 | Elastin | |
1472000 | Adenosine-phosphate deaminase | |
1476002 | Codeine sulfate | |
1477006 | Hemoglobin Yatsushiro | |
1496005 | Proto-oncogene | |
1506001 | Blood group antigen Ch1 (substance) | |
1517000 | HLA-B21 antigen | |
1530004 | 6-Carboxyhexanoate-CoA ligase | |
1535009 | Nitrogen fluoride | |
1536005 | Pargyline hydrochloride | |
1540001 | Tellurium radioisotope | |
1545006 | Uridine phosphorylase | |
1557002 | Talc | |
1565004 | Blood group antibody Buckalew | |
1575001 | Maltose tetrapalmitate | |
1603001 | Cobalt isotope | |
1607000 | Homoserine kinase | |
1609002 | N-octyl isosafrole sulfoxide | |
1634002 | Blood group antigen Ven | |
1649005 | Blood group antigen Sul | |
1656004 | Hemoglobin Shaare Zedek | |
1660001 | Plant seeds | |
1668008 | Ceforanide | |
1672007 | Ligase | |
1673002 | Xylenol | |
1675009 | ^86^Rubidium | |
1676005 | Blood group antibody LW^ab^ | |
1681001 | Blood group antibody BLe^b^ | |
1696002 | 12-Hydroperoxy eicosatetraenoic acid | |
1701009 | ^191^Gold | |
1710001 | Uric acid | |
1726000 | Diamond | |
1727009 | Deoxylimonate A-ring-lactonase | |
1740004 | Deoxy cytidine triphosphate | |
1764003 | Saccharopine dehydrogenase (NADP^+^,L-glutamate-forming) | |
1768000 | Sucrose phosphorylase | |
1786002 | Leucine-tRNA ligase | |
1793003 | Sodium trichloroacetate | |
1795005 | Glyodin | |
1798007 | Hemoglobin Hammersmith | |
1799004 | L-Lysine oxidase | |
1823002 | Hemoglobin Tochigi | |
1827001 | Ribonuclease T>1< | |
1886008 | Verdohemoglobin | |
1904005 | Galactoside 3-fucosyltransferase | |
1914001 | von Willebrand factor antibody (substance) | |
1916004 | Boroglycerin | |
1940007 | Immunoglobulin, GM>21< allotype | |
1944003 | Coagulation factor X Patient variant | |
1956002 | Buclizine hydrochloride | |
1971003 | Loxapine hydrochloride | |
1975007 | Blood group antibody Niemetz | |
1978009 | Site-specific methyltransferase (cytosine-specific) | |
1985008 | Vomitus | |
1991005 | Lignins | |
2000001 | Heavy nitrogen | |
2006007 | Inosine diphosphate | |
2008008 | ^67^Gallium | |
2009000 | Cobalt carbonyl | |
2017008 | DNA topoisomerase | |
2027002 | Alternaria serine proteinase | |
2029004 | Fibrinogen Oslo II | |
2038002 | Blood group antibody Bg^b^ | |
2039005 | sym-Norspermidine synthase | |
2050008 | Choloylglycine hydrolase | |
2064008 | L-Xylulokinase | |
2082006 | Lymphocyte antigen CD51 | |
2085008 | Oncogene protein TCL | |
2088005 | Page blue G-90 stain (substance) | |
2096000 | NAD^+^ ADP-ribosyltransferase | |
2100004 | Sulfonethylmethane | |
2101000 | Yeast proteinase B | |
2125008 | Betazole | |
2130007 | Cyclohexane-1,2-diol dehydrogenase | |
2141009 | Hydrogen | |
2147008 | Blood group antigen Paular | |
2151005 | Pyridoxamine-pyruvate aminotransferase | |
2154002 | Tagaturonate reductase | |
2159007 | Azorubin S stain (substance) | |
2163000 | Dicofol | |
2168009 | Bisphosphoglycerate mutase | |
2179004 | Malonate-semialdehyde dehydratase | |
2189000 | Hemoglobin F-Dammam | |
2194000 | ^101^Rhodium | |
2195004 | Tocainide hydrochloride | |
2197007 | Boric acid topical preparation | |
2201007 | Bacteriopurpurin | |
2208001 | Phenylserine aldolase | |
2212007 | Fibrinogen Bethesda II | |
2215009 | Azuresin | |
2240002 | Guanidinobutyrase | |
2249001 | Gentamicin sulfate | |
2254005 | Orotic acid | |
2260005 | HLA-DRw18 antigen | |
2262002 | Cellulose polysulfatase | |
2264001 | Selenium isotope | |
2309006 | Gold | |
2311002 | Prostacyclin synthase | |
2329007 | Blood group antibody Vel | |
2331003 | Carbohydrate | |
2338009 | Plant roots | |
2343002 | Guthion | |
2346005 | Vascormone | |
2354007 | 3'-Nucleotidase | |
2358005 | Glass fragment | |
2369008 | Indole-3-acetate beta-glucosyltransferase | |
2370009 | UDP-N-acetylmuramate-alanine ligase | |
2376003 | Mercury compound | |
2384004 | ^230^Uranium | |
2404002 | Blood group antibody St^a^ | |
2405001 | b- Propiolactone | |
2414006 | Prolactin receptor | |
2430003 | Silicon radioisotope | |
2431004 | Blood group antibody Friedberg | |
2441001 | Mercury radioisotope | |
2444009 | HLA-Dw25 antigen | |
2450004 | Mannosamine | |
2462000 | Glucose dehydrogenase (NADP^+^) | |
2466002 | Chloride peroxidase | |
2500009 | Lymphocyte antigen CDw41b | |
2509005 | D-Glutamate oxidase | |
2516006 | Metallic sulfide compound | |
2522002 | Extravascular blood | |
2529006 | Hemoglobin Wood | |
2537003 | Antituberculosis agent | |
2568004 | Blood group antigen McAuley | |
2573005 | Immunoglobulin, GM>13< allotype | |
2575003 | Zinc alpha>2< glycoprotein | |
2595009 | ^119m^Tellurium | |
2597001 | alpha 1 globulin | |
2611008 | Blood group antibody La Fave | |
2637006 | Indium isotope | |
2648004 | Bile vomitus | |
2649007 | Azo dye | |
2660003 | Sodium dehydrocholate | |
2671002 | 3-Methyl-2-oxobutanoate hydroxy-methyltransferase | |
2674005 | ^128^Cesium | |
2676007 | C3(H20) | |
2678008 | Hemoglobin New Mexico | |
2680002 | Factor XIII antibody | |
2698003 | Natural gas | |
2705002 | ^72^Arsenic | |
2706001 | Blood group antigen Vennera | |
2719002 | Tartrate dehydratase | |
2721007 | Blood group antigen McC^f^ | |
2728001 | Antigen in Lewis (Le) blood group system | |
2753003 | Blood group antibody M>1< | |
2754009 | Hemoglobin F-Kennestone | |
2765004 | Blood group antigen Sc3 | |
2778004 | Pleural fluid | |
2796008 | Methantheline (substance) | |
2799001 | Methylbenzethonium chloride | |
2823004 | Hemoglobin Bristol | |
2832002 | Molybdenum compound | |
2846002 | Hemoglobin Saitama | |
2869004 | Acetic acid | |
2878005 | Meperidine hydrochloride (substance) | |
2880004 | Calcium sulfate | |
2883002 | Exopolygalacturonate lyase | |
2913009 | Immunoglobulin E, H chain | |
2916001 | ^22^Neon | |
2925007 | Fluorometholone | |
2927004 | Rescinnamine | |
2938004 | Pyrazole | |
2942001 | Carbon^14^ D-xylose | |
2950005 | Hemoglobin L-Persian Gulf | |
2958003 | Zinc caprylate | |
2964005 | Dimethoxyamphetamine | |
2974008 | Trichophyton schoenleinii collagenase | |
2988007 | HLA-Aw antigen | |
2991007 | Mecamylamine hydrochloride | |
2995003 | Arecoline | |
3027009 | ^133^Barium | |
3031003 | Dihydroxyaluminum sodium carbonate | |
3040004 | Technetium Tc^99m^ disofenin | |
3045009 | Nitrochlorobenzene | |
3052006 | Ornithine-oxo-acid aminotransferase | |
3066001 | Triiodothyroacetic acid | |
3070009 | Aspartate-ammonia ligase | |
3087006 | Oil of male fern | |
3107005 | Hemoglobin Shuangfeng | |
3108000 | Aspergillus deoxyribonuclease K>1< | |
3131000 | Blood group antigen Middel | |
3136005 | Cefoperazone sodium | |
3142009 | Azacyclonol | |
3145006 | Penicillic acid | |
3150000 | Sialate O-acetylesterase | |
3151001 | Left upper lobe mucus | |
3155005 | 3-Phosphoglyceroyl-phosphate-polyphosphate phosphotransferase | |
3161008 | 3-Methyl histidine | |
3167007 | Hard coal | |
3187008 | Blood group antigen Nielsen | |
3193000 | alpha-1,4-Glucan-protein synthase (UDP-forming) | |
3197004 | Inosine monophosphate | |
3209002 | Pancuronium sodium | |
3212004 | Manganese sulfate | |
3225007 | Fibrinogen Seattle I | |
3232003 | o-Benzyl-parachlorophenol | |
3271000 | Hemoglobin Southampton | |
3273002 | Tyrosine-ester sulfotransferase | |
3300001 | Euphorbain | |
3318003 | Vaginal secretions | |
3325005 | Lipopolysaccharide | |
3339005 | (R)-20-Hydroxysteroid dehydrogenase | |
3340007 | alpha-Amylase | |
3342004 | Copper isotope (substance) | |
3346001 | Hemoglobin Brest | |
3378009 | Imipramine hydrochloride | |
3379001 | Thimerosal | |
3392003 | Aldehyde dehydrogenase (acceptor) | |
3405005 | 2-Hydroxy-3-oxoadipate synthase | |
3411008 | bis-(Dimethylthiocarbamyl) disulfide | |
3437006 | Hydroxymethylglutaryl-CoA hydrolase | |
3440006 | Biotin carboxylase | |
3455002 | Discontinued pesticide | |
3463001 | L-Amino-acid dehydrogenase | |
3465008 | DNA topoisomerase (ATP-hydrolysing) | |
3466009 | Dimethylamine | |
3492002 | Galactinol-sucrose galactosyltransferase | |
3493007 | Smegma clitoridis | |
3495000 | Cystyl-aminopeptidase | |
3501003 | Isoxsuprine hydrochloride | |
3523004 | Hemoglobin Q-India | |
3532002 | Laryngeal mucus | |
3555004 | Blood group antigen Morrison | |
3579002 | ^129^Cesium | |
3581000 | Glucose-6-phosphatase | |
3587001 | Malate dehydrogenase (decarboxylating) | |
3588006 | Complement enzyme | |
3592004 | Short-acting thyroid stimulator | |
3597005 | Acebutolol hydrochloride | |
3601005 | Ether | |
3602003 | Warm antibody | |
3610002 | Epoxide hydrolase | |
3617004 | ^79^Selenium | |
3648007 | Glucocorticoid receptor | |
3655009 | Hemoglobin Constant Springs | |
3672002 | Fibrinogen Caracas | |
3684000 | Phenylacetic acid | |
3689005 | Hemoglobin Mizushi | |
3692009 | Sodium sulfite | |
3693004 | Fibrinogen Dusard | |
3702007 | CDPglycerol glycerophosphotransferase | |
3710008 | Prostaglandin synthase | |
3718001 | Cow's milk | |
3726009 | Valine-tRNA ligase | |
3727000 | Hemoglobin F-Port Royal | |
3730007 | Blood group antigen Tr^a^ | |
3737005 | Nitrate reductase (NADH) | |
3742002 | Extracellular crystal | |
3757009 | Gossypol | |
3771001 | Neuromelanin | |
3775005 | Choline dehydrogenase | |
3776006 | Xanthine dehydrogenase | |
3792001 | Arachidonic acid | |
3793006 | Soluble barium compound | |
3800009 | Acetate kinase | |
3807007 | Blood group antigen c | |
3811001 | Magnesium-protoporphyrin methyltransferase | |
3812008 | Beryllium isotope | |
3816006 | Vanadium isotope | |
3823007 | Prochlorperazine edisylate | |
3829006 | Iron | |
3834005 | CMP-N-acetylneuraminate-(alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetyl-galactosaminide alpha-2,6-sialyltransferase | |
3836007 | Glutaminase | |
3844007 | Protoaphin-aglucone dehydratase (cyclizing) | |
3848005 | Nitrotoluene | |
3849002 | Carbon black | |
3854006 | bis-Chloro methyl ether | |
3874004 | Hydrocodone bitartrate | |
3892007 | Thymidine | |
3896005 | p-Hydroxybenzoate ester | |
3897001 | Blood group antigen 'N' | |
3906002 | Rectified birch tar oil (substance) | |
3920009 | Hemoglobin Atago | |
3930000 | Manufactured gas | |
3932008 | ^64^Copper | |
3941003 | Metronidazole hydrochloride | |
3945007 | Tin isotope | |
3958008 | ^245^Californium | |
3961009 | Blood group antigen Ritherford | |
3976001 | Blood group antigen HEMPAS | |
3982003 | Oxaloacetate decarboxylase | |
3983008 | N,-N-dimethyltryptamine | |
3990003 | Alkaline phosphatase isoenzyme, bone fraction | |
3994007 | Hemoglobin Tampa | |
4014000 | Sulfisomidine | |
4024008 | Soft metal | |
4025009 | Captodiame | |
4043008 | Etidocaine hydrochloride | |
4047009 | cis-1,2-Dihydrobenzene-1,2-diol dehydrogenase | |
4048004 | 1,1,2,2-Tetrachloro-1,2- difluoroethane | |
4067000 | Chorismate mutase | |
4076007 | Parathyroid hormone | |
4077003 | Dihydrolipoamide succinyltransferase | |
4080002 | Hemoglobin Grady, Dakar | |
4091009 | Enteropeptidase | |
4097008 | Apo-SAA complex | |
4104007 | Chondroitin sulfate | |
4105008 | Adenylate cyclase | |
4115002 | Blood group antibody Norlander | |
4137009 | sec-Butyl acetate | |
4153007 | Long-chain-enoyl-CoA hydratase | |
4167003 | Lymphocyte antigen CD31 | |
4169000 | Blood group antibody Le^bH^ | |
4177001 | Hemoglobin Long Island-Marseille | |
4182008 | CDPdiacylglycerol-serine O-phosphatidyl-transferase | |
4188007 | Fibrinogen Sydney II | |
4200007 | Neriifolin | |
4201006 | 6-Aminohexanoate-dimer hydrolase | |
4203009 | Imipramine pamoate | |
4207005 | Cortisone beta-reductase | |
4217000 | Fluorosilicate salt | |
4218005 | Immunoglobulin, GM>23< allotype | |
4231000 | Gallium isotope | |
4239003 | Glycerol dehydrogenase | |
4255005 | ^241^Americium | |
4289006 | Keyhole-limpet hemocyanin | |
4290002 | Linamarin synthase | |
4314009 | Blood group antibody Allchurch | |
4334005 | Tar oil | |
4342006 | 2-Aminopyridine | |
4353000 | Dibutyl phthalate | |
4355007 | Coagulation factor IX San Dimas variant | |
4362003 | 4-Coumarate-CoA ligase | |
4370008 | Acetone | |
4393002 | Blood group antigen Fedor | |
4401009 | Blood group antibody H>T< | |
4413004 | Benzypyrinium (substance) | |
4422003 | Blood group antigen | |
4423008 | Fibrinogen New York II | |
4425001 | Blood group antibody Binge | |
4435007 | Sulfuryl fluoride | |
4437004 | ^127^Cesium | |
4471008 | ^244^Californium | |
4479005 | Hemoglobin Brockton | |
4480008 | Sulfaethidole | |
4509009 | Plant phenanthrene toxin | |
4518006 | Buthenal | |
4534009 | ^208^Bismuth | |
4540002 | ADP deaminase | |
4546008 | Myristic acid | |
4555006 | Blood group antibody Rils | |
4560005 | Hemoglobin Mizuho | |
4561009 | Arginine decarboxylase | |
4564001 | Blood group antibody Sisson | |
4567008 | Galactose-1-phosphate thymidylyltransferase | |
4582003 | Blood group antigen N^A^ | |
4591004 | Blood group antigen Far | |
4610008 | Senile cardiac protein | |
4616002 | Triclobisonium chloride | |
4629002 | Hypoglycin B | |
4635002 | Arterial blood | |
4643007 | Calf thymus ribonuclease H | |
4656000 | Alcian blue 8GX stain (substance) | |
4674009 | 2,3-Dihydroxybenzoate serine ligase | |
4681002 | Potassium permanganate | |
4693006 | Chromium^51^ albumin | |
4700006 | Beef insulin | |
4706000 | Chlorine monoxide | |
4714006 | ^183m^Osmium | |
4728000 | Scopulariopsis proteinase | |
4731004 | Aluminum pyro powder | |
4732006 | Oncogene protein P55, V-MYC | |
4746006 | Hemoglobin Mito | |
4761007 | Lymphocyte antigen CD30 | |
4762000 | Platelet antigen HPA-3b | |
4777008 | Fluroxene | |
4780009 | Butabarbital sodium (substance) | |
4786003 | beta-1,4-Mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase | |
4789005 | Blood group antibody Bultar | |
4793004 | Azobenzene reductase | |
4814001 | Valethamate | |
4824009 | Amine oxidase (flavin-containing) | |
4825005 | Peptidyl-glycinamidase | |
4831008 | Arabinose-5-phosphate isomerase | |
4832001 | Technetium Tc^99m^ mebrofenin | |
4833006 | Glucan endo-1,3-alpha-glucosidase | |
4844003 | 3,3' Diiodothyronine | |
4864008 | Adenylic acid | |
4872005 | Glucosulfone | |
4878009 | HLA-Dw3 antigen | |
4882006 | Ichthyoallyeinotoxin | |
4889002 | Xylulokinase | |
4901003 | Pyruvate oxidase (CoA-acetylating) | |
4925006 | Oncogene protein V-ABC | |
4933007 | Lymphocyte antigen CD15 | |
4940008 | Tattoo dye | |
4955004 | Neoplastic structural gene | |
4962008 | Tree bark | |
4963003 | Neutral amino acid | |
4965005 | Glutathione reductase (NAD(P)H) | |
4968007 | Acumentin | |
4986005 | Magnesium borate | |
5003005 | Hemoglobin Swan River | |
5004004 | Blood group antibody Panzar | |
5007006 | Papain | |
5024000 | Fresh water | |
5031001 | 3-3'Dichlorobenzidine | |
5040002 | Cesium | |
5043000 | Erythrosin Y stain (substance) | |
5045007 | Oncogene protein TCL4 | |
5059000 | ^97^Technetium | |
5060005 | ^132^Cesium | |
5061009 | Protein-methionine-S-oxide reductase | |
5064001 | Blood group antibody D 1276 | |
5081005 | Blood group antigen hr^B^ | |
5086000 | Gelsolin | |
5094007 | Blood group antigen Rios | |
5098005 | Fennel oil | |
5109006 | Methylated-DNA-protein-cysteine methyltransferase | |
5142007 | Coagulation factor II Houston variant | |
5160007 | Metallic compound | |
5163009 | Scombrotoxin | |
5167005 | Zinc chloride fumes | |
5172001 | Coagulation factor Xa | |
5179005 | Connective tissue fiber | |
5200001 | trans-Epoxysuccinate hydrolase | |
5206007 | Cyanate compound | |
5220000 | Bacitracin | |
5226006 | Flavone O^7^-beta-glucosyltransferase | |
5250008 | Thymus-independent antigen | |
5252000 | Hafnium radioisotope | |
5253005 | Hemoglobin Woodville | |
5259009 | Blood group antigen Braden | |
5289002 | Scilliroside | |
5303002 | Hemoglobin Hoshida | |
5305009 | Polynucleotide | |
5307001 | Blood group antigen Hamet | |
5312000 | ^65^Zinc (substance) | |
5323001 | Uridine diphosphate glucuronic acid | |
5330007 | Actin-binding protein | |
5339008 | L-Glycol dehydrogenase | |
5340005 | Blood group antigen Swietlik | |
5392001 | Propylene glycol monomethyl ether | |
5395004 | Pyridoxamine-phosphate oxidase | |
5404007 | Lymphocyte antigen CD45RA | |
5405008 | ^60^Cobalt (substance) | |
5406009 | beta-L-Arabinosidase | |
5420002 | Accessory sinus mucus | |
5439007 | Blood group antibody Do^a^ | |
5442001 | Page blue 83 stain (substance) | |
5453007 | Iridium isotope | |
5471000 | Hemoglobin G-Coushatta | |
5474008 | Propionate-CoA ligase | |
5477001 | Ferric subsulfate | |
5483003 | Oxalate CoA-transferase | |
5504009 | Blood group antigen Fuerhart | |
5511008 | Inosinate nucleosidase | |
5513006 | Immunoglobulin A, H chain | |
5515004 | Rhodium fumes | |
5533005 | Blood group antibody Kp^a^ | |
5537006 | Immunoglobulin D, H chain (substance) | |
5540006 | Calcium | |
5547009 | ^233^Plutonium | |
5548004 | 2-Dehydro-3-deoxy-D-pentonate aldolase | |
5568005 | Hemoglobin Hijiyama | |
5573004 | Blood group antigen Oca | |
5589001 | Licodione O^2'^-methyltransferase | |
5590005 | Beryllium radioisotope | |
5628003 | Hemoglobin I-High Wycombe | |
5629006 | Cytidylic acid | |
5637003 | HLA-DQw6 antigen | |
5641004 | Divalproex sodium (substance) | |
5647000 | Griseofulvin ultramicrosize | |
5656008 | ^116m^Antimony | |
5657004 | Coal tar topical solution | |
5659001 | Hemoglobin J-Tongariki | |
5670008 | Gold isotope | |
5681006 | Ceftizoxime sodium | |
5691000 | Absorbable gelatin sponge | |
5692007 | Cyanocobalamin Co^58^ | |
5699003 | Somatomedin C | |
5700002 | Blood group antibody Gomez | |
5702005 | ^106m^Silver | |
5704006 | Galactokinase | |
5705007 | 1,3-Propanediol dehydrogenase | |
5739006 | Stramonium | |
5746002 | ^118m^Antimony | |
5757007 | HLA-Cw8 antigen | |
5762008 | Heterogeneous nuclear ribonucleic acid (substance) | |
5764009 | ^242^Plutonium | |
5767002 | Sulfamerazine | |
5774007 | White petrolatum | |
5800007 | tRNA (5-methylaminomethyl-2-thiouridylate)-methyltransferase | |
5813001 | Malate dehydrogenase | |
5826002 | Ethyl-4-bis-(hydroxypropyl)-1-aminobenzoate | |
5827006 | Crotonaldehyde | |
5829009 | Hemoglobin Vaasa | |
5830004 | Hemoglobin Bart | |
5840001 | Blood group antibody Wj | |
5858007 | ^110m^Indium | |
5863006 | Vitexin beta-glucosyltransferase | |
5896008 | Hellebrin | |
5899001 | Bacterial structural gene | |
5907009 | Quinidine polygalacturonate | |
5910002 | Oncogene protein PP60, V-SRC | |
5915007 | Blood group antigen Gladding | |
5927005 | Lactaldehyde dehydrogenase | |
5931004 | Technetium Tc^99m^ sulfur colloid | |
5932006 | Cysteine | |
5950004 | 3',5'-Cyclic-nucleotide phosphodiesterase | |
5955009 | Diethylene glycol | |
5977008 | Blood group antigen Bullock | |
5989005 | Immunoglobulin, GM>17< allotype | |
5991002 | D-Fuconate dehydratase | |
6021003 | ^88^Yttrium | |
6038004 | Oxygen radioisotope | |
6043006 | Bone cement | |
6044000 | Carbon disulfide | |
6054001 | Doxylamine succinate | |
6056004 | Blood group antibody Wk^a^ | |
6068008 | Blood group antigen Mil | |
6083003 | Hydroxylysine | |
6085005 | Synovial fluid | |
6088007 | Benzphetamine hydrochloride (substance) | |
6089004 | Lochia alba | |
6091007 | Blood group antibody L Harris | |
6107003 | Asparagusate reductase (NADH) | |
6109000 | Aromatic-amino-acid aminotransferase | |
6115000 | Blood group antibody Anuszewska | |
6135004 | Blood group antigen Duck | |
6138002 | Blood group antigen Le Provost | |
6162007 | Meclocycline | |
6170002 | Heat labile antibody | |
6172005 | Fatty-acid methyltransferase | |
6178009 | Lymphocyte antigen CD63 | |
6179001 | o-Methy-bufotenine | |
6182006 | Chloroacetone | |
6197009 | Blood group antigen Zd | |
6237004 | Bemegride | |
6249003 | Potassium metabisulfite | |
6256009 | Ribose isomerase | |
6257000 | Sodium chloride Na^22^ | |
6260007 | Protokylol | |
6261006 | Flurothyl (substance) | |
6263009 | Plant residue | |
6264003 | Diazinon | |
6287006 | Methidathion | |
6291001 | N-Acetylglucosamine-1-phosphodiester N-acetylglucosaminidase | |
6301006 | ^178^Tantalum | |
6310003 | Particulate antigen | |
6314007 | Phenol beta-glucosyltransferase | |
6333002 | Squill extract | |
6338006 | Imidazolonepropionase | |
6356006 | Chlorodiallylacetamide | |
6360009 | Kallidin II | |
6367007 | ^95m^Technetium | |
6386004 | N-Acetylneuraminate O^4^-acetyltransferase | |
6394006 | Phentermine hydrochloride | |
6401007 | Lichenase | |
6409009 | Morpholine | |
6411000 | Interleukin-12 | |
6422001 | HLA-DRw14 antigen | |
6451002 | Chlorobenzilate | |
6455006 | Chloroprene | |
6469006 | delta^1^-Piperideine-2-carboxylate reductase | |
6478000 | 6-Phosphofructokinase | |
6495008 | Fibrinogen Montreal II | |
6507009 | Blood group antigen Lu12 | |
6513000 | Flumethiazide | |
6516008 | Indium^111^-Fe(OH)>3< | |
6524003 | Distilled spirits | |
6529008 | Blood group antigen Cl^a^ | |
6532006 | Macrophage activating factor | |
6590001 | Galactosylceramidase | |
6592009 | HLA-Dw12 antigen | |
6602005 | Aminoacridine | |
6611005 | Diethylaminoethanol | |
6612003 | Chloramphenicol sodium succinate | |
6619007 | Bilirubin Y transport protein | |
6642000 | Opsonin | |
6644004 | Homoserine dehydrogenase | |
6671004 | Blood group antigen Caw | |
6672006 | Phosphoadenylate 3'-nucleotidase | |
6699008 | Titanium radioisotope | |
6701008 | Lissamine fast red B stain (substance) | |
6702001 | Ethyl mercaptoethyl diethyl thiophosphate | |
6709005 | Gentamicin 2''-nucleotidyltransferase | |
6710000 | Nitric oxide | |
6713003 | ^91^Yttrium | |
6717002 | Nifuroxime | |
6725000 | Methylthioninium chloride | |
6730001 | ^234^Uranium | |
6741004 | Anti DNA antibody | |
6755007 | Thymus leukemia antigen (substance) | |
6786001 | Silver difluoride | |
6790004 | Aminopterin | |
6792007 | Veratrine | |
6808006 | Ferrous iron compound | |
6809003 | Phomopsin | |
6814004 | Discadenine synthase | |
6817006 | Oxidized glutathione | |
6826009 | Sterol hormone | |
6837005 | Propoxyphene napsylate (substance) | |
6854002 | ^188^Platinum | |
6865007 | Theophylline calcium salicylate | |
6873003 | Cephapirin sodium (substance) | |
6879004 | 5,8,11-Eicosatrienoic acid | |
6881002 | Magnesium fumes | |
6884005 | (S)-3-Amino-2-methylpropionate aminotransferase | |
6890009 | 3-Deoxy-manno-octulosonate-8-phosphatase | |
6896003 | Thiopurine methyltransferase | |
6910009 | Sodium fluoride | |
6911008 | Deoxycytidylate methyltransferase | |
6916003 | Bowieine | |
6924008 | Exopolyphosphatase | |
6925009 | Leucine acetyltransferase | |
6927001 | ^121^Tin | |
6937006 | Thymidylate synthase | |
6945001 | Blood group antigen Le^bH^ | |
6952004 | ^121m^Tin | |
6958000 | Blood group antibody Frando | |
6961004 | Lysolecithin acylmutase | |
6970001 | 4-Hydroxyproline epimerase | |
6973004 | Chromium^51^ chloride | |
6983000 | Acrylamide | |
6992002 | Triflupromazine hydrochloride | |
6993007 | Seminal fluid | |
6999006 | Ammonium compound | |
7008002 | beta-Carotene 15,15'-dioxygenase | |
7018007 | Malate-CoA ligase | |
7029006 | Blood group antigen Greenlee | |
7030001 | Globoside | |
7034005 | Diclofenac | |
7045008 | Lycorine | |
7047000 | Asphyxiant atmosphere | |
7049002 | Pyruvate carboxylase | |
7054006 | Hemoglobin Poissy | |
7056008 | 3-Propylmalate synthase | |
7059001 | N-Acylneuraminate-9-phosphatase | |
7061005 | Anthocyanidin O^3^-glucosyltransferase | |
7070008 | Convallamarin | |
7084003 | Fibrinogen Buenos Aires II | |
7110002 | ^69^Germanium | |
7120007 | Antigen | |
7132006 | ^73^Gallium (substance) | |
7139002 | Acid-CoA ligase (GDP-forming) | |
7146006 | Cyclohexene oxide | |
7152007 | Chlorthion | |
7156005 | Phosphorus isotope | |
7158006 | HLA-Dw19 antigen | |
7161007 | Complement component C2a | |
7179006 | Prekallikrein | |
7191002 | Methenyltetrahydrofolate cyclohydrolase | |
7208009 | Thiol oxidase | |
7211005 | Blood group antibody Haakestad (substance) | |
7237008 | Galactonate dehydratase | |
7243005 | Methyl isocyanate | |
7269004 | Thorium | |
7271004 | Mixed dust | |
7280004 | dTDP4-dehydrorhamnose reductase | |
7281000 | Technetium Tc^99m^ lidofenin | |
7284008 | Mercaptan compound | |
7294003 | tert-Butyl acetate | |
7302008 | Ambuphylline | |
7318002 | Bacteriochlorophyll | |
7321000 | Pyrimidine | |
7325009 | Calcium hydroxide (substance) | |
7327001 | Sulfurous acid | |
7328006 | Red petrolatum | |
7330008 | Shellac | |
7337006 | Blood group antibody Tr^a^ | |
7348004 | Coagulation factor II | |
7382005 | Aminoalcohol ester (substance) | |
7401000 | Heme-hemopexin complex | |
7411007 | Blood group antibody HLA-B8 | |
7427000 | Sepiapterin reductase | |
7434003 | Erythrosin B stain (substance) | |
7446004 | Ruthenium | |
7451005 | Tobramycin ophthalmic preparation | |
7460002 | ^127^Tellurium | |
7470000 | p-tert-Butyltoluene | |
7489000 | Homocytotropic antibody | |
7503004 | ^72^Gallium | |
7509000 | Mannitol hexanitrate | |
7515000 | Hepatotoxic mycotoxin | |
7537007 | Stizolobinate synthase | |
7547005 | Hemoglobin Lincoln Park | |
7549008 | Fibrinogen Bethesda I | |
7588005 | Blood group antibody Sk^a^ | |
7608003 | Triethylene glycol | |
7616007 | Blood group antibody Pruitt | |
7648006 | HLA-Bw70 antigen | |
7661006 | Fish bone | |
7670009 | Aminobutyraldehyde dehydrogenase | |
7675004 | Blood group antigen Towey | |
7679005 | Strong oxidizing compound | |
7685003 | Blood group antibody Bg^c^ | |
7696006 | Ferrovanadium dust | |
7716001 | Isovaleryl-CoA dehydrogenase | |
7737009 | Chlortetracycline hydrochloride (substance) | |
7738004 | HLA-B49 antigen | |
7761002 | ^111^Silver | |
7770004 | ^89^Strontium | |
7774008 | Neo-b-vitamin A>1< | |
7779003 | ^103^Ruthenium | |
7785005 | Sphingomyelin phosphodiesterase D | |
7790008 | 1-Monoacylglycerol | |
7791007 | Soy protein | |
7795003 | Oxalate oxidase | |
7801007 | Tetrahydroxypteridine cycloisomerase | |
7816005 | Antazoline hydrochloride | |
7834009 | Acetyldigitoxin | |
7846008 | Sphingomyelin phosphodiesterase | |
7848009 | 1-Phosphatidylinositol phosphodiesterase | |
7868003 | beta-Cyclopiazonate dehydrogenase | |
7879008 | ^218^Radon | |
7900007 | Hemoglobin Presbyterian | |
7904003 | Deanol | |
7909008 | Arginine carboxypeptidase | |
7924004 | Diflorasone | |
7938006 | D-Arabinitol dehydrogenase | |
7945006 | Orsellinate-depside hydrolase | |
7948008 | Reed-Sternberg antibody | |
7953003 | Thioneb | |
7957002 | Phosphatidate cytidylyltransferase | |
7961008 | Hemoglobin F-Shanghai | |
7970006 | Allograft | |
7974002 | Blood group antibody Dalman | |
7975001 | Amiphenazole | |
7979007 | 3'-Phosphoadenylylsulfate 3'-phosphatase | |
7983007 | Sodium rhodanide | |
7985000 | Sulfur isotope | |
7997004 | Butyl mercaptan | |
8000007 | Cucurbitacin delta^23^-reductase | |
8002004 | Blood group antibody Fleming | |
8025003 | Blood group antibody Gibson | |
8029009 | Allyl glycidyl ether | |
8030004 | Polyethylene glycol | |
8035009 | Cholestenol delta-isomerase | |
8048008 | Blood group antigen Th | |
8054009 | Orotate reductase (NADPH) | |
8055005 | Galactoside acetyltransferase | |
8105004 | Hemoglobin Leiden | |
8108002 | Undecaprenyl-diphosphatase | |
8123007 | Blood group antibody Schuppenhauer | |
8132009 | Magnesium acetylsalicylate | |
8143001 | Diosmin | |
8153000 | Pipecolic acid | |
8156008 | Immunoglobulin, Fd fragment | |
8164002 | Lymphocyte antigen CD67 | |
8168004 | Uracil-5-carboxylate decarboxylase | |
8179009 | Cevadilline | |
8184003 | Convallamarogenin | |
8190004 | Diaminopimelate epimerase | |
8202008 | ^43^Potassium | |
8203003 | Human menopausal gonadotropin | |
8204009 | Polyester | |
8222007 | Coagulation factor II Padua variant | |
8227001 | ^106^Ruthenium | |
8230008 | Streptococcal cysteine proteinase | |
8237006 | Strobane | |
8252004 | Chlorothiazide sodium | |
8257005 | Abnormal hemoglobin | |
8261004 | Potassium thiosulfate | |
8268005 | Blood group antibody Hildebrandt | |
8270001 | tRNA adenylyltransferase | |
8275006 | Methionine-S-oxide reductase | |
8295000 | Uromucoid protein | |
8300003 | Cyclohexanol | |
8310007 | Hemoglobin Madrid | |
8313009 | RNA-directed DNA polymerase | |
8340009 | Procollagen-lysine,2-oxoglutarate 5-dioxygenase | |
8342001 | Brilliant cresyl blue stain (substance) | |
8343006 | Blood group antibody Re^a^ | |
8354001 | Manganese ethylene bis-dithiocarbamate | |
8355000 | Hafnium isotope | |
8362009 | Blood group antibody c | |
8365006 | Oil of pennyroyal-European | |
8368008 | Xylan 1,44-beta-xylosidase | |
8376005 | Antibody to antigen in Duffy blood group system | |
8385005 | Glucan 1,4-alpha-glucosidase | |
8397006 | Nicotine resin complex | |
8406008 | Nitroethane oxidase | |
8429000 | Brilliant orange stain (substance) | |
8450009 | Oil of lemon grass | |
8452001 | Blood group antigen Sisson | |
8456003 | Methyl ethyl ketone peroxide | |
8460000 | Blood group antibody Vg^a^ | |
8473001 | Homocysteine methyltransferase | |
8474007 | Lead oleate | |
8484008 | Blood group antigen Mur | |
8485009 | Oncogene protein P210, BCR-ABL | |
8486005 | HLA-DRw15 antigen | |
8487001 | ^48^Vanadium | |
8491006 | Complement inhibitor | |
8492004 | Allantoicase | |
8498000 | Short neurotoxin venom | |
8507001 | Cyclohexane | |
8514004 | Ornithine | |
8520003 | Hemoglobin Machida | |
8525008 | ^183^Osmium | |
8529002 | Urinary protein of low molecular weight | |
8534003 | ^110^Tin | |
8537005 | Solution | |
8578007 | Potassium cyanate | |
8591008 | Dichlorodifluoromethane | |
8612007 | Tumor necrosis factor | |
8620009 | Oncogene protein TCL6 | |
8631001 | Potassium chloride | |
8653004 | Rubijervine | |
8660005 | Complement component C3c | |
8687009 | Gum arabic | |
8689007 | Kanamycin sulfate | |
8701002 | Sulfachlorpyridazine | |
8705006 | 4-Hydroxybenzoate decarboxylase | |
8731008 | Blood group antibody Austin | |
8740007 | C3(H20)Bb | |
8761000 | Adenylylsulfate kinase | |
8767001 | Santonin | |
8785008 | Chlorine dioxide | |
8786009 | Blood group antigen Wd^a^ | |
8795001 | Hemoglobin F | |
8817004 | LH receptor site | |
8818009 | Blood group antibody Tri W | |
8822004 | Linoleic acid | |
8830003 | Nitrate reductase [NAD(P)H] (substance) | |
8836009 | Gallocyanine stain (substance) | |
8844009 | Hydroxybutyrate-dimer hydrolase | |
8858006 | Strontium nitrate Sr^85^ | |
8865003 | Natural graphite | |
8878003 | Blood group antigen Evelyn | |
8882001 | 3-Hydroxybenzoate 6-monooxygenase | |
8886003 | Flecainide acetate | |
8908003 | Blood group antibody I^T^ | |
8914005 | Endolymph | |
8919000 | Biotin | |
8926000 | Azure B stain (substance) | |
8945009 | Phosphopantothenate-cysteine ligase | |
8953001 | 2,3-Dihydroxyindole 2,3-dioxygenase | |
8963009 | N-Acetylmuramoyl-L-alanine amidase | |
8969008 | Bulbourethral secretions | |
8977007 | Blood group antibody Tarplee | |
8982000 | Oleate hydratase | |
8987006 | Cycle-phase specific agent | |
8991001 | Ribulokinase | |
9010006 | Methyl blue stain (substance) | |
9013008 | Dephospho-CoA kinase | |
9021002 | Carbaryl | |
9024005 | Glucose-6-phosphate dehydrogenase | |
9045003 | Radon radioisotope | |
9052001 | Allspice oil | |
9054000 | Blood group antigen HLA-B15 | |
9103003 | Retinol fatty-acyltransferase | |
9110009 | Mercuric compound | |
9125009 | Sempervirine | |
9159008 | Triacetate-lactonase | |
9172009 | Blood group antibody Alda | |
9174005 | Fibrinogen Poitiers | |
9183000 | beta-N-Acetylgalactosaminidase | |
9189001 | CMP-N-acetylneuraminate-lactosylceramide alpha-2,3-sialyltransferase | |
9195000 | Immunoglobulin gene INV allotype | |
9197008 | Apiose reductase | |
9205004 | Hemoglobin Tarrant | |
9220005 | Plant phenol oil | |
9223007 | Borneol dehydrogenase | |
9234005 | Chlorobutanol | |
9246009 | ^118^Tellurium | |
9253000 | HLA-DRw16 antigen | |
9270008 | Catecholamine receptor | |
9271007 | Fibrinogen Pontoise | |
9296005 | Gamma interferon | |
9301005 | Lens neutral proteinase | |
9302003 | Gentisate decarboxylase | |
9315007 | Spearmint oil | |
9319001 | Blood group antibody Vennera | |
9334007 | Isopropyl glycidyl ether | |
9349004 | Nitrobenzene | |
9351000 | ^103^Palladium | |
9355009 | Hemoglobin F-Alexandra | |
9392009 | Blood group antibody Pollio | |
9396007 | ^60^Iron | |
9398008 | Blood group antigen Pillsbury | |
9410003 | Bromoform | |
9422000 | High density lipoprotein | |
9457002 | Fibrinogen Almeria | |
9471005 | Polypropylene glycol | |
9472003 | Blood group antigen Schneider | |
9477009 | ATP pyrophosphatase | |
9485000 | Glucuronosyl-disulfoglucosamine glucuronidase | |
9493000 | Homologous antigen | |
9507008 | ^238^Uranium | |
9508003 | Hemoglobin F-Kotobuki | |
9530002 | Amine hormone | |
9532005 | Coagulation factor XIIIa | |
9539001 | Chlorprothixene lactate | |
9549003 | Hemoglobin F-Albaicin | |
9556009 | Cholesterol acyltransferase | |
9582000 | Alanine racemase | |
9588001 | beta-Phosphoglucomutase | |
9608008 | Blood group antigen Noble | |
9623003 | 6-Phosphofructo-2-kinase | |
9630009 | Poly(ribitol-phosphate) N-acetylglucosaminyltransferase | |
9639005 | Bromine compound | |
9643009 | Chlorphentermine | |
9663002 | Mepazine (substance) | |
9664008 | Di-sec-octyl phthalate | |
9672005 | Blood group antigen S | |
9675007 | Coniferyl-alcohol glucosyltransferase | |
9676008 | Fibrinogen New York III | |
9680003 | Central depressant | |
9695001 | Hemoglobin J-Camaguey | |
9701007 | Blood group antibody Pr>3< | |
9716005 | Blood group antibody Luke | |
9721008 | Phencyclidine | |
9765000 | Lithium salt | |
9797000 | Phosphorus trichloride | |
9817005 | Mycoplasma pulmonis antibody test kit | |
9821003 | Methylthioadenosine nucleosidase | |
9830006 | ^200^Thallium | |
9865006 | Deoxyhemoglobin | |
9871000 | D-Amino-acid acetyltransferase | |
9885005 | Mannitol-1-phosphatase | |
9890008 | Unspecific monooxygenase | |
9900004 | Phenylalanine (histidine) aminotransferase | |
9910008 | Oxymetazoline hydrochloride | |
9913005 | Arachidic acid | |
9921004 | Blood group antibody 'N' | |
9923001 | Phenylalanine 4-monooxygenase | |
9928005 | alpha-Dextrin endo-1,6-alpha-glucosidase | |
9930007 | Blood group antigen Hartley | |
9955001 | Oil of juniper wood (substance) | |
9969001 | alpha-Glutamyl-glutamate dipeptidase | |
9974009 | Angiotensin | |
9975005 | Arabinan endo-1,5-alpha-L-arabinosidase | |
9980001 | Lymphocyte antigen CDw75 | |
9981002 | Lactate-malate transhydrogenase | |
9985006 | Desarginisated complement enzyme | |
9986007 | Tryptophanase | |
9992001 | Molybdenum radioisotope | |
10016008 | Bithionol | |
10020007 | Biperiden hydrochloride | |
10031004 | Vulvar secretions | |
10034007 | Formyltetrahydrofolate deformylase | |
10039002 | ^210m^Bismuth | |
10043003 | D-Alanine-alanyl-poly(glycerolphosphate) ligase | |
10063005 | Inorganic pyrophosphatase | |
10067006 | Phosphatidylethanolamine methyltransferase | |
10097003 | Ribose-5-phosphate-ammonia ligase | |
10102000 | Plant enzyme | |
10105003 | Active C3bBbC3b | |
10109009 | Fibrinogen London III | |
10126003 | Awn | |
10133003 | Cyclizine lactate | |
10150001 | Uraninite | |
10158008 | Blood group antigen K13 | |
10160005 | Formiminotetrahydrofolate cyclodeaminase | |
10162002 | 3beta-Hydroxysteroid dehydrogenase | |
10168003 | Immunoglobulin kappa light chain gene | |
10174003 | Procarbazine hydrochloride | |
10189007 | Conglutinin | |
10192006 | Prostaglandin PGF2 (substance) | |
10202007 | Prostaglandin PGE3 | |
10228005 | Blood group antibody Mil | |
10229002 | Hemoglobin Kenya | |
10240005 | Lethanes | |
10247008 | Chrysoidine R stain (substance) | |
10249006 | Agar | |
10265007 | Blood group antibody Jobbins | |
10270000 | Erythromycin estolate | |
10282009 | Betahistidine | |
10308009 | ^42^Argon | |
10313008 | Phenylmercuric nitrate | |
10324005 | Demeclocycline hydrochloride | |
10329000 | Zinc insulin | |
10333007 | Clobenoside | |
10336004 | Ribosylnicotinamide kinase | |
10342000 | Heparin cofactor II | |
10354000 | Somantin | |
10357007 | Arsenite compound | |
10373001 | beta-1,3-Galactosyl-o-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase | |
10377000 | Sodium nitrite | |
10393009 | HLA-Dw20 antigen | |
10397005 | Protein-lysine 6-oxidase | |
10398000 | Blood group antibody iH | |
10407003 | Hemoglobin F-Xin-Su | |
10419006 | Thorium isotope | |
10424009 | Maprotiline hydrochloride | |
10430009 | Benzpyrene | |
10436003 | Blood group antibody Ad | |
10440007 | HLA class II antigen | |
10450008 | Glucose-1-phosphate phosphodismutase | |
10466005 | Phosphide compound | |
10471003 | Fibrinogen Vienna | |
10473000 | Complement component C3 | |
10488005 | Hemoglobin F-Cobb | |
10490006 | Thymidine-triphosphatase | |
10500003 | Xanthinol | |
10508005 | Tetramine toxin | |
10511006 | Monuron | |
10534002 | Thyrotropin releasing factor | |
10550005 | Dipotassium salt of endothall | |
10560001 | Blood group antibody By | |
10570004 | Blood group antigen Sf^a^ | |
10581001 | Hemoglobin Grange-Blanche | |
10595003 | Pseudoephedrine sulfate | |
10622000 | Blood group antibody Gilbraith | |
10627006 | Gliocladium proteinase | |
10641002 | 3-Phosphoshikimate 1-carboxyvinyltransferase | |
10644005 | Black phosphorus | |
10645006 | ^207m^Lead | |
10660009 | Luteoskyrin | |
10669005 | Lectin | |
10682002 | Fibrinogen Grand Rapids | |
10685000 | Type I site-specific deoxyribonuclease | |
10691003 | Biliverdin reductase | |
10710009 | Anilazine | |
10730008 | Azlocillin sodium | |
10738001 | ^86^Yttrium | |
10740006 | Sudan blue stain (substance) | |
10750007 | Neurotoxic mycotoxin | |
10751006 | Netilmicin sulfate | |
10767000 | Calcium phosphate dibasic | |
10781003 | Sodium phosphate P^32^ | |
10782005 | Pentagastrin | |
10790005 | ^53^Manganese | |
10796004 | Glucose-6-phosphate | |
10827009 | Milk protein | |
10838009 | ADPphosphoglycerate phosphatase | |
10843002 | Anterior pituitary hormone | |
10862004 | Oncogene protein neu | |
10889009 | Blood group antigen Tc^a^ | |
10912008 | Blood group antigen Le^a^ | |
10914009 | Cyanamide hydratase | |
10931002 | Tryptophan 2'-dioxygenase | |
10938008 | Sulfurous oxychloride | |
10944007 | Taurine | |
10949002 | alpha-Mannosidase | |
10952005 | Antimony compound | |
10955007 | Factor X antibody (substance) | |
10976002 | Dinitrobenzene isomer | |
10987005 | Platelet-derived growth factor | |
11004008 | Blood group antigen Ge3 | |
11022006 | Blood group antibody Cr2 (substance) | |
11036001 | Alum | |
11038000 | Limonene | |
11041009 | Blood group antibody Dr^a^ | |
11058004 | ^111^Palladium | |
11064006 | Blood group antigen Lu^b^ | |
11066008 | Sodium ethyl xanthate | |
11069001 | Azure C stain (substance) | |
11085006 | D-Alanine hydroxymethyltransferase | |
11091008 | Blood group antibody Madden | |
11111005 | Fructan beta-fructosidase | |
11115001 | Thromboxane A>2< | |
11121002 | ^135^Iodine | |
11123004 | Blood group antigen Simpson | |
11136004 | Methoxyflurane | |
11137008 | Chymotrypsin | |
11151008 | Immunoglobulin D | |
11170003 | Vanillin | |
11199008 | Phosphatidyl glycerol | |
11201005 | Solochrome black 6B stain (substance) | |
11202003 | Manganese salt | |
11203008 | Methane | |
11206000 | Hemoglobin Hikari | |
11220007 | Ileal juice | |
11222004 | Blood group antigen Ge1 | |
11233001 | Public blood group antigen | |
11238005 | Caprolactam | |
11239002 | Urate-ribonucleotide phosphorylase | |
11252007 | Blood group antigen Sa | |
11253002 | Boron trioxide | |
11257001 | Nitrogen compound | |
11259003 | Cassaine | |
11264004 | Sulfated fatty alcohol | |
11267006 | Interleukin-10 | |
11289005 | CMP-N-acetylneuraminate-monosialoganglioside sialyltransferase | |
11298008 | Hemoglobin Riyadh | |
11307006 | 2-Acetyl amino fluorine | |
11311000 | Pus | |
11312007 | Malate dehydrogenase (oxaloacetate-decarboxylating) | |
11320009 | Sucrose | |
11323006 | Methyl mercuric dicyanodiamine (substance) | |
11330000 | Platelet antibody HPA-4b | |
11331001 | ^56^Cobalt | |
11345007 | Tribromsalan | |
11353004 | Glomerular basement membrane antibody | |
11355006 | Hemoglobin Alabama | |
11370007 | Carbarsone | |
11392006 | Aminoglycoside N^6'^-acetyltransferase | |
11416006 | Cypridina-luciferin 2-monooxygenase | |
11420005 | Rhubarb preparation | |
11425000 | Glycopeptide alpha-N-acetylgalactosaminidase | |
11427008 | 2-Hydroxy-4-carboxymuconate-6-semialdehyde dehydrogenase | |
11439000 | Vas deferens secretions | |
11447000 | Antibody to hepatitis B core antigen, IgM type | |
11453000 | Cerebroventricular fluid | |
11462003 | Ostomy appliance adhesive | |
11473005 | Trichlormethiazide | |
11474004 | Blood group antibody French | |
11479009 | Blood group antibody Ok^a^ | |
11489008 | Blood group antigen Nickolai | |
11490004 | Hemoglobin Bari | |
11496005 | Mercuric chloride | |
11504003 | Edrophonium chloride | |
11525003 | Silver citrate | |
11526002 | Aspartame | |
11555005 | Boron compound | |
11566003 | Blood group antibody Braden | |
11576000 | Cyclohexylamine | |
11587008 | dTDP4-amino-4,6-dideoxygalactose aminotransferase | |
11589006 | Copper acetoarsenite | |
11594006 | Blood group antigen hr^s^ | |
11600003 | Blood group antibody Terrell | |
11605008 | UDPglucose 4-epimerase | |
11621003 | Organic metallic compound | |
11622005 | Cyclopamine | |
11633008 | Flurbiprofen sodium | |
11643006 | Phosphoenolpyruvate carboxykinase (ATP) | |
11644000 | Piperacillin sodium | |
11645004 | Spirit soluble aniline blue stain (substance) | |
11652002 | Vasoactive intestinal peptide | |
11684009 | Blood group antigen Kennedy | |
11699009 | Petroleum | |
11702002 | bis-(p-Chlorophenyl) ethanol | |
11713004 | Water | |
11714005 | Strong silver protein | |
11715006 | ^4^Helium | |
11725001 | Blood group antigen Gould | |
11727009 | Indophenol from naphthol stain (substance) | |
11734006 | Bis (5'-guanosyl) tetraphosphatase | |
11735007 | T>2<-induced deoxynucleotide kinase | |
11741000 | 2-Nitro-1,1-bis (p-chlorophenyl) propane | |
11742007 | Samarandin toxin | |
11744008 | Blood group antigen Knudsen | |
11761006 | Hemoglobin Duarte | |
11770009 | Blood group antigen Fy^a^ | |
11780008 | Durazol red stain (substance) | |
11799004 | Blood group antibody Donaldson | |
11825009 | Endomysial antibody | |
11831007 | Dichloroethyl ether | |
11863001 | Blood group antigen Ls^a^ | |
11869002 | 2,4-Diaminophenol hydrochloride | |
11873004 | Carbon monoxide dehydrogenase | |
11877003 | HLA-DRw10 antigen | |
11880002 | Hemoglobin Andrew-Minneapolis | |
11886008 | Blood group antibody Mckeever | |
11891009 | Breath | |
11894001 | Clostridium botulinum toxin | |
11907003 | Ethylamine | |
11943009 | Hydroxydione | |
11965009 | Difluorodibromomethane | |
11966005 | Dimethylaniline | |
11968006 | Formate dehydrogenase (cytochrome) | |
11984007 | 1, Hydroxy cholecalciferol | |
11986009 | Penicillin G potassium | |
11989002 | Plant azoxy glycoside | |
11996000 | Platinum compound | |
12001002 | Thionine stain (substance) | |
12009000 | Coagulation factor IX Chapel Hill variant (substance) | |
12015000 | Magnesium carbonate hydroxide | |
12016004 | Creatine kinase isoenzyme, MB fraction | |
12018003 | Trichophyton extract skin test | |
12030009 | Sudan II stain (substance) | |
12034000 | Coagulation factor II Salatka variant | |
12079001 | Hemoglobin J-Meerut | |
12085008 | 1,3-beta-Glucan synthase | |
12086009 | Hemoglobin G-Hsi-Tsou | |
12103002 | HLA-B45 antigen | |
12112000 | Neon | |
12117006 | 5-Methyltetrahydrofolate-homocysteine methyltransferase | |
12119009 | Water soluble nigrosine stain (substance) | |
12147008 | Serratia marcescans nuclease | |
12148003 | Hemoglobin Avicenna | |
12160002 | Loganate methyltransferase | |
12171001 | Cutting oil | |
12177002 | Pseudoephedrine hydrochloride | |
12186007 | Radioactive gas | |
12190009 | Blood group antibody Lazicki | |
12194000 | Leukotriene | |
12203005 | Prenyl-pyrophosphatase | |
12206002 | Glutamine-fructose-6-phosphate aminotransferase (isomerizing) | |
12208001 | Syrosingopine | |
12216005 | Hemoglobin F-Malta I | |
12218006 | Diltiazem hydrochloride | |
12233003 | Diphenylamine | |
12235005 | Hemoglobin Zambia | |
12290003 | Emetine hydrochloride | |
12292006 | Californium | |
12315006 | Halazone | |
12353001 | AMP deaminase | |
12358005 | Citronella oil | |
12366001 | Hemoglobin Hope | |
12374000 | Hemoglobin Pasadena | |
12375004 | Krypton | |
12379005 | Blood group antibody Do^b^ | |
12391001 | Dextran 70 | |
12414006 | Osmium isotope | |
12426001 | Methylglutamate dehydrogenase | |
12433001 | p-Chlorophenyl-p-chlorobenzyl sulfide | |
12438005 | Dilan | |
12439002 | Carnosine N-methyltransferase | |
12448007 | Whelk poison | |
12457001 | Hemoglobin Evanston | |
12465003 | Hemoglobin Suan-Dok | |
12474001 | Long neurotoxin venom (substance) | |
12485004 | Glycerol-1,2-cyclic-phosphate 2-phosphodiesterase | |
12487007 | Printing ink | |
12490001 | Potassium hypochlorite | |
12498008 | Blood group antibody Kn^b^ | |
12499000 | Cord blood | |
12502001 | Cedar oil | |
12503006 | Aluminum | |
12509005 | Galactoside 2-L-fucosyltransferase | |
12510000 | Eucalyptus oil | |
12525000 | Tybamate | |
12542006 | Ethyl butyl ketone | |
12564002 | HLA class III antigen | |
12567009 | Fire retardant | |
12568004 | Belladonnine | |
12577006 | Blood group antibody Ch^a^ | |
12578001 | Erythromycin ethylsuccinate | |
12597001 | Tin | |
12598006 | Arachidonate 5-lipoxygenase | |
12614000 | Serine-tRNA ligase | |
12627001 | Macrophage chemotactic factor | |
12641005 | Boron tribromide (substance) | |
12642003 | Artificial antigen | |
12648004 | LFA-1 leukocyte adhesive protein | |
12671002 | Clostridium difficile toxin | |
12684006 | Glutamate-ammonia ligase | |
12685007 | Blood group antigen Wiley | |
12689001 | Magnesium radioisotope | |
12710003 | Hematoxylin stain (substance) | |
12714007 | Cysteine dioxygenase | |
12716009 | Aluminum carbonate | |
12743004 | Thorium oxide | |
12750000 | ^182^Hafnium | |
12752008 | Blood group antibody HLA-A7 | |
12753003 | Blood group antibody Fr^a^ | |
12754009 | L-Lactate dehydrogenase (cytochrome) | |
12788003 | Hemoglobin Sunshine Seth | |
12790002 | (S)-6-Hydroxynicotine oxidase | |
12798009 | Cicutoxin | |
12801003 | Iodamide meglumine | |
12821002 | Clemizole | |
12823004 | Altronate dehydratase | |
12860000 | Hemoglobin Shepherds Bush | |
12870003 | Coagulation factor IX Durham variant | |
12878005 | Thiophene | |
12899008 | Blood group antibody Lu^a^ | |
12915002 | Nerve growth factor | |
12917005 | Steryl-sulfatase | |
12930006 | Calcium phosphate dibasic dihydrate | |
12934002 | HLA-Cw7 antigen | |
12937009 | Glucoside 3-dehydrogenase | |
12940009 | ^7^Beryllium | |
12950005 | Putrescine methyltransferase | |
12970004 | Inositol hexanitrate | |
12977001 | Deuterium oxide | |
12984009 | Inulin fructotransferase (depolymerizing) | |
12995003 | Bagasse | |
12998001 | Blood group antibody Mineo | |
13005000 | Hemoglobin New York | |
13006004 | Oil of cajuput | |
13012009 | Nucleoside phosphotransferase | |
13016007 | Blood group antigen Li^a^ | |
13030002 | Piperocaine | |
13032005 | Pentanamidase | |
13074000 | Acetoin racemase | |
13083005 | Eosinophilic chemotactic factor (substance) | |
13105002 | Hepatitis B surface antigen subtype ayr | |
13121007 | gamma-Linolenic acid | |
13134008 | trans-1,2-Dihydrobenzene-1,2-diol dehydrogenase | |
13143004 | Glycosaminoglycan galactosyltransferase | |
13150000 | Animal fat | |
13185000 | Pyrogallol 1,2-oxygenase | |
13188003 | Tobramycin sulfate | |
13195007 | Immunoglobulin IgA2, H chain | |
13198009 | UDP-N-acetylmuramoylpentapeptide-lysine N^6^-alanyltransferase | |
13230006 | Farnesyl-diphosphate farnesyltransferase | |
13232003 | Achromobacter proteinase I | |
13235001 | Riboflavin (substance) | |
13237009 | ^131^Cesium | |
13240009 | Hemoglobin Warwickshire | |
13241008 | ^106m^Rhodium | |
13245004 | Aspartate kinase | |
13287002 | Bromoxynil | |
13293005 | Galactarate dehydratase | |
13294004 | ^242^Americium | |
13295003 | Urocanate hydratase | |
13304005 | Ribose-phosphate pyrophosphokinase | |
13305006 | Perillyl-alcohol dehydrogenase | |
13342004 | Diethyl 2-chlorovinyl phosphate | |
13373000 | Serine-phosphoethanolamine synthase | |
13377004 | Blood group antigen Vw | |
13393008 | Antimony trichloride | |
13400000 | HLA-Bw65 antigen | |
13422007 | ^117^Tellurium | |
13435003 | Blood group antibody Cs^a^ | |
13477003 | Lysozyme | |
13484006 | Blood group antibody NOR | |
13489001 | Methoxyethyl mercuriacetate | |
13492002 | Blood group antibody Di^b^ | |
13494001 | Kynurenine-glyoxylate aminotransferase | |
13501003 | Erythritol kinase | |
13502005 | Hydroxychloroquine sulfate | |
13523004 | Protium | |
13524005 | Grease | |
13531009 | Butyl alcohol | |
13539006 | Blood group antibody Sharp | |
13541007 | N-Acetylneuraminate lyase | |
13571004 | Blood group antibody Stevenson | |
13577000 | Nut | |
13579002 | 1-Naththylamine | |
13585009 | Cefotetan | |
13590007 | Blood group antibody Kosis | |
13597005 | Dihydroxy-acid dehydratase | |
13598000 | CMP-N-acetylneuraminate-N-acetyllactosaminide alpha-2,3-sialyltransferase | |
13602003 | ^209^Thallium | |
13618009 | Hemoglobin Twin Peaks | |
13625002 | HLA-A24 antigen | |
13626001 | Selenium^75^ HCAT | |
13634007 | Fructose-6-phosphate phosphoketolase | |
13652007 | Silicone | |
13659003 | Benzquinamide | |
13668001 | Propylene glycol | |
13676004 | Creolin | |
13696007 | Immunoglobulin lambda light chain gene | |
13701000 | Blood group antigen E. Amos | |
13708006 | Rectified pine tar oil | |
13717006 | Blood group antibody McCall | |
13718001 | Immunoglobulin, variable region | |
13722006 | Cymarin | |
13723001 | Blood group antigen Man | |
13727000 | Human immunodeficiency virus receptor (substance) | |
13739008 | Gallate decarboxylase | |
13744001 | Methyl red stain (substance) | |
13772008 | Blood group antibody Middel | |
13774009 | Ribosomal RNA | |
13780001 | Sphinganine-1-phosphate aldolase | |
13781002 | alpha Amino isobutyric acid | |
13784005 | Pyruvic acid | |
13786007 | Pyrophosphate-fructose-6-phosphate 1-phosphotransferase | |
13787003 | Protein secretory trypsin inhibitor | |
13788008 | Dinitrobutyl phenol | |
13789000 | Coal tar creosote | |
13799005 | Plasmanylethanolamine desaturase | |
13804000 | Amidinoaspartase | |
13818007 | Cork | |
13827008 | Boron trifluoride | |
13833004 | Daminozide | |
13835006 | Bile-salt sulfotransferase | |
13841004 | Leukotriene C | |
13858009 | alpha>1x< Glycoprotein | |
13863008 | Arabinose | |
13864002 | Hemoglobin A>2< Roosevelt | |
13872000 | Blood group antibody Fuller | |
13884003 | Phenyl mercuric acetate | |
13887005 | ^190m^Osmium | |
13903005 | Pectinesterase (substance) | |
13919003 | Indole 2,3-dioxygenase | |
13925004 | Deoxyribonucleic acid, double stranded | |
13931001 | Osmium tetroxide | |
13932008 | Undecaprenyl-phosphate mannosyltransferase | |
13952009 | Oil of hops | |
13961009 | Hemoglobin Wayne | |
13967008 | Methylcholanthrene | |
13979008 | Bromic acid | |
13999002 | Thetin-homocysteine methyltransferase | |
14006006 | Ethylene oxide | |
14013006 | Guanadrel sulfate | |
14057005 | Ficin | |
14060003 | Catechol | |
14071002 | ^90^Strontium | |
14090005 | Blood group antigen N | |
14092002 | Tyramine | |
14097008 | Halogen compound | |
14101004 | Indoleacetylglucose-inositol acyltransferase | |
14104007 | Blood group antigen O'Connor | |
14120002 | Rodenticide | |
14125007 | Serine | |
14132003 | Silicon carbide | |
14139007 | Arginine glutamate | |
14146003 | Potassium isotope | |
14148002 | L-Pipecolate dehydrogenase | |
14172007 | Intrinsic factor concentrate preparation | |
14190008 | Blood group antibody T | |
14193005 | Sulfobromophthalein | |
14195003 | Mercury isotope | |
14213001 | ^47^Calcium | |
14226002 | Blood group antigen Friedberg | |
14228001 | Dolichyl-phosphate-mannose-protein mannosyltransferase | |
14231000 | Aliphatic unsaturated hydrocarbon | |
14263006 | Prepared fish | |
14271005 | Blood group antigen Gon | |
14279007 | Blood group antibody Epi | |
14285000 | Coagulation factor XI variant type III | |
14306003 | 1L-myo-Inositol-1-phosphatase | |
14312008 | Vitamin L>2< | |
14321009 | Captafol | |
14330001 | Gold radioisotope | |
14334005 | tRNA (uracil-5)-methyltransferase | |
14338008 | Peptidoglycan beta-N-acetylmuramidase | |
14340003 | Verapamil hydrochloride | |
14349002 | Fibrinogen Seattle II | |
14360006 | Trinitroaniline | |
14376002 | Adenylylsulfatase | |
14388000 | Cyanide hydratase | |
14396005 | Blood group antibody Ls^a^ | |
14399003 | Iodine radioisotope | |
14401009 | Indium | |
14402002 | Wood | |
14409006 | Neocinchophen | |
14436008 | Peripheral myelin | |
14438009 | Carbenicillin disodium | |
14439001 | Pyrazolylalanine synthase | |
14443002 | Aminoglycoside -class of antibiotic- | |
14444008 | Blood group antibody Todd | |
14458005 | Ketohexokinase | |
14461006 | Aluminum phosphate | |
14464003 | HLA-Cw3 antigen | |
14472001 | Dehydroacetic acid | |
14503005 | Sucrose 1^F^-fructosyltransferase | |
14507006 | Arsthinol | |
14517001 | Blood group antibody Jordan | |
14529005 | ^153^Gadolinium | |
14539004 | Dimethylaniline-N-oxide aldolase | |
14543000 | Glycosulfatase | |
14544006 | Methyl violet 6B stain (substance) | |
14550001 | ^131^Barium | |
14558008 | Malate dehydrogenase oxaloacetate-decarboxylating (NADP^+^) | |
14564001 | Amylopectin | |
14574003 | Blood group antibody Bovet | |
14583008 | Oxyuranus scutellotus prothrombin-activating proteinase | |
14585001 | Benzquinamide hydrochloride | |
14586000 | Phospho-5-dehydro-2-deoxygluconate aldolase | |
14602007 | Chlorophyll | |
14604008 | Blood group antibody Hg^a^ | |
14611007 | Hemoglobin Yoshizuka | |
14616002 | Heteroglycan alpha-mannosyltransferase | |
14620003 | Blood group antibody B 9724 | |
14638000 | Thiobarbiturate | |
14645000 | Zinc phenolsulfonate | |
14655001 | Histidinol-phosphatase | |
14660002 | Actinidin | |
14665007 | Blood group antigen Parra | |
14668009 | Hemoglobin Tak | |
14674009 | Azinphos-methyl | |
14691008 | ^90^Yttrium | |
14699005 | Dichloronaphthoquinone | |
14702003 | Threonine-tRNA ligase | |
14708004 | Hemoglobin Noko | |
14711003 | Blood group antigen A | |
14715007 | Dextran 75 | |
14726001 | Antibody to antigen in Lewis blood group system | |
14733001 | 2-Enoate reductase | |
14743003 | Cinchonine | |
14767006 | alpha>1< Anti-trypsin | |
14796007 | Amfecloral (substance) | |
14802009 | Acetoacetyl-CoA reductase | |
14804005 | Creatine | |
14805006 | Cucumisin | |
14809000 | Dihydroxyacetone | |
14813007 | ^177^Tungsten | |
14815000 | Phosphorylase | |
14819006 | Aspidium | |
14827002 | Blood group antigen Di^a^ | |
14839005 | Hafnium dust | |
14843009 | Adenosine-tetraphosphatase | |
14846001 | Glycerol-3-phosphate 1-dehydrogenase (NADP^+^) | |
14849008 | HLA-Bw77 antigen | |
14860004 | ADPsugar pyrophosphatase | |
14863002 | Arsenic radioisotope | |
14873000 | Structural gene | |
14898004 | Nicotinate phosphoribosyltransferase | |
14903000 | Antimony sodium thioglycolate | |
14905007 | Promethazine hydrochloride | |
14931009 | Glycine-transfer ribonucleic acid ligase (substance) | |
14958002 | Naphthol green B stain (substance) | |
14971004 | Isoleucine | |
14976009 | Succinate-semialdehyde dehydrogenase | |
14986005 | Blood group antigen Wilson | |
14996001 | Glucose dehydrogenase (acceptor) | |
15009009 | Meprylcaine | |
15011000 | Blood group antibody Ts | |
15017001 | Beeswax | |
15021008 | Neoantigen | |
15047004 | ^93^Yttrium | |
15052009 | Diphenoxylate | |
15061009 | Formate dehydrogenase (NADP^+^) | |
15072004 | Diethylene glycol monobutyl ether | |
15073009 | Antigen excess immune complex | |
15085001 | (S)-Usnate reductase | |
15092006 | Malonyl-CoA decarboxylase | |
15093001 | Glutathione-homocystine transhydrogenase | |
15098005 | Alseroxylon | |
15116007 | Mycodextranase | |
15126000 | Ruthenium isotope | |
15129007 | Zinc propionate | |
15145009 | N-Acetylglucosamine-6-sulfatase | |
15150003 | Thallium salt | |
15158005 | Air | |
15186002 | Hemoglobin A,b | |
15217008 | 6-Aminohexanoate-cyclic-dimer hydrolase | |
15234000 | Dihydrouracil dehydrogenase (NAD^+^) | |
15245002 | n-Acetyl galactosamine | |
15248000 | Fluoropolymer | |
15249008 | Ethylidene diacetate | |
15254004 | Thiamin kinase | |
15272005 | ^197^Thallium | |
15275007 | Blood group antibody FR | |
15286009 | HLA-Cw2 antigen | |
15287000 | trans-Hexaprenyltranstransferase | |
15294002 | Hemoglobin Bushwick | |
15297009 | ATP citrate (pro-3S)-lyase | |
15298004 | 1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase | |
15308006 | Dibasic copper sulfate | |
15313005 | Blood group antibody Gf | |
15322006 | Benzoquinonium | |
15327000 | 7beta-Hydroxysteroid dehydrogenase (NADP^+^) | |
15331006 | Glycine | |
15352003 | Cyproheptadine hydrochloride | |
15369001 | Disodium salt of endothall | |
15373003 | Creatinine | |
15379004 | Aryl-aldehyde dehydrogenase | |
15392001 | Blood group antigen Jo^a^ | |
15399005 | 2-Methyleneglutarate mutase | |
15416001 | Blood group antigen Pruitt | |
15424006 | ^243^Californium | |
15450005 | ^244m^Americium | |
15451009 | Hemoglobin Geelong | |
15455000 | Hemoglobin Lepore-Washington-Boston | |
15458003 | Boron isotope | |
15469000 | Blood group antibody p | |
15472007 | Disaccharide | |
15495003 | CDPdiacylglycerol-glycerol-3-phosphate 3-phosphatidyltransferase | |
15505005 | Preprodynorphin | |
15529003 | Rosolic acid sodium salt stain (substance) | |
15551006 | Complement component, alternate pathway | |
15563001 | Cyclopentanone monooxygenase | |
15571002 | Mezlocillin sodium | |
15595000 | Amorphous or granular extracellular material | |
15612008 | Porphobilinogen synthase | |
15620005 | Blood group antigen Yk^a^ | |
15623007 | Oil of cumin | |
15653000 | Lymphocyte antigen CD76 | |
15658009 | Cytidine diphosphate | |
15660006 | Bleomycin sulfate | |
15666000 | Chlorine isotope | |
15668004 | 3,4,5-Trihydroxybenzoic acid | |
15683009 | Blood group antigen Robert | |
15698006 | Lysergic acid diethylamide | |
15730005 | Porphyrin | |
15735000 | Solanine | |
15752001 | Immunoglobulin M, H chain | |
15754000 | Interleukin-7 | |
15764009 | Cyclohexanone | |
15769004 | Aspartate 1-decarboxylase | |
15781000 | Blood group antigen K20 | |
15785009 | Phenazopyridine | |
15790007 | NAD^+^ synthase (glutamine-hydrolysing) | |
15797005 | Blood group antigen A. Owens | |
15798000 | Blood group antibody Bp^a^ | |
15800007 | Hemoglobin Mobile | |
15810003 | Tuaminoheptane | |
15817000 | Phosphomevalonate kinase | |
15821007 | Brackish water | |
15826002 | Dihydrorotenone | |
15833002 | 4-Aminobiphenyl | |
15835009 | Hemoglobin Moabit | |
15879007 | Autograft | |
15882002 | n-Butyric acid | |
15895007 | Fibrinogen London I | |
15896008 | Methyl violet 2B stain (substance) | |
15901005 | Fibrinogen Paris III | |
15909007 | Blood group antibody Yk^a^ | |
15917004 | 4-Methyloxaloacetate esterase | |
15928000 | Donovan's solution | |
15942008 | Blood group antibody Lanthois | |
15943003 | Guanylic acid | |
15951000 | 2-Methylcitrate dehydratase | |
16011006 | Technetium Tc^99m^ albumin colloid (substance) | |
16017005 | Hemoglobin Syracuse | |
16019008 | Blood group antibody Fy^x^ (substance) | |
16022005 | Abnormal hemoglobin, multiple point mutation | |
16024006 | ^204^Thallium | |
16025007 | HLA-DQw8 antigen | |
16045004 | Catechol 2,3-dioxygenase | |
16073002 | Mercurous compound | |
16074008 | Immune complex at equivalence | |
16082008 | Tritium | |
16085005 | 2-Furoyl-CoA dehydrogenase | |
16103004 | L-Arabinose dehydrogenase | |
16106007 | Sulfameter (substance) | |
16122008 | Blood group antibody hr^H^ | |
16125005 | Styramate | |
16128007 | Anionic detergent | |
16130009 | Deoxyribonuclease IV (Phage T>4<-induced) | |
16133006 | Blood group antigen Kamiya | |
16136003 | Sterol | |
16138002 | Blood group antigen M' | |
16159009 | Tracheal mucus | |
16164008 | 4-Oxoproline reductase | |
16165009 | Saccharopine dehydrogenase (NAD^+^,L-glutamate-forming) | |
16179001 | Diethanolamine-p-methoxycinnamate | |
16202002 | Ribitol-5-phosphate dehydrogenase | |
16213004 | Glycine acetyltransferase | |
16214005 | Deslanoside | |
16229007 | 5-Amino-6-(5-phosphoribosylamino) uracil reductase | |
16230002 | Blood group antigen Madden (substance) | |
16236008 | Fetoprotein | |
16243002 | ^166^Ytterbium | |
16257000 | Dopamine hydrochloride | |
16265002 | ^172^Hafnium | |
16267005 | Carrier protein | |
16270009 | Prephenate dehydrogenase | |
16272001 | Succinate-semialdehyde dehydrogenase (NAD(P)^+^) | |
16274000 | Tantalum radioisotope | |
16276003 | Coagulation factor IX Eagle Rock variant | |
16285003 | Isoamyl salicylate | |
16290000 | ^184^Iridium | |
16296006 | Prostaglandin receptor | |
16303009 | D-Proline reductase (dithiol) | |
16309008 | Carboxy-cis,cis-muconate cyclase | |
16313001 | Tea | |
16318005 | Dibenzothiepin | |
16321007 | Ovex | |
16355005 | Tetracycline hydrochloride | |
16359004 | Phthalylsulfathiazole | |
16368002 | Cadmium fumes | |
16369005 | Asbestos | |
16392005 | Hexylcaine | |
16395007 | Pituitary gonadotropin | |
16405003 | Chlorophenol | |
16441003 | N-Acetyllactosamine synthase | |
16456007 | Hemoglobin P-Galveston | |
16458008 | 2-Isopropylmalate synthase | |
16462002 | Alpha neoendorphin | |
16469006 | Hemoglobin Edmonton | |
16472004 | Guanylate kinase | |
16477005 | Diagnostic vaccine | |
16480006 | Aminoacyl-histidine dipeptidase | |
16482003 | Monobutyl biphenyl sodium monosulfonate | |
16492006 | Cloxacillin sodium | |
16502003 | Molecular oxygen | |
16503008 | Glycine formiminotransferase | |
16509007 | Hemoglobin Ankara | |
16515007 | ^188^Tungsten | |
16519001 | Blood group antibody Ny^a^ | |
16520007 | Pyridoxine 4-oxidase | |
16522004 | Flurandrenolide (substance) | |
16526001 | ^173^Tantalum | |
16546006 | Palmitoleic acid | |
16586003 | ^86^Zirconium | |
16605007 | n-Butyl acetate | |
16610006 | Cyclohexanone monooxygenase | |
16613008 | Prostaglandin PGD2 (substance) | |
16624005 | Bromide salt | |
16628008 | Somatotropin releasing factor | |
16633007 | Methyl mercuric cyanoguanidine | |
16641007 | Bonellinin | |
16642000 | Glutamate-ethylamine ligase | |
16660000 | Cholesterol monooxygenase (side-chain cleaving) | |
16670003 | Fibrinopeptide B-beta 1-42 | |
16683002 | Progesterone | |
16693009 | Cesium compound | |
16696001 | Plant pigment | |
16705004 | HLA-Bw47 antigen | |
16712008 | Saccharopine dehydrogenase (NADP^+^,L-lysine-forming) | |
16716006 | Glutamate 5-kinase | |
16717002 | Dehydrocorticosterone | |
16719004 | Flowers | |
16729006 | Phosphogluconate dehydrogenase (decarboxylating) | |
16734005 | Blood group antibody S>2< | |
16739000 | Ethane | |
16744007 | Lactobacillus acidophilus agent (substance) | |
16745008 | Xenon isotope | |
16748005 | Zolamine | |
16752005 | Blood group antigen Pearl | |
16774004 | Dry cleaning agent | |
16778001 | Octachlorocyclohexenone | |
16783009 | alpha-Glucosidase | |
16788000 | Naphthalene black 12B stain (substance) | |
16803002 | Thyrotropin receptor | |
16808006 | Trichloroethylene | |
16826009 | Pentamidine isethionate | |
16836001 | Azure A stain (substance) | |
16840005 | Hemoglobin Hekinan | |
16842002 | Acyl-[acyl-carrier-protein]-phospholipid acyltransferase | |
16847008 | o-Demethylpuromycin methyltransferase | |
16848003 | Hemoglobin Vicksburg | |
16850006 | Ribose | |
16878007 | Blood group antibody E | |
16885006 | Trimellitic acid | |
16906006 | Clostridium histolyticum aminopeptidase | |
16915004 | Streptozocin | |
16923002 | Lupus anticoagulant | |
16927001 | Sodium-n-methyl dithiocarbamate | |
16943008 | Chrysoidine Y stain (substance) | |
16946000 | Triacetin | |
16951006 | Antigen in Rh blood group system (substance) | |
16968005 | Diethyltoluamide | |
16969002 | (R)-2-Hydroxy-fatty-acid dehydrogenase | |
16984006 | Phosphocreatine | |
16989001 | Polygalacturonate 4-alpha-galacturonosyltransferase | |
16995000 | Hemoglobin Osu Christiansborg | |
16996004 | Blood group antibody Gd | |
17003006 | alpha-1- Acid glycoprotein | |
17008002 | Levallorphan | |
17023007 | Soluble metallo-endopeptidase | |
17032009 | Xylosylprotein 4-beta-galactosyltransferase | |
17033004 | Lysine 2,3-aminomutase | |
17047000 | Aniline | |
17053000 | Pterin deaminase | |
17058009 | Argemone oil | |
17062003 | Nafoxidine hydrochloride | |
17069007 | Chromic phosphate P^32^ | |
17072000 | Cathepsin D | |
17074004 | Blood group antigen Pelletier | |
17108004 | Blood group antibody En^a^TS | |
17117004 | Androsterone | |
17119001 | Blood group antibody Yh^a^ | |
17147002 | Cholic acid | |
17152007 | Blood group antibody I^D^ | |
17165003 | Blood group antigen 754 | |
17171009 | Chlorine monofluoride | |
17172002 | Dibromofluorescein stain (substance) | |
17174001 | (R)-3-Amino-2-methylpropionate-pyruvate aminotransferase | |
17178003 | Dolichyl-phosphate xylosyltransferase | |
17199000 | ^195^Iridium | |
17212003 | Bismuth subcarbonate | |
17223004 | Insulin receptor | |
17224005 | ^177^Ytterbium | |
17229000 | Acetonitrile | |
17240008 | Oil in water agent | |
17243005 | Uracil mustard (substance) | |
17244004 | Apraclonidine hydrochloride | |
17253006 | Hypoderma collagenase | |
17255004 | D-threo-Aldose dehydrogenase | |
17257007 | Idoxuridine ophthalmic preparation | |
17265005 | ^191^Osmium | |
17270003 | Amino-acid acetyltransferase | |
17334004 | Acetate CoA-transferase | |
17356001 | Pralidoxime chloride | |
17371002 | Hemoglobin Cordele | |
17377003 | Glucan 1,3-beta-glucosidase | |
17387004 | Pancreatic fluid | |
17400004 | ^202m^Lead | |
17430007 | Blood group antigen Hey | |
17445000 | Trichloronaphthalene | |
17455001 | Lipopolysaccharide galactosyltransferase | |
17462005 | Blood group antigen K12 | |
17483004 | Trichlorobenzene | |
17485006 | Methoxypsoralen solution | |
17486007 | Methyl 2-cyanoacrylate (substance) | |
17497007 | Pseudomonas cytochrome oxidase | |
17503004 | Clocortolone pivalate | |
17524009 | Phosphoacetylglucosamine mutase | |
17534000 | Chylomicrons | |
17546001 | L-Aspartate oxidase | |
17574006 | Hemoglobin A>2< Melbourne | |
17577004 | Exo-poly-alpha-galacturonosidase | |
17595001 | Lymphocyte antigen CD32 | |
17597009 | Protein-N-pi-phosphohistidine-sugar phosphotransferase | |
17598004 | L-Arabinonate dehydratase | |
17603007 | Cob(I)alamin adenosyltransferase | |
17614005 | Fibrinogen Buenos Aires I | |
17626000 | L-Serine dehydratase | |
17627009 | Antibody to hepatitis Be antigen | |
17628004 | Indole-3-glycerol-phosphate synthase | |
17635007 | ^111m^Palladium | |
17637004 | Dimethylhistidine methyltransferase | |
17640004 | Blood group antibody Savery | |
17643002 | Hafnium compound | |
17644008 | Enoyl-[acyl-carrier-protein] reductase (NADH) | |
17646005 | ^107m^Silver | |
17659002 | Blood group antigen R.M. | |
17666001 | Calcium thioglycolate | |
17676003 | Lactoylglutathione lyase | |
17677007 | Hemoglobin F-Columbus-Ga | |
17678002 | Zirconium | |
17685003 | Urushiol | |
17693003 | Acriflavine stain (substance) | |
17694009 | Anthraquinone dye | |
17701004 | Brucella protein nucleate | |
17707000 | Blood group antibody Ritter | |
17708005 | Nitrate reductase | |
17728009 | Tellurium dioxide | |
17730006 | Mannuronate reductase | |
17731005 | Coagulation factor IX London variant | |
17733008 | Carnitine palmitoyltransferase | |
17740009 | Blood group antigen Epi | |
17750005 | Naphthalene | |
17761002 | ^120^Antimony | |
17764005 | Platinum salt | |
17768008 | Oxamate carbamoyltransferase | |
17773002 | 8-Hydroxyfuranocoumarin O^8^-methyltransferase | |
17777001 | Blastomycin | |
17784009 | Petroleum distillate | |
17798001 | Coagulation factor II Cardeza variant | |
17830000 | Hydroxyethylthiazole kinase (substance) | |
17836006 | Aromatic ammonia spirit | |
17838007 | Hemoglobin South Florida | |
17848009 | Thioperazine | |
17853004 | Antibody excess immune complex | |
17870007 | Xylidine | |
17874003 | Bergamot oil | |
17895008 | Hemoglobin A>2< Manzanares | |
17898005 | Succinchlorimide | |
17900007 | 4-Carboxymuconolactone decarboxylase | |
17903009 | Abnormal hemoglobin, gamma-chain variant | |
17906001 | ^92^Yttrium | |
17908000 | Betamethasone benzoate | |
17909008 | Glucuronate-1-phosphate uridylyltransferase | |
17910003 | ^75^Bromine | |
17913001 | Allantoic fluid | |
17916009 | Propylene glycol dinitrate | |
17917000 | Activated attapulgite | |
17927006 | Hemoglobin Dallas | |
17932007 | Fibrinogen Vicenza | |
17936005 | Alkyl phenol polyglycol ether | |
17942009 | Fibrinogen Houston | |
17948008 | Hematopoietic factor | |
17965004 | Dihydroxyphenylalanine aminotransferase | |
17990002 | Melarsoprol | |
17991003 | Fibrinogen Adelaide | |
17997004 | L-Xylose dehydrogenase | |
18004003 | Cholinesterase | |
18015008 | ^128^Antimony | |
18017000 | Phenyl glycidyl ether | |
18025003 | Binary chemical warfare agent | |
18030004 | Blood group antibody Balkin | |
18039003 | Alkyl mercuric phosphate | |
18082002 | Blood group antigen V | |
18093000 | Halogenated hydrocarbon-organic oxygen insecticide | |
18094006 | Hemoglobin J-Norfolk | |
18124001 | Histamine methyltransferase | |
18127008 | Bacterial endotoxin | |
18128003 | Keratan sulfate | |
18143001 | Fibrinogen Quebec II | |
18150002 | Blood group antibody A,B | |
18164002 | Gentisate 1,2-dioxygenase | |
18180007 | Hemoglobin J-Auckland | |
18195009 | HLA-DR9 antigen | |
18202008 | beta-Mannosidase | |
18211008 | Hydroxymethylglutaryl-CoA reductase | |
18220004 | Thyroid hormone | |
18230008 | Deoxy adenosine triphosphate | |
18247009 | Technetium radioisotope | |
18287004 | Plastic polymer | |
18288009 | von Willebrand factor | |
18290005 | 3-Dehydroquinate synthase | |
18298003 | Thromboxane B>2< | |
18300003 | Thiodimeton | |
18303001 | Amidase | |
18321003 | Thiethylperazine maleate | |
18324006 | D-Arabinonolactonase | |
18328009 | Mannose isomerase | |
18344000 | 2,4-Dichlorophenoxyacetic acid | |
18350005 | Ribonuclease IV | |
18359006 | Blood group antibody Fedor | |
18368008 | Chyle | |
18380000 | Blood group antibody K^w^ | |
18394004 | Collagenase preparation | |
18395003 | Hydroxypyruvate decarboxylase | |
18397006 | Sulfatide | |
18406008 | Hemoglobin Summer Hill | |
18414002 | Vitamin D>3< (substance) | |
18421002 | 3-Hydroxydecanoyl-[acyl-carrier-protein]-dehydratase | |
18426007 | Blood group antibody MZ 443 | |
18436004 | Lymphocyte antigen CD58 | |
18449009 | Lincomycin hydrochloride | |
18454000 | 3-Oxo-5beta-steroid delta^4^-dehydrogenase | |
18462008 | Methdilazine | |
18468007 | Blood group antibody M^g^ | |
18470003 | Genome | |
18486005 | Blood group antigen BLe^b^ | |
18490007 | NAD(P)^+^ nucleosidase | |
18501000 | HLA-B51 antigen | |
18509003 | Angiogenesis growth factor | |
18532004 | Sassafras oil | |
18533009 | Blood group antigen Rh34 | |
18535002 | Hypothalamic releasing factor | |
18550006 | Thioridazine hydrochloride | |
18566008 | Dodecarbonium chloride | |
18569001 | Potassium chlorate | |
18574009 | Dichloroethylene | |
18594000 | Immunoglobulin, GM>16< allotype | |
18600008 | Glucurolactone | |
18611000 | Blood group antigen Hr | |
18616005 | Lithium hydride | |
18617001 | Thrombopoietin | |
18622001 | Pyridoxal dehydrogenase | |
18627007 | Blood group antigen iP>1< | |
18633003 | Trimethylamine dehydrogenase | |
18659000 | Anti fungal antibody | |
18667008 | Hemoglobin Indianapolis | |
18681005 | Isopropyl-n-(3-chlorophenyl) carbamate | |
18712002 | Phenacemide | |
18732001 | Trimethylamine-oxide aldolase | |
18737007 | Blood group antigen Duclos | |
18743009 | ^228^Actinium | |
18754004 | Ytterbium radioisotope | |
18759009 | Sodium thioglycolate | |
18761000 | Lymphocyte antigen CD69 | |
18763002 | Blood group antigen Dropik | |
18774006 | Arylamine acetyltransferase | |
18786009 | Aspartate carbamoyltransferase | |
18800006 | Crotalus atrox metalloproteinase | |
18815007 | Diethyl phthalate | |
18819001 | Cryoglobulin | |
18832006 | Butylphenamide | |
18836009 | Bacterial toxin | |
18838005 | Pentachloronaphthalene | |
18847002 | Tryptamines | |
18852007 | Fibrinogen New York IV | |
18853002 | Lymphocyte antigen CD2 | |
18858006 | Indole | |
18916007 | Oxaloacetase | |
18924002 | Alkyl dimethyl ethylbenzyl ammonium bromide | |
18925001 | Vanadium | |
18959002 | Dibenzazepine derivative | |
18970009 | Prolactin releasing factor | |
18975004 | beta-L-Rhamnosidase | |
18989009 | Carbon compound | |
18992008 | Triturus species toxin | |
19004006 | Dichloro-chloroaniline-triazine | |
19007004 | Glycolate dehydrogenase | |
19009001 | Lymphocyte antigen CD18 | |
19011005 | Blood group antibody N | |
19012003 | Fibrinogen Tokyo I | |
19013008 | Sulfoacetaldehyde lyase | |
19016000 | Copper arsenate | |
19022009 | Blood group antigen Jopson | |
19023004 | Acetoacetate decarboxylase | |
19035000 | Blood group antibody Hall J | |
19041007 | Tolazoline hydrochloride | |
19046002 | Fibrinogen Pamplona | |
19064009 | ^110^Indium (substance) | |
19066006 | Dimethylaniline monooxygenase (N-oxide-forming) | |
19089003 | Lymphocyte antigen CD16 | |
19097005 | w-Amidase | |
19113006 | Cellulose 1,4-beta-cellobiosidase | |
19114000 | Mafenide acetate | |
19126005 | Merbromin | |
19136002 | Blood group antibody S1^a^ | |
19142003 | Hyaluronate lyase | |
19151006 | 3-Hydroxyanthranilate 3,4-dioxygenase | |
19152004 | Biotin-[acetyl-CoA-carboxylase] ligase | |
19160003 | Xylose | |
19163001 | Prohormone | |
19173004 | Pyrophosphate-serine phosphotransferase | |
19178008 | Blood group antibody U | |
19182005 | C>5b67< inhibitor | |
19186008 | Krypton isotope | |
19205004 | Secretin | |
19209005 | Fungicide | |
19238008 | Glycolipid | |
19277006 | Leukocyte elastase | |
19298006 | Calpain | |
19299003 | Aminolevulinate aminotransferase | |
19323009 | alpha,alpha-Phosphotrehalase | |
19331004 | Blood group antigen Rb^a^ | |
19395006 | Blood group antigen Pe | |
19400007 | Blood group antibody Baumler | |
19421007 | Chloroprocaine hydrochloride | |
19427006 | ^59^Nickel | |
19456006 | Glucosamine-6-phosphate isomerase | |
19462001 | Carbon dioxide absorbent | |
19495007 | Sodium pertechnetate Tc^99m^ | |
19499001 | Carbinoxamine maleate | |
19501009 | Hemoglobin Singapore | |
19509006 | Bryonidin | |
19510001 | Diphenhydramine hydrochloride | |
19516007 | ^98^Technetium | |
19521005 | Phosphatidylglycerophosphatase | |
19524002 | Penthienate | |
19530002 | Blood group antibody P>1< | |
19543002 | Pantetheine-phosphate adenylyltransferase | |
19545009 | ^114m^Indium | |
19565002 | Blood group antibody Rios | |
19574000 | Immunoglobulin, KM allotype | |
19595005 | Phenolphthalein | |
19622008 | ^48^Chromium | |
19635004 | Rhodium isotope | |
19638002 | Formylmethionine deformylase | |
19677004 | Lymphocyte antigen CD45 | |
19710004 | Plant lectin | |
19728002 | Lymphocyte antigen CD17 | |
19734009 | 4-Trimethylammoniobutyraldehyde dehydrogenase | |
19736006 | ^103^Silver | |
19737002 | Renilla-luciferin sulfotransferase | |
19747004 | Chlorine radioisotope | |
19751002 | Potassium compound | |
19755006 | Blood group antibody Shannon | |
19759000 | Dipropyl ketone | |
19767008 | ^175^Ytterbium | |
19775002 | Oil of cubeb | |
19783008 | Blood group antibody Groslouis | |
19814003 | Endogalactosaminidase | |
19823000 | Glucose-1,6-bisphosphate synthase | |
19830006 | Blood group antibody | |
19839007 | Sorbitol | |
19868008 | Lymphocyte antigen CDw78 | |
19872007 | Pyocyanin | |
19879003 | Di-isobutyl phenoxy ethoxy ethyl dimethyl benzyl ammonium chloride | |
19893005 | Potassium dichromate | |
19901000 | Pentylenetetrazol (substance) | |
19917006 | Hydroperoxy eicosatetraenoic acid | |
19918001 | Dihydroergocornine | |
19945000 | Blood group antigen M | |
19950006 | Brevetoxin | |
19964006 | Dinitrophenol | |
19967004 | Viomycin | |
19971001 | Glucuronate isomerase | |
19975005 | Phosphoribosyl-AMP cyclohydrolase | |
19978007 | Hexafluorenium | |
19985006 | N-Acetyl-gamma-glutamyl-phosphate reductase | |
19986007 | Urease | |
20009008 | Blood group antigen Rg1 | |
20024004 | Demeton | |
20028001 | Diborane | |
20040001 | Blood group antigen Di^b^ | |
20056006 | Dibromosalicylaldehyde | |
20057002 | Complement component C6 | |
20076000 | Phenylethanolamine N-methyltransferase | |
20077009 | Streptomycin-6-phosphatase | |
20083007 | Di-isobutyl cresolyl ethoxy ethyl dimethyl benzyl ammonium chloride | |
20096008 | Trichlorobenzoic acid | |
20120005 | ^230^Thorium | |
20125000 | Intracellular fluid | |
20138008 | Lethal gene | |
20150002 | Hemoglobin J-Luhe | |
20160006 | Glucose oxidase | |
20170008 | Lung surfactant | |
20183009 | Nicotinate-nucleotide-dimethylbenz-imidazole phosphoribosyltransferase | |
20211008 | Methylglyoxal synthase | |
20214000 | N-Acetylglucosamine-6-phosphate deacetylase | |
20217007 | Trimethaphan camsylate | |
20221000 | Profilin (substance) | |
20228006 | Blood group antigen Ku | |
20229003 | Pyrrobutamine | |
20230008 | Vital new red stain (substance) | |
20231007 | Aminosalicylic sodium | |
20238001 | Chlorinated lime | |
20265008 | Perchlorate salt | |
20296004 | Nitroaniline | |
20304007 | Blood group antibody P | |
20309002 | Dichloronitroethane | |
20327004 | Sodium caprylate | |
20337009 | Glycerone-phosphate acyltransferase | |
20340009 | Methysergide maleate | |
20355000 | Granulocyte antibody (substance) | |
20368008 | Diphenadione | |
20371000 | Acetylenecarboxylate hydratase (substance) | |
20378006 | Methyldimethoxyamphetamine | |
20379003 | Neomycin C | |
20383003 | Blood group antibody Duclos | |
20386006 | Aminoacyl-tRNA hydrolase | |
20413008 | Levopropoxyphene | |
20450009 | Ciprofloxacin hydrochloride | |
20459005 | Abalone viscera poison | |
20468007 | Isopropamide | |
20478005 | Diaminopimelate decarboxylase | |
20493009 | HLA-Dw24 antigen | |
20495002 | Fibrinogen Bergamo II | |
20507001 | Oil of garlic | |
20515003 | Oncogene protein c-ets | |
20524007 | Rhamnulokinase | |
20527000 | Hemoglobin Willamette | |
20532004 | beta-1,3-Galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase | |
20539008 | Tyrosine aminotransferase | |
20560002 | Cerebroside-sulfatase | |
20564006 | Toluene-2-4-diisocyanate | |
20569001 | Imidazoleacetate 4-monooxygenase | |
20574009 | Prostaglandin-D 15-dehydrogenase (NADP^+^) | |
20576006 | Blood group antigen Santano | |
20591008 | Blood group antibody Nielsen | |
20611000 | Hemoglobin Hotel-Dieu | |
20631001 | Convallarin | |
20642005 | mRNA guanylyltransferase | |
20643000 | 1,2-Dichloropropane | |
20645007 | Aspulvinone dimethylallyltransferase | |
20651002 | Pyridoxal kinase | |
20672004 | Guanine | |
20675002 | Inulosucrase | |
20685001 | Cholinergic receptor | |
20686000 | Fibrinogen Christchurg II | |
20732001 | Arthrobacter serine proteinase | |
20742004 | Glutaconate CoA-transferase | |
20748000 | Blood group antigen VK | |
20751007 | Deoxyadenylic acid | |
20752000 | Prothrombin antibody | |
20761000 | Ketene | |
20764008 | Lymphocyte antigen CD57 | |
20771003 | Congenital dysfibrinogen | |
20777004 | Blood group antibody Margaret | |
20792003 | Glucan 1,4-alpha-maltotetraohydrolase | |
20807009 | Anti nucleolus antibody | |
20821006 | Isopullulanase | |
20822004 | rRNA (adenosine-O^2'^)-methyltransferase | |
20823009 | Complement | |
20832006 | Farnesyl-diphosphate kinase | |
20844009 | Oxyprocaine | |
20847002 | Streptokinase agent (substance) | |
20878003 | Blood group antibody Hut | |
20887007 | Triethylenemelamine (substance) | |
20898008 | Lymphocyte antigen CD44 | |
20907008 | Blood group antibody Cipriano | |
20914005 | Adenylate kinase | |
20918008 | 3-Mercaptopyruvate sulfurtransferase | |
20925001 | Calcium glycerophosphate | |
20966001 | ^125^Antimony | |
20989009 | Cyanide compound | |
20993003 | Oncogene protein P53 | |
20994009 | Dinitro-o-amyl phenol | |
21004009 | ^199^Thallium | |
21023002 | Blood group antigen Rh42 | |
21028006 | Fibrinogen Bergamo I | |
21064007 | Blood group antibody Rm | |
21066009 | Buprenorphine hydrochloride | |
21074005 | Fucosylgalactose alpha-N-acetylgalactosaminyltransferase | |
21075006 | ^61^Cobalt | |
21094001 | Coal tar ointment | |
21102006 | Blood group antigen McC^d^ | |
21140009 | Mannose-6-phosphate isomerase | |
21141008 | ^95^Ruthenium | |
21145004 | Blood group antibody Hr>o< | |
21149005 | Blood group antibody Pr>1h< | |
21158003 | Independent high incidence blood group antibody | |
21166007 | Lymphocyte antigen CD21 | |
21168008 | Acetosulfone | |
21175009 | Methantheline bromide (substance) | |
21204003 | Pantetheine kinase | |
21209008 | Long-chain-alcohol oxidase | |
21231000 | Corticosteroid side-chain-isomerase | |
21235009 | Piperoxan | |
21239003 | beta-D-fructopyranose | |
21246007 | Fibrinogen Detroit | |
21256006 | HLA-Dw23 antigen | |
21275001 | Plasmalogen synthase | |
21289006 | Platelet factor 4 | |
21292005 | Mannan endo-1,4-beta-mannosidase | |
21302001 | Hemoglobin Denmark Hill | |
21303006 | Methoxamine hydrochloride | |
21309005 | Estradiol 17beta-dehydrogenase | |
21315005 | Blood group antigen St^a^ | |
21317002 | Sodium fluoroacetate | |
21319004 | Ribulose-phosphate 3-epimerase | |
21325000 | beta-Glucosidase | |
21373005 | Soap enema | |
21378001 | Iodinated I^125^ Rose Bengal | |
21380007 | 4-Methoxybenzoate monooxygenase (O-demethylating) | |
21383009 | Immunoglobulin, KM>3< allotype | |
21394008 | Adiphenine | |
21410001 | Protocatechuate decarboxylase | |
21416007 | Lead arsenite | |
21438009 | Ureidoglycolate dehydrogenase | |
21456009 | Glucarate dehydratase | |
21458005 | Glucose-6-phosphate isomerase | |
21495005 | Glutaryl-CoA dehydrogenase | |
21500008 | Dimethoate | |
21518006 | Naloxone hydrochloride | |
21521008 | HLA-Bw71 antigen | |
21533003 | Lyase | |
21540002 | Endosulfan | |
21541003 | Oncogene protein TCRD | |
21556007 | p-Methylaminophenol sulfate | |
21559000 | ^69m^Zinc | |
21564001 | Thyme oil | |
21566004 | Methyldopate hydrochloride | |
21568003 | Adrenal cortical hormone | |
21572004 | ^123^Iodine | |
21576001 | ^13^ Nitrogen | |
21585001 | Lysyltransferase | |
21592006 | Tartrazine stain (substance) | |
21607001 | Agmatine kinase | |
21609003 | Gastric vomitus | |
21611007 | Boric acid | |
21614004 | Phenelzine sulfate | |
21621004 | Copying ink | |
21625008 | Unsaturated fatty acid | |
21627000 | Hemoglobin Beirut | |
21632004 | Titanium compound | |
21642002 | Blood group antigen G | |
21660002 | Taxifolin 8-monooxygenase | |
21677002 | Colonic contents | |
21680001 | Hemoglobin G-Pest | |
21697007 | Rectal mucus | |
21706000 | Tetrahydrofolic acid | |
21712005 | Polyribonucleotide nucleotidyltransferase | |
21713000 | Thermomycolin | |
21716008 | 1-Chloro-3-bromopropene-1 | |
21728000 | Hemoglobin G-Ferrara | |
21729008 | Immunoglobulin, GM>15< allotype | |
21733001 | Prolyl endopeptidase | |
21736009 | Amine dehydrogenase | |
21743003 | N-Acetylglucosamine kinase | |
21750004 | Metmyoglobin | |
21760008 | Radiogold colloid | |
21774001 | Complement component, precursor (substance) | |
21790001 | Operon gene | |
21802009 | Blood group antibody HEMPAS | |
21803004 | Alkyl aryl ammonium chloride | |
21822008 | Hemoglobin A>2<^1^ (B>2<) | |
21847005 | Oil | |
21873000 | Blood group antibody Griffith | |
21876008 | Blood group antigen NOR | |
21880003 | Aurothioglucose | |
21888005 | Nickel carbonyl | |
21891005 | Digestive enzyme (substance) | |
21899007 | Thiocarbarsone | |
21903000 | Bismuth violet | |
21907004 | Hemoglobin Pitie-Salpetriere | |
21919007 | Opium | |
21920001 | Blood group antigen Lu14 | |
21936004 | Plutonium radioisotope | |
21951008 | Alizarin cyanine green stain (substance) | |
21961001 | Oil of spruce | |
21966006 | Aldose 1-epimerase | |
21977000 | ^121m^Tellurium | |
21988006 | Bacterial genome | |
21990007 | Phospholipase A venom | |
21999008 | 3-Hydroxy-3-isohexenylglutaryl-CoA lyase | |
22005007 | Ethyl chloride | |
22008009 | Fenchlorphos (substance) | |
22018004 | Tropine dehydrogenase | |
22021002 | Methyl green stain (substance) | |
22023004 | Blood group antigen Le^x^ | |
22038003 | Selenium | |
22065005 | Paraquat | |
22078005 | Pterins | |
22086005 | Sodium antimonyl gluconate | |
22088006 | 3-Hydroxyanthranilate oxidase | |
22092004 | Endopolyphosphatase | |
22100000 | Hemoglobin Zürich | |
22105005 | Sucrose-1,6-a-glucan 3(6)-alpha-glucosyltransferase | |
22110009 | Carnosine synthase | |
22129003 | ^123m^Tellurium | |
22141005 | Limonin-D-ring-lactonase | |
22147009 | Cyclohexylamine oxidase | |
22158000 | Sinapine esterase | |
22160003 | ^87^Yttrium | |
22165008 | Dipyrone (substance) | |
22175006 | Hemoglobin Natal | |
22179000 | Lysophospholipase | |
22183000 | ^119^Tellurium | |
22185007 | G protein | |
22192002 | Salicylamide | |
22196004 | NADPH dehydrogenase (flavin) | |
22219004 | Hemoglobin Riverdale-Bronx | |
22224001 | Chorismate synthase (substance) | |
22236007 | Acetarsone (substance) | |
22242006 | Glutaraldehyde | |
22244007 | Low density lipoprotein | |
22250002 | Fibrinogen Birmingham | |
22269007 | Blood group antibody Sa | |
22284003 | Glucosyl-DNA beta-glucosyltransferase | |
22290004 | Hepatitis B surface antigen (substance) | |
22308004 | ^116^Tellurium | |
22322004 | Steroid receptor | |
22332006 | Blood group antibody McC^e^ | |
22340000 | Sodium ricinoleate | |
22348007 | HLA-DR5 antigen | |
22360008 | Dimethoxane | |
22362000 | Calcium phosphate dibasic anhydrous | |
22377008 | Alkaline phosphatase isoenzyme, intestinal fraction | |
22392009 | Diffusely mineralized extracellular matrix | |
22403009 | 5-Oxopent-3-ene-1,2,5-tricarboxylate decarboxylase | |
22422000 | Maltose phosphorylase | |
22424004 | Ochratoxins | |
22453003 | Cathepsin G | |
22463006 | Hemoglobin G-San Jose | |
22479007 | ^71^Arsenic | |
22492005 | Hemoglobin Alamo | |
22496008 | Fibrinogen Cleveland I | |
22503007 | HLA-Bw50 antigen | |
22518008 | Hydrogen telluride | |
22538009 | Lead arsenate | |
22551004 | Dichlorophenyl dimethyl urea (substance) | |
22553001 | Mascara | |
22555008 | Sorbose | |
22559002 | Glycoasparagine | |
22568000 | Blood group antigen Hr>o< | |
22579005 | Heparan-alpha-glucosaminide acetyltransferase | |
22584004 | Hemoglobin Sydney | |
22604005 | Uridine triphosphate | |
22606007 | Vitamin K>2< | |
22627002 | Blood group antibody Barrett | |
22635004 | Factor V antibody | |
22643009 | Hemoglobin Belfast | |
22654004 | Propantheline bromide | |
22691005 | Urea carboxylase (hydrolysing) | |
22703005 | Brucine | |
22712007 | K-Carrageenase | |
22723006 | GABA-benzodiazepine receptor | |
22726003 | Cyclohexene | |
22727007 | Serum amyloid protein | |
22732008 | Pseudomonas aeruginosa alkaline proteinase | |
22746008 | Perbromate salt | |
22749001 | Victoria blue B stain (substance) | |
22769006 | Penthienate bromide | |
22771006 | Cellobiose dehydrogenase (quinone) | |
22779008 | Coagulation factor II Habana variant | |
22790003 | Physostigmine sulfate | |
22792006 | Tripelennamine citrate | |
22796009 | Hemoglobin D-Iran | |
22804007 | Hemoglobin D-Granada | |
22827004 | Prochlorperazine maleate | |
22836000 | Vegetable | |
22839007 | Blood group antibody Au^a^ | |
22840009 | Tetraethyl pyrophosphate | |
22842001 | Indene | |
22864005 | Phosphorylase phosphatase | |
22865006 | Anthophyllite | |
22880000 | 3-Hydroxypalmitoyl-[acyl-carrier-protein]-dehydratase | |
22882008 | Coagulation factor II Molise variant | |
22893005 | Inert matter | |
22904008 | Hemoglobin K-Ibadan | |
22907001 | Heavy metal | |
22908006 | Phorbol-diester hydrolase | |
22917006 | Hemoglobin D-Los Angeles | |
22931006 | Evans blue stain (substance) | |
22939008 | Blood group antibody Messenger | |
22941009 | 11-Deoxycortisol | |
22944001 | ^246^Plutonium | |
22947008 | Testosterone 17beta-dehydrogenase | |
22951005 | Screening smoke | |
22967004 | Drug receptor | |
22968009 | Sunset yellow FCF stain (substance) | |
22971001 | Blood group antibody I (substance) | |
22976006 | Aluminum acetate | |
22979004 | Oleic acid I^125^ | |
22987003 | Phosphopantothenoylcysteine decarboxylase | |
23003008 | Ribosylpyrimidine nucleosidase | |
23005001 | Glucose dehydrogenase (NAD) | |
23016008 | HLA-DPw1 antigen | |
23038005 | Myosin | |
23050004 | Small intestinal juice | |
23052007 | Hemoglobin O-Padova | |
23053002 | Iophenoxic acid (substance) | |
23064004 | Blood group antigen Jn^a^ | |
23068001 | Caffeine citrate | |
23077008 | Barbituric acid | |
23095006 | Thevetin | |
23101007 | Blood group antigen Dr^a^ | |
23103005 | Blood group antigen Niemetz | |
23113002 | Glutamine-tRNA ligase | |
23126003 | Hemoglobin G-Georgia | |
23134009 | Organic sulfide compound | |
23164001 | Sp40/40 | |
23165000 | Blood group antigen Terrano | |
23169006 | Poly (glycerol-phosphate) alpha-glucosyltransferase | |
23172004 | Bismuth | |
23176001 | Bacampicillin hydrochloride | |
23182003 | Cereal | |
23200004 | Blood group antigen Fy3 | |
23208006 | N-butyl acetanilide | |
23216002 | Suppressor gene | |
23217006 | Arsenic compound | |
23219009 | Hemoglobin Legnano | |
23240005 | Homologous restriction factor | |
23243007 | Oligonucleotide | |
23254002 | Squalene | |
23295004 | Coagulation factor I | |
23303000 | Silver isotope | |
23307004 | Estrogen receptor | |
23308009 | Taurine aminotransferase | |
23314002 | Blood group antibody Schwend | |
23317009 | Saxitoxin | |
23318004 | Anti neutrophilic cytoplasm antibody | |
23324005 | trans-Pentaprenyltranstransferase | |
23349009 | Phosphatidyl ethanolamine | |
23367002 | Monofluoroacetate salt | |
23369004 | Immune complex | |
23375008 | Colistin sulfate | |
23378005 | Male genital fluid | |
23380004 | Blood group antigen Kp^a^ | |
23385009 | Blood group antibody ALe^b^ | |
23396001 | Blood group antibody Green | |
23408008 | ^236^Plutonium | |
23423003 | Sodium hydroxide | |
23433006 | Vitamin D>2< | |
23434000 | Blood group antigen Or | |
23459009 | Selenium radioisotope | |
23465009 | 2-Dehydro-3-deoxygalactonokinase | |
23475007 | ^73m^Germanium | |
23504007 | 2-Deoxy-D-gluconate dehydrogenase | |
23519008 | ^180m^Tantalum | |
23555000 | Dethiobiotin synthase | |
23563004 | Very late antigen receptor | |
23564005 | Dyclonine | |
23570004 | ^219^Radon | |
23571000 | ^115^Cadmium | |
23573002 | Acetylcholinesterase | |
23590008 | Sialoprotein | |
23599009 | Allosteric site | |
23601006 | Mesityl oxide | |
23603009 | Blood group antigen Ge4 | |
23647003 | Hemoglobin Kawachi | |
23677009 | 4-Hydroxyglutamate aminotransferase | |
23689006 | Platelet antigen HPA-3a | |
23692005 | Tribasic calcium phosphate | |
23696008 | Catechol oxidase | |
23701001 | Trichlorocarbanilide | |
23711008 | Alkyl quaternary ammonium chloride | |
23733005 | Hemoglobin I-Toulouse | |
23734004 | D-Ornithine 4,5-aminomutase | |
23736002 | Na^+^/K^+^-transporting ATPase | |
23760003 | Blood group antibody Wb | |
23774005 | HLA-Dw9 antigen | |
23775006 | Blood group antibody Tar | |
23783000 | Harmaline | |
23788009 | ^97^Ruthenium | |
23814005 | Guanethidine monosulfate | |
23816007 | Tetrahydrocortisol (substance) | |
23832005 | Lavender oil | |
23841000 | Acid phosphatase isoenzyme, tartrate-sensitive fraction | |
23845009 | Phenylalanine acetyltransferase | |
23847001 | UDPglucose dehydrogenase | |
23861006 | Phenolsulfonphthalein | |
23862004 | Fibrinogen Bethesda III | |
23866001 | Fluoroacetic acid | |
23878002 | Blood group antibody Whittle | |
23883005 | Methadone hydrochloride | |
23893003 | Blood group antigen La Fave | |
23904000 | Xanthopterin | |
23921009 | Zirconium silicate | |
23923007 | 3-Hydroxy-2-methylpyridinecarboxylate dioxygenase | |
23929006 | Hemoglobin Tacoma | |
23942006 | Hemoglobin Titusville | |
23956008 | 2,2-Dialkylglycine decarboxylase (pyruvate) | |
23959001 | Thyroglobulin | |
23964002 | Pumiliotoxin A | |
23969007 | Tryparsamide | |
23974004 | Hemoglobin J-Abidjan | |
23989008 | Indanol dehydrogenase | |
24002009 | Blood group antigen Kn^b^ | |
24004005 | Hemoglobin St. Mande | |
24008008 | Blood group antibody Laine | |
24012002 | Sugar-phosphatase | |
24022008 | Bupivacaine hydrochloride | |
24023003 | Properdin native | |
24032001 | Arginine aminopeptidase | |
24037007 | Dihydrocoumarin hydrolase | |
24041006 | Immunoglobulin, GM>1< allotype | |
24049008 | Uronate dehydrogenase | |
24070002 | Phosphorylcholine | |
24099007 | Oxygen | |
24102007 | Chlorothalonil | |
24143007 | Platelet antibody HPA-2a | |
24156000 | Organic boron compound | |
24161003 | ^171^Hafnium | |
24167004 | Fast green FCF stain (substance) | |
24185006 | Histidine ammonia-lyase | |
24186007 | Abnormal pigment | |
24189000 | ^189^Platinum | |
24202000 | Ranitidine hydrochloride | |
24207006 | Blood group antigen Tri W | |
24213002 | Lead carbonate | |
24215009 | Picric acid | |
24237002 | Prostaglandin PGF1 (substance) | |
24243000 | Mercurous iodide | |
24248009 | Complete antibody | |
24254005 | Cerolipoid | |
24261009 | Trimethobenzamide hydrochloride | |
24276001 | ^132^Tellurium | |
24282003 | Hydroxymethylpyrimidine kinase | |
24301009 | ^198^Gold | |
24304001 | Blood group antibody K11 | |
24307008 | Retinyl-palmitate esterase | |
24331003 | ^181^Hafnium | |
24336008 | Aminophylline anhydrous | |
24352006 | Chondroitin ABC lyase | |
24357000 | Colony-stimulating factor, macrophage | |
24371008 | Mercuric arsenate | |
24375004 | Hemoglobin Ottawa | |
24391001 | Platelet antigen HPA-4a | |
24404002 | Blood group antigen A,B | |
24411003 | Sodium metaborate | |
24427005 | Metanephrine (substance) | |
24434007 | Sodium tartrate | |
24435008 | Fibrinogen Versailles | |
24479006 | Blood group antibody Kollogo | |
24487007 | High incidence antigen | |
24492009 | Immunoglobulin, GM>7< allotype | |
24503006 | Blood group antibody Vr | |
24511001 | Technetium Tc^99m^ succimer | |
24515005 | Spice | |
24516006 | Meldola blue stain (substance) | |
24517002 | Rhamnulose-1-phosphate aldolase | |
24521009 | Plastic monomer | |
24537003 | Laccase | |
24539000 | ^115m^Indium | |
24540003 | Blood group antibody En^a^KT | |
24544007 | L-erythro-3,5-Diaminohexanoate dehydrogenase | |
24545008 | 2-Hydroxyglutarate synthase | |
24556008 | N-butyl glycidyl ether | |
24570008 | Cathartic | |
24574004 | Blood group antigen Fy^b^ | |
24583009 | Terbutaline sulfate | |
24589008 | Rhodium radioisotope | |
24605005 | Mica | |
24615004 | Tryptophan aminotransferase | |
24634004 | Histone acetyltransferase | |
24648004 | Metabolite AND/OR marker of neoplasm | |
24650007 | Dihydro-alpha-ergocryptine | |
24655002 | Lymphocyte antigen CD4 | |
24660003 | Adenosylmethionine cyclotransferase | |
24665008 | Cocillana | |
24671002 | alpha,alpha-Trehalose-phosphate synthase UDP-forming | |
24673004 | HLA-Dw11 antigen | |
24675006 | Glial fibrillary acidic protein | |
24686008 | Acaricide | |
24701006 | Aliphatic saturated hydrocarbon | |
24710003 | Blood group antibody Pr^a^ | |
24721007 | Chlorothymol | |
24732007 | Maleylacetate reductase | |
24733002 | ^104^Silver | |
24751001 | Oxymorphone | |
24756006 | Dimetan | |
24769005 | Hydroxypyruvate reductase | |
24772003 | Sodium citrate and citric acid | |
24778004 | ^101m^Rhodium | |
24791003 | Citramalate lyase | |
24809001 | Spectinomycin hydrochloride | |
24821002 | Blood group antibody Tx | |
24823004 | Pipobroman | |
24824005 | 3-(Imidazol-5-yl)lactate dehydrogenase | |
24837008 | Dinitro-o-cresol | |
24838003 | Undecylenic acid and zinc undecylenate | |
24839006 | Polynucleotide 3'-phosphatase | |
24851008 | Deoxyribonucleic acid | |
24853006 | ^223^Radium | |
24857007 | Complement fixing antibody | |
24860000 | Blood group antibody Don E. W. | |
24862008 | Ureidosuccinase | |
24869004 | Nifurtimox | |
24873001 | Intramitochondrial cell metabolite | |
24877000 | Alkyl aryl ammonium bromide | |
24898000 | Independent low incidence blood group antibody | |
24900003 | Procion brilliant blue MRS stain (substance) | |
24903001 | Deoxyribonucleoside | |
24908005 | Organic sulfonic acid | |
24922005 | Hemoglobin Garden State | |
24926008 | Blood group antigen LW^ab^ | |
24938004 | Zirconium isotope | |
24939007 | Normetanephrine (substance) | |
24945004 | Acetylpyruvate hydrolase | |
24953007 | Arabinogalactan endo-1,3-beta galactosidase | |
24972007 | ^240^Plutonium | |
24978006 | Blood group antigen Bert | |
24995003 | Blood group antigen Bg^c^ | |
25001008 | Lead radioisotope | |
25002001 | Perazine | |
25013003 | Pyrantel pamoate | |
25027008 | Glycoprotein hormone | |
25059001 | Methyl oxydemeton | |
25071007 | Vaccenic acid | |
25077006 | Transketolase | |
25079009 | Lissamine fast yellow stain (substance) | |
25089008 | Enolase | |
25090004 | Nitramine | |
25091000 | Solochrome cyanine R stain (substance) | |
25095009 | Blood group antigen Ol^a^ | |
25108004 | Glutathione synthase | |
25111003 | L-Rhamnose dehydrogenase | |
25115007 | Hemoglobin Richmond | |
25128000 | ^72^Zinc | |
25130003 | Methylal | |
25141001 | Tubocurarine chloride | |
25153002 | Cysteine-tRNA ligase | |
25172002 | p-Nitroaniline | |
25175000 | UDPgalacturonate decarboxylase | |
25176004 | Mumps skin test antigen | |
25183006 | Manganese chloride | |
25195006 | Endothall | |
25204006 | Aluminum soluble salt | |
25205007 | Fluorine radioisotope | |
25213008 | Bicyclic antidepressant | |
25217009 | Pituitary follicle stimulating hormone | |
25222009 | Geranylgeranyl-diphosphate geranylgeranyltransferase | |
25234001 | Shikimate dehydrogenase | |
25249009 | N-Acetylneuraminate O^7^-acetyltransferase | |
25254000 | Procainamide hydrochloride | |
25282007 | Human leukocyte antigen Bw55 (substance) | |
25292004 | Hemoglobin Strumica | |
25293009 | Fluorine perchlorate | |
25305005 | Long-acting insulin | |
25307002 | Petrolatum | |
25315004 | HLA-Aw34 antigen | |
25329003 | Hemoglobin Ty Gard | |
25339009 | Inulinase | |
25351006 | Fluorescein sodium stain (substance) | |
25356001 | myo-Inositol 2-dehydrogenase | |
25386008 | Alanine-glyoxylate aminotransferase | |
25390005 | Acid phosphatase | |
25399006 | Glycerol dehydrogenase (NADP^+^) | |
25400004 | Blood group antibody Yt^b^ | |
25401000 | Barbiturate analog | |
25403002 | ^106^Rhodium | |
25414004 | Hemoglobin Handa | |
25426009 | Blood group antigen Bridgewater | |
25438000 | Hemoglobin Seattle | |
25453008 | Antibody to antigen in Kidd blood group system | |
25454002 | D-Pinitol dehydrogenase | |
25486007 | Sodium thiosalicylate | |
25494000 | Glucuronic acid | |
25500001 | ^40^Potassium | |
25513007 | Blood group antigen Stewart | |
25525005 | Protein C | |
25531008 | Protoberberine | |
25538002 | Thiothixene hydrochloride (substance) | |
25557006 | Blood group antigen Langer | |
25571003 | Chlordantoin (substance) | |
25574006 | 1-Aminocyclopropane-1-carboxylate deaminase (substance) | |
25589002 | Phenylpyruvate decarboxylase | |
25597009 | Hemoglobin Shimonoseki | |
25607008 | D-dimer | |
25608003 | Hemoglobin Ann Arbor | |
25620006 | Bitter orange oil | |
25644008 | Protein kinase | |
25650003 | Tryptophan-tRNA ligase | |
25670009 | Fetal fluids | |
25701004 | Disodium 3,6-endoxohexahydrophthalate | |
25705008 | Cadmium dust | |
25709002 | ^170^Hafnium | |
25710007 | ^113^Tin | |
25717005 | Myeloid-macrophage antibody | |
25719008 | MCPA amine | |
25722005 | War gas | |
25743006 | Skim milk | |
25745004 | Dehydrogluconate dehydrogenase | |
25747007 | ^135m^Xenon | |
25752002 | ^78^Germanium | |
25761002 | Glutamine | |
25770004 | Octyl alcohol | |
25773002 | Blood group antigen Elder | |
25780000 | Soap | |
25793005 | Poly(A)-specific ribonuclease | |
25796002 | Aluminum aspirin | |
25818006 | Colloid sulfur | |
25826003 | Platelet antibody HPA-5a | |
25833003 | Blood group antigen Lu^a^ | |
25838007 | 2,3-Dihydro-2,3-dihydroxybenzoate dehydrogenase | |
25843000 | Lead ethyl gasoline (substance) | |
25867008 | Blood group antigen Haven | |
25886000 | Fibrinogen Bergamo III | |
25911004 | Prostaglandin PGH2 (substance) | |
25926002 | 3-Oxolaurate decarboxylase | |
25931000 | Nitrosamine | |
25941002 | Orange II stain (substance) | |
25946007 | Dichlorophenyl methyl butyl urea | |
25958007 | Cobalt compound | |
25964000 | Blood group antigen Wk^a^ | |
25977009 | Bulan | |
25978004 | 3',5'-Cyclic-GMP phosphodiesterase | |
25981009 | Barrier grease | |
25992005 | Propyl acetate | |
26005009 | Blood group antigen Tajama | |
26012000 | Cholecystokinin receptor | |
26021004 | Blood group antibody Sd^a^ | |
26024007 | Pituitary hormone receptor | |
26066008 | Blood group antigen U | |
26069001 | Homoserine succinyltransferase | |
26070000 | Halogenated hydrocarbon-organic sulfur insecticide | |
26091008 | Aspartate aminotransferase | |
26093006 | Platelet antigen HPA-4b | |
26095004 | Gallium radioisotope | |
26101003 | Glucan endo-1,3-beta-glucosidase | |
26104006 | Maleic acid (substance) | |
26109001 | Piperazine citrate | |
26120001 | Desipramine hydrochloride | |
26131009 | Lead tetramethyl | |
26134001 | L-Lysine 6-aminotransferase | |
26148001 | Aryl-alcohol dehydrogenase (NADP^+^) | |
26159005 | Clostridium tetani toxin | |
26160000 | Isomerase | |
26161001 | dATP(dGTP)-DNA purinetransferase | |
26181000 | CDPdiacylglycerol-inositol 3-phosphatidyltransferase | |
26191006 | Bromodiphenhydramine hydrochloride (substance) | |
26192004 | Hemoglobin Maputo | |
26194003 | Tungsten | |
26227005 | Mineral dust | |
26233001 | Thioredoxin reductase (NADPH) | |
26238005 | Nitrite reductase (NAD(P)H) | |
26240000 | Oil of chamomile, Roman | |
26258006 | Sarcosine dehydrogenase | |
26261007 | Deoxyribonucleic acid (cytosine-5)-methyltransferase (substance) | |
26266002 | Arginine deiminase | |
26271009 | Glucosaminylgalactosylglucosylceramide beta-galactosyltransferase | |
26274001 | Hydroxyeicosatetraenoic acid | |
26277008 | Dynorphin | |
26282001 | ^231^Thorium | |
26288002 | Mitotane | |
26304004 | Alliin lyase | |
26312007 | Phosphatidylcholine | |
26327007 | Red phosphorus | |
26346008 | Ethambutol hydrochloride | |
26351002 | Prostaglandin | |
26353004 | Boron radioisotope | |
26355006 | Blood group antibody Cameron | |
26371006 | Chlorophacinone | |
26379008 | Dimethisoquin (substance) | |
26387009 | Threonine synthase | |
26405004 | Hemoglobin Brisbane | |
26414009 | Hemoglobin Knossos | |
26426004 | Ciguatoxin | |
26430001 | Taurocyamine kinase | |
26434005 | Indium radioisotope | |
26437003 | Oil of mustard | |
26441004 | Blood group antigen Bg^a^ | |
26469007 | Prepro-opiomelanocortin | |
26470008 | Hemoglobin Gun Hill | |
26473005 | Sucrose-phosphatase | |
26490004 | Glucose-6-phosphate 1-epimerase | |
26497001 | Viral genome | |
26518005 | Coagulation factor XIa | |
26521007 | Glycolipid 3-alpha-mannosyltransferase | |
26524004 | Catechol oxidase (dimerizing) | |
26539003 | N-Acetyllactosaminide alpha-1,3-galactosyltransferase | |
26557002 | Pentachloroethane | |
26567007 | Hemoglobin Port de France | |
26569005 | Gonadotropin receptor | |
26575001 | Myrcia oil | |
26591003 | Kininogen | |
26598009 | 8-Amino-7-oxononanoate synthase | |
26645004 | Homocystine | |
26647007 | Blood group antibody Coates | |
26651009 | Blood group antigen Rd | |
26656004 | Aromatic castor oil | |
26663004 | Cigar smoking tobacco | |
26674008 | Heptachlorocyclopentadiene | |
26709006 | Immunoglobulin monomer | |
26712009 | Mannan 1,2-(1,3)-alpha-mannosidase | |
26720006 | Blood group antibody McC^c^ | |
26721005 | Cellular proto-oncogene MYC | |
26740004 | Eosinophilic derived inhibitor | |
26749003 | Blood group antibody Kaj | |
26753001 | Aryl-alcohol dehydrogenase | |
26756009 | ^87^Zirconium | |
26766001 | Starch glycerite | |
26775004 | Dioxin | |
26798007 | Hemoglobin P-Nilotic | |
26817007 | Methylated naphthalene | |
26821000 | Apolipoprotein B | |
26822007 | 2-Naphthylamine | |
26841005 | DDT-dehydrochlorinase | |
26855002 | Blood group antigen K14 | |
26856001 | Small intestine contents | |
26858000 | Spermine | |
26859008 | Cervical mucus | |
26898003 | Immunoglobulin IgA1 | |
26926006 | Alkyl toluyl methyl trimethyl ammonium chloride | |
26930009 | Quercetin 2,3-dioxygenase | |
26937007 | Blood group antigen Hil | |
26945002 | Phendimetrazine tartrate | |
26952000 | Formyl-CoA hydrolase | |
26956002 | Glutamate-1-semialdehyde 2,1-aminomutase | |
26959009 | Phosphoribosylformylglycinamidine cyclo-ligase (substance) | |
26961000 | Benzyl chloride | |
26967001 | Sulfate salt | |
26979001 | Phenylalanine racemase (ATP-hydrolysing) | |
26992003 | Chlorisondamine | |
27013004 | Hemoglobin McKees Rocks | |
27014005 | Diacylglycerol acyltransferase | |
27016007 | Alizarin yellow GG stain (substance) | |
27024002 | Blood group antigen By | |
27044008 | Blood group antibody Becker | |
27045009 | UDP-N-acetylglucosamine 4-epimerase | |
27047001 | Blood group antigen Schwend | |
27048006 | Blood group antigen Can | |
27054007 | ^57^Cobalt | |
27076003 | Blood group antibody Rich | |
27079005 | Meclocycline sulfosalicylate | |
27081007 | ^127^Xenon | |
27082000 | Sulfapyridine | |
27089009 | Blood group antibody Ce | |
27109008 | ^126^Barium | |
27119002 | Trimellitic anhydride | |
27120008 | Malachite green stain (substance) | |
27122000 | ^56^Nickel | |
27127006 | Thymidylate 5'-phosphatase | |
27130004 | Lymphocyte antigen CD11b | |
27138006 | Saccharin | |
27177009 | Steam | |
27184001 | 17-Hydroxypregnenolone | |
27188003 | Cephalosporin-C deacetylase | |
27192005 | Aminosalicylic acid | |
27200003 | Hemoglobin Doha | |
27205008 | Blood group antigen IAB | |
27244000 | Lithium isotope | |
27247007 | Dioxane | |
27248002 | Coagulation factor X R.E.D. variant | |
27273002 | Complement component C1s | |
27316004 | ^49^Vanadium | |
27319006 | Hemoglobin Pierre-Benite | |
27332001 | NMN nucleosidase | |
27340007 | Blood group antigen HLA-A10 | |
27341006 | Pokeweed mitogen | |
27345002 | Hemin | |
27347005 | Lymphocyte antigen CD4 receptor (substance) | |
27349008 | ^135m^Barium | |
27361000 | Barium salt | |
27363002 | 2-Dehydro-3-deoxy-D-gluconate 6-dehydrogenase | |
27370002 | Sulfinoalanine decarboxylase | |
27378009 | Tyrosine | |
27380003 | Nucleic acid | |
27384007 | Blood group antigen LKE | |
27390006 | Hydrogen sulfide | |
27412001 | D-Glutamate cyclase | |
27417007 | Blood group antigen Geslin | |
27425009 | Platelet antigen HPA-2a | |
27430008 | Chlorobenzene | |
27432000 | Guanosine phosphorylase | |
27440006 | Convalescent phase reactant | |
27453009 | Blood group antigen John Smith | |
27459008 | Blood group antigen Co^b^ | |
27470001 | Butoxypolypropylene glycol | |
27487004 | Blood group antigen Talbert | |
27488009 | 1-Phosphatidylinositol kinase | |
27489001 | Blood group antigen Don | |
27499006 | Oxyphencyclimine | |
27512003 | Hemoglobin J-Paris-I | |
27562008 | Superoxide dismutase | |
27565005 | D-Xylose dehydrogenase (NADP^+^) | |
27569004 | Hemoglobin Hirosaki | |
27586005 | Undecoylium chloride iodine | |
27594003 | Ferric pyrophosphate | |
27595002 | Hemoglobin Heathrow | |
27602003 | Dichloromonofluoromethane | |
27607009 | Blood group antigen Ts | |
27610002 | NADPH dehydrogenase | |
27626001 | Blood group antibody S | |
27631004 | Oligonucleotidase | |
27647002 | L-Lysine-lactamase | |
27656005 | Gitalin (substance) | |
27671009 | Rhodamine B stain (substance) | |
27674001 | Fungal structural gene | |
27675000 | Hemoglobin Chesapeake | |
27730007 | Merodicein | |
27736001 | Bacitracin A | |
27747008 | NAD(P)^+^ transhydrogenase | |
27758004 | delta^24^-Sterol methyltransferase | |
27763000 | Hydrochloric acid | |
27766008 | Prothipendyl | |
27800009 | Blood group antibody BLe^d^ | |
27822002 | Phenylpropylmethylamine | |
27831002 | Snake venom | |
27840003 | Methemoglobin | |
27844007 | Benzo fast scarlet stain (substance) | |
27847000 | Ceroid | |
27850002 | Calycanthine | |
27862003 | Blocking antibody | |
27888000 | Ribonucleic acid | |
27894008 | Amino sugar | |
27897001 | Jejunal juice | |
27899003 | Blood group antibody Ol^a^ | |
27914008 | Hemoglobin Hasharon | |
27928002 | Flurazepam hydrochloride | |
27931001 | Dipeptidyl peptidase I | |
27961009 | Homoaconitate hydratase | |
27963007 | Blood group antibody Toms | |
27980006 | Ferri-hemoglobin | |
27989007 | Coagulation factor II Segovia variant | |
27995008 | Hemoglobin Dhofar | |
27999002 | Blood group antigen Hands | |
28015009 | D-Glutamate (D-aspartate) oxidase | |
28021008 | Ethyl acrylate | |
28025004 | L-Rhamnose isomerase | |
28027007 | Uranium radioisotope | |
28029005 | Metescufylline | |
28069006 | Refrigerant anesthetic | |
28095008 | Hemoglobin Complutense | |
28112009 | Meconium stool | |
28113004 | Actinolite | |
28117003 | Carvone | |
28118008 | tRNA-queuosine beta-mannosyltransferase | |
28121005 | Iophendylate (substance) | |
28142007 | (S,S)-Butanediol dehydrogenase | |
28145009 | Blood group antibody Cr3 (substance) | |
28162004 | Vinyl bromide (substance) | |
28176003 | Dipeptidyl peptidase III | |
28203004 | 3-Oxoacyl-[acyl-carrier-protein] reductase | |
28223003 | Cycloguanil | |
28227002 | Halogen | |
28230009 | Poultry | |
28243009 | ^226^Radium | |
28251007 | Phosphatidylcholine desaturase | |
28252000 | Glycine N-choloyltransferase | |
28262007 | Blood group antibody Robert | |
28268006 | Pregnanediol | |
28298004 | Pan-leukocyte antibody | |
28344001 | Mephenytoin | |
28356000 | Sulfite dehydrogenase | |
28361003 | Blood group antibody Mathison | |
28406009 | Immunoglobulin IgG1 (substance) | |
28408005 | Blood group antigen LW^b^ | |
28421003 | Sorbic acid | |
28424006 | Lymphocyte antigen CD62 | |
28427004 | HLA-DQw9 antigen | |
28430006 | Methylsterol monooxygenase | |
28444000 | Hemoglobin J-Iran | |
28451009 | 4-Hydroxymandelate oxidase | |
28464005 | Dioxyline | |
28469000 | Intracisternal material, periodic | |
28495003 | Blood group antibody El | |
28511008 | Biotin-[methylcrotonoyl-CoA-carboxylase] ligase | |
28521000 | Coagulation factor II Denver variant | |
28525009 | ^193m^Iridium | |
28530008 | beta-Galactosidase | |
28538001 | Hemoglobin Dagestan | |
28539009 | Auxin | |
28546000 | Aminopeptidase A | |
28549007 | Phosphoketolase | |
28564007 | Blood group antibody Reiter | |
28577003 | Blood group antibody Chr^a^ | |
28580002 | Diprenorphine | |
28585007 | Platelet-specific antigen | |
28588009 | Cephaloridine (substance) | |
28589001 | cis-1,2-Dihydro-1,2-dihydroxynaphthalene dehydrogenase | |
28598003 | Fructose-bisphosphate aldolase | |
28622002 | Alizarin yellow R stain (substance) | |
28632009 | Focally mineralized extracellular matrix | |
28647000 | Meat | |
28648005 | Oncogene protein TAL 1 | |
28649002 | Secondary-alcohol oxidase | |
28662003 | Hydralazine hydrochloride | |
28666000 | Bentazon | |
28673005 | Antiribosomal antibody | |
28675003 | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | |
28679009 | Lymphocyte antigen CD28 | |
28702005 | Ambutonium | |
28708009 | Blood group antigen Bovet | |
28716000 | Lymphocyte antigen CDw65 | |
28721002 | ^99^Rhodium | |
28731009 | Blood group antibody Morrison | |
28747006 | Kinetins | |
28752001 | Pectate lyase | |
28767002 | Oligogalacturonide lyase | |
28779002 | Blood group antibody Savior | |
28785009 | Arginyltransferase | |
28787001 | Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase | |
28793009 | Right bronchial mucus | |
28808000 | Blood group antigen Stevenson | |
28819002 | Blood group antibody K12 | |
28823005 | Terpineol | |
28824004 | ^214^Lead | |
28825003 | Sterigmatocystin | |
28829009 | Coal tar naphtha | |
28832007 | Phenylalanine-tRNA ligase | |
28848008 | Hemoglobin O-Arab | |
28881009 | Blood group antibody B 9208 | |
28917004 | Hydroxy-mercurichlorophenol | |
28927005 | Diphenylheptane derivative | |
28935008 | Transfer RNA | |
28942008 | Coconut oil | |
28954008 | Guanylate cyclase | |
28957001 | Polypeptide N-acetylgalactosaminyltransferase | |
28963005 | Abnormal hemoglobin, deleted residue | |
28973007 | Methyl phenol | |
28983006 | 6-Ketoprostaglandin PGF>1< | |
28999000 | Fusarin | |
29004007 | Huratoxin | |
29011006 | Manganese trioxide | |
29043006 | Cadmium isotope | |
29053007 | Chlorodiethylacetamide | |
29091007 | Hemoglobin F-La Grande | |
29102009 | Methyl chlorophenoxyacetic acid | |
29107003 | Platinum radioisotope | |
29109000 | Formamide | |
29128007 | Karathane | |
29135004 | Flax fiber | |
29154004 | 3-(p-Chlorophenyl)-1, 1-dimethyl urea | |
29157006 | Thiazolsulfone (substance) | |
29170002 | Antimony isotope | |
29181004 | Haloacetate dehalogenase | |
29183001 | Fluorine compound | |
29184007 | Diphemanil methylsulfate (substance) | |
29190006 | Fentanyl citrate | |
29204001 | Alkyl trimethyl ammonium bromide | |
29218008 | Indium^111^ pentetate | |
29229007 | Hemoglobin Rothschild | |
29234006 | Arylamine sulfotransferase | |
29244008 | Blood group antibody Lu4 | |
29246005 | Immunoglobulin G (substance) | |
29247001 | D-Aspartate oxidase | |
29252006 | Acridine orange stain (substance) | |
29253001 | Nicotinamide phosphoribosyltransferase | |
29262004 | UTP-hexose-1-phosphate uridylyltransferase | |
29263009 | Coffee | |
29266001 | Blood group antigen Sadler | |
29275004 | Blood group antibody Tollefsen-Oyen | |
29276003 | Chlorine | |
29279005 | Glycerophosphocholine phosphodiesterase | |
29282000 | 17alpha-Hydroxyprogesterone aldolase | |
29285003 | Agarase | |
29301006 | Isoproterenol hydrochloride (substance) | |
29308000 | tert-Pentyl alcohol | |
29327006 | Chloramphenicol palmitate | |
29332007 | Acylmuramoyl-alanine carboxypeptidase | |
29336005 | Hippuric acid | |
29342009 | Kenacid blue R stain (substance) | |
29348008 | Pentetate calcium trisodium Yb^169^ | |
29349000 | Hydroxy-mercurinitrophenol | |
29360009 | Varnish | |
29363006 | Diethanolamine | |
29377009 | 3-Hydroxyisobutyryl CoA hydrolase | |
29382002 | ^5^Helium | |
29393000 | Extracellular secretion material following exocytosis, interstitial, endocrine | |
29398009 | Oncogene protein TCRB | |
29403005 | Aryl sulfotransferase | |
29406002 | alpha-Amylase preparation | |
29412007 | Dihydrobunolol dehydrogenase | |
29414008 | 1D-1-Guanidino-3-amino-1,3-dideoxy-scyllo-inositol aminotransferase | |
29436006 | Hemoglobin A>2< Indonesia | |
29455006 | Algicide (substance) | |
29460005 | Copper^67^ ceruloplasmin | |
29461009 | Crotin | |
29467008 | Tannase | |
29468003 | Blood group antigen ELO | |
29496009 | Polyolefin | |
29497000 | alpha-N-Acetylglucosaminidase | |
29502003 | Blood group antigen IBH | |
29516008 | Venerupin shellfish toxin | |
29520007 | Protoanemonin | |
29522004 | Toluidine blue stain (substance) | |
29527005 | Benztropine mesylate (substance) | |
29531004 | Nickel radioisotope | |
29552007 | Hydroxymethylglutaryl-CoA reductase (NADPH) | |
29554008 | Glycine amidinotransferase | |
29573007 | Blood group antigen Wade | |
29579006 | Choline kinase | |
29584000 | Diagnostic antigen | |
29588002 | Brompheniramine maleate | |
29607004 | tRNA-uridine aminocarboxypropyltransferase | |
29614002 | Glyceryl-p-aminobenzoate | |
29622009 | Octyl salicylate | |
29649009 | Rhodium compound | |
29652001 | Blood group antibody Noble | |
29661001 | Immunoglobulin A secretory | |
29666006 | Nortriptyline hydrochloride | |
29671004 | Lithium bromide | |
29676009 | 16-alpha-Hydroxysteroid dehydrogenase (substance) | |
29677000 | Hemoglobin Pyrgos | |
29678005 | ^136^Cesium | |
29698000 | Photinus-luciferin 4-monooxygenase (ATP-hydrolysing) | |
29705004 | Dimethylaminobenzene | |
29706003 | ^102m^Rhodium | |
29719004 | Blood group antibody Dav | |
29725000 | Heparin calcium | |
29735006 | Lymphocyte antigen CD33 | |
29750002 | Bacterial exotoxin | |
29754006 | ADPribose pyrophosphatase | |
29763008 | Deoxy guanosine diphosphate | |
29765001 | Fumagillin | |
29776002 | Complement component C7 | |
29783009 | Chromocarb | |
29784003 | Hexachloroethane | |
29791000 | ^196^Gold | |
29794008 | Diisobutyl ketone | |
29797001 | Pyroglobulin | |
29805009 | Potassium perchlorate | |
29817006 | Indican | |
29831006 | Blood group antigen Taylor | |
29842002 | Nicotine dehydrogenase | |
29876006 | ^129m^Xenon | |
29890009 | Blue-green algae product | |
29900000 | Pantoate dehydrogenase | |
29910009 | GTP cyclohydrolase II | |
29917007 | Phosphorous acid | |
29919005 | ^100^Palladium | |
29925009 | Antimony radioisotope | |
29945001 | Liquid oxygen | |
29953009 | Hemoglobin Bourmeds | |
29973004 | ^235^Plutonium | |
29974005 | (R,R)-Butanediol dehydrogenase | |
29985007 | Immunoglobulin, L chain, lambda | |
29986008 | Immunoglobulin A>1< proteinase | |
29988009 | Blood group antibody McC^f^ | |
29991009 | Methyl malonyl-CoA epimerase | |
29992002 | Cob(II)alamin reductase (substance) | |
29998003 | ^31^Silicon | |
30022007 | Citrulline (substance) | |
30030008 | Interleukin-9 | |
30034004 | Dimethoxanate | |
30040006 | Chloro-o-phenyl phenol | |
30053009 | Brefeldin | |
30056001 | Aromatic-amino-acid-glyoxylate aminotransferase | |
30065008 | Adenosine deaminase | |
30094001 | Riboflavin dinucleotide | |
30095000 | Cassaidine | |
30096004 | Ricin | |
30103001 | Butylamine | |
30109002 | Phosphogluconate dehydrogenase | |
30137009 | Blood group antigen CE | |
30145004 | Activin hormone | |
30158003 | Deoxyribose-phosphate aldolase | |
30159006 | Hemeprotein | |
30178006 | Vitamin D | |
30179003 | Carbonyl fluoride | |
30192000 | Oncogene protein V-FMS | |
30203009 | Paromomycin sulfate | |
30205002 | Thymic T lymphocyte factor | |
30209008 | Blood group antibody Gladding | |
30236005 | Tilorone | |
30245006 | Blood group antibody Kelly | |
30286004 | Acylglycerol palmitoyltransferase | |
30302001 | Hydroxylamine sulfate | |
30324001 | ^132^Iodine | |
30325000 | Chlorfenvinphos | |
30326004 | Atrial natriuretic factor (substance) | |
30329006 | Triflupromazine | |
30333004 | Mercaptomerin sodium | |
30357004 | Blood group antibody Santano | |
30363008 | Aldehyde dehydrogenase [NADP+] (substance) | |
30364002 | Non-mineralized extracellular matrix | |
30375003 | Clinically relevant isoenzyme | |
30395009 | UDP-N-acetylglucosamine dehydrogenase | |
30403007 | Glycine acyltransferase | |
30411002 | 6-Phosphogluconolactonase | |
30413004 | Blood group antigen Cad | |
30424002 | Proparacaine hydrochloride | |
30443002 | H^+^/K^+^-transporting ATPase | |
30485003 | Methylamine glutamate methyltransferase | |
30487006 | Formaldehyde dehydrogenase | |
30498007 | Blood group antigen Emm | |
30499004 | ^83m^Krypton | |
30511000 | Gold salt | |
30525004 | Leucyltransferase | |
30531001 | Calcium oxalate | |
30540002 | Blood group antibody Simpson | |
30551002 | Thioglycolate salt | |
30559000 | Glycerol 2-dehydrogenase (NADP^+^) | |
30563007 | Hemoglobin Lepore-Hollandia | |
30589007 | Dibutyl phosphate | |
30594007 | Lymphocyte antigen CD5 | |
30603002 | Tyrosine 3-monooxygenase | |
30604008 | Platelet antigen HPA-2b | |
30607001 | Blood group antigen Lu3 | |
30609003 | Blood group antibody Terrano | |
30616002 | Malonate CoA-transferase | |
30621004 | Autoantibody | |
30656000 | Glyoxylate oxidase | |
30658004 | Turacoporphyrin | |
30676006 | Metharbital (substance) | |
30690009 | Porphobilinogen deaminase | |
30702003 | Blood group antibody D^w^ | |
30703008 | Metaphosphoric acid | |
30708004 | alpha-Galactosidase | |
30723009 | Blood group antigen Payer | |
30734007 | Proline dehydrogenase | |
30745005 | Loxapine succinate | |
30749004 | Nitrous acid | |
30774001 | Mitogen receptor | |
30787007 | ^194^Iridium | |
30792009 | Hemoglobin Prato | |
30797003 | Blood group antigen Tc^c^ | |
30804005 | Coagulation factor VII (substance) | |
30805006 | Gluconate dehydratase | |
30820000 | Phosphorus | |
30825005 | Colloidal Indium^111^ | |
30827002 | Azapetine | |
30841006 | CDP-4-dehydro-6-deoxyglucose reductase | |
30848000 | Fibrinogen Oslo III | |
30853005 | ^97^Zirconium | |
30861000 | Steroid 11-beta-monooxygenase | |
30863002 | Desiccated whole bile | |
30906008 | Transcobalamin II | |
30907004 | Hemoglobin Tokoname | |
30932002 | Phylloquinone monooxygenase (2,3-epoxidizing) | |
30939006 | ^137m^Barium | |
30954000 | Blood group antigen Charles | |
30960000 | 1,1,1,2-Tetrachloro-2,2- difluoroethane | |
30965005 | Interleukin-6 | |
30986005 | 2-Ethoxyethanol | |
30987001 | Blood group antibody Rh35 | |
30990007 | Abnormal fibrinogen | |
31001006 | Lymphocyte antigen CD68 | |
31008000 | Blood group antibody Talbert | |
31011004 | 4-hydroxycoumarin | |
31024004 | Blood group antigen Good | |
31034008 | Isoleucine-tRNA ligase | |
31036005 | Blood group antigen Mansfield | |
31039003 | Cysteamine dioxygenase | |
31042009 | Plant structural gene | |
31046007 | Cation | |
31052008 | Pectin lyase | |
31055005 | Gastrointestinal hormone | |
31086004 | Gasoline | |
31088003 | Chlorophyllase | |
31109005 | Acylglycerone-phosphate reductase | |
31111001 | Apoatropine | |
31119004 | Hypoglycin A | |
31121009 | gamma Aminoisobutyric acid | |
31147000 | Metoclopramide hydrochloride | |
31178001 | Bethanechol chloride | |
31182004 | Diethylene glycol monoethyl ether | |
31192007 | Ferrous chloride Fe^59^ | |
31202008 | Pseudomonas serine proteinase | |
31212001 | Calcium compound | |
31245001 | Blood group antibody Oca | |
31252004 | Hemoglobin Nunobiki | |
31260003 | Methylene violet stain (Bernthsen) (substance) | |
31278008 | 1,4-alpha-Glucan 6alpha-glucosyltransferase | |
31299006 | Hemoglobin A | |
31310007 | Ganglioside | |
31317005 | Blood group antigen C^w^ | |
31324006 | Colloidal oatmeal powder with oil | |
31328009 | L-Threonate dehydrogenase | |
31347007 | Glycyrrhiza | |
31349005 | Aspergillus oryzae aspartic proteinase | |
31357008 | Blood group antibody Sc3 | |
31369000 | Purine nucleosidase | |
31370004 | Dopamine-beta-monooxygenase | |
31381001 | Vesicating gas | |
31395003 | 3,4-Dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione 4,5-dioxygenase | |
31400002 | HLA-Bw63 antigen | |
31405007 | Glutamate dehydrogenase [NAD(P)+] (substance) | |
31409001 | Valine-3-methyl-2-oxovalerate aminotransferase | |
31414002 | Amide | |
31422009 | Ox bile extract | |
31433007 | Cortisol acetyltransferase | |
31444004 | Plant product insecticide | |
31480004 | Chlorpyrifos | |
31503002 | Steroid 21-monooxygenase | |
31522006 | Mild silver protein | |
31527000 | Sodium chloride Na^24^ | |
31528005 | Nitrite salt | |
31538000 | CoA-glutathione reductase (NADPH) | |
31539008 | Magnesium compound | |
31540005 | Extracellular fiber | |
31543007 | 6-Acetylglucose deacetylase | |
31555001 | ^234^Plutonium | |
31559007 | Ribonuclease P | |
31576006 | N-Sulfoglucosamine sulfohydrolase | |
31579004 | Oil of champaca | |
31603005 | ^190^Iridium | |
31617001 | Hydrophilic petrolatum | |
31618006 | Difenamide | |
31622001 | ^127m^Xenon | |
31662002 | Orange flower oil | |
31675002 | Capillary blood | |
31706007 | Ketamine hydrochloride | |
31707003 | Zinc bacitracin | |
31714001 | New fuchsin stain (substance) | |
31720000 | Diacylglycerol kinase | |
31731008 | Magnesium phosphate | |
31744003 | Orotate phosphoribosyltransferase | |
31756002 | Methionine racemase | |
31773000 | Gastric juice | |
31775007 | Hemoglobin F-Melbourne | |
31780003 | Preproenkephalin | |
31787000 | Coagulation factor IX Alabama variant (substance) | |
31790006 | Malic acid | |
31799007 | Mephentermine sulfate | |
31801005 | Benzonatate | |
31811003 | Carbon dioxide | |
31815007 | Oxybutynin chloride | |
31818009 | Deoxyribonuclease (pyrimidine dimer) | |
31827005 | Ristocetin | |
31849004 | Succinate-citramalate CoA-transferase | |
31854008 | Blood group antibody Terschurr | |
31856005 | Dimethyl-1,1-dibromo-2-2-dichloroethyl phosphate | |
31857001 | (2-Aminoethyl) phosphonate-pyruvate aminotransferase | |
31862000 | Galactonolactone dehydrogenase | |
31876004 | 6-Methylsalicylate decarboxylase | |
31880009 | ^6^Helium | |
31895006 | Gonadotropin | |
31896007 | Barium radioisotope | |
31897003 | Blood group antigen Hop (substance) | |
31936008 | Sodium isotope | |
31947001 | Carbon isotope | |
31953001 | Strontium nitrate Sr^87^ | |
31960007 | Anti SS-B antibody | |
31963009 | beta-Butoxy beta-thiocyano-diethyl ether | |
31979005 | Fatty acid | |
31990000 | Fibrinogen Cleveland II | |
32027009 | Hemoglobin A>2< Flatbush | |
32030002 | Diphenidol hydrochloride (substance) | |
32039001 | Glass | |
32040004 | Putrescine acetyltransferase | |
32049003 | Rhodium dust | |
32050003 | Pine oil | |
32059002 | ^225^Actinium | |
32068000 | Serine-glyoxylate aminotransferase | |
32072001 | Dalapon | |
32073006 | HLA-Bw60 antigen | |
32079005 | Blood group antigen Ramskin | |
32083005 | Oxanamide | |
32089009 | Blood group antibody VS | |
32100007 | Haptoglobin 2-1 | |
32103009 | Thyroid hormone receptor | |
32120008 | Camphorated oil | |
32131000 | Carboxymethylhydantoinase | |
32133002 | Microarazide nitrate (substance) | |
32138006 | Bile pigment | |
32147003 | Blood group antigen Suhany | |
32154009 | Inulin | |
32157002 | Cathepsin B | |
32165004 | N-Acetylneuraminate synthase | |
32167007 | Blood group antibody Nickolai | |
32180005 | Nicotinic receptor | |
32197004 | Clobetasol propionate | |
32216001 | Acylamino-acid-releasing enzyme | |
32228009 | Butadiene | |
32233008 | Blood group antibody Kasamatsuo | |
32235001 | Blood group antibody A 8306 | |
32237009 | Blood group antibody IBH | |
32241008 | Blood group antigen Wr^b^ | |
32245004 | Cystathionine gamma-lyase | |
32261002 | Blood group antibody Lu6 | |
32269000 | Uranium compound | |
32277001 | Soluble immune complex | |
32281001 | Fibrinogen Oslo IV | |
32291007 | Steryl-beta-glucosidase | |
32302009 | Ornithine decarboxylase | |
32305006 | Blood group antibody Rd^a^ | |
32314001 | Blood group antibody Marriott | |
32317008 | Hemoglobin J-Bangkok | |
32324009 | Blood group antibody BR 726750 | |
32329004 | Blood group antigen I^F^ | |
32335004 | Sodium fluoroacetamide | |
32338002 | Systemic poison chemical warfare agent | |
32340007 | Piperonyl butoxide (substance) | |
32351007 | Thymus-dependent antigen | |
32364008 | Blood group antigen Tm | |
32370002 | Dyphylline (substance) | |
32378009 | ^147^Gadolinium | |
32396000 | Blood group antibody Lu5 | |
32403003 | Blood group antibody Pr>a< | |
32431007 | ^193m^Platinum (substance) | |
32436002 | Phentolamine mesylate | |
32437006 | Triphenyl phosphate | |
32445001 | Calcium glubionate | |
32457005 | Body fluid | |
32459008 | Hemoglobin Nigeria | |
32467000 | ^204m^Lead | |
32481003 | Blood group antibody Mackin | |
32498003 | Cortisone | |
32500002 | Shellfish toxin | |
32505007 | ^32^Phosphorus | |
32519007 | Activated charcoal (substance) | |
32533007 | Endrin | |
32536004 | Glutamate-ammonia-ligase adenylyltransferase | |
32601005 | alpha-Chloroacetophenone | |
32609007 | Antibody to hepatitis A virus (substance) | |
32616008 | Blood group antibody Zim | |
32627005 | Eburnetoxin | |
32633001 | Phosphatidate phosphatase | |
32657001 | D-Malate dehydrogenase (decarboxylating) | |
32663005 | Allyl alcohol | |
32668001 | Viral oncogene protein | |
32669009 | Tryptophan dimethylallyltransferase | |
32685004 | Lactose synthase | |
32699000 | Blood group antigen R>2<R>2<-202 | |
32707001 | Deoxyribonuclease I | |
32714004 | Magnesium dust | |
32717006 | Hemoglobin J-Lens | |
32725008 | Glycolipid 2-alpha-mannosyltransferase | |
32741009 | d-Xylulose | |
32757009 | Dibenzepin | |
32759007 | Agmatine deiminase | |
32770000 | Deoxyuridine phosphorylase | |
32784005 | N-Acetyl-beta-alanine deacetylase | |
32789000 | Ferritin | |
32800009 | Ethionamide | |
32824001 | Ergot alkaloid | |
32826004 | L-Aminoadipate-semialdehyde dehydrogenase | |
32830001 | trans-Acenaphthene-1,2-diol dehydrogenase | |
32832009 | ^110m^Silver | |
32836007 | Sodium acetrizoate (substance) | |
32842006 | Blood group antibody Rh42 | |
32852005 | beta-Melanocyte stimulating hormone | |
32860006 | Blood group antigen HLA-A9 | |
32863008 | Methylamine | |
32882004 | Coriander oil | |
32898006 | Fibrinogen San Francisco | |
32901007 | Prostaglandin PGA2 | |
32922001 | ^227^Actinium | |
32926003 | Iridium | |
32932008 | Extracorporeal blood | |
32943000 | Lymphocyte antigen CD24 | |
32946008 | Fallopian tube secretions | |
32948009 | Radical | |
32954005 | Iron carbonyl | |
32969006 | Ubiquitin | |
32974003 | Blood group antigen Banks | |
32990003 | Factor H | |
33008008 | Dust | |
33019006 | Pancreatic amylase | |
33029004 | Blood group antibody Bowyer | |
33034000 | Oncogene protein sis | |
33037007 | Blood group antigen Austin | |
33053005 | Blood group antigen Bruno | |
33055003 | Trichlorotrifluoroethane | |
33057006 | Macrophage antibody | |
33063002 | Blood group antigen Lu13 | |
33073000 | Gluconate 5-dehydrogenase | |
33082006 | Nitroethane | |
33119009 | Sugar-1-phosphate adenylyltransferase | |
33137005 | Calcium radioisotope | |
33161003 | alpha,alpha-Trehalose-phosphate synthase (GDP-forming) | |
33166008 | Intramitochondrial lipid | |
33174009 | ^175^Hafnium | |
33188008 | Blood group antigen Chr^a^ | |
33190009 | Hydroxylamine | |
33193006 | Physarum polycephalum ribonuclease | |
33201007 | Long-chain-fatty-acid-CoA ligase | |
33204004 | alpha Sitosterol | |
33206002 | Hemoglobin F-Beech Island | |
33210004 | Blood group antibody P^k^ | |
33218006 | Arsenic isotope | |
33238007 | Mesangial matrix | |
33239004 | Iridium radioisotope | |
33263007 | Trichophyton mentagrophytes keratinase | |
33271006 | Iodohippurate I^131^ sodium | |
33273009 | CTP synthase | |
33278000 | Insecticide | |
33280006 | Medicinal zinc peroxide | |
33291004 | trans-Octaprenyltranstransferase | |
33307008 | Sodium meralein | |
33309006 | HLA-DQw5 antigen | |
33324002 | Glutamine acyltransferase | |
33355008 | Blood group antibody Banks | |
33362004 | Cinoxate | |
33373006 | Cyclopentane | |
33395005 | Monomethyl mercury | |
33396006 | Nickel | |
33404002 | Endo-1,3(4)-beta-glucanase | |
33414006 | Isopropyl-n-phenylcarbamate | |
33417004 | Citrate(pro-3S)-lyase | |
33418009 | Hemoglobin Cocody | |
33435008 | Capillary active drug | |
33440000 | Ceftriaxone sodium | |
33443003 | Polynucleotide 5'-phosphatase | |
33447002 | Bephenium hydroxynaphthoate | |
33463005 | Liquid substance | |
33465003 | Acridine dye | |
33492009 | Heparitin sulfotransferase | |
33509005 | Blood group antibody Mur | |
33519004 | Animal structural gene | |
33524001 | 5-Methyldeoxycytidine-5'-phosphate kinase | |
33535006 | Renal hormone | |
33545008 | Procollagen glucosyltransferase | |
33550002 | Blood group antigen Kirkpatrick | |
33566000 | Phosphoglycerate dehydrogenase | |
33601001 | Glycosylated hemoglobin A | |
33604009 | Blood group antigen Burrett | |
33619005 | Plasminogen activator | |
33635003 | Serotonin | |
33638001 | Isotope | |
33642003 | Fibrinogen Sydney I | |
33643008 | Nucleoside deoxyribosyltransferase | |
33667000 | Mercumatilin | |
33680002 | Blood group antigen HLA-B12 | |
33691009 | Blood group antibody Co^b^ | |
33695000 | Camphor 1,2-monooxygenase | |
33709008 | Aryl-alcohol oxidase | |
33752008 | Motilin | |
33780005 | Dimethyl carbamate | |
33785000 | Iodinated I^125^ liothyronine | |
33791003 | ^199^Lead | |
33797004 | 3-Carboxy-2-hydroxyadipate dehydrogenase | |
33817009 | Infusorial earth | |
33825006 | Blood group antigen Jk^b^ | |
33837008 | Aluminum glycinate | |
33844004 | Alginate lyase | |
33865005 | Blood group antibody Baltzer | |
33922005 | Vitamin L | |
33936000 | Toad toxin | |
33963004 | Angiotensin III | |
33977001 | Microbial aspartic proteinases | |
33984009 | Dihydropteroate synthase | |
33987002 | Public blood group antibody | |
34003008 | Phospho-2-dehydro-3-deoxyoctonate aldolase | |
34007009 | Cholelitholytic agent | |
34011003 | Acetoarsenite | |
34027005 | Inorganic sulfide compound | |
34049004 | Blood group antibody Lu9 | |
34053002 | Diphenyl | |
34057001 | Acetyl-CoA hydrolase | |
34060008 | ^84^Rubidium | |
34070005 | Fibrinogen Nagoya | |
34074001 | Borate salt | |
34086003 | Antithrombin III | |
34101007 | Phycoerythrin | |
34113002 | Acrisorcin | |
34119003 | Delphinine | |
34120009 | Fibrinogen Amsterdam | |
34127007 | ^85^Krypton | |
34128002 | Chrome azurol S stain (substance) | |
34143000 | Immunoglobulin, GM>10< allotype | |
34156007 | Hemoglobin Savaria | |
34158008 | Bromine isotope | |
34161009 | Blood group antibody Ku | |
34174003 | ^224^Actinium | |
34180006 | Blood group antibody Min | |
34198005 | Folescutol | |
34204008 | Blood group antibody Warren | |
34208006 | Oxalate salt | |
34211007 | ^83^Strontium | |
34219009 | Terbufos | |
34221004 | Hemoglobin A>2< Yokoshima | |
34239008 | Castor oil | |
34261003 | Potassium oxalate | |
34274009 | Iodine pentafluoride | |
34302005 | Uracil dehydrogenase | |
34316000 | Blood group antibody Ge1 | |
34323004 | Coal | |
34329000 | Immunoglobulin, GM>14< allotype (substance) | |
34330005 | Calcium oxide | |
34332002 | Nitrophenol | |
34354000 | Octachloronaphthalene | |
34355004 | Inactivated complement enzyme | |
34358002 | ^228^Thorium | |
34370003 | Glucocerebroside | |
34388006 | Blood group antibody Fuerhart | |
34392004 | Hemoglobin F-Pordenone | |
34400001 | Blood group antibody Teremok | |
34410005 | Camphor 5-monooxygenase | |
34425005 | Amolanone | |
34428007 | Cyclopentadiene | |
34429004 | Pericardial fluid | |
34443009 | Hemoglobin F-Baskent | |
34453005 | HLA-B27 antigen | |
34465009 | HLA-DQw7 antigen | |
34471003 | ^121^Iodine | |
34505008 | Dental adhesive (substance) | |
34510007 | Clonal inhibitory factor | |
34548002 | Toxaphene | |
34549005 | Hemoglobin Palmerston North | |
34569000 | Blood group antibody Jn^a^ | |
34575009 | Guanidinodeoxy-scyllo-inositol-4-phosphatase (substance) | |
34582008 | Catecholamine | |
34641002 | Hydrazine | |
34654009 | Iodine solution | |
34657002 | Isopropamide iodide | |
34658007 | Met-enkephalin | |
34659004 | Lysine dehydrogenase | |
34690002 | 3-Hydroxybenzyl-alcohol dehydrogenase | |
34692005 | Hemoglobin Miyada | |
34700000 | Fast blue B salt stain (substance) | |
34722007 | Hemoglobin K-Woolwich | |
34737006 | C1 esterase inhibitor | |
34744002 | Plant asparagine | |
34745001 | Slow reacting substance-A of anaphylaxis | |
34750007 | Blood group antigen Panzar | |
34754003 | Myxobacter b-lytic proteinase | |
34757005 | Cystathionine beta-lyase | |
34763001 | Potassium hydroxide | |
34768005 | Cholestanetetraol 26-dehydrogenase | |
34771002 | Hemoglobin Quin-Hai | |
34788009 | Tartrate epimerase | |
34792002 | Coniine | |
34793007 | Octanol dehydrogenase | |
34800005 | beta-Nitroacrylate reductase | |
34820006 | Kynurenate 7,8-hydroxylase | |
34829007 | Complement component | |
34832005 | Blood group antibody I^s^ | |
34848006 | Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase | |
34856009 | UDPglucuronate 4-epimerase | |
34862004 | Aromatic hydrocarbon | |
34864003 | Benzoyl formate decarboxylase | |
34865002 | Chromium compound | |
34868000 | HLA-DQw3 antigen | |
34888001 | Aspartate-ammonia ligase (ADP-forming) | |
34895005 | Basic cupric sulfate | |
34900009 | Blood group antigen B | |
34904000 | Beryllium compound | |
34912008 | Blood group antibody Ramskin | |
34914009 | Serine-pyruvate aminotransferase | |
34915005 | Pyridostigmine bromide | |
34919004 | Potassium tartrate | |
34940003 | Phosphoserine aminotransferase | |
34946009 | Calcium sulfide | |
34953000 | Colocynth | |
34957004 | Acid | |
34968004 | Blood group antigen Lee | |
34970008 | Blood group antigen JAL | |
34978001 | Perchloromethyl mercaptan | |
34982004 | Uroporphyrinogen decarboxylase | |
34983009 | Epicillin | |
34999003 | tRNA (guanine-N^2^)-methyltransferase | |
35000003 | Hurain | |
35003001 | Maleate isomerase | |
35012004 | Blood group antibody HLA-A9 | |
35016001 | Argon radioisotope | |
35027004 | Pyrophosphoric acid | |
35040009 | Blood group antibody Rh29 | |
35059006 | Nicotinate-nucleotide pyrophosphorylase (carboxylating) | |
35060001 | Testicular hormone | |
35068008 | Blood group antibody C | |
35069000 | Neurotransmitter | |
35072007 | HLA-B16 antigen | |
35077001 | Nerve gas | |
35079003 | Volatile oil | |
35092000 | Lymphocyte antigen CD70 | |
35094004 | Tropaeolin O stain (substance) | |
35098001 | Imidazole | |
35118003 | Blood group antibody Fy5 | |
35124009 | Clupeotoxin | |
35131008 | Histidine decarboxylase | |
35133006 | Immunoglobulin IgG4, H chain | |
35135004 | Aglycone | |
35148000 | Protein-glutamine glutaminase | |
35150008 | Glucocorticoid hormone | |
35151007 | Ruthenium radioisotope | |
35181004 | Maleate hydratase | |
35190006 | Depilatory | |
35192003 | 2,3-Diaminopropionate oxalyltransferase | |
35196000 | Ethyl iodide | |
35206004 | ^242m^Americium | |
35213004 | Blood group antibody Wallin | |
35215006 | Scarlet fever streptococcus toxin | |
35231003 | Sphingosine acyltransferase | |
35233000 | Polyvinyl chloride | |
35234006 | Ethylene chlorobromide | |
35236008 | Thenyldiamine | |
35251004 | Chlordecone | |
35257000 | Entsulfon | |
35281007 | Acetophenazine | |
35292008 | Lipoxygenase | |
35293003 | 3-Carboxyethylcatechol 2,3-dioxygenase | |
35296006 | S-Alkylcysteine lyase | |
35297002 | Alkyl hydroxyethyl imidazolinium chloride | |
35310003 | Polyclonal antibody | |
35312006 | Gluconokinase | |
35318005 | Esmolol hydrochloride | |
35321007 | Fluorodeoxyglucose F^18^ | |
35331000 | Toxic substance | |
35337001 | ^68^Gallium | |
35342009 | 1-Acylglycerophosphocholine acyltransferase | |
35343004 | Cefonicid sodium | |
35344005 | Ribulose | |
35352008 | Fluorescent stain | |
35353003 | Zygacine | |
35367007 | Blood group antigen McC^e^ | |
35406002 | Clocortolone | |
35410004 | Blood group antibody Kp^c^ | |
35415009 | Homocysteine desulfhydrase | |
35416005 | Sex-linked gene | |
35422001 | Hemoglobin Bundury | |
35431001 | Adenosine | |
35432008 | ^87^Rubidium (substance) | |
35457003 | Narcotic drug receptor | |
35464001 | Trioxsalen (substance) | |
35466004 | Relaxin | |
35467008 | Pseudouridylate synthase | |
35473009 | Fibrinogen St. Louis | |
35477005 | Phenol methyltransferase | |
35479008 | Hemoglobin Mozhaisk | |
35488004 | Abnormal hemoglobin, alpha-chain variant | |
35499002 | 3-Hydroxypropionate dehydrogenase | |
35503008 | Cationic detergent | |
35527005 | Sanguinarine (substance) | |
35530003 | Hemoglobin J-Lome | |
35556005 | Sessile antibody | |
35573007 | Hemoglobin Las Palmas | |
35584000 | Sodium bitartrate | |
35589005 | Gadolinium isotope | |
35605007 | Anhydrous lanolin | |
35609001 | Azophloxin stain (substance) | |
35614002 | Blood group antigen Lu17 | |
35617009 | Isotomin | |
35628008 | Animal gene | |
35645003 | Blood group antigen French | |
35651008 | Cholest-5ene-3beta,7alpha-diol 3beta dehydrogenase | |
35659005 | Dinitrocresol | |
35663003 | Asphalt | |
35668007 | Endometrial secretions | |
35677000 | Heat stable bacterial toxin | |
35684008 | Tetranitromethane | |
35690007 | Hypochlorous acid | |
35724001 | Lacmoid stain (substance) | |
35733004 | Fat-soluble vitamin | |
35740003 | Stable isotope | |
35747000 | Osmium compound | |
35748005 | Wine | |
35760006 | Myeloid antibody | |
35765001 | Sincalide | |
35780007 | Isochorismatase | |
35798006 | Elastic fiber | |
35808006 | Ornithine cyclodeaminase | |
35815003 | Cadmium sulfide | |
35825008 | Cat scratch disease antigen | |
35841009 | Macrophage inhibitory factor | |
35864006 | Pyrathiazine (substance) | |
35866008 | Acyl-CoA desaturase | |
35867004 | Cytochrome-c>3< hydrogenase | |
35871001 | Oleandrin | |
35878007 | Thyroid-hormone aminotransferase | |
35883004 | Fluorine | |
35884005 | Iodine^131^ polyvinylpyrrolidone | |
35891008 | Liquid cyanamide | |
35895004 | Aspartyltransferase | |
35903003 | Potassium bromide | |
35906006 | Blood group antibody MPD | |
35922007 | Blood group antibody Black | |
35946000 | Pentolinium | |
35952004 | Blood group antibody Block | |
35954003 | Coagulation factor II variant | |
35960003 | Arachidonate-CoA ligase | |
35966009 | Ouabain | |
35976007 | Pancreatic peptide | |
35978008 | ^252^Californium | |
35997008 | Metacresylacetate | |
36005003 | Blood group antibody Tofts | |
36012007 | Nitrogen | |
36016005 | Blood group antibody Haase | |
36020009 | Factor IX antibody | |
36021008 | Cefadroxil monohydrate | |
36022001 | Fibrinogen Freiberg | |
36028002 | Aldehyde reductase | |
36058008 | Oil of myrtle | |
36062002 | Xanthurenic acid | |
36065000 | Oxine benzoate | |
36066004 | Coumarate reductase | |
36085001 | Pantoate-beta-alanine ligase | |
36093001 | Crotonic acid | |
36095008 | Glycine aminotransferase | |
36098005 | Malate synthase | |
36100005 | Blood group antigen Do^b^ | |
36130002 | dTDP-4-dehydrorhamnose 3,5-epimerase | |
36136008 | Penitrem-A | |
36137004 | Triacylglycerol-sterol acyltransferase | |
36156009 | Oxynervonic acid | |
36167005 | Fibrinogen Torino | |
36173006 | Tetraiodothyroacetic acid | |
36176003 | Thrombin | |
36178002 | Chromate salt | |
36197002 | Ecdysone 20-monooxygenase | |
36212002 | Myxobacter-a-lytic proteinase | |
36220000 | Chloric acid | |
36231008 | Proteinglutamine gamma-glutamyltransferase | |
36232001 | Mucinaminylserine mucinaminidase | |
36235004 | Pine needle oil | |
36238002 | Chlorobromomethane | |
36240007 | Alkyl sodium n-methyltaurate | |
36260004 | Blood group antibody Raison | |
36264008 | Lupinine | |
36270002 | Arylformamidase | |
36301000 | ^198m^Thallium | |
36312000 | Xylan 1,3-beta-xylosidase | |
36322006 | Acetylindoxyl oxidase | |
36326009 | Pteridine | |
36343007 | beta>2B< Glycoprotein | |
36345000 | 1-Phosphatidylinositol-4-phosphate kinase | |
36372008 | GDP-6-deoxy-D-talose dehydrogenase | |
36377002 | Isomaltulose synthase | |
36378007 | Lithium compound | |
36380001 | Oxyphencyclimine hydrochloride | |
36381002 | Hemoglobin P-Congo | |
36385006 | Synaptic receptor | |
36387003 | DNA-directed DNA polymerase | |
36393006 | Nonionic detergent | |
36396003 | Blood group antigen Van Buggenhout | |
36397007 | Muramic acid | |
36403001 | Blood group antibody ELO (substance) | |
36410007 | Lactone dye | |
36413009 | CDPribitol ribitolphosphotransferase | |
36418000 | Blood group antigen McC^b^ | |
36434002 | 1-Methyl histidine | |
36443006 | Hemoglobin E-Saskatoon | |
36445004 | Spectrin | |
36461002 | Oncogene protein TAL | |
36466007 | Furocoumarin | |
36494004 | Galactose dehydrogenase | |
36513006 | Boron carbide | |
36516003 | Pyrilamine maleate | |
36541005 | Mercuric iodide | |
36562006 | Haemolysin | |
36567000 | Prostaglandin-H>2< E-isomerase | |
36569002 | Isocyanide compound | |
36572009 | Sudan black B stain | |
36613003 | Blood group antigen Pr>1h< | |
36632009 | Mannokinase | |
36636007 | Thiamine-triphosphatase (substance) | |
36641004 | Potassium chloride K^42^ | |
36651003 | Bismuth salt | |
36652005 | Blood group antigen H>T< | |
36661005 | Tyrothricin | |
36663008 | ^121^Tellurium | |
36671007 | Nitrogen pentoxide | |
36677006 | Phenylalanine decarboxylase | |
36687005 | Uronolactonase | |
36690004 | Nitrate reductase (NADPH) | |
36694008 | Hemoglobin Bologna | |
36704006 | 5' Acylphosphoadenosine hydrolase | |
36707004 | Polydeoxyribonucleotide synthase (NAD^+^) | |
36712003 | Factor XII antibody | |
36713008 | Blood group antibody McC^d^ | |
36726007 | Nicotinate methyltransferase | |
36744004 | Blood group antigen E | |
36747006 | Psychosine sulfotransferase | |
36757007 | Blood group antigen Raison | |
36759005 | HLA-Bw6 antigen | |
36766006 | Succinyldiaminopimelate desuccinylase | |
36774007 | Cadmium compound | |
36801006 | Tagatose kinase | |
36804003 | Blood group antigen Tasich | |
36806001 | Bhilawanol oil | |
36816009 | Glucose-1-phosphate | |
36824004 | Dauricine | |
36842009 | HLA-Dw16 antigen | |
36848008 | Citrate dehydratase | |
36853003 | Blood group antigen Vienna | |
36856006 | Flavanone 3-dioxygenase | |
36863006 | 2-Dehydro-3-deoxy-D-gluconate 5-dehydrogenase (NAD(P)^+^) | |
36864000 | Paint | |
36872003 | Tridihexethyl | |
36879007 | Water soluble eosin stain (substance) | |
36887008 | Mineralocorticoid hormone | |
36888003 | Exodeoxyribonuclease VII | |
36900006 | Iodohippurate I^125^ sodium | |
36907009 | Blood group antibody Kennedy | |
36933001 | Antibody to antigen in Rh blood group system (substance) | |
36934007 | Alkylglycerol kinase | |
36953002 | Fibrinogen Nancy | |
36993004 | Fucokinase | |
36998008 | Glycogen | |
37000002 | ^35^Sulfur | |
37004006 | Immunoglobulin, Fc' fragment | |
37006008 | Cyclothiazide | |
37010006 | Tetraphylline | |
37013008 | Dipivefrin hydrochloride (substance) | |
37015001 | UDP-N-acetyl muramoylalanine-D-glutamate ligase | |
37023004 | Deoxyribodipyrimidine photo-lyase | |
37052001 | Tellurium hexafluoride | |
37067002 | Blood group antibody Shier | |
37077000 | ^122^Xenon | |
37078005 | Nitromersol | |
37080004 | Phoabol | |
37086005 | Oil of pennyroyal-American | |
37094003 | Chlorotoluene | |
37100000 | Blood group antigen Bradford | |
37112001 | Ceramide | |
37123002 | Copper dust and mist | |
37148004 | Hemoglobin F-Malaysia | |
37150007 | Streptomycin 3''-adenylyltransferase | |
37162006 | Polypeptide receptor | |
37177003 | Deoxyribonucleic acid, single stranded | |
37196004 | L-Glutamate oxidase | |
37202001 | Plant fiber | |
37225000 | ^52^Manganese | |
37237003 | Vitamin E | |
37241004 | Corticosterone 18-monooxygenase | |
37243001 | Hemoglobin A>2< Coburg | |
37262003 | Phenyl p-aminosalicylate | |
37264002 | Glucomannan 4-beta-mannosyltransferase | |
37276002 | Polypeptide hormone | |
37282004 | Blood group antibody B 7358 | |
37287005 | HLA-A1 antigen | |
37300006 | Blood group antibody h | |
37315007 | n-Acetyl mannosamine | |
37318009 | Ethylene chlorohydrin | |
37329008 | Hemoglobin J-Taichung | |
37334007 | Thyroxine deiodinase | |
37346006 | Adenylosuccinate synthase (substance) | |
37352007 | Fungus antigenic product | |
37357001 | L-Arabinonolactonase | |
37365003 | Fibrinogen Rouen | |
37375000 | L-Arabinitol dehydrogenase (ribulose-forming) | |
37379006 | ^191m^Osmium | |
37411004 | Tissue plasminogen activator | |
37433002 | Polycarbophil | |
37437001 | Iodinated I^125^ sealed source | |
37451001 | Laudanum | |
37462001 | Oncogene protein c-fes | |
37484001 | Dopamine receptor | |
37489006 | Fructokinase | |
37513004 | Hemoglobin Lepore-Baltimore | |
37526000 | Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6N-acetylglucosaminyltransferase | |
37527009 | Sufentanil citrate | |
37536008 | Dehydrobufotenine | |
37566001 | Dinitrochlorobenzene | |
37569008 | Galactose-6-sulfurylase | |
37575004 | Carmoisine A stain (substance) | |
37583005 | Blood group antigen Buckalew | |
37588001 | Immunoglobulin polymer | |
37595005 | Suspension | |
37620000 | Lipopolysaccharide glucosyltransferase I | |
37624009 | Cyclomaltodextrin glucanotransferase | |
37648000 | Clindamycin phosphate | |
37654004 | Blood group antigen K19 | |
37656002 | Methimazole (substance) | |
37662007 | 5,10-Methylenetetrahydrofolate reductase (FADH>2<) | |
37663002 | Venom | |
37681004 | S-Formylglutathione hydrolase | |
37683001 | Tanghin extract | |
37691005 | Hetacillin | |
37704004 | Perichromatin granule | |
37713002 | Blood group antigen Dautriche | |
37716005 | White ointment | |
37751002 | Beta 2 blocking agent | |
37756007 | Gastric inhibitory polypeptide | |
37758008 | Drug-induced coagulation inhibitor | |
37765000 | Diethylpropion hydrochloride (substance) | |
37784002 | Striatoxin | |
37838004 | Hemoglobin F-Minoo | |
37841008 | Menstrual fluid | |
37850005 | 2-Acetolactate mutase | |
37852002 | Indirect reacting bilirubin | |
37861002 | Blood group antigen Js^b^ | |
37863004 | Pyruvate,orthophosphate dikinase | |
37881001 | Dolichyl-diphosphooligosaccharide-protein glycotransferase | |
37889004 | Gonadoliberin receptor | |
37892000 | Exodeoxyribonuclease (Phage SP>3<-induced) | |
37902007 | Blood group antigen A.M. | |
37905009 | Copper 3-phenyl salicylate | |
37912000 | Heterotricyclic dye | |
37915003 | Protein-tyrosine-phosphatase | |
37927000 | Cystine | |
37930007 | Neon isotope | |
37932004 | LDL receptor | |
37938000 | Carbonic acid | |
37947008 | Colloidal gold Au^198^ | |
37950006 | sn-Glycerol-3-phosphate 1-galactosyltransferase | |
37951005 | Fibrinogen Paris I | |
37957009 | Pentoxyverine | |
37959007 | Prealbumin | |
37969001 | ^119^Antimony | |
37970000 | Phosphogluconate dehydratase | |
37978007 | Nitrofurantoin sodium | |
37984005 | Blood group antibody Don | |
37986007 | Tremorgen | |
37994000 | Fibrinogen Hanover | |
38000004 | Lymph | |
38019009 | Plastic object | |
38044001 | Paromomycin | |
38065007 | Hemoglobin G-Copenhagen | |
38082009 | Hemoglobin | |
38088008 | 2-Dehydro-3-deoxygluconokinase | |
38100002 | Isopropyl acetone | |
38120001 | Progesterone 5alpha-reductase | |
38122009 | Anisindione | |
38123004 | Trichlorofluoromethane (substance) | |
38132002 | (+)-Neomenthol dehydrogenase | |
38148001 | Ribosylhomocysteinase | |
38154000 | ^239^Americium | |
38156003 | Hemoglobin Tottori | |
38167002 | Aquacobalamin reductase | |
38174007 | ^237^Americium | |
38182007 | Galactose | |
38207009 | Hemoglobin Regina | |
38218009 | Hyaluronic acid | |
38227005 | Blood group antigen He | |
38229008 | UDP-N-acetylgalactosamine-4-sulfate sulfotransferase | |
38245005 | Thymic hormone | |
38262000 | Active C5b678 | |
38263005 | N-ethylmercuri-p-toluene sulphonanilide | |
38269009 | Lymphocyte antigen CD1c | |
38271009 | Saffron stain (substance) | |
38289005 | ^200^Lead | |
38319003 | Mercuric sulfide | |
38327007 | Plutonium | |
38344006 | Sodium iodomethamate | |
38347004 | 2,5-Diaminovalerate aminotransferase | |
38348009 | Body water | |
38367008 | Blood group antigen Hoalzel | |
38373009 | Glutathione-CoA-glutathione transhydrogenase | |
38379008 | Alcohol sulfotransferase | |
38399002 | ^135^Xenon | |
38401008 | Crocidolite | |
38408002 | Paregoric | |
38410000 | Acyl-CoA dehydrogenase | |
38415005 | ^44^Titanium | |
38424001 | Strontium chloride Sr^87^ | |
38445008 | Blood group antigen Rils | |
38446009 | Diflorasone diacetate | |
38457004 | Kerasin | |
38476002 | Interleukin | |
38482004 | Apocrine sweat | |
38496005 | Phenyl dimethyl urea | |
38499003 | Blood group antibody Naz | |
38519002 | Blood group antigen Donaldson | |
38543004 | Lissamine green B stain (substance) | |
38553003 | Blood group antigen Schuppenhauer | |
38554009 | HLA-B5 antigen | |
38558007 | Blood group antibody Ghawiler | |
38588003 | bis-(Dimethylamino)-phosphorous anhydride | |
38595007 | Trimethyl phosphite | |
38612004 | Chitin synthase | |
38622005 | Aluminum oxide ore | |
38623000 | ^69^Zinc | |
38647007 | Ribonucleoside-diphosphate reductase | |
38648002 | Mephentermine | |
38649005 | Dichloroethane | |
38652002 | Acylglycerol lipase | |
38684009 | Alclometasone dipropionate | |
38686006 | Colistimethate sodium | |
38705000 | Acetaldehyde | |
38707008 | Celestine blue B stain (substance) | |
38710001 | Procollagen N-proteinase | |
38714005 | Somatomedin A | |
38726000 | Hemoglobin G-Taiwan Ami | |
38730002 | p-Methylaminophenol hydrochloride | |
38733000 | ^207^Bismuth | |
38744008 | Progesterone binding protein | |
38747001 | Penicillium notatum extracellular proteinase | |
38758005 | ^229^Actinium | |
38765002 | Hemoglobin Nottingham | |
38771008 | HLA-DPw6 antigen | |
38778002 | Deacetyl-[citrate-(pro-3S)-lyase] acetyltransferase | |
38779005 | Blood group antibody Ht^a^ | |
38794009 | Molybdenum isotope | |
38808007 | Glutathione transferase | |
38810009 | Hemoglobin Olympia | |
38833005 | Vinyl chloride | |
38834004 | Glutamate 1-kinase | |
38839009 | Glycerol teichoic acid | |
38854003 | Adenosinetriphosphatase | |
38874005 | Blood group antigen V.G. | |
38899006 | Hemoglobin North Shore | |
38902009 | Solochrome dark blue stain (substance) | |
38908008 | Blood group antigen Lu6 | |
38909000 | Glutamic acid hydrochloride | |
38914001 | Thymol iodide | |
38922008 | Urinary tract fluid | |
38932001 | Hemoglobin J-Nayanza | |
38937007 | Water in oil agent | |
38947005 | Pyrithiamin deaminase | |
38957006 | Hemoglobin Kofu | |
38990006 | Hydrogen-sulfide acetyltransferase | |
39004000 | Hemoglobin Ypsilanti | |
39006003 | 3alpha,7alpha,12alpha-Trihydroxycholestan-26-al 26-dehydrogenase | |
39012008 | Thiram | |
39013003 | Galactocerebroside | |
39022002 | Deoxycytidine diphosphate (substance) | |
39024001 | Blood group antibody Yt^a^ | |
39044007 | Aluminum alkyl | |
39049002 | Nasopharyngeal mucus | |
39053000 | Complement factor D | |
39081006 | Iron ore | |
39082004 | Hepatitis B core antigen | |
39102003 | Food particle | |
39110002 | Protein-arginine deiminase | |
39118009 | High incidence antibody | |
39123009 | Cephaloglycin (substance) | |
39135008 | Phosphoribosylaminoimidazole-succinocarboxamide synthase | |
39138005 | Blood group antibody Milano | |
39152007 | Erythromycin stearate | |
39162000 | Bronsted-Lowry acid | |
39173007 | Estradiol 6beta-monooxygenase | |
39192009 | ^235m^Uranium | |
39200002 | Iodinated I^131^ albumin | |
39203000 | Conanine | |
39212003 | Acylpyruvate hydrolase | |
39223004 | Stipitatonate decarboxylase | |
39240008 | Hemoglobin Sherwood Forest | |
39241007 | HLA-Dw1 antigen | |
39254000 | S-Succinylglutathione hydrolase | |
39263003 | Amisometradine | |
39265005 | Free radical | |
39276009 | Aldehyde dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) | |
39290007 | Barium | |
39292004 | Iodine trichloride | |
39294003 | Iron carbohydrate complex | |
39313006 | Phosphonoacetaldehyde hydrolase | |
39318002 | Hemoglobin Yokohama | |
39327001 | Blood group antibody Craw | |
39331007 | Hemoglobin Djelfa | |
39337006 | Blood group antibody Es^a^ | |
39339009 | Oil of linaloe | |
39340006 | Cycloate | |
39360003 | Starch | |
39368005 | Arsenate compound | |
39378008 | Hydrastinine | |
39383000 | Dihydrolipoamide dehydrogenase | |
39385007 | Riboflavin kinase | |
39411007 | Glycocyaminase | |
39428005 | Deuteroporphyrin | |
39442002 | Antibody binding site | |
39467004 | ^124^Antimony | |
39469001 | beta-Phenylisopropylamine | |
39477002 | Feces | |
39494000 | Indole-3-acetaldehyde reductase (NADPH) | |
39505006 | Hemoglobin Chongqing | |
39514001 | Decamethonium | |
39515000 | Blood group antigen Ht^a^ | |
39522008 | ^253^Californium | |
39525005 | Tumor necrosis factor alpha | |
39529004 | Chromous sulfate | |
39546001 | Manganese isotope | |
39552000 | Scabicide | |
39554004 | Propane | |
39560004 | Hemoglobin Bicetre | |
39576008 | Galactose dehydrogenase (NADP^+^) | |
39580003 | Benzoate 4-monooxygenase | |
39581004 | Trimethyl benzene | |
39588005 | Lipstick | |
39605000 | Hemoglobin Niteroi | |
39635007 | ^195m^Platinum | |
39650003 | HLA-Bw54 antigen | |
39665002 | Blood group antigen Pr>2< | |
39669008 | ^202^Bismuth | |
39678002 | Blood group antigen Kominarek | |
39694009 | Kynurenic acid | |
39701004 | Metabolite AND/OR marker of carcinogen | |
39705008 | ^238^Americium (substance) | |
39736000 | Sodium sulfide | |
39757008 | Cinnamoyl-CoA reductase | |
39765006 | Uroporphyrinogen-III synthase | |
39769000 | Inert gas | |
39777001 | Sudan III stain (substance) | |
39789004 | Snuff tobacco | |
39805003 | Hemoglobin Aztec | |
39806002 | Oil of niaouli | |
39808001 | Dibucaine hydrochloride (substance) | |
39815009 | Clorazepate | |
39817001 | Prothrombin fragment 1.2 | |
39830000 | N-Sulfoglucosamine-6-sulfatase | |
39840002 | Blood group antibody Di^a^ | |
39862002 | Imino acid | |
39867008 | Hemoglobin F-Xinjiang | |
39909008 | dGTPase | |
39932007 | ^117^Cadmium | |
39933002 | Pancreatic hormone | |
39953003 | Tobacco | |
39954009 | Cellobiose phosphorylase | |
39962001 | Coagulation factor II Barcelona variant | |
39972003 | Sodium | |
39973008 | C peptide | |
39979007 | T-2 fungal toxin | |
39985000 | Beryllium oxide | |
39988003 | Skin reactive factor | |
39989006 | Serotonin receptor | |
39999001 | Blood group antigen C^G^ | |
40012004 | Methionine adenosyltransferase | |
40018000 | Blood group antibody Oliver | |
40030006 | Blood group antigen M^c^ | |
40034002 | Hemoglobin Minneapolis-Laos | |
40036000 | Sulfamethazine (substance) | |
40044000 | HLA-DRw11 antigen | |
40048002 | Blood group antigen Englund | |
40057008 | Ozone | |
40065006 | HLA-Bw73 antigen | |
40076005 | Erie garnet stain (substance) | |
40078006 | Quercitrinase | |
40082008 | Prostaglandin-A>1< delta-isomerase | |
40112002 | Ichthyotoxin (substance) | |
40115000 | Aluminum hydroxychloride | |
40140007 | Blood group antibody Kirkpatrick | |
40147005 | Diphenylmethane dye | |
40154004 | Blood group antibody Singleton | |
40164008 | Glycerol-3-phosphate cytidylyltransferase | |
40179001 | Tremolite | |
40185008 | Serum amyloid A protein | |
40200005 | Cytochrome-c peroxidase | |
40205000 | Hemoglobin Cheverly | |
40217003 | Glucan 1,4-alpha-maltohexaosidase | |
40235007 | Hydroxymalonate dehydrogenase | |
40239001 | Esophageal mucus | |
40256009 | Indole-3-acetaldehyde oxidase | |
40263009 | ^231^Uranium | |
40270009 | Blood group antibody Truax | |
40327006 | Hemoglobin Petah Tikva | |
40342009 | Thiamylal sodium | |
40346007 | ^207^Thallium | |
40351001 | Isocyanate compound | |
40352008 | Ryanodine | |
40356006 | beta Fetoprotein | |
40364000 | Blood group antigen A>1< Le^b^ | |
40404004 | Papaverine hydrochloride | |
40414008 | Hemoglobin Peterborough | |
40424000 | dUTP pyrophosphatase | |
40426003 | Sucrose phosphate synthase | |
40431001 | Tears | |
40438007 | Antimony sodium tartrate | |
40447004 | Blood group antibody Hy | |
40456007 | Blood group antigen IB | |
40469006 | Parathion | |
40471006 | Magnesium stearate | |
40479008 | Fructose-1-phosphate | |
40534007 | Aflatrem | |
40545005 | Amphotericin A | |
40558006 | Blood group antigen VA | |
40565003 | ^11^Carbon | |
40569009 | Aminomethyltransferase | |
40581008 | Alanylphosphatidylglycerol synthase | |
40584000 | Uranium | |
40588002 | Hexadecanal dehydrogenase (acylating) | |
40601003 | Chlordiazepoxide hydrochloride | |
40621002 | Blood group antigen Vr | |
40647006 | Hexane | |
40660000 | Organic silicon compound | |
40699008 | Barium fluorosilicate | |
40706003 | Blood group antigen Toms | |
40710000 | Iodopyracet (substance) | |
40718007 | Fast red B salt stain (substance) | |
40728003 | ^201m^Lead | |
40730001 | Hemoglobin Kariya | |
40734005 | Rhus toxin | |
40744007 | Alanine carboxypeptidase | |
40755007 | Hemoglobin J-Kurosh | |
40756008 | Membrane lipid (substance) | |
40763008 | Oil of petitgrain | |
40776002 | Strictosidine beta-glucosidase | |
40783009 | Sec-hexyl acetate | |
40789008 | Adrenocorticotropic hormone | |
40808006 | Oil red O stain | |
40813005 | Cardamom oil | |
40817006 | Rubidium compound (substance) | |
40830007 | Abnormal hemoglobin, beta-chain variant | |
40840005 | Glycerol-1-phosphatase | |
40848003 | Malate dehydrogenase (NADP^+^) | |
40856000 | Leukotriene A | |
40879004 | NADH dehydrogenase (ubiquinon) | |
40922007 | Nylon 46 | |
40924008 | Water-soluble vitamin | |
40937006 | ^124^Iodine | |
40940006 | Human chorionic gonadotropin, beta subunit | |
40942003 | Taurine dehydrogenase | |
40955002 | Hemoglobin Wien | |
40968005 | Silver nitrate ophthalmic preparation | |
40971002 | Adenylyl-[glutamate-ammonia ligase] hydrolase | |
40991009 | alpha-L-Arabinofuranosidase | |
40992002 | Lymphocyte antigen | |
40996004 | Glutamin-(asparagin-)ase | |
41043002 | Chemical solution | |
41044008 | Blood group antigen Woit | |
41062004 | Methoxsalen | |
41067005 | Oxiconazole nitrate | |
41091001 | Mebutamate | |
41093003 | Blood group antibody E^w^ | |
41094009 | Cyanidin-3-rhamnosylglucoside O^5^-glucosyltransferase | |
41096006 | Blood group antibody Y. Bern | |
41097002 | Hemoglobin F-Kingston | |
41105002 | Halogenated hydrocarbon | |
41126002 | Glycerate dehydrogenase | |
41143004 | Ursodeoxycholic acid | |
41153003 | Amyl nitrate | |
41175001 | Organic compound | |
41198009 | ^117^Antimony | |
41199001 | Melatonin | |
41220002 | Dugaldin | |
41233008 | Chlorophenyl dimethyl urea trichloroacetate | |
41247007 | Dephospho-[reductase kinase] kinase | |
41255000 | Dihydrolipoamide acetyltransferase | |
41261002 | Quinethazone | |
41268008 | Pyruvate,water dikinase | |
41282008 | Hemoglobin Boras | |
41285005 | Blood group antigen Jones | |
41301002 | H-2 locus | |
41311009 | Hemoglobin F-Auckland | |
41317008 | Asterosaponin | |
41318003 | Blood group antibody Js^b^ | |
41322008 | Hemoglobin Shenyang | |
41332001 | Oleandomycin | |
41343009 | ^222^Radium | |
41372005 | Anthranilate phosphoribosyltransferase | |
41383001 | Hemoglobin York | |
41389002 | Ethyl hexanediol | |
41395001 | Tamoxifen citrate | |
41401001 | 1,2-alpha-L-Fucosidase | |
41403003 | Blood group antigen Mt^a^ | |
41410009 | Intrinsic factor | |
41412001 | Tannic acid | |
41414000 | Methylmalonyl-CoA decarboxylase | |
41420004 | Content of exocytic membrane invagination | |
41433005 | Aluminum compound | |
41441005 | Erythrose | |
41459008 | Sodium bisulfite | |
41464007 | ^90^Molybdenum | |
41465008 | Glutamate decarboxylase (substance) | |
41469002 | Oncogene protein | |
41485007 | Leuc-enkephalin | |
41492002 | Satratoxins | |
41499006 | 3-Hydroxybenzoate 2-monooxygenase | |
41503000 | Zinc compound | |
41504006 | Lauric acid | |
41508009 | Cerumen | |
41509001 | Potassium warfarin | |
41528008 | 2-Hydroxyacylsphingosine 1-beta-galactosyltransferase | |
41540008 | Ribonucleoside-triphosphate reductase | |
41548001 | Protochlorophyllide reductase | |
41551008 | Right lower lobe mucus | |
41558002 | Immunoglobulin, GM>8< allotype | |
41562008 | Blood group antibody Tm | |
41568007 | Arabinonate dehydratase | |
41573001 | Linseed oil | |
41576009 | Blood group antigen Rh26 | |
41577000 | Tellurium | |
41579002 | beta-N-acetylhexosaminidase | |
41583002 | ^32^Silicon | |
41592004 | ^82^Strontium | |
41598000 | Estrogen | |
41606000 | Tetrahydrofuran | |
41612005 | 3-Chloro-D-alanine dehydrochlorinase | |
41613000 | Adenylosuccinate lyase | |
41623009 | Syntenic gene | |
41641001 | ^196^Thallium | |
41644009 | Blood group antigen Baltzer | |
41646006 | Corticotropin binding globulin | |
41649004 | Calmodulin | |
41667006 | Blood group antigen Begovitch | |
41691002 | ^210^Radon | |
41692009 | Hemoglobin Ube-4 | |
41711007 | Thymidine phosphorylase | |
41718001 | N-(5'-Phospho-D-ribosylformimino)-5-amino-1-(5''-phosphoribosyl)-4-imidazole-carboxamide isomerase | |
41722006 | Cefotaxime sodium | |
41748003 | Organic tin compound | |
41750006 | Brazilin stain (substance) | |
41758004 | ^169^Ytterbium | |
41759007 | Trimetaphosphatase | |
41761003 | Blood group antibody Stewart | |
41771001 | Blood group antigen Gallner | |
41773003 | Formiminoglutamate deiminase | |
41793006 | Calcium cyanamide | |
41805004 | Lipoprotein lipase | |
41810000 | beta Aminoisobutyric acid | |
41830001 | Aromatic-L-amino-acid decarboxylase | |
41834005 | Olive oil | |
41856008 | Dioxotetrahydropyrimidine phosphoribosyltransferase | |
41858009 | Blood group antigen Wetz | |
41861005 | 2-Hydroxy-3-oxopropionate reductase | |
41875003 | Glutathione-cystine transhydrogenase | |
41886001 | Blood group antigen Kenneddy | |
41896005 | Hemoglobin Toyama | |
41903005 | Hexapradol | |
41917001 | Hemoglobin Potomac | |
41924000 | NAD^+^ kinase | |
41926003 | Cholesterol 7alpha-monooxygenase | |
41930000 | Blood group antigen McDermott | |
41937002 | Hemoglobin Gower-1 | |
41940002 | Mannosyl-oligosaccharide glucosidase | |
41945007 | Alkylpiperidine derivative of phenothiazine | |
41956007 | Propylene imide | |
41967008 | Silver | |
41978000 | Blood group antibody V.G. | |
41989007 | Lolitrem | |
41990003 | Mannosyl-glycoprotein endo-beta-N-acetyl-glucosaminidase | |
41994007 | Animal alkaloid | |
41999002 | Blood group antibody Joslin | |
42001007 | Polychlorinated biphenyl | |
42013002 | Banisterine | |
42027007 | Alcohol radical | |
42033003 | Sterculia gum | |
42038007 | HLA-Bw62 antigen | |
42048009 | Blood group antibody Terry | |
42053004 | Plant teratogen | |
42056007 | Placental hormone | |
42076001 | Crystallin | |
42078000 | Blood group antigen Kursteiner | |
42092006 | Blood group antigen Allchurch | |
42104001 | L-Fuculokinase | |
42107008 | HLA-Cw antigen | |
42121005 | Hemopexin | |
42122003 | Blood group antibody M^v^ | |
42124002 | Glutamate-tRNA ligase | |
42130002 | Prephenate dehydratase | |
42133000 | Sulfur pentafluoride | |
42144008 | Bisulfate salt | |
42145009 | Fibrinogen Copenhagen | |
42146005 | Iodide salt | |
42151004 | ^73^Arsenic | |
42159002 | Mushroom poison | |
42163009 | Methylphenidate hydrochloride | |
42165002 | Immunoglobulin gene | |
42166001 | Blood group antigen Kx | |
42172001 | Uca pugilator collagenolytic proteinase | |
42180008 | Vitamin D>2<, phosphate ester | |
42184004 | Hemoglobin G-Norfolk | |
42193003 | Stannous fluoride | |
42204005 | Cyclic guanosine monophosphate | |
42210005 | Leukocyte-membrane neutral endopeptidase | |
42212002 | Sodium pentachlorophenate | |
42230009 | Bentonite | |
42231008 | Bilirubin diglucuronide | |
42240007 | Duplicating ink | |
42242004 | Aminomuconate-semialdehyde dehydrogenase | |
42244003 | Debromoaplysiatoxin | |
42248000 | Methyl orange stain (substance) | |
42255003 | Blood group antibody Zaw | |
42257006 | ^183^Iridium | |
42281004 | Cellobiose dehydrogenase (acceptor) | |
42303002 | Phytolaccigenin | |
42319009 | Lipotropin | |
42325008 | Lacrimator gas | |
42328005 | o-Chlorobenzylidenemalononitrile | |
42333009 | Blood group antibody LW^b^ | |
42342002 | Aspartate-semialdehyde dehydrogenase | |
42363000 | Ethyl mercury chloride | |
42370000 | Mannitol dehydrogenase (cytochrome) | |
42371001 | Heterocytotropic antibody | |
42382009 | 4-Ipomeanol | |
42416001 | Lanolin | |
42417005 | Carbon^14^ triolein | |
42428009 | Hemoglobin N-Baltimore | |
42435001 | Hemoglobin Saint Jacques | |
42449005 | Antimony | |
42464005 | p-Phenylenediamine | |
42465006 | 3-Dehydroquinate dehydratase | |
42473002 | Blood group antibody Cross | |
42489004 | Cysteine aminotransferase | |
42490008 | Blood group antibody Tn (substance) | |
42503003 | AMP thymidine kinase | |
42507002 | Calmodulin-lysine methyltransferase | |
42520004 | Bulrush millet ergot alkaloid | |
42549007 | alpha 2 macroglobulin (substance) | |
42558000 | Californium radioisotope | |
42564007 | Bensulfide | |
42566009 | Toluidine | |
42580002 | Hemoglobin Etobicoke | |
42589001 | ^176^Tantalum | |
42605004 | Aldosterone | |
42607007 | Carbamoyl-phosphate synthase (ammonia) | |
42634005 | GTP cyclohydrolase I | |
42657004 | Cyclamate sulfohydrolase | |
42664002 | HLA-Dw17 antigen | |
42671007 | Rye ergot alkaloid | |
42674004 | Sucrose synthase | |
42692007 | Naproxen sodium | |
42702005 | ^237^Plutonium | |
42710006 | Coagulation factor XI variant type II | |
42722009 | Hydrogenase | |
42728008 | Indium^113^ pentetate | |
42730005 | Periodate salt | |
42732002 | Lymphocyte antigen CD1a | |
42735000 | Carbamoyl-phosphate synthase (glutamine-hydrolysing) | |
42753006 | Dextrin dextranase | |
42757007 | Hydrofluoric acid | |
42761001 | Pyrocatechol | |
42768007 | Blood group antigen En^a^TS | |
42784008 | Blood group antibody Wd^a^ | |
42789003 | ^95^Technetium (substance) | |
42799008 | Immunoglobulin idiotype | |
42804003 | Lymphocyte antigen CD13 | |
42830004 | Blood group antibody Wilson (substance) | |
42831000 | ^87m^Yttrium | |
42832007 | 2-Dehydro-3-deoxyglucarate aldolase | |
42841002 | Zinc oxide | |
42848008 | Blood group antigen MPD | |
42850000 | Fluorinated hydrocarbon | |
42860009 | Hemoglobin Mexico | |
42877009 | Anhydrous borate | |
42884001 | Neuraminic acid | |
42885000 | dTDP-6-deoxy-L-talose dehydrogenase | |
42888003 | Blood group antigen Cipriano | |
42891003 | Lymphocyte antigen CD56 | |
42897004 | Blood group antigen Donati | |
42907009 | Carboxylic acid | |
42918009 | Arginine 2-monooxygenase | |
42922004 | Methemalbumin | |
42926001 | Blood group antigen Seymour | |
42934007 | Hydroxy phenylpyruvic acid, ortho | |
42938005 | alpha-Adrenergic receptor | |
42951000 | Methomyl | |
42958006 | 5-methyl-3-heptanone | |
43004008 | Glucagon-like peptide 1 | |
43013005 | Hemoglobin Fannin-Lubbock | |
43024007 | Iron salt | |
43032004 | Anabasine | |
43041009 | Acetate-CoA ligase (ADP-forming) | |
43042002 | Platelet antibody HPA-5b | |
43048003 | Amphomycin (substance) | |
43076006 | Blood group antibody Evans | |
43095004 | Complement receptor CRI | |
43097007 | Pantothenoylcysteine decarboxylase | |
43106008 | Pyronine G stain (substance) | |
43117009 | Imidazoleglycerol-phosphate dehydratase | |
43136004 | Strontium | |
43161001 | Fluoroacetate salt | |
43169004 | N-Methyl-2-oxoglutaramate hydrolase | |
43171004 | Ovarian hormone | |
43181000 | Blood group antibody Cl^a^ (substance) | |
43201005 | Amine | |
43211003 | n-Acetyl neuraminic acid | |
43212005 | Concanavalin A | |
43215007 | Glucan 1,3-alpha-glucosidase | |
43230003 | Rubber | |
43237000 | Succinyldiaminopimelate aminotransferase | |
43239002 | ^75^Selenium | |
43241001 | Blood group antibody Pelletier | |
43268001 | Copper compound | |
43278003 | Platelet activating factor | |
43289005 | Dihydrofolic acid | |
43290001 | Sedoheptulose-bisphosphatase | |
43305003 | Protein-tyrosine kinase | |
43314008 | Extracellular material | |
43328002 | Oxalate-CoA ligase | |
43332008 | Coagulation factor IX Lake Elsinor variant | |
43342005 | Capric acid | |
43347004 | Blood group antigen A>1< Le^d^ | |
43356007 | Betaine | |
43357003 | Hemoglobin Baylor | |
43360005 | Aconitine | |
43365000 | L-Threonine 3-dehydrogenase | |
43374003 | [Pyruvate dehydrogenase (lipoamide)] kinase | |
43397000 | Idiotope | |
43417002 | Blood group antibody IH | |
43419004 | Bitter almond oil | |
43425000 | Blood group antigen Dahl | |
43431002 | Maltose | |
43436007 | Chromic salt | |
43440003 | Melanocyte stimulating hormone releasing factor | |
43461005 | Bryonal | |
43462003 | Para-aminohippuric acid | |
43494008 | Acetoacetyl-CoA hydrolase | |
43506001 | Tephrosin | |
43514007 | Disodium ethylene bis-(dithiocarbonate) | |
43538006 | Non radiopaque medium | |
43541002 | Pentapiperide | |
43549000 | Solochrome azurine (BS) stain (substance) | |
43564000 | Hematite | |
43576000 | Blood group antibody N^A^ | |
43585000 | Sulfonamide diuretic | |
43588003 | Immunoglobulin, GM>9< allotype | |
43592005 | Cactinomycin | |
43596008 | HLA-Bw64 antigen | |
43597004 | Chymodenin | |
43605008 | Hemoglobin C-Makassar | |
43613009 | Phosphorous pentachloride | |
43621003 | Coagulation factor IX Oxford 2 variant | |
43625007 | Cholesterol oxidase | |
43632003 | Blood group antibody K14 | |
43677001 | ^148^Gadolinium | |
43678006 | Blood group antigen Pr>3< | |
43687002 | Hemoglobin Quong Sze | |
43688007 | Testosterone | |
43698001 | Hydroxystilbamidine isethionate | |
43706004 | Ascorbic acid | |
43708003 | Animal feed additive | |
43709006 | Phosphatidyl 3-0-alanylglycerol | |
43710001 | Butylidene chloride | |
43713004 | NAD^+^ synthase | |
43723008 | Tributyl phosphate | |
43728004 | beta-D-fructofuranose | |
43735007 | Sulfur | |
43740004 | ^210^Lead | |
43743002 | Polyvinyl acetate | |
43751004 | RNA-directed RNA polymerase | |
43775004 | CMP-N-acetylneuraminate-alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase | |
43784004 | Thymic lymphopoietin suppressing factor | |
43788001 | Blood group antibody Davis | |
43803003 | 2-(Acetamidomethylene) succinate hydrolase | |
43804009 | Ethyl silicate | |
43807002 | Blood group antigen In^b^ | |
43813006 | Phosphoribosylglycinamide formyltransferase | |
43819005 | Hemoglobin Kansas | |
43821000 | Alcohol dehydrogenase (acceptor) | |
43827001 | Blood group antigen Mineo | |
43835003 | Zinc gelatin | |
43839009 | Aminocarboxymuconate-semialdehyde decarboxylase | |
43848004 | Agkistrodon serine proteinase | |
43850007 | ^105^Rhodium | |
43862006 | Isovitexin beta-glucosyltransferase | |
43864007 | Blood group antigen Ull | |
43866009 | UDP-N-acetylglucosamine-lysosomal-enzyme-N-acetylglucosaminephosphotransferase | |
43871002 | HLA-Dw7 antigen | |
43880002 | Chloroacetamide | |
43886008 | Boron oxide | |
43896004 | p-Dichlorobenzene | |
43897008 | ^56^Manganese | |
43909000 | Thiamine triphosphate | |
43920000 | Hemoglobin A,a | |
43921001 | Nickel compound | |
43936003 | Oncogene protein fins | |
43953005 | Ammonia | |
43965009 | Phenothioxin | |
43974006 | Alkyl sodium sulphates | |
43984007 | Alpha amino acid | |
43987000 | Acacia | |
43989002 | 3,4-Methylenedioxybenzyl methyl ketone | |
44007007 | Padimate O | |
44027008 | Seafood | |
44033004 | Anthracene | |
44035006 | Nitromethane | |
44040003 | HLA-Bw57 antigen | |
44044007 | Calcium phosphate | |
44045008 | Blood group antibody Tasich | |
44046009 | Blood group antibody Paular | |
44048005 | Geranoyl-CoA carboxylase | |
44049002 | Blood group antigen Lindsay | |
44059001 | Gamboge | |
44063008 | Blood group antigen Pt^a^ | |
44068004 | Doxylamine | |
44079009 | Urobilinogen | |
44090004 | Hemoglobin Handsworth | |
44093002 | Blood group antibody KL | |
44112005 | Blood group antigen Lu11 | |
44120007 | 2,5-Diokovalerate dehydrogenase | |
44121006 | Transferase | |
44125002 | Aconitate delta-isomerase | |
44127005 | alpha, alpha-Trehalase | |
44139002 | Blood group antigen Don E. W. | |
44142008 | Hemoglobin Ocho Rios | |
44153002 | Cytokinin 7-beta-glucosyltransferase | |
44158006 | Lymphocyte antigen CD64 | |
44159003 | Barium oxide | |
44179006 | Renilla-luciferin 2-monooxygenase | |
44205007 | Grayanotoxin | |
44207004 | Methylaspartate ammonia-lyase | |
44212003 | Anti SS-A antibody | |
44220001 | Formate acetyltransferase | |
44225006 | Oncogene protein N-RAS | |
44234001 | Strontium isotope (substance) | |
44239006 | Platelet antibody HPA-1 | |
44262008 | Oxidized cellulose | |
44293009 | Phenoxybenzamine hydrochloride | |
44302008 | Peptidyl-glutaminase | |
44320004 | alpha-Naphthol | |
44330008 | Pyrvinium pamoate | |
44331007 | Blood group antibody In^b^ | |
44344002 | Abscisic acid | |
44347009 | Lergotrile | |
44368005 | Oncogene protein HER-2/neu | |
44369002 | Anaphylatoxin | |
44370001 | Oncogene protein c-fos | |
44394001 | Copper naphthenate | |
44404008 | Sulfoxide | |
44406005 | Polyethylene glycol alkyl ether | |
44407001 | [Acyl-carrier-protein] malonyltransferase | |
44411007 | GC globulin | |
44413005 | beta-Thiocyanoethyl fatty acid ester | |
44417006 | Monoterpenol beta-glucosyltransferase | |
44439008 | Blood group antigen Smith | |
44446004 | Petroleum product | |
44447008 | Blood group antigen Fleming | |
44459007 | Interleukin-8 | |
44461003 | Homoserine acetyltransferase | |
44469001 | Fibrinogen Petoskey | |
44472008 | Blood group antibody Begovitch | |
44475005 | Fucoidanase | |
44488008 | Bismark brown R stain (substance) | |
44495004 | ^126^Antimony | |
44506007 | ^112^Silver | |
44508008 | Hydromorphone | |
44510005 | UDPglucose-hexose-1-phosphate uridylyltransferase | |
44517008 | Glycerol-3-phosphate dehydrogenase | |
44520000 | Nylidrin hydrochloride | |
44533006 | Benzaldehyde dehydrogenase (NAD^+^) | |
44555003 | Methylenedioxyamphetamine | |
44556002 | Pyruvate decarboxylase | |
44581004 | 1-1-Dichloro-1-nitroethane | |
44588005 | Iodine | |
44590006 | Callistin toxin | |
44603007 | Iodinated glycerol | |
44609006 | Calcitonin gene-related peptide | |
44611002 | Nitrosyl chloride | |
44624002 | Fibrinogen New Orleans I | |
44632005 | 4,7,10,13,16,19-Docosahexaenoic acid | |
44639001 | Solid carbon dioxide | |
44644008 | Mycotoxin | |
44675004 | Blood group antibody Nou | |
44680008 | Factor VIII antigen | |
44681007 | Hypothalamic inhibiting factor | |
44686002 | Blood group antigen Lud | |
44706009 | Lymphocyte antigen CD3 | |
44711006 | Gastrin II | |
44719008 | Mediator of immune response | |
44728009 | Complement component C1 | |
44740009 | Choline oxidase | |
44742001 | Hemoglobin Louisville | |
44746003 | Bufotalin | |
44753007 | Thymine,2-oxoglutarate dioxygenase | |
44770004 | Intracisternal granule of ER | |
44776005 | Xenon radioisotope | |
44822001 | Ethyl bromide | |
44824000 | Blood group antibody Pearl | |
44837002 | Cyclopropane | |
44839004 | Armillaria mellea neutral proteinase | |
44858008 | Hemoglobin Q-Iran | |
44896009 | Hemoglobin Hamilton | |
44908000 | Chlorzoxozone | |
44924004 | Endorphin receptor (substance) | |
44931000 | Adenosylhomocysteinase | |
44937001 | beta-Ureidopropionase | |
44954009 | Oncogene protein TCRG | |
44970006 | Aspartic acid | |
44971005 | Thromboxane synthase | |
44973008 | ^182^Tantalum | |
44976000 | Hydroxy-mercuricresol | |
45001002 | Bone matrix | |
45003004 | Virus receptor | |
45011009 | Tyramine N-methyltransferase | |
45018003 | Steroid N-acetylglucosaminyltransferase | |
45025005 | Permanganic acid | |
45026006 | Blood group antigen M^v^ | |
45032001 | Hemoglobin D-Ibadan | |
45041006 | Dicycloxylamine | |
45044003 | Blood group antibody Lud | |
45047005 | Lymphokine | |
45060004 | Yttrium compound | |
45065009 | myo-Inosose-2 dehydratase | |
45068006 | 3-Hydroxybutyryl-CoA epimerase | |
45084007 | Fibrin degradation product, D fragment | |
45087000 | Oleoyl-[acyl-carrier-protein] hydrolase | |
45095001 | Blood group antigen K18 | |
45106005 | Congo red stain (substance) | |
45108006 | Lysosomal carboxypeptidase B | |
45119009 | Glycine salt of bile acid | |
45120003 | Ester | |
45137005 | Hemoglobin Suresnes | |
45141009 | Ornithine carbamoyltransferase | |
45158004 | Fluorine isotope | |
45159007 | Azatadine maleate | |
45160002 | Oxazine dye | |
45174009 | Alkylglycerophosphoethanolamine phosphodiesterase | |
45193006 | Blood group antibody Horw | |
45199005 | Oil of geranium | |
45207006 | Dextroamphetamine sulfate (substance) | |
45209009 | Epsilon-chain hemoglobin | |
45215009 | Tantalum | |
45219003 | Sodium monofluoroacetate | |
45246008 | C4bp complement protein | |
45262002 | Mercury | |
45266004 | Antiplasmin | |
45273009 | Blood group antigen hr^H^ | |
45285001 | Hemoglobin Arya | |
45321005 | Blood group antibody M | |
45333000 | Blood group antigen Sl^a^ | |
45345009 | Hemoglobin A>2< Victoria | |
45367005 | Tungsten radioisotope | |
45373006 | NADH peroxidase | |
45375004 | Hemoglobin F-Carlton | |
45380008 | ^134m^Cesium | |
45386002 | Purine | |
45388001 | Blood group antigen Laine | |
45389009 | Tissue stain | |
45394009 | Monophenol monooxygenase | |
45396006 | Cardiolipin antibody | |
45397002 | Hemoglobin Matsue-Oki | |
45407009 | Blood group antigen Ghawiler | |
45425002 | Tellurium compound | |
45428000 | Blood group antibody Perry | |
45436009 | Tenebrio alpha-proteinase | |
45441001 | Blood group antigen Tk (substance) | |
45442008 | Phenyl mercuric chloride | |
45454008 | Cerebrin | |
45457001 | Lipopolysaccharide N-acetylglucosaminyltransferase | |
45470005 | Bromacil | |
45475000 | Indigo carmine stain (substance) | |
45483006 | Psilocin | |
45487007 | Trifluridine ophthalmic preparation | |
45510000 | Blood group antibody Jopson | |
45524001 | Dextranomer | |
45528003 | Blood group antibody Dugstad | |
45530001 | Antinuclear antibody | |
45537003 | Farnesyltranstransferase | |
45539000 | Succinate dehydrogenase (ubiquinone) | |
45542006 | Thiosulfate salt | |
45555007 | Norepinephrine | |
45570008 | Mevaldate reductase (NADPH) | |
45585002 | beta-1 Adrenergic receptor | |
45601001 | Blood group antibody A.M. | |
45604009 | Tranquilizer | |
45609004 | Hemoglobin F-Pendergrass | |
45620004 | Pyrethrin | |
45622007 | 3-Deoxy-D-manno-octulosonate aldolase | |
45627001 | ^41^Argon | |
45637006 | Blood group antibody Bonde | |
45641005 | Hemoglobin Atlanta | |
45648004 | Angiotensin receptor | |
45656001 | HLA-Bw22 antigen | |
45668005 | Blood group antigen Bouteille | |
45672009 | Blood group antibody Lu11 | |
45695000 | Plant alkaloid | |
45698003 | Putrescine | |
45710003 | Sputum | |
45717000 | Coniferyl-alcohol dehydrogenase | |
45729009 | Glucosamine-phosphate acetyltransferase | |
45733002 | Magnesium chloride | |
45737001 | Glycolic acid | |
45754009 | Alpha interferon | |
45784001 | Xanthine oxidase | |
45791003 | Mannose-1-phosphate guanylyltransferase (GDP) | |
45799001 | Tissue-endopeptidase degrading collagenase-synthetic-substrate | |
45800002 | L-Arabinose isomerase | |
45807004 | Coagulation factor IX variant | |
45849009 | Technetium Tc^99m^ sodium glucoheptonate | |
45857007 | Antilysosomal antibody | |
45867002 | Glyoxylate dehydrogenase (acylating) | |
45878005 | Immunologic receptor | |
45883002 | Mitochondrial RNA | |
45922005 | Amphibole asbestos | |
45932003 | Anti Jo-1 antibody | |
45934002 | Blood group antigen Os^a^ | |
45940009 | Theophylline anhydrous | |
45946003 | Proglucagon | |
45947007 | Amylo-1,6-glucosidase | |
45952002 | 1-Acylglycerol-3-phosphate acyltransferase | |
45954001 | Arginine racemase | |
45957008 | Vinyl acetate | |
45960001 | Naepaine | |
45962009 | Collodion | |
45969000 | Blood group antibody i | |
45986006 | Teratogenic substance | |
45992000 | Blood group antigen s | |
45996002 | CDPacylglycerol arachidonyltransferase | |
45997006 | Omega amino acid | |
46015007 | Melanocyte stimulating hormone | |
46016008 | Mancozeb | |
46021006 | ^91^Strontium | |
46031004 | Salt water | |
46046006 | Immunoglobulin A (substance) | |
46058006 | Prostaglandin PGG2 | |
46064004 | Asparagine-oxo-acid aminotransferase | |
46066002 | dTDPglucose 4,6 dehydratase | |
46075000 | Oligosaccharide | |
46084000 | 2-Aminoadipate aminotransferase | |
46096007 | Blood group antibody Knudsen | |
46097003 | Lactated Ringer's solution | |
46120009 | 17-Ketosteroid | |
46122001 | Antitreponemal agent | |
46134009 | Prostaglandin PGA1 | |
46137002 | Borneol | |
46139004 | Martius yellow stain (substance) | |
46146008 | Cefotetan disodium | |
46150001 | HLA-Bw4 antigen | |
46158008 | HLA-Dw14 antigen | |
46164001 | ^109^Indium | |
46187009 | Abequosyltransferase | |
46188004 | D-Glutamyltransferase | |
46191004 | Cataglykin | |
46195008 | Blood group antibody Smith | |
46201000 | Piperidolate | |
46225008 | Cholecystokinin | |
46234003 | Blood group antigen Nob (substance) | |
46242002 | Body secretion | |
46243007 | Methyl sulfate difenzoquat | |
46245000 | Haemoglobin Korle-Bu | |
46250006 | Slaframine | |
46257009 | Triiodomethane | |
46261003 | Blood group antigen C^x^ | |
46281002 | Caffeate o-methyltransferase | |
46290009 | Bisphosphoglycerate phosphatase | |
46293006 | Bromocriptine mesylate | |
46310006 | Glycine dehydrogenase (decarboxylating) | |
46320001 | N-Acylsphingosine galactosyltransferase | |
46321002 | Asterotoxin | |
46329000 | Chocolate milk | |
46331009 | Blood group antibody K13 | |
46335000 | Sulisobenzone | |
46336004 | Complement component C2b | |
46338003 | Cysteine-S-conjugate N-acetyltransferase | |
46344004 | Alginate synthase | |
46346002 | Tabernamontanain | |
46358002 | ^118^Antimony | |
46384008 | Ink | |
46407003 | GDPmannose 4,6 dehydratase | |
46409000 | Bilirubin-glucuronoside glucuronosyltransferase | |
46417008 | Chlorate salt | |
46425005 | Intestinal vomitus | |
46445002 | 11beta-Hydroxysteroid dehydrogenase | |
46461000 | Fucose-1-phosphate guanylyltransferase | |
46469003 | Properdin convertase, complement component | |
46484007 | Bleaching powder | |
46491005 | Menthyl anthranilate | |
46492003 | Nivalenol | |
46509002 | 1-Phosphofructokinase | |
46512004 | Tertiary butyl chromate | |
46514003 | Calcium mandelate | |
46519008 | Blood group antibody ILe^bH^ | |
46520002 | Immunoglobulin, GM>2< allotype | |
46539007 | Complement component C1r | |
46543006 | ^107^Palladium | |
46548002 | Leukotriene B | |
46558003 | Imipenem | |
46566007 | Arylamine N-methyltransferase | |
46572007 | Coagulation factor XI | |
46583003 | Actin | |
46591007 | Superfatted soap | |
46601006 | Diazomethane | |
46602004 | Electron | |
46610003 | 3-Dehydrosphinganine reductase | |
46613001 | HLA-Bw58 antigen | |
46654009 | Tetrahydrocortisone | |
46663006 | Blood group antibody Lee | |
46668002 | Homatropine methylbromide | |
46682002 | Ribonuclease T>2< | |
46684001 | Hemoglobin N-Seattle | |
46685000 | Serine-ethanolaminephosphate phosphodiesterase | |
46691003 | Organoalkyl mercury | |
46711008 | Diglycol hydroiodide (substance) | |
46730008 | Blood group antigen Bio-5 | |
46736002 | Glutamate racemase | |
46743008 | Nucleotide pyrophosphatase | |
46749007 | Medicinal iodine | |
46755002 | Blood group antigen Schor | |
46757005 | Hemoglobin St. Antoine | |
46769002 | Immune suppressor gene | |
46810001 | Flint | |
46815006 | Connective tissue matrix | |
46840004 | Animal oil | |
46841000 | Blood group antigen BOW | |
46843002 | Xanthine | |
46845009 | Tyrosine phenol-lyase | |
46859002 | Septicine | |
46861006 | Deoxynivalenol | |
46864003 | Thiocyanate isomerase | |
46887006 | Ambenonium chloride | |
46921009 | Quinoline dye | |
46932009 | Thyroid colloid | |
46942006 | Oxamic acid | |
46943001 | Cortolone (substance) | |
46950002 | Protriptyline hydrochloride | |
46959001 | Lymphocyte antigen CD11c | |
46961005 | Hydroxypyruvate isomerase | |
46974004 | Hemoglobin Oleander | |
46978001 | Cyclopentanol dehydrogenase | |
46985002 | 1,2-Dichloroethene | |
47019005 | Blood group antigen Hildebrandt | |
47023002 | Lymphocyte antigen CD66 | |
47026005 | Thymol oxide | |
47030008 | Insoluble berlin blue stain (substance) | |
47038001 | HLA antigen | |
47052004 | Chemical suspension | |
47053009 | ^193^Gold | |
47068005 | Blood group antibody Jr^a^ | |
47088009 | Carboxymethylenebutenolidase | |
47097008 | Oxaloacetic acid | |
47104007 | Blood group antigen Co3 | |
47121003 | Bismuth isotope | |
47136000 | Blood group antigen Manley | |
47151009 | Blood group antibody Win | |
47167003 | Glyceraldehyde-3-phosphate | |
47169000 | Aminoacyl-methylhistidine dipeptidase | |
47172007 | Sulfuric acid | |
47174008 | Glutamine-pyruvate aminotransferase | |
47176005 | Methdilazine hydrochloride | |
47180000 | Methisazone (substance) | |
47184009 | Silver compound | |
47189004 | ^195^Thallium | |
47192000 | Meglumine diatrizoate | |
47201006 | 5-Hydroperoxy-6,8,11,14-eicosatetraenoic acid | |
47204003 | Ferbam | |
47205002 | Cobalt blue | |
47215008 | Blood group antigen Sc2 | |
47218005 | Fibrinogen Giessen II (substance) | |
47232007 | Alkyl quaternary ammonium bromide | |
47245006 | Dolichyl-phosphate alpha-N-acetylglucosaminyltransferase | |
47247003 | Fibrinogen Kyoto | |
47280005 | Macrocyclic trichothecenes | |
47291003 | Mucor pusillus aspartic proteinase | |
47310000 | Exoribonuclease II | |
47313003 | Hemoglobin A>2< Adria | |
47336007 | Fibrinogen Manchester | |
47341004 | Blood group antigen Driver | |
47343001 | N-Formyl methionylaminoacyl-transfer ribonucleic acid deformylase (substance) | |
47349002 | beta Neoendorphin | |
47350002 | Pregnenolone | |
47355007 | Benzodiazepine nucleus | |
47358009 | Polystyrene | |
47364002 | Blood group antigen Ryan | |
47368004 | Nucleoside | |
47379009 | Technetium compound | |
47380007 | ^210^Bismuth | |
47383009 | Cephaeline | |
47389008 | Methyl tert-butyl ether | |
47407008 | Sphingolipid | |
47408003 | Naftifine hydrochloride | |
47413004 | Fat emulsion | |
47414005 | Trimethidinium | |
47419000 | Long-chain-alcohol fatty-acyltransferase | |
47425001 | ^187^Iridium | |
47431003 | Dichlorobenzene | |
47448006 | Hot water | |
47463009 | ^209^Lead | |
47464003 | Blood group antibody Woit | |
47469008 | Blood group antibody Seymour | |
47472001 | 4-Hydroxy-3-methoxy mandelic acid | |
47486002 | Fast red ITR stain (substance) | |
47500008 | Borate pentahydrate | |
47521008 | ^109^Palladium | |
47543000 | Exodeoxyribonuclease I | |
47553004 | Blood group antibody Sul | |
47562002 | 4-Hydroxybutyrate dehydrogenase | |
47565000 | I region, MHC | |
47581005 | Type 1 chain precursor structure (lacto-N-tetraosylceramide) | |
47588004 | ^203^Lead | |
47601000 | Blood group antigen Savery | |
47603002 | Blood group antibody Pillsbury (substance) | |
47617006 | Basic amino acid | |
47618001 | (R)-Aminopropanol dehydrogenase | |
47619009 | Phosphoramidate-hexose phosphotransferase | |
47626009 | Blood group antibody Kemma | |
47635002 | Lauryl isoquinolinium bromide | |
47646004 | Antiarin | |
47662005 | Blood group antigen h | |
47663000 | Clindamycin palmitate hydrochloride | |
47670000 | Colonic mucus | |
47674009 | Blood group antigen Pr>1d< | |
47676006 | ^39^Chlorine | |
47677002 | Orange oil | |
47691008 | Fibrin degradation product, first derivative | |
47692001 | Blood group antigen Rm | |
47702003 | Carboxylesterase | |
47703008 | Lactose | |
47707009 | Anion | |
47711003 | Allyl chloride | |
47714006 | Fibrinogen Troyes | |
47716008 | Nucleotide pyrophosphokinase | |
47729008 | Potassium chloride K^43^ | |
47733001 | Blood group antibody Bradford | |
47735008 | Chalcone isomerase | |
47737000 | Valine dehydrogenase (NADP^+^) | |
47769009 | Platelet antibody HPA-5 | |
47773007 | D-Nopaline dehydrogenase | |
47784000 | Blood group antibody IP | |
47786003 | Hemoglobin Austin | |
47788002 | Hemoglobin J-Medellin | |
47799000 | ^126^Cesium | |
47809000 | Arsenic | |
47826006 | Thiourea | |
47832001 | Alkaline phosphatase isoenzyme | |
47834000 | Oxophenarsine hydrochloride | |
47845002 | Glycoprotein 4-beta-galactosyltransferase | |
47851007 | HLA-Aw69 antigen | |
47853005 | Parachlorophenol | |
47857006 | Quinine sulfate | |
47860004 | HLA-A3 antigen | |
47862007 | Schizozygine | |
47888005 | Propionyl-CoA carboxylase | |
47894002 | Tumor necrosis factor beta | |
47899007 | Oxyhemoglobin F | |
47900002 | Adenylylsulfate reductase | |
47901003 | 5-Trimethoxyamphetamine | |
47910006 | Neurophysin | |
47929000 | Hemoglobin M-Milwaukee-I | |
47937008 | Ipecac syrup | |
47946002 | Hemoglobin F-Heather | |
47950009 | Taurocholic acid | |
47974007 | Blood group antibody Tg^a^ | |
47994003 | Immunoglobulin, GM>25< allotype | |
47995002 | Alcohol soluble nigrosine stain (substance) | |
47998000 | Hemoglobin Connecticut | |
48006008 | Ion | |
48041007 | Benomyl | |
48050009 | Glycosylceramidase | |
48051008 | Carnitine acetyltransferase | |
48052001 | Enalaprilat | |
48060000 | Blood group antigen Ritter (substance) | |
48070003 | Phenylpiperidine derivative | |
48078005 | Butyl aminobenzoate | |
48095002 | Nicotinate dehydrogenase | |
48102008 | 3alpha-Hydroxysteroid dehydrogenase | |
48109004 | Blood group antigen Js^a^ | |
48110009 | 4-Hydroxyphenylacetate 1-monooxygenase | |
48111008 | Immunoglobulin, J piece | |
48116003 | Blood group antigen Paris | |
48131007 | Blood group antibody Neut | |
48132000 | Fibrinogen New York I | |
48140006 | Blood group antibody Whittaker | |
48154003 | Blood group antibody Zwal | |
48161004 | Galactosylgalactosylglucosylceramidase | |
48170001 | HLA-Cw1 antigen | |
48172009 | Cefamandole nafate | |
48175006 | Sea-urchin-hatching proteinase | |
48179000 | Hemoglobin T-Cambodia | |
48181003 | Trimethylamine | |
48184006 | Tropomyosin | |
48199006 | Diamthazole (substance) | |
48207007 | Methylcytisine | |
48209005 | ^232^Thorium | |
48212008 | Hemoglobin Chemilly | |
48214009 | Oncogene protein TCL5 | |
48217002 | Complement regulator | |
48244007 | L-Xylulose reductase | |
48265001 | 1,3-Dichloro-5,5- dimethylhydantoin | |
48270008 | Lymphocyte antigen CDw49f | |
48271007 | ^105^Silver | |
48282004 | Sorbose dehydrogenase | |
48284003 | Antigen in Kell (KEL) blood group system | |
48302003 | Methylcyclohexanone | |
48323009 | Blood group antibody Schneider | |
48324003 | Vinyl cyclohexene dioxide | |
48332006 | Plant cyanogenic glycoside | |
48341001 | ^192^Iridium | |
48358006 | Heme oxygenase (decyclizing) | |
48366002 | Blood group antigen Rh39 | |
48369009 | ^183^Tantalum | |
48384000 | Amitriptyline hydrochloride | |
48401006 | Blood group antigen I | |
48416009 | Blood group antigen Green | |
48417000 | HLA-Dw26 antigen | |
48444005 | Freund's adjuvant | |
48464000 | Blood group antibody Sw^a^ | |
48474002 | Albuterol sulfate (substance) | |
48478004 | Aminoglycoside N^3'^-acetyltransferase | |
48486004 | Immunoglobulin IgG4 (substance) | |
48494006 | N-Acetylgalactosamine-4-sulfatase | |
48517003 | Pepsin A | |
48540004 | Patent blue V sodium salt stain (substance) | |
48551004 | Fusion oncogene protein | |
48562004 | Monobutyl phenyl phenol sodium monosulfonate | |
48581007 | Plastic reagent (substance) | |
48583005 | Immunoglobulin E | |
48590000 | 1,2-Cyclic-inositol-phosphate phospho-diesterase | |
48593003 | Safrol | |
48605006 | Glycolaldehyde dehydrogenase | |
48618003 | Sodium para-aminohippurate | |
48650008 | Procollagen galactosyltransferase | |
48663002 | Alkylhalidase | |
48682006 | Metridium proteinase A | |
48686009 | Aluminum radioisotope | |
48693008 | Phenaglycodol | |
48699007 | Blood group antigen Carson | |
48714008 | Palladium | |
48727007 | Interleukin-4 | |
48736006 | Ribitol teichoic acid | |
48741003 | Toothpaste | |
48751002 | Blood group antibody Can | |
48753004 | Cefuroxime sodium | |
48766004 | Glycerate kinase | |
48779008 | Blood group antibody Hamet | |
48798005 | Antigen in Lutheran (LU) blood group system | |
48802006 | Chlorogenate hydrolase | |
48815002 | Blood group antigen Shannon | |
48821003 | Lymphocyte antigen CD19 | |
48824006 | Aminoimidazolase | |
48830006 | 2-Acylglycerol-3-phosphate acyltransferase | |
48847007 | Hemolysin venom | |
48861002 | ^99^Molybdenum | |
48869000 | Blood group antigen Jordan | |
48885005 | Vanadium pentoxide dust | |
48893005 | Sodium dinitro-ortho-cresylate | |
48895003 | ^113m^Indium | |
48898001 | Hemoglobin Buenos Aires | |
48910008 | ^21^Neon | |
48915003 | Chitinase | |
48919009 | Blood group antigen Block | |
48931006 | Enoyl-[acyl-carrier-protein] reductase (NADPH) | |
48940005 | Methoxypromazine (substance) | |
48945000 | Oxalate decarboxylase | |
48949006 | Hemoglobin Duan | |
48968009 | Histidine aminotransferase | |
48978007 | Cesium hydroxide | |
48988008 | Prostaglandin PGE1 (substance) | |
49003009 | Osmium radioisotope | |
49009008 | NAPH cytochrome-c>2< reductase | |
49010003 | Paraprotein | |
49022000 | Merethoxylline procaine | |
49028001 | Blood group antibody K16 | |
49046007 | Human structural gene | |
49053003 | Tuftsin | |
49056006 | Sucrose alpha-glucosidase | |
49060009 | mRNA (guanine-N^7^)-methyltransferase | |
49067007 | Thymic neuromuscular function blocking agent | |
49069005 | Lead isotope | |
49106003 | HLA-DR1 antigen | |
49115005 | Polyphosphate-glucose phosphotransferase | |
49119004 | Blood group antigen Bryant | |
49143001 | ^201m^Bismuth | |
49145008 | Demecarium bromide | |
49146009 | Cutaneous fluid | |
49148005 | HLA-Cw11 antigen | |
49163008 | Blood group antigen Sd^a^ | |
49173005 | Oil of spike | |
49174004 | ^85^Yttrium | |
49185002 | Germanium radioisotope | |
49193002 | Pyranose oxidase | |
49208007 | Cinerin | |
49212001 | Blood group antigen D 1276 | |
49214000 | Concanavalin receptor | |
49251006 | scyllo-Inosamine kinase | |
49254003 | ^201^Bismuth | |
49291009 | Glycine dehydrogenase (cytochrome) | |
49313009 | Nialamide | |
49314003 | Flavonol O^3^-glucosyltransferase | |
49318000 | ^173^Hafnium | |
49322005 | Hemoglobin F-Sardinia | |
49327004 | Interferon | |
49328009 | myo-Inositol 1-methyltransferase | |
49344000 | Blood group antibody VK | |
49352002 | Mediator of inflammation (substance) | |
49354001 | Acetolactate synthase | |
49358003 | Linoleate isomerase | |
49371000 | Methscopolamine bromide | |
49377001 | Blood group antigen Davis | |
49378006 | Eccrine sweat | |
49382008 | Oil of cherry laurel | |
49383003 | Maltose acetyltransferase | |
49389004 | Protoporphyrinogen III | |
49399009 | Magnesium salicylate | |
49419007 | Active C4b | |
49426007 | Lewis acid | |
49427003 | 3,5 Diiodothyronine | |
49444004 | Maleic hydrazide | |
49449009 | Blood group antibody Wimberly | |
49451008 | Ethaverine | |
49461001 | Hemoglobin Hobart | |
49469004 | Phosphoribokinase | |
49471004 | Diacetoxyscirpenol | |
49477000 | Phosalone | |
49478005 | ^195m^Mercury | |
49495002 | HLA-A antigen | |
49506005 | Gluconic acid | |
49508006 | Heparitin-sulfate lyase | |
49519009 | Immunoglobulin, F(ab')>2< fragment | |
49529002 | UDP glucose 4,6-dehydratase | |
49543007 | Succinate dehydrogenase | |
49551005 | Oil of organum | |
49559007 | Zinc pelargonate | |
49560002 | Heptachloro-camphene | |
49565007 | Disopyramide phosphate | |
49568009 | Blood group antigen Terrell | |
49576006 | 1,1,1-Trichloroethane | |
49582009 | Blood group antigen Dantu | |
49599005 | Private blood group antibody | |
49602000 | Isoproterenol sulfate (substance) | |
49613002 | Hemoglobin Malmo | |
49616005 | Monoclonal antibody | |
49633003 | Prolyl dipeptidase | |
49636006 | Lochia | |
49643000 | Oil of cypress | |
49653004 | Blood group antigen Taur | |
49660005 | Methylmalonyl-CoA carboxyltransferase | |
49677005 | HLA-Dw22 antigen | |
49686000 | Propanediol dehydratase | |
49687009 | Coriphosphine stain (substance) | |
49695008 | Lead sulfide | |
49702009 | Phenylacetaldehyde dehydrogenase | |
49722008 | Somatostatin | |
49724009 | Pyrvinium chloride | |
49733006 | 2-Oxopent-4-enoate hydratase | |
49739005 | n-1-Naphthyl-phthalamic acid | |
49743009 | ^241^Californium | |
49744003 | Blood group antibody M1^a^ | |
49745002 | Adenosine diphosphate | |
49772005 | Blood group antigen Simon | |
49775007 | 15-Hydroxyprostaglandin dehydrogenase (NADP^+^) | |
49777004 | bis-(Isopropylamido) fluorophosphate | |
49797009 | ^193^Osmium | |
49821006 | Immunoglobulin, KM>1< allotype | |
49837000 | Blood group antigen Horn | |
49839002 | Hexamethonium | |
49846006 | Carboxymethyloxysuccinate lyase | |
49849004 | Trichlorfon (substance) | |
49858006 | Lymphocyte antigen CDw52 | |
49867006 | Leucine 2,3-aminomutase | |
49869009 | Gonadotropin releasing factor | |
49873007 | Tetrahymena aspartic proteinase | |
49884000 | Barium isotope | |
49889005 | Formiminoglutamic acid | |
49893004 | Polyamine methylene resin | |
49902002 | Hemoglobin Himeji | |
49909006 | Mucus | |
49912009 | Blood group antigen D^w^ | |
49944008 | alpha Fetoprotein | |
49952006 | 4-Dimethylaminoazobenzene | |
49977007 | Lead compound | |
49991001 | Blood group antigen Mateja | |
49997002 | HLA-Bw59 antigen | |
49998007 | Sufentanil | |
50010001 | 4-Nitrobiphenyl | |
50028004 | Blood group antibody Boston | |
50045009 | Heparin sodium | |
50062004 | Fuchsin basic stain (substance) | |
50068000 | Phytochrome | |
50073006 | Dimethylglycine dehydrogenase | |
50095005 | Hemoglobin S | |
50096006 | 3-Isopropylmalate dehydrogenase | |
50100007 | Chrysotile | |
50106001 | Formate dehydrogenase (cytochrome-c-553) | |
50107005 | Immunoglobulin, GM>5< allotype | |
50129009 | Hemoglobin St. Louis | |
50139003 | Glycoprotein 6-alpha-L-fucosyltransferase | |
50140001 | Choline acetyltransferase | |
50142009 | NADPH-ferrihemoprotein reductase | |
50151001 | Flavoprotein | |
50156006 | Blood group antigen Le^b^ | |
50191003 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase | |
50195007 | O-Acetylserine (thiol)-lyase | |
50213009 | Chloride salt | |
50218000 | Melarsonyl | |
50221003 | Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase | |
50233008 | gamma-Ketovaleric acid | |
50254001 | Viral gene | |
50272007 | Blood group antibody hr^s^ | |
50298001 | ^235^Uranium | |
50306007 | Sodium tetraborate (substance) | |
50309000 | Sodium oxalate | |
50352000 | Organic phosphorus compound | |
50358001 | Heparin lyase | |
50359009 | ^45^Calcium | |
50371003 | Carnosine | |
50374006 | ^120^Iodine | |
50383001 | HLA-Bw76 antigen | |
50418002 | Hexose oxidase | |
50423002 | Formamidase | |
50425009 | ^114^Indium | |
50431007 | Cortisone alpha-reductase | |
50456001 | Urine protein | |
50470001 | Human genome | |
50473004 | Female genital fluid | |
50479000 | Soy protein-iron complex | |
50480002 | Blood group antigen Ri^a^ | |
50491009 | Yttrium isotope | |
50502005 | ^194^Gold | |
50507004 | N-phenylacetamide | |
50512003 | Phospholipase A>1< | |
50526007 | Blood group antibody S^D^ | |
50533007 | Adenosine nucleosidase | |
50550009 | 6-Phospho 2-dehydro-3-deoxygalactonate aldolase | |
50580004 | Sulthiamine | |
50593009 | Casein | |
50605001 | L-Amino-acid oxidase | |
50622004 | Cholesterol esterase | |
50627005 | Labetalol hydrochloride | |
50641001 | Hemoglobin G-Taichung | |
50656005 | Creatininase | |
50661007 | Bismuth subgallate | |
50665003 | Hydrocortisone butyrate | |
50668001 | Oncogene protein TCRA | |
50672002 | Hafnium | |
50685004 | Epinephrine hydrochloride | |
50700004 | Blood group antigen Heibel | |
50706005 | Fibrinogen Malmoe | |
50716002 | ^122^Antimony | |
50735002 | Coagulation factor X Melbourne variant | |
50750006 | Hexachlorobenzene | |
50752003 | Blood group antibody Wiley | |
50754002 | Trifluoperazine hydrochloride | |
50762005 | Interleukin-1 | |
50767004 | 5-Methylthioribose kinase (substance) | |
50778007 | Hemoglobin J-Wenchang-Wuming | |
50784005 | Intracisternal material, amorphous (substance) | |
50791008 | Tetramethyl succinonitrile | |
50825000 | Food coloring | |
50848005 | Sulfamoxole | |
50852005 | Seminal vesicle fluid | |
50854006 | alpha-Amino-acid esterase | |
50863008 | Plasma | |
50864002 | Blood group antibody CE | |
50898006 | UDPglucosamine 4-epimerase | |
50899003 | Blood group antibody Je^a^ | |
50912007 | Oncogene protein trk | |
50914008 | Adamsite | |
50925004 | Amidophosphoribosyltransferase | |
50948009 | rRNA (guanine-N^1^)-methyltransferase | |
50951002 | Neuropeptide Y | |
50957003 | Leukopterin | |
50969006 | Tetrahydrozoline hydrochloride (substance) | |
50973009 | Methacycline hydrochloride (substance) | |
50981005 | Hemoglobin Takamatsu | |
50988004 | Lymphocyte antigen CD10 | |
51034002 | Phosphoglycerate kinase | |
51076005 | Fibrinogen Argenteuil | |
51079003 | Pelargonic acid | |
51090008 | NADH kinase | |
51125005 | Diacetylaminoazotoluene | |
51137007 | Sodium arsenate | |
51139005 | Tetrabromo-o-cresol | |
51148000 | Dicamba | |
51161000 | Coagulation factor XIII | |
51162007 | Holo-[acyl-carrier-protein] synthase | |
51163002 | Lanosterol synthase | |
51172005 | Cryofibrinogen | |
51173000 | Muconolactone delta-isomerase | |
51177004 | Citreoviridin | |
51179001 | Alkyl dimethyl benzyl ammonium bromide | |
51200005 | Strychnine | |
51202002 | Sepiapterin deaminase | |
51222003 | Blood group antigen IP>1< | |
51224002 | Carboxymethylcellulose sodium | |
51238009 | Lymphocyte antigen CD2R | |
51242007 | Blood group antigen Riv | |
51245009 | Barium propionate | |
51248006 | Dihydroneopterin aldolase | |
51250003 | Hemoglobin J-Buda | |
51256009 | Cystathionine beta-synthase | |
51260007 | Metabutoxycaine | |
51262004 | Blood group antibody Donati | |
51263009 | 3alpha-Hydroxy-5beta-androstane-17-one 3alpha-dehydrogenase | |
51276003 | Blood group antibody Bothrops | |
51280008 | Sebum | |
51285003 | Hemoglobin J-Toronto | |
51293003 | Blood group antigen rr-35 | |
51303009 | (-)-Menthol dehydrogenase | |
51304003 | Rubidium (substance) | |
51305002 | Thymosin | |
51311004 | Blood group antigen B 9208 | |
51314007 | Hyponitrite reductase | |
51321007 | Propylhexedrine | |
51364000 | 2-Dehydro-3-deoxy-L-pentonate aldolase | |
51366003 | Ammonium chloride | |
51369005 | Phosmet | |
51372003 | Blood group antibody An^a^ | |
51379007 | Fibrinogen Alba/Geneva | |
51386004 | Food preservative | |
51389006 | Histidinol dehydrogenase | |
51390002 | Hemoglobin F-Clarke | |
51397004 | Hemoglobin Guizhou | |
51405003 | Ammonia kinase | |
51414008 | Human leukocyte antigen DR2 (substance) | |
51415009 | Blood group antibody Kn^a^ | |
51419003 | Mucoprotein | |
51420009 | Silicon | |
51426003 | Vanadium radioisotope | |
51437002 | 3-Deoxy-manno-octulosonate cytidylyltransferase | |
51441003 | Reiterated gene | |
51447004 | Blood group antibody Kam | |
51462002 | Hematoporphyrin | |
51466004 | Retinal isomerase | |
51468003 | Blood group antibody Tajama | |
51483008 | Naringenin-chalcone synthase | |
51503008 | Rose oil | |
51511003 | Blood group antigen Kosis | |
51515007 | HLA-DRw antigen | |
51542008 | Appendiceal contents | |
51562000 | 2-Bromo-4-phenyl phenol | |
51567006 | Sirius red F3B stain (substance) | |
51569009 | Sulfaphenazole | |
51598008 | Coproporphyrin | |
51610006 | Quercetin O^3^methyltransferase | |
51612003 | Hydrocortisone valerate | |
51622009 | Adenine deaminase | |
51644004 | Electrolytic agent | |
51645003 | Blood group antibody Good | |
51663003 | Plant mutagen | |
51664009 | Metallic amalgam | |
51674007 | ^241^Plutonium | |
51704000 | Phospholipase C | |
51708002 | Hemoglobin Rainier | |
51718007 | HLA-Bw46 antigen | |
51739000 | Ethyl biscoumacetate | |
51765001 | Carbon monoxide | |
51769007 | Pyrimidine-5'-nucleotide nucleosidase | |
51770008 | Cyclic AMP receptor | |
51774004 | ^123^Tin | |
51775003 | Estrone | |
51776002 | Singlet oxygen | |
51800004 | ^222^Radon | |
51803002 | Fibrinogen Chapel Hill II | |
51809003 | Blood group antibody Pantaysh | |
51810008 | Proliferative inhibitory factor | |
51824007 | NADH dehydrogenase | |
51844001 | Tetracaine hydrochloride | |
51856000 | Hemoglobin J-Sardegna | |
51859007 | Organic thiocyanate insecticide | |
51866008 | Protoporphyrin | |
51873003 | Blood group antibody Lagay | |
51874009 | Proline iminopeptidase | |
51876006 | [Hydroxymethylglutaryl-CoA reductase (NADPH)] kinase | |
51880001 | Isohexenylglutaconyl-CoA hydratase | |
51888008 | Calcium salt (substance) | |
51889000 | Oxaloglycolate reductase (decarboxylating) | |
51905005 | Mustard | |
51910009 | N-ethylmorpholine | |
51913006 | Sorbose dehydrogenase (NADP^+^) | |
51918002 | Hemoglobin Milledgeville | |
51922007 | Magnetite | |
51927001 | Dipropylene glycol methyl ether | |
51931007 | Nail polish remover | |
51934004 | Hemocyanin | |
51941005 | Blood group antibody B | |
51950007 | Antimitochondrial antibody | |
51955002 | Asclepain | |
51961004 | ^101^Palladium | |
51963001 | Sulfite salt | |
51964007 | Deoxydenylate kinase | |
51965008 | Amsinckine | |
51967000 | Sulfite reductase (NADPH) | |
51974005 | Geranyl-diphosphate cyclase | |
51990005 | Ganglioside galactosyltransferase | |
52021000 | Tetrachlorobenzoquinone | |
52024008 | Upper respiratory tract mucus | |
52027001 | Crimidine | |
52053009 | Epididymal fluid | |
52062006 | Oxythioquinox | |
52078008 | Epitope | |
52081003 | Blood group antigen Griffith | |
52086008 | Glycol | |
52094001 | ^117m^Indium | |
52104007 | Right upper lobe mucus | |
52119008 | beta Endorphin preparation | |
52126008 | Cortol | |
52129001 | Protamine kinase | |
52130006 | Quercetin | |
52140009 | Benoxinate (substance) | |
52141008 | Coal dust | |
52160001 | Lymphocyte antigen CD9 | |
52162009 | 2-Oxobutyrate synthase | |
52169000 | Platelet antibody HPA-2 | |
52193005 | Blood group antibody Lindsay | |
52209008 | Calcium citrate | |
52210003 | Blood group antibody Manley | |
52227006 | Platelet antibody HPA-3b | |
52243004 | 1,3-Dichloro-2-propanol | |
52258007 | Blood group antibody C^x^ | |
52261008 | Hemoglobin Vanderbilt | |
52264000 | Hemoglobin Yakima | |
52269005 | Muramoyl-pentapeptide carboxypeptidase | |
52275001 | Benactyzine | |
52282002 | Histamine receptor | |
52283007 | Peppermint oil | |
52293000 | Abnormal hemoglobin, fusion defect | |
52310000 | Blood group antibody Dp | |
52313003 | Complement component C8 | |
52315005 | o-Dichlorobenzene | |
52326004 | Indoleacetaldoxime dehydratase | |
52339000 | Nitrogen chloride (substance) | |
52354006 | Zirconium compound | |
52358009 | D-Serine dehydratase | |
52360006 | Estrone sulfotransferase | |
52370008 | Psyllium (substance) | |
52371007 | Hemoglobin Westmead | |
52380007 | Glycine dehydrogenase | |
52394008 | Potassium acetate (substance) | |
52398006 | Phospho-2-dehydro-3-deoxyheptonate aldolase | |
52401009 | Thrombin-antithrombin complex | |
52408003 | Iodinated I^131^ gamma globulin | |
52418008 | Chondroitin sulfotransferase | |
52419000 | HLA-Bw72 antigen | |
52422003 | 20-Hydroxyprogesterone | |
52442007 | Betaine-homocysteine methyltransferase | |
52454007 | Albumin | |
52458005 | Hemoglobin J-Kaohslung | |
52467005 | Blood group antigen Krog | |
52470009 | Nickel salt | |
52480008 | Alkenylglycerophosphoethanolamine hydrolase | |
52493003 | ^129^Antimony | |
52502000 | bis-(Trichlorohydroxy ethyl) urea | |
52503005 | Argon | |
52513002 | Hemoglobin Ferndown | |
52518006 | Amino acid | |
52525004 | Pyrimidine-nucleoside phosphorylase (substance) | |
52541003 | Proline | |
52546008 | Perilymph | |
52555006 | Blood group antigen Shier | |
52560005 | Norleucine | |
52573009 | Blood group antibody Tj^a^ | |
52574003 | Amiodarone hydrochloride | |
52587009 | ^113^ Silver | |
52596009 | Inosamine-phosphate amidinotransferase | |
52601000 | Deproteinated pancreatic extract | |
52609003 | Hemoglobin Pontoise | |
52610008 | Glucuronolactone reductase | |
52625008 | Arginine | |
52642002 | Peptide | |
52646004 | Actinium isotope | |
52679004 | Submandibular proteinase A | |
52680001 | Hepatitis B surface antigen subtype adr | |
52690009 | ^133m^Xenon | |
52701005 | ^210^Thallium | |
52717004 | Iodate salt | |
52720007 | Bismuth compound | |
52722004 | Biotinidase | |
52733001 | Overlapping gene | |
52736009 | Threonine | |
52740000 | meso-Tartrate dehydrogenase | |
52745005 | ^51^Chromium | |
52752007 | ^85m^Strontium | |
52764004 | Blood group antibody Cad | |
52770005 | Acetoacetic acid | |
52786003 | Immunoglobulin, hinge region | |
52793004 | Liquid nitrogen | |
52797003 | Non structural gene | |
52800001 | Marine toxin | |
52803004 | Trimeprazine tartrate (substance) | |
52804005 | o-Nitro-p-phenylenediamine | |
52806007 | Chenopodium oil | |
52830009 | Glyceryl-ether monooxygenase | |
52834000 | Hemoglobin A>2< Canada | |
52836003 | Paraformaldehyde | |
52841006 | Methyl malonic acid | |
52850008 | Ethopropazine (substance) | |
52854004 | Stilbene dye | |
52860004 | Manganese radioisotope | |
52881004 | Glucosaminate ammonia-lyase | |
52885008 | Alphaprodine | |
52886009 | Minocycline hydrochloride | |
52905007 | L-Arabinokinase | |
52912003 | Blood group antibody Marks | |
52935000 | HLA-Bw42 antigen | |
52959005 | ^108m^Silver | |
52973001 | 3-Methyleneoxindole reductase | |
52978005 | Coagulation factor II Brussels variant | |
52991006 | Blood group antibody Bryant | |
53005004 | Cerebroside | |
53008002 | Acetic anhydride | |
53022002 | Chaulmoogra oil | |
53023007 | Leukotriene D | |
53027008 | Dinitrotoluene | |
53034005 | Coal tar | |
53041004 | Alcohol | |
53047000 | HLA-DR3 antigen | |
53048005 | Hematin | |
53052005 | Methazolamide | |
53072000 | Leukotriene E | |
53082004 | Blood group antibody Le^c^ | |
53090004 | Sulfacytidine | |
53117004 | Hepatitis delta virus antibody (substance) | |
53130003 | Venous blood (substance) | |
53136009 | Chloroquine phosphate | |
53149004 | Hydrophilic ointment | |
53158006 | Luteolin methyltransferase | |
53164004 | Perchloryl fluoride | |
53166002 | trans-Cinnamate 2-monooxygenase | |
53171009 | Lead-free gasoline (substance) | |
53172002 | Protein-glucosylgalactosylhydroxylysine glucosidase | |
53175000 | Oil of celery | |
53207004 | Diiodofluorescein I^131^ (substance) | |
53211005 | Cyanogen chloride | |
53235000 | Protamine zinc insulin | |
53246002 | Ethylene | |
53252001 | Mullerian regression factor | |
53268007 | Ipomea | |
53278005 | Hemoglobin Mississippi | |
53287001 | HLA-A32 antigen | |
53289003 | Oil of savin | |
53302008 | Platelet antibody HPA-1a | |
53306006 | Glutamate synthase (NADH) | |
53307002 | Blood group antigen Hu | |
53315004 | ^68^Germanium | |
53323002 | Histidine acetyltransferase | |
53327001 | Blood group antibody Caw | |
53331007 | Platelet antibody HPA-1b | |
53353009 | Stibophen | |
53368005 | Phosphatidylserine decarboxylase | |
53382005 | B-cell antigen receptor (substance) | |
53393007 | Bromine radioisotope | |
53398003 | Staphylococcus toxin | |
53404008 | Thyroid aspartic proteinase | |
53405009 | Tripelennamine hydrochloride | |
53409003 | Blood group antigen Sieb | |
53410008 | Beer | |
53415003 | Plant anthraquinone glycoside | |
53426009 | Phosphoribosylamine-glycine ligase | |
53468009 | Acetylenedicarboxylate hydratase | |
53473003 | Apolipoprotein C | |
53475005 | beta-Glucoside kinase | |
53491008 | Aspergillus saitoi aspartic proteinase | |
53493006 | Dimethyl chlorthal | |
53499005 | Riboflavin mononucleotide | |
53511009 | Tropaeolin OO stain (substance) | |
53513007 | Psilocybine | |
53517008 | ^249^Californium | |
53519006 | Dichlorotetrafluoromethane | |
53527002 | Alcoholic beverage | |
53532001 | Cesium isotope | |
53545002 | Blood group antibody Cr1 | |
53553005 | HLA-DPw5 antigen | |
53557006 | Blood group antibody Starcher | |
53560004 | Zinc isotope | |
53563002 | Bismuth telluride | |
53577004 | Phthalylsulfacetamide | |
53588005 | Elaterin | |
53594002 | Abnormal hemoglobin, delta-chain variant | |
53598004 | Blood group antibody Ge3 | |
53606004 | IMP cyclohydrolase | |
53609006 | Thiaminase | |
53646005 | Fructose-6-phosphate | |
53673006 | Captan | |
53681007 | Colony-stimulating factor, granulocyte-macrophage | |
53682000 | Endorphin | |
53689009 | tRNA (adenine-N^1^)-methyltransferase | |
53692008 | ^150^Gadolinium | |
53699004 | Hemoglobin Alberta | |
53700003 | ^67^Copper | |
53716001 | Blood group antibody Kursteiner | |
53749005 | Glutathione thiolesterase | |
53777001 | Ethoxyquin | |
53784009 | Low incidence antibody | |
53794004 | Immunoglobulin, heavy chain fragment | |
53806002 | ^205^Bismuth | |
53817001 | Alkyl trimethyl ammonium chloride | |
53831001 | 3-Carboxy-cis,cis-muconate cycloisomerase | |
53834009 | Hemicellulose | |
53845007 | Bromisovalum (substance) | |
53856007 | Single chain urokinase-like plasminogen activator | |
53859000 | Methyl lomustine | |
53871006 | Blood group antigen Kp^b^ | |
53875002 | Colostrum | |
53876001 | Blood group antibody Suhany | |
53878000 | Diacetone alcohol | |
53882003 | Blood group antigen McC^a^ | |
53902004 | UDP-N-acetylglucosamine 2-epimerase | |
53914007 | Acetyl-CoA acetyltransferase | |
53934008 | Hemoglobin St. Lukes | |
53946007 | Butene | |
53951001 | Technetium Tc^99m^ oxidronate | |
53962001 | beta 1C/A globulin | |
53971005 | Blood group antibody Kuhn | |
53990002 | 4-alpha-Glucanotransferase | |
54005009 | Yeast ribonuclease | |
54024007 | Duodenal juice | |
54028005 | tRNA (cytosine-5)-methyltransferase | |
54041009 | Safflower oil | |
54045000 | Glyceraldehyde | |
54062005 | Cephalexin hydrochloride (substance) | |
54083004 | Iodic acid | |
54086007 | Hexylresorcinol | |
54103000 | Immunoglobulin, GM>18< allotype | |
54107004 | Sandalwood oil | |
54108009 | Sodium silicate | |
54112003 | Hemoglobin Gainesville | |
54140008 | Hemoglobin F-Dickinson | |
54141007 | Psyllium seed | |
54144004 | Factor IX complex preparation | |
54152001 | Nitrite reductase | |
54158002 | Procollagen-proline,2-oxoglutarate 3-dioxygenase | |
54159005 | Blood group antigen Es^a^ | |
54163003 | Diaminopimelate dehydrogenase | |
54167002 | Hemoglobin Sabine | |
54168007 | Plant quinolizidine alkaloid | |
54170003 | ^74^Arsenic | |
54172006 | Metaproterenol sulfate (substance) | |
54175008 | Hemoglobin St. Claude | |
54179002 | Strontium radioisotope | |
54180004 | S protein complement component | |
54188006 | Human placental lactogen | |
54195002 | Tissue factor antibody | |
54197005 | Cyclomethycaine | |
54202003 | Oil of ginger | |
54221006 | Orange G stain (substance) | |
54223009 | Glycerol-3-phosphate acyltransferase | |
54228000 | Fibrinogen Montreal I | |
54235008 | Histamine | |
54237000 | Lymphocyte antigen CD8 | |
54239002 | Aconitate hydratase | |
54245005 | Lithocholic acid | |
54248007 | Formate kinase | |
54252007 | Minor histocompatibility loci | |
54256005 | Aluminum isotope | |
54313002 | ^184^Tantalum | |
54323006 | Glycogen (starch) synthase | |
54331001 | Isooctyl alcohol | |
54338007 | Type 1 H substance | |
54340002 | Antimony potassium tartrate | |
54343000 | Blood group antibody Ryan | |
54346008 | D-Arginase | |
54351002 | Glutamine phenylacetyltransferase | |
54352009 | Histoplasmin | |
54353004 | Blood group antigen Hall J | |
54370007 | Coagulation factor IX Long Beach variant | |
54371006 | Alkyl mercuric chloride | |
54375002 | Oncogene protein LYL | |
54378000 | Coagulation factor IX | |
54390003 | Exodeoxyribonuclease V | |
54396009 | Leptodactylin | |
54401008 | Adenosylmethionine-8-amino-7-oxononanoate aminotransferase | |
54413003 | Blood group antibody Heibel | |
54416006 | von Willebrand receptor | |
54423007 | Testosterone 17beta-dehydrogenase (NADP^+^) | |
54428003 | Peptide-tryptophan 2,3-dioxygenase | |
54432009 | Alizarin blue S stain (substance) | |
54434005 | Hemoglobin Russ | |
54442006 | Right pleural fluid | |
54446009 | Lysolecithin | |
54456008 | Ribonuclease F | |
54462003 | Direct reacting bilirubin | |
54465001 | Lymphocyte antigen CD45RB | |
54475003 | Blood group antibody Lu16 | |
54481006 | HLA-B antigen | |
54506001 | Galactitol dehydrogenase | |
54508000 | Ferrocholinate | |
54517000 | Hydrogen selenide | |
54524004 | Blood group antigen Er^a^ | |
54526002 | Acetate | |
54534008 | 1-Chloro-1-nitropropane | |
54543004 | Plant triterpene | |
54546007 | Blood group antibody Jk^b^ | |
54548008 | Dichlobenil | |
54557002 | Blood group antigen Lagay | |
54563006 | Dental cement | |
54579007 | Deoxy adenosine diphosphate | |
54588003 | Croton oil | |
54592005 | Angiotensinogen | |
54600003 | Hemoglobin F-Hull | |
54628009 | D-Xylulose reductase | |
54633008 | ^232^Uranium | |
54643006 | Thiosulfate-thiol sulfurtransferase | |
54651009 | Maneb | |
54661002 | Alkyl sodium sulfonates | |
54663004 | Active C3b | |
54669000 | Dihydropteridine reductase | |
54673002 | Perchloric acid | |
54681001 | Blood group antigen Fy4 | |
54708003 | Extended zinc insulin | |
54717003 | Ethinamate | |
54724002 | Bile acid AND/OR bile salt (substance) | |
54729007 | Oxytetracycline hydrochloride | |
54732005 | Persic oil | |
54751004 | Chloroacetic acid | |
54753001 | Secondary amyl acetate | |
54760007 | Bryonin | |
54769008 | Serine acetyltransferase | |
54774000 | O-Succinyl homoserine (thiol)-lyase | |
54788001 | Hemoglobin F-Texas-II | |
54791001 | Metanil yellow stain (substance) | |
54800000 | Guanidinoacetate kinase | |
54804009 | ^181^Tungsten | |
54808007 | Cobalt | |
54813006 | Blood group antigen Jr^a^ | |
54821000 | Tryptophan (substance) | |
54832000 | Fructose-bisphosphatase | |
54835003 | Lithium chloride | |
54841005 | Hydrocyanic acid | |
54843008 | Plant terpene | |
54850007 | Blood group antibody Doughty | |
54855002 | Blood group antigen Gomez | |
54871002 | Acyl-lysine deacylase | |
54894001 | ^228^Radium | |
54901002 | Acetylesterase | |
54911009 | GDPglucosidase | |
54918003 | Dialkyl sodium sulfosuccinate | |
54932001 | Thymol | |
54939005 | Dimethylmalate dehydrogenase | |
54941006 | Adenosine phosphate | |
54965009 | Hemoglobin Porto Alegre | |
54966005 | Phenyl ether-biphenyl vapor mixture | |
54968006 | Tetraethyl dithiopyrophosphate | |
54976008 | Phenyl ether | |
54994002 | 1,3-beta-Oligoglucan phosphorylase | |
55035009 | Blood group antibody Kopman | |
55036005 | HLA-Aw66 antigen | |
55049000 | Carbon trichloride | |
55090002 | Chondro-4-sulfatase | |
55092005 | Blood group antigen Sw^a^ | |
55100009 | Blood group antigen M>1< | |
55110000 | Pentasodium tripolyphosphate | |
55117002 | ^137^Cesium | |
55119004 | Immunoglobulin IgA1, H chain (substance) | |
55122002 | Blood group antigen Tg^a^ | |
55123007 | Diphtheria toxin | |
55124001 | Molindone hydrochloride | |
55128003 | Allyl cinerin (substance) | |
55138008 | Permanganate salt | |
55159001 | Blood group antigen Binge | |
55170008 | Uroporphyrin | |
55201001 | Amine receptor | |
55202008 | Methoxychlor | |
55203003 | Loliine | |
55224008 | Trichloropropane | |
55261004 | Fumonisin | |
55291009 | Pholcoline | |
55302006 | Phosphoribosyl-ATP pyrophosphatase | |
55316001 | Colestipol hydrochloride | |
55324006 | Helium isotope | |
55325007 | Homoisocitrate dehydrogenase | |
55328009 | ^28^Magnesium | |
55330006 | Subtilisin | |
55354001 | Fructose-2,6-bisphosphatase | |
55358003 | Thiouracil | |
55368008 | Vanadium compound | |
55386006 | Ricinine nitrilase | |
55403000 | Sulfate adenylyltransferase | |
55435000 | Nafcillin sodium | |
55443005 | Hydroxycyclohexanecarboxylate dehydrogenase | |
55450009 | Extracellular fluid | |
55451008 | Blood group antigen Nou (substance) | |
55452001 | Oxycodone | |
55477000 | Glutathione | |
55486005 | Antipyrine (substance) | |
55491006 | Strophanthin | |
55494003 | Technetium Tc^99m^ albumin microspheres (substance) | |
55495002 | Acidulated phosphate fluoride | |
55500004 | Hemoglobin Perth | |
55503002 | Sex steroid binding globulin | |
55507001 | Iron oxide fumes | |
55508006 | Bufogenin | |
55515003 | Hemoglobin Köln (substance) | |
55521004 | Phosphatidyl inositol | |
55522006 | Fc receptor | |
55527000 | Geraniol | |
55535002 | ^113m^Cadmium | |
55540005 | Ferrous carbonate | |
55549006 | Blood group antigen Ridd | |
55559007 | ^36^Chlorine | |
55579004 | Coagulation factor II San Juan 2 variant | |
55582009 | Arginase | |
55583004 | Lathyrus poison | |
55624000 | Inosine nucleosidase | |
55633003 | Unstable hemoglobin | |
55636006 | Octyl cresol | |
55657003 | Estradiol 17alpha-dehydrogenase | |
55660005 | Blood group antigen f | |
55667008 | UDP-N-acetylmuramoylalanyl-D-glutamyl-lysine-D-alamyl-D-alanine ligase | |
55683008 | Hemoglobin Kokura | |
55691004 | Dibenzocycloheptane derivative | |
55695008 | Blood group antigen Kemma | |
55700001 | Nylon | |
55706007 | Fibrinogen Wiesbaden (substance) | |
55723003 | Fibrin degradation product, intermediate derivative | |
55724009 | Potassium salt | |
55727002 | Barium dust | |
55729004 | Blood group antibody At^a^ | |
55741006 | Methenamine hippurate | |
55753005 | Furfuraldehyde | |
55755003 | Blood group antigen Pollio | |
55762007 | Acrylic acid | |
55763002 | Micrococcal nuclease | |
55789002 | Porphobilinogen | |
55792003 | Rotenone | |
55793008 | Anileridine | |
55795001 | Human leukocyte antigen abnormal (substance) | |
55808004 | Malonate-semialdehyde dehydrogenase (acetylating) | |
55813000 | 4-Enoyl-CoA reductase (NADPH) | |
55814006 | Iodinated I^131^ aggregated albumin | |
55816008 | Amino alcohol (substance) | |
55831004 | Xylene cyanol FF stain (substance) | |
55835008 | Blood group antibody Wu | |
55840000 | CMP-N-acetylneuraminate-alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase | |
55848007 | Blood group antibody Gon | |
55877008 | Hemoglobin Fort Gordon | |
55880009 | p-Toluenediamine | |
55882001 | White wax | |
55884000 | ^189m^Osmium | |
55886003 | Cytosol aminopeptidase | |
55895006 | Soft coal | |
55900005 | Fatty-acid peroxidase | |
55902002 | Benzyl alcohol | |
55917003 | Glucosamine kinase | |
55922003 | Blood group antigen Ge2 | |
55939001 | Dihydrosphingosine | |
55944008 | Niridazole | |
55946005 | Pectin (substance) | |
55951004 | ^38^Chlorine | |
55972001 | Silicate salt | |
56003000 | Glycerol-3-phosphate dehydrogenase (NAD(P)^+^) | |
56006008 | Indium^113^ oxoquinoline platelet label | |
56022009 | Right middle lobe mucus | |
56024005 | Methylmalonyl-CoA mutase | |
56025006 | D-Lactaldehyde dehydrogenase | |
56065005 | Spermaceti | |
56066006 | Turacin | |
56071004 | Blood group antigen Thompson | |
56085009 | Hyoscyamine sulfate | |
56104009 | D-Lysine 5,6-aminomutase | |
56114000 | HLA-Dw6 antigen | |
56117007 | Air bubble | |
56139009 | Glutaminyl-tRNA cyclotransferase | |
56146000 | Androstenedione | |
56147009 | Bufotenine | |
56150007 | ^243^Plutonium | |
56156001 | Desoxycorticosterone acetate | |
56158000 | ^58m^Cobalt (substance) | |
56163001 | Burr | |
56167000 | Potassium radioisotope | |
56181003 | Chlorinated hydrocarbon | |
56227008 | Trolnitrate phosphate | |
56232009 | HLA-Dw10 antigen | |
56248005 | Blood group antigen Kp^c^ | |
56261005 | Hydroxy phenylpyruvic acid, para | |
56282004 | 2,3-Dihydroxybenzoate 2,3-dioxygenase | |
56286001 | Blood group antibody Bouteille | |
56297001 | Propoxyphene hydrochloride (substance) | |
56312005 | HLA-Cw10 antigen | |
56314006 | Silver fluoride | |
56325002 | Carbromal | |
56328000 | Fibrinogen Homberg III | |
56339002 | Saprol | |
56352007 | Fibrinogen Giessen I (substance) | |
56355009 | Clostridium histolyticum collagenase | |
56362000 | L-Gulonolactone oxidase | |
56363005 | Adenosine kinase | |
56374001 | Plasminogen activator inhibitor-2 | |
56382001 | Hemoglobin G-Galveston | |
56383006 | Leucocyanidin | |
56389005 | Etafedrine | |
56410003 | Heterophil antibody | |
56412006 | Arsine | |
56414007 | Galactolipase | |
56427006 | Metallic alloy | |
56436005 | Sulfanilamide | |
56448008 | Kallidin I | |
56455005 | Anthranilate synthase | |
56471005 | Colonic vomitus | |
56473008 | Ethyl dipropylthiocarbamate | |
56475001 | Disodium indium^111^ | |
56489006 | Blood group substance | |
56499001 | Blood group antigen Ul^a^ | |
56516007 | Very low density lipoprotein | |
56521005 | Lymphocyte antigen CDw49b | |
56523008 | Sequoyitol dehydrogenase | |
56534006 | Hemoglobin Chico | |
56564003 | Fusion protein BCR-ABL | |
56566001 | ^88^Krypton | |
56567005 | Lymphocyte antigen CD39 | |
56586002 | Skatole | |
56590000 | Methylene biphenyl isocyanate | |
56592008 | Hemoglobin C-Ziguinchor | |
56594009 | di-trans,poly-cis-Decaprenylcistransferase | |
56609000 | ^111^Indium | |
56613007 | Bretylium tosylate (substance) | |
56617008 | Blood group antibody Gerhany | |
56634000 | Methyl formate | |
56695001 | Guanosine-triphosphate guanylyltransferase | |
56702000 | Pyruvate dehydrogenase (lipoamide) | |
56714008 | Bombesin | |
56715009 | Chlorcyclizine | |
56723006 | Penicillin V potassium (substance) | |
56735005 | Blood group antibody Dropik | |
56736006 | Methionine-tRNA ligase | |
56740002 | Triiodotyrosine | |
56747004 | Lymphocyte antigen CD40 | |
56750001 | Blood group antibody In^a^ | |
56755006 | Actinium compound | |
56762002 | Stimulant laxative | |
56773009 | Ichthyocrinotoxin | |
56774003 | 4,5-Dihydroxyphthalate decarboxylase | |
56781005 | Rhodotorula aspartic proteinase (substance) | |
56796009 | Alloxan | |
56822005 | Quaternary ammonium salt | |
56838004 | NADH dehydrogenase (quinone) | |
56846003 | N-Acetylglucosamine deacetylase | |
56866007 | Blood group antibody Ri^a^ | |
56867003 | Indium^113^ oxoquinoline RBC label | |
56877001 | Kanamycin kinase | |
56885005 | Blood group antibody Carson | |
56886006 | Strontium compound | |
56891007 | Independent high incidence blood group antigen | |
56898001 | Protein S | |
56899009 | ^125^Xenon | |
56902007 | Methylitaconate delta-isomerase | |
56904008 | Tungsten isotope | |
56926009 | Hemoglobin J-Daloa | |
56933009 | Blood group antibody Nijhuis | |
56935002 | Alanine aminotransferase | |
56942002 | Free fatty acid-albumin complex | |
56945000 | Blood group antibody Fy3 | |
56958004 | Barium compound (substance) | |
56980001 | Hemoglobin Rahere | |
57031001 | 1,1,-Dichloropropane | |
57037002 | Fibrin degradation product, small peptide | |
57040002 | Dibutyl adipate | |
57051002 | Hemoglobin C-Harlem | |
57056007 | Alkaline phosphatase | |
57064001 | Fibrinogen Quebec I | |
57076001 | Active C3bBb | |
57078000 | H^+^-transporting ATP synthase | |
57082003 | Arylesterase | |
57090003 | Collagen type III | |
57091004 | Methylisocitrate lyase | |
57126000 | Glue | |
57133000 | HLA antigen absent | |
57150003 | Blood group antibody Eggenberger | |
57155008 | Pyruvate dehydrogenase lipoamide-phosphatase | |
57164003 | Dyclonine hydrochloride | |
57178002 | Hemoglobin Henri Mondor | |
57198007 | Lemon oil | |
57199004 | Plasminogen activator inhibitor-1 | |
57228007 | Blood group antibody Knoebnchild | |
57244003 | 11-Ketoandrosterone | |
57251007 | 2,6-beta-Fructan 6-levan biohydrolase | |
57259009 | Gallbladder bile | |
57268006 | Blood group antigen Oliver | |
57272005 | Iodine compound | |
57273000 | Zinc radioisotope | |
57279001 | ^57^Nickel | |
57281004 | Blood group antigen Re^a^ (substance) | |
57294002 | Z line material | |
57308006 | Acetylcholine | |
57318001 | Blood group antibody Lu7 | |
57362005 | 3-Oxoadipate enol-lactonase | |
57377002 | Blood group antigen Lu9 | |
57400003 | Phenol 2-monooxygenase | |
57439007 | Blood group antigen JMH | |
57440009 | Glycine hydroxymethyltransferase | |
57442001 | Acylphosphatase | |
57452002 | Homocitrate synthase | |
57454001 | Metalloporphyrin | |
57466007 | Phenyl cyclohexanol | |
57471000 | Methyl flamprop | |
57479003 | Air contaminant | |
57519005 | Inorganic tin compound | |
57528006 | Furylfuramide isomerase | |
57529003 | Blood group antibody Marcus | |
57533005 | Thioglucosidase | |
57542003 | Glycerol dehydratase | |
57562006 | dTDPdihydrostreptose-streptidine-6-phosphate dihydrostreptosyltransferase | |
57573004 | Hemoglobin Beijing | |
57574005 | Loperamide hydrochloride | |
57575006 | Alkali-resistant hemoglobin | |
57583000 | Naphazoline hydrochloride | |
57595000 | Blood group antibody Kowanski | |
57601008 | ^238^Plutonium | |
57634005 | Iodophenol methyltransferase | |
57635006 | N-butyl lactate | |
57641004 | HLA-Dw2 antigen | |
57649002 | Rhodopsin | |
57678001 | Blood group antibody Jones | |
57679009 | Ethanolamine-phosphate phospho-lyase | |
57707004 | 2-Haloacid dehalogenase | |
57720001 | Anise oil | |
57743005 | Butyrate-CoA ligase | |
57753006 | Brilliant yellow stain (substance) | |
57763003 | Uridine | |
57765005 | Aminopeptidase | |
57795002 | Chemical element | |
57808000 | beta-Thromboglobulin | |
57813001 | Heme | |
57818005 | Scillaren B | |
57827006 | Dihydroxyfumarate decarboxylase | |
57830004 | Immunoglobulin, joining region | |
57837001 | Blood group antibody Ridd | |
57842009 | Coagulation factor X Friuli variant | |
57843004 | Hemoglobin Okayama | |
57851001 | Propyl nitrate | |
57858007 | Guanosine diphosphate | |
57859004 | Cyclohexamide | |
57860009 | Hemoglobin Genova | |
57868002 | Dichlorvos | |
57880005 | Ascorbate 2,3-dioxygenase | |
57894006 | Hemoglobin Lille | |
57899001 | Zineb | |
57911003 | Methotrimeprazine hydrochloride | |
57912005 | Blood group antigen Enriquez | |
57913000 | Anisotropine | |
57915007 | Propylene oxide | |
57916008 | Pyruvate oxidase | |
57939002 | Benzene | |
57959003 | ^205^Lead | |
57960008 | Ferrochelatase | |
57969009 | Deoxyadenosine kinase | |
57979006 | Picrotoxin | |
57986003 | Semisynthetic alkaloid | |
58014006 | Diphosphomevalonate decarboxylase | |
58017004 | Blood group antigen P1 | |
58018009 | Cevadine | |
58035008 | Blood group antibody Arun | |
58043003 | NAD(P)^+^ arginine ADP-ribosyltransferase | |
58046006 | gamma-Butyrobetaine, 2-oxoglutarate dioxygenase | |
58049004 | Glutamate synthase (NADPH) | |
58072002 | Monokine | |
58089005 | mRNA (nucleoside-O^2^)'-methyltransferase | |
58131001 | Alpha particle | |
58132008 | Monodehydroascorbate reductase (NADH) | |
58138007 | Thiamin pyrophosphokinase | |
58139004 | Zirconium oxide | |
58151002 | HLA-DPw4 antigen | |
58152009 | Bacitracin C | |
58163007 | Lactic dehydrogenase isoenzyme | |
58165000 | Hemoglobin Gavello | |
58173009 | Prostaglandin PGF2 alpha tromethamine (substance) | |
58182003 | Blasticidin-S deaminase | |
58186000 | Methyl phenyl ethyl hydantoin | |
58187009 | Phosphoenolpyruvate carboxykinase (pyrophosphate) | |
58195008 | Genetic code | |
58202007 | Fructose | |
58232004 | Blood group antibody Ven | |
58233009 | Meclofenamate sodium | |
58254002 | Blood group antigen Hg^a^ | |
58257009 | D-Lactate dehydrogenase (cytochrome) | |
58272008 | n-Acetyl muramic acid | |
58279004 | Selenium hexafluoride | |
58281002 | Gadolinium | |
58292001 | Selenium sulfide | |
58295004 | Inorganic chemical | |
58305007 | Blood group antibody McC^a^ | |
58313008 | Succinate-CoA ligase (GDP-forming) | |
58319007 | Blood group antigen Kollogo | |
58325006 | Methsuximide (substance) | |
58339006 | Saccharopine dehydrogenase (NAD^+^,L-lysine-forming) | |
58343005 | Cefonicid | |
58345003 | Phosphoric acid | |
58348001 | Sex chromatin | |
58364009 | Blood group antibody HLA-A10 | |
58368007 | Blood group antibody Englund | |
58369004 | Pyrroline-5-carboxylate reductase | |
58370003 | Coproporphyrinogen oxidase | |
58376009 | Anisidine | |
58397005 | Alkanal monooxygenase (FMN-Iinked) | |
58402009 | HLA-A11 antigen | |
58414001 | Hemoglobin Yusa | |
58416004 | Kanamycin 6'-acetyltransferase | |
58422008 | Methyl acrylate | |
58441006 | Mannitol dehydrogenase | |
58447005 | Tetrachlorodibenzofuran | |
58449008 | Industrial smog | |
58453005 | Blood group antigen Duvall | |
58461000 | Metaraminol bitartrate | |
58466005 | Propionate CoA-transferase | |
58505008 | Plant isoquinoline alkaloid | |
58520002 | Collagen type I | |
58529001 | Hydroxylamine reductase (NADH) | |
58536000 | Antimony dimercaptosuccinate | |
58541008 | ^24^Sodium | |
58560001 | Blood group antigen Teremok | |
58573002 | 2-Ethoxyethyl acetate | |
58578006 | UDPgalacturonosyltransferase | |
58591007 | Nucleoside-triphosphate-adenylate kinase | |
58594004 | Blood group antigen Zwal | |
58595003 | Carboxylic salt | |
58597006 | DNA-deoxyinosine glycosidase | |
58607005 | Neutron | |
58613001 | Interleukin-3 | |
58616009 | Githagenin | |
58620008 | Sporidesmin | |
58624004 | Fibrinogen Philadelphia | |
58630004 | Protein-disulfide reductase (NAD(P)H) | |
58631000 | Eriochrome blue black SE stain (substance) | |
58644005 | Dolichol kinase | |
58649000 | Cosmetic cream | |
58652008 | N^4^(beta-N-Acetylglucosaminyl)-L-asparaginase | |
58656006 | Ferredoxin-nitrite reductase | |
58674002 | Naphthol | |
58679007 | Blood group antibody Peacock | |
58680005 | Glutamate acetyltransferase | |
58687008 | p-tert-Butylphenol | |
58693000 | Sodium bromide | |
58721000 | Limonite | |
58730008 | Factor VIII antibody | |
58732000 | Red wine | |
58739009 | Valine-pyruvate aminotransferase | |
58745001 | ^195^Gold | |
58753009 | Alanine | |
58755002 | Water soluble anthracene brown stain (substance) | |
58765008 | Uroporphyrin I | |
58775006 | Phosphatidylinositol deacylase | |
58782005 | ^85m^Yttrium | |
58783000 | Amylase isoenzyme | |
58787004 | Aspartate-tRNA ligase | |
58789001 | Nicotinamidase | |
58792002 | ^149^Gadolinium | |
58793007 | Pinene hydrochloride | |
58794001 | Monoterpenol acetyltransferase | |
58796004 | ^211^Bismuth | |
58799006 | Cucurbitacin | |
58804001 | Fibrinogen Bern II | |
58831003 | Hemoglobin Sawara | |
58847001 | Thiamin-diphosphate kinase | |
58876003 | ^186^Platinum | |
58891001 | Salivary amylase | |
58900009 | Properdin | |
58907007 | Succinylcholine chloride (substance) | |
58910000 | Fibrinogen Genova I | |
58927008 | Beryllium fumes | |
58955007 | Adenylate isopentenyltransferase | |
58956008 | Trazodone hydrochloride | |
58962003 | Chrysarobin | |
58971007 | Petroleum sulfonate | |
58975003 | Blood group antigen Dh^a^ | |
58977006 | Magnesium salt | |
58995009 | Pseudomonas aeruginosa neutral proteinase | |
58996005 | Dieldrin | |
59001002 | ^197m^Platinum | |
59015000 | Guanosine 3',5'-bis(diphosphate) 3'-pyrophosphatase | |
59025005 | Iridium compound | |
59027002 | Peroxidase | |
59031008 | Liquefied phenol | |
59034000 | Tromethamine (substance) | |
59036003 | Silver radioisotope | |
59040007 | Sarcina neutral proteinase | |
59045002 | Hemoglobin Winnipeg | |
59071003 | Vinyl ether | |
59072005 | 3-Hydroxy-2-methylbutyryl-CoA dehydrogenase | |
59074006 | Butyrate-acetoacetate CoA-transferase | |
59075007 | Blood group antibody Paris | |
59082006 | Urokinase (substance) | |
59087000 | Coagulation factor XI variant type I | |
59094002 | Melanin | |
59111007 | Blood group antigen K22 | |
59119009 | Ichthyosarcotoxin | |
59134003 | Lymphogranuloma venereum antigen | |
59147008 | Active C5b6 | |
59149006 | Tetrodotoxin | |
59161003 | Thymic erythropoietin suppression factor | |
59162005 | Lysophosphatide | |
59163000 | Fibrinogen Valencia | |
59170000 | Dextrothyroxine | |
59195004 | Site-specific methyltransferase (adenine-specific) | |
59202000 | Actinium radioisotope | |
59203005 | Thiol sulfotransferase | |
59205003 | Blood group antibody Ge2 | |
59208001 | Adrenergic receptor | |
59224000 | Ethyl nitrophenyl thiobenzene | |
59226003 | 4-2,4-Dichlorophenoxybutanoic acid | |
59231001 | 5-Hydroxyfuranocoumarin O^5^-methyltransferase | |
59241003 | 5-Oxoprolinase (ATP-hydrolysing) | |
59243000 | Nucleotidase | |
59259000 | ^191^Mercury | |
59267008 | L-Fuconate dehydratase | |
59268003 | Tubulin | |
59271006 | C6 inactivator | |
59287009 | ^180m^Hafnium | |
59308003 | Dimethylsulfate | |
59312009 | Blood group antigen Pr>a< | |
59314005 | Pipradrol | |
59318008 | Arsenic pentoxide | |
59334006 | Cement, industrial | |
59338009 | Methapyrilene | |
59339001 | Hemoglobin Albany-Suma | |
59347001 | Blood group antigen A 8306 | |
59351004 | Citrate | |
59353001 | ^187^Tungsten | |
59365002 | Caraway oil | |
59375004 | Lymphocyte antigen CD53 | |
59386002 | Fetuin | |
59406000 | Blood group antibody Krog | |
59414006 | Stercobilin | |
59431004 | Ketone | |
59433001 | Human chorionic gonadotropin | |
59435008 | Creatine kinase isoenzyme | |
59439002 | Conglutinogen | |
59440000 | Diglycidyl ether | |
59442008 | Nitric acid | |
59485004 | Hemoglobin Koya Dora | |
59488002 | Phenprocoumon | |
59489005 | Calusterone | |
59497003 | Choline sulfotransferase | |
59501008 | Actinomycin lactonase | |
59525000 | Hemoglobin J-Cape Town | |
59526004 | Florantyrone | |
59533004 | Food additive | |
59541004 | ^175^Tantalum | |
59542006 | Blood group antibody IB | |
59545008 | Pesticide | |
59549002 | Fibrinogen Milano II | |
59560006 | Mepivacaine | |
59570008 | Transferrin | |
59584003 | Mercurous sulfate | |
59595009 | Verdochromogen | |
59605005 | Blood group antigen Whittaker | |
59610009 | Left lower lobe mucus | |
59718005 | N-Acylneuraminate-9-phosphate synthase (substance) | |
59723005 | HLA-A31 antigen | |
59732007 | Hemoglobin Perspolis | |
59737001 | Blood group antibody Co^a^ | |
59755005 | Muscarine | |
59759004 | Bacitracin B | |
59776000 | Calcium cyanide | |
59779007 | Human chorionic gonadotropin, alpha subunit | |
59787008 | Hemoglobin Creteil | |
59801003 | Rhodium | |
59804006 | Glycoprotein | |
59808009 | Blood group antibody Man | |
59815001 | Azoxybenzene | |
59822009 | Histamine H2 receptor | |
59835000 | Lymphocyte antigen CDw50 | |
59840008 | Blood group antibody Zt^a^ | |
59842000 | Nicotinate-nucleotide adenylyltransferase | |
59844004 | ^42^Potassium | |
59865005 | Complement component C1q | |
59872006 | ^198^Thallium | |
59880004 | Hemoglobin J-Calabria | |
59882007 | Aminocaproic acid | |
59888006 | Carnitine | |
59895002 | Blood group antibody Tichmeyer | |
59905008 | Isoantibody | |
59906009 | Glucose dehydrogenase (pyrroloquinolinequinone) | |
59924006 | Polynucleotide adenylyltransferase | |
59937009 | Cephalothin sodium (substance) | |
59938004 | ^208^Thallium | |
59951009 | 4-Pyridoxolactonase | |
59954001 | Oxaloacetate tautomerase | |
59961002 | Eye liner | |
59964005 | ^192^Gold | |
59987002 | Polyoxyethelene 4 sorbitan monostearate | |
60018006 | Amrinone lactate | |
60047004 | Oncogene protein c-fms | |
60052009 | Venom exonuclease | |
60057003 | ^201^Thallium | |
60061009 | Protein N-acetylglucosaminyltransferase | |
60069006 | Plutonium compound | |
60085001 | Chromatin | |
60135007 | Homosalate | |
60141000 | Ribonuclease P4 | |
60153001 | gamma-Glutamyltransferase | |
60175004 | Formate-tetrahydrofolate ligase | |
60187006 | NADPH peroxidase | |
60200001 | Glyoxylate reductase | |
60208008 | Coagulation factor V | |
60215000 | HLA-A2 antigen | |
60244003 | 3-Dehydroretinol | |
60245002 | ^240^Californium | |
60253005 | Aminoacylase | |
60260004 | Histidine | |
60266005 | Chloroquine hydrochloride | |
60273000 | ^220^Radon | |
60289002 | Mepenzolate bromide | |
60292003 | Blood group antigen I^D^ | |
60300004 | Blood group antibody C^G^ | |
60303002 | Dinitrobenzene | |
60310008 | Mytilidase | |
60323001 | Mercuric oxycyanide | |
60343007 | D-Lyxose ketol-isomerase | |
60344001 | Malonate-semialdehyde dehydrogenase | |
60345000 | Cobalt hydrocarbonyl | |
60349006 | Uridylic acid | |
60351005 | Salicylate 1-monooxygenase | |
60352003 | Anthocyanin | |
60355001 | Hemoglobin Philly | |
60364006 | Blood group antibody McC^b^ | |
60373003 | Cathepsin H | |
60376006 | Succinic acid | |
60381002 | Nickel fluoride | |
60403001 | beta-Amylase | |
60407000 | Lymphocyte antigen CD46 | |
60418000 | Serine dehydrogenase | |
60424006 | Acetylserotonin methyltransferase | |
60430006 | FSH receptor | |
60441008 | Trypan blue stain (substance) | |
60444000 | tRNA (guanosine-O^2'^)-methyltransferase | |
60449005 | Putrescine oxidase | |
60455000 | Racephedrine | |
60457008 | Proprionic acid | |
60459006 | Iron Fe^59^ labeled dextran | |
60469000 | C>5b678< inhibitor | |
60470004 | Blood group antigen Marcus | |
60471000 | Sodium compound | |
60489004 | Hemoglobin J-Habana | |
60491007 | Blood group antigen Bothrops | |
60500000 | Cysteine lyase | |
60516003 | Blood group antibody McDermott | |
60526005 | Acetyl salicylate | |
60530008 | Aldehyde | |
60543008 | ^78^Arsenic | |
60544002 | Aminoamide | |
60556001 | Glutamate-methylamine ligase | |
60575006 | Blood group antibody Wiggins | |
60577003 | Glucan 1,4-beta-glucosidase | |
60596004 | Hemoglobin Providence | |
60598003 | Operator gene | |
60605004 | Hepatitis B e antigen | |
60617002 | Nitrogenase (flavodoxin) | |
60663008 | Phosphatidyl-N-methylethanolamine methyltransferase | |
60702005 | Myelin protein | |
60714002 | Fibrin degradation product, E fragment | |
60717009 | Blood group antibody John Smith | |
60722009 | Serine-sulfate ammonia-lyase | |
60727003 | Miconazole nitrate | |
60739006 | Waxoline blue stain (substance) | |
60740008 | Dolichyl-phosphatase (substance) | |
60760000 | Reverse T>3< | |
60762008 | Cysteine-conjugate beta-lyase | |
60764009 | Neovitamin A | |
60769004 | Hard metal | |
60772006 | Blood group antibody Rasmussen | |
60792004 | HLA-Cw4 antigen | |
60793009 | Smegma | |
60803009 | Protocollagen | |
60808000 | Fibrinogen Marburg | |
60838006 | Blood group antigen Holmes | |
60840001 | Blood group antigen Horw | |
60842009 | Hemoglobin Agenogi | |
60848008 | Blood group antibody Lu17 | |
60860009 | Hemoglobin F-Caltech | |
60868002 | Blood group antigen MZ 443 | |
60872003 | Acetic naphthalene | |
60874002 | Blood group antigen Au^a^ | |
60884001 | Procollagen | |
60885000 | Trisulfapyrimidines | |
60886004 | Morphine sulfate | |
60889006 | Hemoglobin Guangzhou-Hangzhou | |
60904002 | HLA-Cw6 antigen | |
60905001 | Salicylanilide | |
60908004 | ^125^Tin | |
60917004 | Cholinesulfatase | |
60920007 | Fuchsin acid stain (substance) | |
60924003 | Fibrinogen Paris II | |
60925002 | Hemoglobin Tübingen | |
60943003 | Glutamate-5-semialdehyde dehydrogenase | |
60976004 | w-Hydroxydecanoate dehydrogenase | |
60988002 | Tolmetin sodium | |
61004005 | Blood group antigen Wiggins | |
61010005 | Solvent | |
61015000 | Blood group antibody Craig | |
61024009 | Blood group antibody Bruno | |
61025005 | Colloidal iodine | |
61029004 | Hemoglobin Arlington Park | |
61044003 | Acipenserin | |
61045002 | Sedoheptulose | |
61068006 | Thioflavine T stain (substance) | |
61076008 | Hemoglobin Beth Israel | |
61078009 | Progesterone receptor | |
61088005 | Plastic | |
61103002 | Choline-phosphate cytidylyltransferase | |
61114004 | Chymase | |
61116002 | Immunoglobulin, GM allotype | |
61133009 | Cytochrome-c-lysine methyltransferase | |
61149006 | 4-Acetamidobutyryl-CoA deacetylase | |
61171001 | Maleylpyruvate isomerase | |
61177002 | Arachidonate 15-lipoxygenase | |
61178007 | Neamine | |
61188008 | Extracellular fibril | |
61190009 | Blood group antibody Payer | |
61195004 | D-Glutaminase | |
61201007 | Pheophytin | |
61205003 | Molten metal (substance) | |
61224000 | Deoxyribonuclease V | |
61226003 | ^201^Lead | |
61238007 | Creatine kinase isoenzyme, MM fraction | |
61243000 | Orotidine-5'-phosphate decarboxylase | |
61244006 | Monobasic potassium phosphate | |
61245007 | Hemoglobin Cochin-Port Royal | |
61268003 | Gastrointestinal contents | |
61271006 | Blood group antibody s | |
61275002 | Triiodothyronine | |
61298005 | Acyl-CoA dehydrogenase (NADP^+^) | |
61299002 | Enkephalin | |
61306004 | Methylrosaniline | |
61308003 | Putrescine carbamoyltransferase | |
61321005 | Cancer-related substance | |
61348006 | Lombricine kinase | |
61357000 | Paramethadione | |
61359002 | Thiosulfuric acid | |
61360007 | Polymyxin B sulfate | |
61384004 | Camphene | |
61391001 | Temuline | |
61398007 | Chlophedianol (substance) | |
61418009 | Nitroquinoline-N-oxide reductase | |
61425002 | C reactive protein | |
61429008 | Bismuth radioisotope | |
61450004 | Dibromochloropropane | |
61453002 | Glutarate-CoA ligase | |
61454008 | Immune response gene | |
61466002 | Uridine nucleosidase | |
61467006 | Ribitol dehydrogenase | |
61471009 | Chloride trifluoride | |
61472002 | Collagen | |
61479006 | Galactosylxylosylprotein 3-beta-galactosyltransferase | |
61481008 | Amanitine | |
61483006 | Azaribine | |
61489005 | 1-Aminocyclopropane-1-carboxylate synthase | |
61497003 | Latia-luciferin monooxygenase (demethylating) | |
61505004 | Plant mitogen | |
61527008 | Radium radioisotope | |
61529006 | 4-Cresol dehydrogenase (hydroxylating) | |
61540003 | Oil of hyssop | |
61541004 | Dichlorophenoxy ethyl sulfate | |
61566000 | Benzene 1,2-dioxygenase | |
61573005 | Dehydro-L-gulonate decarboxylase | |
61580007 | Red cell neutral endopeptidase | |
61581006 | Carbendazim | |
61588000 | Thymidine kinase | |
61595009 | Octane | |
61615004 | Aspergillus nuclease S>1< | |
61617007 | 7alpha-Hydroxysteroid dehydrogenase | |
61630008 | Chondroitin AC lyase | |
61643008 | Isocitrate lyase (substance) | |
61644002 | Solanain | |
61655002 | Blood group antigen Kasamatsuo | |
61664007 | Ribonuclease V | |
61678008 | Fluphenazine hydrochloride | |
61684006 | ^211^Radon | |
61692002 | Chromoprotein | |
61694001 | Ribonucleoside | |
61709008 | Cinchophen | |
61716009 | ^81m^Krypton | |
61730004 | Ketotetrose-phosphate aldolase | |
61731000 | Methyl isobutyl carbinol | |
61736005 | Heavy metal compound | |
61742009 | Biperiden lactate | |
61765004 | Hemoglobin Altdorf | |
61773008 | Lidocaine hydrochloride | |
61789006 | Dye | |
61795007 | Corticotropin-like intermediate lobe peptide | |
61813008 | Fibrinogen Chapel Hill I | |
61833007 | Blood group antibody Li^a^ | |
61841007 | Complement activator | |
61849009 | Disperse orange | |
61863003 | Barium sulfide | |
61864009 | Vinca alkaloid | |
61871004 | Alanine-oxo-acid aminotransferase | |
61872006 | Lactaldehyde reductase | |
61899008 | Dextrothyroxine sodium | |
61904007 | Phensuximide | |
61905008 | Methylcyclohexanol | |
61915002 | Blood group antigen Walin | |
61925007 | Rubratoxin | |
61936000 | Nicotinamide methyltransferase | |
61944000 | Collagen type II | |
61967003 | Hemoglobin C | |
61971000 | Butyrate kinase | |
61978006 | Blood group antibody Burrett | |
61993005 | Allergoid | |
61994004 | Haptoglobin 2-2 | |
62003001 | Blood group antigen Boldog | |
62004007 | Blood group antigen Lu8 | |
62007000 | Blood group antigen Kowanski | |
62027004 | Hexadecanol dehydrogenase | |
62032003 | Dextransucrase | |
62036000 | Titanium dioxide | |
62038004 | HLA-DR antigen | |
62039007 | Diclofenac sodium | |
62044000 | Isopentenyl-diphosphate delta-isomerase | |
62046003 | Pyrophosphate-protein phosphotransferase | |
62053007 | Nylon 6 | |
62059006 | Gastric contents | |
62070004 | Dibromsalicylanilide | |
62077001 | 2-Methoxyethanol acetate | |
62097006 | Chlorate reductase | |
62128007 | Kerosene | |
62135004 | Protein xylosyltransferase | |
62145002 | Fibrinogen Aarhus | |
62150008 | Hemoglobin Sendagi | |
62162007 | ^90m^Zirconium | |
62167001 | Quinate dehydrogenase | |
62168006 | Fibrinogen antibody | |
62174006 | Fructose-1-6-phosphate | |
62177004 | Tantalum compound | |
62183001 | Collagen fiber | |
62184007 | Hemoglobin Collingwood | |
62194002 | Lung irritant chemical warfare agent | |
62197009 | Nucleoside-diphosphate kinase | |
62214005 | Phosphatidic acid | |
62237004 | Mesoporphyrin | |
62249003 | HLA-Cw5 antigen | |
62252006 | Plasminogen | |
62256009 | Bilirubin monoglucuronide | |
62265002 | Acylagmatine amidase | |
62267005 | Capsular-polysaccharide endo-1,3-alpha-galactosidase | |
62298007 | Melanocyte hormone inhibiting factor | |
62301006 | Thiamin oxidase | |
62304003 | Mercuric sulfate | |
62346007 | Phloretin hydrolase | |
62352008 | 6-beta Hydroxycortisol | |
62358007 | Blood group antibody Bio-5 | |
62364000 | Monomethyl aniline | |
62368002 | Erythrityl tetranitrate (substance) | |
62384001 | Fibrinogen Oslo I | |
62387008 | ^109m^Silver | |
62412007 | Dipeptidyl peptidase IV | |
62416005 | Formaldehyde transketolase | |
62417001 | trans-Cinnamate 4-monooxygenase | |
62421008 | Blood group antibody Henry | |
62442005 | Chloriodized oil | |
62443000 | Hemoglobin Christchurch | |
62444006 | Cyclopentamine | |
62451002 | Alcohol acetyltransferase | |
62483008 | Hydroxycinnamate 4-beta-glucosyltransferase | |
62486000 | ^10^Beryllium | |
62492006 | Frangula | |
62504002 | Antigen recognition site | |
62506000 | Agavain | |
62515007 | Heterophil antigen | |
62517004 | Sodium chromate Cr^51^ | |
62523009 | Blood group antibody e | |
62543003 | Gallium | |
62544009 | ^87^Krypton | |
62545005 | Ammonium carbonate | |
62547002 | ^251^Californium | |
62563005 | Blood group antigen Anuszewska | |
62569009 | Transferrin receptor | |
62576004 | Carboxyhemoglobin | |
62600002 | Blood group antibody Bert | |
62601003 | 3-Phosphoglycerate phosphatase | |
62613008 | Blood group antigen Balkin | |
62632002 | Blood group antibody Kx | |
62649009 | Butyl fluazifop | |
62652001 | beta-Aspartyldipeptidase | |
62661001 | ^80m^Bromine | |
62666006 | Histamine phosphate | |
62673001 | Platelet antibody HPA-3a | |
62680004 | Glycerophosphoinositol inositolphosphodiesterase | |
62694003 | Aflatoxin | |
62699008 | Complement component C5 | |
62707007 | ^110^Silver | |
62721009 | Fibrinopeptide A | |
62741004 | Alkaline phosphatase isoenzyme, liver fraction | |
62754006 | Sodium iodide | |
62763008 | Teichoic acid | |
62775003 | Fusion protein GAG-ONC | |
62776002 | Fatty-acid synthase | |
62797001 | Arginine kinase | |
62800004 | Blood group antigen En^a^FS | |
62812000 | Pharyngeal contents | |
62817006 | Verruculogen | |
62821004 | Hydroxybutyric acid | |
62832004 | Blood group antigen Tollefsen-Oyen | |
62841009 | Blood group antibody Stairwalt | |
62848003 | Amphibian venom | |
62854002 | Gastrin | |
62873003 | Plant product | |
62874009 | Bisalbumin | |
62882009 | Hemoglobin A>2< Sphakia | |
62885006 | Blood group antigen Ok^a^ | |
62902008 | Oncogene protein L-MYC | |
62915004 | Acrylonitrile | |
62916003 | Polyvinylidene chloride | |
62929003 | Blood group antibody Le^bL^ | |
62934004 | Myxobacter AL-1 proteinase II | |
62948004 | Hemoglobin J-Rajappen | |
62957005 | ^237^Uranium | |
62959008 | Immunoglobulin IgG1, H chain | |
62963001 | Blood group antibody Rh41 | |
62975006 | Methyl acetylene-propadiene mixture | |
62998003 | Lymphocyte antigen CD74 | |
63004003 | Phenylalanine | |
63006001 | 3-Oxoacid CoA-transferase | |
63026002 | Anti lymphocyte antibody | |
63028001 | Indolelactate dehydrogenase | |
63037001 | Phytotoxin | |
63045006 | Berry | |
63047003 | Blood group antigen K11 | |
63083007 | Cyclobenzaprine hydrochloride | |
63084001 | Clindamycin hydrochloride | |
63089006 | Mannose | |
63096008 | m^7^G(5')pppN pyrophosphatase | |
63108002 | Dimethylallyltranstransferase | |
63123007 | Estrogen binding protein | |
63133004 | Phenylhydrazine | |
63134005 | 2,5-Dihydroxypyridine 5,6-dioxygenase | |
63146009 | Blood group antigen Covas | |
63155007 | Blood group antibody Rh33 | |
63167009 | Warfarin sodium | |
63169007 | Blood group antibody Fy^a^ | |
63188000 | Carbenicillin indanyl sodium | |
63203003 | Ethoxyzolamide | |
63222007 | 2,4-Diaminopentanoate dehydrogenase (substance) | |
63229003 | Blood group antigen Win | |
63261004 | Chloroxuron | |
63266009 | Blood group antibody Anton | |
63271002 | Hemoglobin Lufkin | |
63281003 | Enterobacter ribonuclease | |
63282005 | Thiphenamyl (substance) | |
63306009 | Immunoglobulin IgG2 | |
63307000 | Lactoyl-CoA dehydratase | |
63326008 | Inhibin hormone | |
63330006 | Nonessential amino acid | |
63341008 | Mevinphos | |
63349005 | Zinc cyanide | |
63350005 | Hepatitis B surface antigen subtype adw | |
63360001 | ^89^Zirconium | |
63366007 | Immune reactive locus | |
63374008 | Hemoglobin Castilla | |
63379003 | Coal tar pitch volatiles | |
63383003 | Zinc stearate | |
63399009 | Reduced glutathione | |
63408009 | Cysteinyl-glycine dipeptidase | |
63441007 | Isobutyl alcohol | |
63447006 | Ribokinase | |
63461001 | Cumene | |
63478005 | Blood group antibody M^c^ | |
63482007 | Gentamicin 3'-acetyltransferase | |
63494003 | Inosine kinase (substance) | |
63497005 | Dibutoline | |
63522006 | Plant gene | |
63527000 | Methionine decarboxylase | |
63538000 | Blood group antigen Ny^a^ | |
63545000 | Halazepam | |
63559007 | Doxycycline calcium | |
63591008 | Chromic sulfate | |
63595004 | Blood group antigen Bultar | |
63598002 | Blood group antigen Mi^a^ | |
63606002 | Tin oxide | |
63615009 | Bromdimethoxyamphetamine | |
63621008 | Lymphocyte antigen CD47 | |
63635005 | Blood group antigen Cross | |
63652009 | Oncogene protein C-ABL | |
63658008 | Methylenetetrahydrofolate-tRNA-(uracil-5)-methyltransferase (FADH>2<-oxidizing) | |
63664001 | Glycine methyltransferase | |
63676001 | Arginine hydrochloride | |
63679008 | 2-Amino-4-hydroxy-6-hydroxymethyl-dihydropteridine pyrophosphokinase | |
63689007 | Jatropham | |
63704005 | Thermophilic aminopeptidase | |
63707003 | Hemoglobin F-Texas-I | |
63718003 | Folic acid | |
63730009 | Calcitonin | |
63735004 | Immunoglobulin, KM>2< allotype | |
63754004 | Yttrium | |
63759009 | Trehalose-phosphatase | |
63760004 | ^135^Cesium | |
63766005 | Flour | |
63768006 | Type II site-specific deoxyribonuclease | |
63770002 | Hemoglobin Dunn | |
63779001 | Diphenidol (substance) | |
63788005 | Blood group antibody Davis J | |
63789002 | Carbamyl phosphate | |
63793008 | Phosphorus compound | |
63798004 | Hemoglobin Caribbean | |
63809007 | Sphingosine beta-galactosyltransferase | |
63813000 | Alkali | |
63842008 | Dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase | |
63852007 | Catkin | |
63854008 | Isopropylmethylpyrimidyl diethyl thiophosphate | |
63856005 | Coagulation factor IXa | |
63857001 | Candida skin test antigen | |
63862000 | 1, 2-Diacylglycerol | |
63865003 | Blood group antigen Margaret | |
63867006 | Blood group antigen Dav | |
63868001 | ^193m^Mercury | |
63869009 | Khellin | |
63882001 | Aromatic solvent naphtha | |
63889005 | Dichromate salt | |
63896007 | Taurine salt of bile acid | |
63920006 | Platelet antibody HPA-4 | |
63927009 | Bromate salt | |
63929007 | Alkali blue 6B stain (substance) | |
63950003 | Immunoglobulin IgA2 (substance) | |
63969008 | Regulator gene | |
63984004 | Fibrinogen Awaji | |
63999004 | Testolactone | |
64011005 | Cyhalothrin | |
64020001 | Blood group antibody A. Owens | |
64026007 | Thiamin-phosphate kinase | |
64029000 | Ticrynafen (substance) | |
64032002 | Blood group antigen Tn | |
64037008 | Blood group antibody Bregi | |
64039006 | Cuprous oxide | |
64053006 | Triokinase | |
64055004 | 21-Hydroxysteroid dehydrogenase (NAD^+^) | |
64070003 | Blood group antibody Schor | |
64082007 | Plant toxalbumin | |
64086005 | Formic acid | |
64093009 | Blood group antigen Bx^a^ | |
64095002 | Quinone oxime benzoyl hydrazine | |
64096001 | Blood group antibody Giaigue | |
64099008 | Oligo-1,6-glucosidase | |
64105005 | Blood group antibody LW^a^ | |
64112001 | Fast blue RR salt stain (substance) | |
64128006 | Phosphoglycerate mutase | |
64130008 | Troleandomycin | |
64142003 | Spermine synthase | |
64147009 | Nephrotoxic mycotoxin | |
64170001 | Blood group antigen Whittle | |
64179000 | Zinc chloride | |
64182005 | Pituitary luteinizing hormone | |
64187004 | Cellulase | |
64191009 | Naltrexone hydrochloride | |
64197008 | Smoke | |
64221009 | Tropinesterase | |
64238008 | Blood group antigen Ce | |
64242006 | Aerosol | |
64244007 | Plant genome | |
64257004 | D-Ribitol-5-phosphate cytidylyltransferase | |
64259001 | Blood group antigen e | |
64263008 | 3-Oxoadipate CoA-transferase | |
64267009 | Hemoglobin Saki | |
64273005 | HLA-A25 antigen | |
64276002 | Calcium antacid | |
64279009 | HLA-B13 antigen | |
64288000 | Oncogene protein TCL1 | |
64291000 | Blood group antibody Kamiya | |
64365003 | Granulopoietin | |
64385004 | Pyridoxal oxidase | |
64416009 | Ganglioside GM>1< | |
64426002 | Ribonuclease alpha | |
64436005 | Fibrinogen Giessen III (substance) | |
64437001 | Phycocyanin | |
64447003 | Dihydroergocristine | |
64449000 | Dhurrin | |
64463006 | Ethotoin | |
64471005 | Blood group antibody Lucy | |
64472003 | Immunoreactive parathormone | |
64488003 | Iodinated I^125^ human serum albumin | |
64493000 | Immunoglobulin, GM>22< allotype | |
64494006 | Dinoseb | |
64499001 | Blood group antibody Lu8 | |
64505000 | Uracil phosphoribosyltransferase | |
64507008 | Amantadine hydrochloride | |
64511002 | Cholestanetriol 26-monooxygenase | |
64517003 | Yersinia pestis V antigen | |
64520006 | Protamine sulfate | |
64527009 | Orsellinate decarboxylase | |
64530002 | Amyl acetate | |
64535007 | Padimate A | |
64538009 | Iodine heptafluoride | |
64543002 | ^178^Tungsten | |
64547001 | Naphthalene acetamide | |
64563009 | Oncogene protein P190, BCR-ABL | |
64566001 | HLA-Aw19 antigen | |
64570009 | HLA-B44 antigen | |
64601002 | Wood dust | |
64602009 | Blood group antibody Kominarek | |
64618003 | 2-Chloroethyl 2-(4-1,1-dimethylethyl) phenoxy-1 methylethyl ester | |
64629004 | Antibody to hepatitis E virus (substance) | |
64648000 | Herbicide oil | |
64652000 | Horseradish peroxidase | |
64659009 | Microbial metalloproteinases | |
64669003 | Succinylsulfathiazole | |
64686009 | Benzalkonium chloride | |
64687000 | Halogenated hydrocarbon insecticide | |
64699007 | Ferredoxin-NAD^+^ reductase | |
64709009 | Dead space air | |
64734009 | Starch (bacterial glycogen) synthase | |
64763007 | 2-Dehydropantoyl-lactone reductase | |
64769006 | Hemoglobin F-Marietta | |
64778000 | Mammary fluid | |
64780006 | Glycerophosphoinositol glycerophosphodiesterase | |
64783008 | Chlormequat chloride | |
64788004 | Blood group antigen Pr^a^ | |
64790003 | Vertebrate collagenase | |
64796009 | Malt soup extract | |
64797000 | Blood group antibody Emma | |
64806009 | Retinol dehydrogenase | |
64813009 | Aminopentamide (substance) | |
64821003 | Isobornyl thiocyanoacetate | |
64823000 | Blood group antibody IP>1< | |
64827004 | Quartz | |
64843006 | Tungsten compound | |
64845004 | Freund antigen | |
64846003 | Blood group antigen i | |
64856004 | Digestive system fluid | |
64868008 | ^115m^Cadmium | |
64869000 | Conotoxin | |
64871000 | Insoluble immune complex | |
64881001 | Phosphatidyl serine | |
64888007 | Methicillin sodium (substance) | |
64891007 | Urea cream | |
64893005 | Immunoglobulin, L chain, kappa | |
64895003 | Blood group antibody R.M. | |
64896002 | Allergenic extract | |
64901000 | Rubidium isotope | |
64903002 | Methylguanidinase | |
64918001 | HLA-Aw43 antigen | |
64940005 | Ethoheptazine | |
64974009 | Calcium isotope | |
64991008 | Soluble berlin blue stain (substance) | |
64993006 | Placental fluid | |
65016007 | Tetrabromobenzoquinone | |
65025001 | Pyridine | |
65054007 | ^62^Zinc | |
65070009 | L-Ascorbate peroxidase | |
65081007 | Blood group antibody Tk | |
65086002 | ^240^Americium | |
65088001 | Propranolol hydrochloride | |
65097002 | Immunoglobulin, GM>3< allotype | |
65104003 | Furfuryl alcohol | |
65114007 | Blood group antigen Boil | |
65115008 | Sepia proteinase | |
65123005 | Choline | |
65125003 | Immunoglobulin, GM>20< allotype | |
65134008 | Hemoglobin Athens-Ga | |
65148008 | Xanthosine | |
65149000 | Exhaled air | |
65150000 | Autoantigen | |
65151001 | Blood group antibody Bridgewater | |
65156006 | Technetium Tc^99m^ pyrophosphate and polyphosphate | |
65170006 | Arginine-tRNA ligase | |
65183007 | Vitamin K | |
65216001 | Cerebrospinal fluid | |
65222005 | Calcium aminosalicylate | |
65227004 | Blood group antigen Gilbraith | |
65236000 | Blood group antigen Tx | |
65246003 | Aldicarb | |
65248002 | Blood group antigen HLA-A8 | |
65249005 | Terphenyl | |
65257008 | Phosphate butyryltransferase | |
65269000 | Blood group antibody K20 | |
65270004 | Hydroxyacylglutathione hydrolase | |
65282008 | CMP-N-acetylneuraminate-galactosyldiacyl-glycerol alpha-2,3-sialyltransferase | |
65283003 | Tryptophan 2-monooxygenase | |
65285005 | Aflatoxin G | |
65288007 | Hemoglobin Boyle Heights | |
65302009 | Choline salicylate | |
65311009 | ^196m^Thallium | |
65345002 | Epoxy resin | |
65386009 | Bocillus thermoproteolyticus neutral proteinase | |
65395001 | Phosphoglucomutase | |
65403003 | Novobiocin sodium | |
65407002 | Androgen receptor | |
65414000 | Hemoglobin Hamadan | |
65418002 | Glucose-1-phosphate guanylyltransferase (substance) | |
65423002 | Isosparteine | |
65426005 | Benzaldehyde | |
65428006 | Thyroid stimulating hormone | |
65436002 | Light metal | |
65445001 | Ethyl violet stain (substance) | |
65449007 | Blood group antibody R>2<R>2<-202 | |
65456001 | Blood group antibody Donavieski | |
65458000 | Aminopyrine (substance) | |
65459008 | Blood group antibody U^x^ | |
65465008 | Fibrinogen Munich II | |
65479000 | Inseparable antibody | |
65480002 | Dihydroorotate dehydrogenase | |
65485007 | Immunoglobulin, switch region | |
65488009 | Citramalate CoA-transferase | |
65495000 | Butopyronoxyl | |
65509001 | Fibrinogen Stony Brook | |
65512003 | Blood group antibody Thompson | |
65527003 | ^190m>1<^Iridium | |
65530005 | Oil of basil | |
65543005 | Blood group antibody Haven | |
65555004 | 11-beta Hydroxyandrostenedione | |
65557007 | Graphite dust | |
65580004 | Alizarin red S stain (substance) | |
65586005 | Phosphorus oxychloride | |
65589003 | Blood group antibody Fy^b^ | |
65592004 | Nutmeg oil | |
65601005 | Hemoglobin Kempsey | |
65639002 | Uridine diphosphate | |
65640000 | Sulfhemoglobin | |
65644009 | Coke oven emission | |
65665003 | Acylneuraminate cytidylyltransferase | |
65669009 | Strong acid | |
65674001 | ^190^Platinum | |
65682001 | Proline dipeptidase | |
65699000 | beta globulin | |
65716002 | Blood group antigen Terry | |
65730007 | Ponceau 3R stain (substance) | |
65738000 | Coagulation factor VIIIa | |
65741009 | Mepivacaine hydrochloride | |
65746004 | Blood group antigen Lu5 | |
65757009 | Non-protein nitrogen | |
65773003 | Chloropicrin | |
65777002 | Blood group antigen Joslin | |
65799005 | Epiglottic mucus | |
65802001 | Complement enzyme, active (substance) | |
65806003 | Blood group antibody Much | |
65826004 | Oil of rue | |
65863008 | Pigment | |
65868004 | Propiomazine hydrochloride | |
65874004 | Hemoglobin Le Lamentin | |
65887005 | Blood group antigen Jk^a^ | |
65889008 | Hypoxanthine phosphoribosyltransferase | |
65898006 | Bothrops atrox serine proteinase | |
65903005 | Hemoglobin Ohio | |
65914008 | Glyceric acid | |
65919003 | D-Ribulokinase | |
65923006 | Pumice | |
65925004 | Hemoglobin F-Bonaire-GA | |
65932008 | Carbolineum | |
65945007 | ^88^Zirconium | |
65948009 | Aluminum ammonium sulfate | |
65951002 | L-Ribulose-phosphate 4-epimerase | |
65955006 | Dihydroxyphenylalanine | |
65972004 | Daunorubicin hydrochloride | |
65973009 | Hemoglobin Fort Worth | |
65982003 | Triprolidine hydrochloride | |
65988004 | [Acyl-carrier-protein] phosphodiesterase | |
65992006 | Streptomycin 3''-kinase | |
66004009 | Isoetharine (substance) | |
66015004 | Transplantation antigen | |
66037006 | Hydroxymethylglutaryl-CoA synthase | |
66043008 | Pyruvate dehydrogenase (cytochrome) | |
66044002 | Skin antiviral agent | |
66086008 | Lepromin | |
66103001 | Malyl-CoA lyase | |
66124006 | Trypsin | |
66128009 | Creatine kinase isoenzyme, BB fraction | |
66143006 | alpha-Methyl styrene | |
66147007 | Lymphocyte antigen CD14 | |
66148002 | Sabadilla | |
66153007 | 1-Alkylglycerophosphocholine acetyltransferase | |
66178006 | ^117m^Cadmium | |
66194004 | myo-Inositol oxygenase | |
66196002 | Inositol 1-alpha-galactosyltransferase | |
66202004 | Alkenylglycerophosphocholine hydrolase | |
66203009 | Branched-chain-amino-acid aminotransferase | |
66209008 | Hemoglobin Montgomery | |
66228001 | Actinocongestin | |
66234008 | Alanine-oxomalonate aminotransferase | |
66235009 | Oncogene protein bcl-1 | |
66240001 | Blood group antibody Parra | |
66263006 | Lysine racemase | |
66290002 | Benzthiazide | |
66296008 | Hemoglobin J-Altgeld Gardens | |
66322002 | Dextran 40 | |
66365001 | N-m-tolyl phthalamic acid | |
66384003 | Isophane insulin | |
66389008 | Magnesium oxide | |
66395009 | Blood group antigen Mitch | |
66396005 | Fibrinogen Zürich II | |
66404001 | Lochia rubra | |
66428004 | Blood group antigen Wu | |
66431003 | Alkyl dimethyl 3,4-dichlorobenzene ammonium chloride | |
66440004 | HLA-DRw8 antigen | |
66458005 | Thiol methyltransferase | |
66460007 | Single stranded anti DNA antibody | |
66461006 | Diamine aminotransferase | |
66465002 | Silicon isotope | |
66472001 | Fibrinogen Parma | |
66481007 | Semisynthetic human insulin | |
66497002 | Blood group antibody Weeks | |
66506002 | Peptidoglycan endopeptidase | |
66508001 | Quinine hydrochloride | |
66509009 | Vancomycin hydrochloride | |
66511000 | Blood group antigen Gf | |
66524000 | Sphingomyelin | |
66533003 | gamma-Glutamyl hydrolase | |
66538007 | Glucan endo-1,2-beta-glucosidase | |
66560005 | Rubredoxin-NAD^+^ reductase | |
66562002 | Cigarette smoking tobacco | |
66565000 | ^209^Bismuth | |
66566004 | Gastrointestinal hormone receptor | |
66573009 | Bordeaux mixture | |
66586000 | Cadmium | |
66587009 | Kallikrein | |
66594007 | Phosphopentomutase | |
66603002 | Glucagon | |
66632004 | Lymphocyte antigen CD6 | |
66639008 | Secobarbital sodium | |
66644001 | Blood group antibody Sieb | |
66653008 | Oxolinic acid | |
66656000 | Vitamin K>1< (substance) | |
66676006 | Vinyl carbazole | |
66684005 | Sulfur dye | |
66685006 | Pion | |
66686007 | D-Arabinose dehydrogenase (NAD(P)^+^) | |
66687003 | Tetrahydronaphthalene | |
66716008 | ^234^Thorium | |
66726001 | Acetaldehyde dehydrogenase (acetylating) | |
66733001 | Hachimycin | |
66734007 | Nicotinamide-nucleotide amidase | |
66741001 | Fibrinogen Marseille | |
66753002 | Heat labile bacterial toxin | |
66756005 | ^115^Antimony | |
66766002 | Dimethyl acetamide | |
66770005 | Acid phosphatase isoenzyme, prostatic fraction | |
66781008 | Cobalt dust | |
66796007 | Oligoclonal protein | |
66805006 | Hemoglobin J-Antakya | |
66811009 | Plant aldehyde oil | |
66815000 | Blood group antigen Baumler | |
66817008 | Vasoprotectant | |
66820000 | Hemoglobin J-Amiens | |
66831008 | Blood group antibody Lu3 | |
66832001 | Blood group antibody Vw | |
66833006 | Coagulation factor II Clamart variant | |
66843009 | Pentobarbital sodium | |
66849008 | Cytotoxin venom | |
66850008 | ^96^Technetium | |
66875007 | Surface immunoglobulin | |
66891005 | Cytotoxic antibody | |
66901003 | Chloroacetaldehyde | |
66906008 | Blood group antigen VS | |
66925006 | Copper | |
66945003 | Phosphite salt | |
66956003 | ^122^Iodine | |
67007009 | Blood group antigen McCall | |
67008004 | Roridin | |
67011003 | Cyanohydrin beta-glucosyltransferase | |
67014006 | Glycerol kinase | |
67025002 | Methionyl dipeptidase | |
67029008 | Acetophenazine maleate | |
67036009 | Plant growth regulator | |
67054008 | Zinc phosphide | |
67060008 | Vitamin D>3<, phosphate ester | |
67064004 | HLA-Dw4 antigen | |
67065003 | Serratia marcescens extracellular proteinase | |
67079006 | Glucose | |
67080009 | Glucuronate reductase | |
67098008 | ^226^Actinium | |
67100008 | GDP-4-dehydro-D-rhamnose reductase | |
67127007 | Methyl benzene | |
67131001 | Amino-acid racemase | |
67152009 | Hemoglobin Torino | |
67154005 | ^66^Nickel | |
67164001 | Lymphocyte antigen CD54 | |
67174003 | Bronchial mucus | |
67194007 | Syngraft | |
67200004 | Pyrophosphate-glycerol phosphotransferase | |
67215003 | Isoflavone O^4'^-methyltransferase | |
67216002 | Pipazethate (substance) | |
67218001 | Complement component C4b | |
67221004 | Azathioprine sodium | |
67246004 | Carcinoembryonic antigen | |
67250006 | Blood group antibody Inaba | |
67265007 | Fumigant | |
67266008 | Chromium isotope | |
67271001 | Gene | |
67273003 | Blood group antigen HLA-A7 | |
67296003 | Pork insulin | |
67324005 | Rice | |
67339006 | Levansucrase | |
67340008 | Hemoglobin Hiroshima | |
67342000 | Blood group antibody Jo^a^ | |
67345003 | Blood group antibody He | |
67347006 | Levorphanol tartrate | |
67355004 | Hemoglobin M-Saskatoon | |
67366006 | Hair spray | |
67368007 | Glycine carboxypeptidase | |
67377000 | Pangamic acid | |
67379002 | 2-Hexadecenal reductase | |
67384008 | UTP-xylose-1-phosphate uridylyltransferase | |
67386005 | Blood group antibody Rx | |
67404005 | 1,2-beta-fructan 1^F^-fructosyltransferase | |
67412002 | Phosphoenolpyruvate carboxykinase (GTP) | |
67428007 | Benzphetamine (substance) | |
67436003 | Blood group antibody Lu^b^ | |
67449008 | Pyruvate synthase | |
67451007 | Hemoglobin J-Rovigo | |
67471003 | Jasmolin | |
67473000 | Lithium hydroxide | |
67485008 | Isoamylase | |
67517005 | 25-Hydroxy ergocalciferol | |
67518000 | ^195^Mercury | |
67535001 | Thiamine monophosphate | |
67538004 | Citrinin | |
67552002 | Inorganic polysulfide compound | |
67560001 | Polypyrrole | |
67568008 | D-Lactate dehydrogenase | |
67575009 | ^125m^Tellurium | |
67584009 | Glutamate dehydrogenase (NADP+) (substance) | |
67586006 | Nonylphenoxy P.H. ethanol | |
67594004 | 4-Hydroxy-4-methyl-2-oxoglutarate aldolase | |
67609008 | 8,11,14-Eicosatrienoic acid | |
67610003 | Leukoagglutinin | |
67618005 | Isopropyl ether | |
67620008 | Quinoline | |
67634008 | Hydrogenated terphenyls | |
67636005 | Guaiacol | |
67639003 | Sulfonmethane | |
67650000 | Xenograft | |
67652008 | 1-Alkyl-2-acetylglycerol cholinephospho-transferase | |
67658007 | tRNA sulfurtransferase | |
67659004 | Sequestered antigen | |
67675001 | Eosinophilic chemotactic factor-anaphylaxis | |
67686004 | Tripalmitin | |
67687008 | 16-Hydroxysteroid epimerase | |
67690002 | Sodium iodide I^123^ | |
67695007 | Cytidylate kinase (substance) | |
67713006 | Blood group antibody Le^x^ | |
67719005 | Iodine isotope | |
67771002 | Deoxyribonuclease II | |
67774005 | Blood group antibody Le^a^ | |
67785007 | tRNA (guanine-N^7^)-methyltransferase | |
67803007 | Thiamin pyridinylase | |
67812009 | [Pyruvate kinase] phosphatase | |
67831003 | Hemoglobin J-Singapore | |
67836008 | Chelidonine | |
67844008 | 1-Methyladenosine nucleosidase | |
67846005 | Scopoletin glucosyltransferase | |
67866001 | Insulin | |
67899004 | Complement component, classic pathway | |
67903006 | D-Iditol dehydrogenase | |
67906003 | Etiocholanolone | |
67910000 | Hydroxylamine reductase | |
67921009 | ^203^Bismuth | |
67922002 | Serum | |
67927008 | HLA-A29 antigen | |
67928003 | Suramin sodium | |
67938008 | Amnesic shellfish poison | |
67956008 | Neutral red stain (substance) | |
67957004 | Vinyl toluene | |
67958009 | Blood group antibody Towey | |
67980007 | Amcinonide | |
67990004 | White wine | |
67994008 | Kynurenate-7,8-dihydrodiol dehydrogenase | |
68005004 | Chlorflurecol | |
68020005 | dCTP pyrophosphatase | |
68024001 | Cellulose acetate | |
68039000 | beta-Naphthol | |
68051003 | Dichloropropene | |
68077006 | Rutin (substance) | |
68101005 | Oxidoreductase | |
68105001 | Decahydronaphthalene | |
68110002 | Sphinganine kinase | |
68117004 | Yttrium radioisotope | |
68120007 | AMP nucleosidase | |
68132006 | N-b-bis (2-chloroethyl)-2-naphthylamine | |
68134007 | CDPdiacylglycerol pyrophosphatase | |
68144009 | Formyltetrahydrofolate dehydrogenase | |
68149004 | Blood group antigen Tofts | |
68153002 | ^123^Xenon | |
68174001 | Pyrroline-2-carboxylate reductase | |
68175000 | Complement component C3a | |
68185004 | Hemoglobin Abruzzo | |
68198008 | Extracellular metabolic product | |
68224005 | Ammonium sulfamate | |
68238003 | ^186^Iridium (substance) | |
68249009 | Blood group antigen Kn^a^ | |
68263003 | Janus green B stain (substance) | |
68277000 | Phorate | |
68283002 | beta-Fructofuranosidase | |
68293009 | Methenamine mandelate | |
68296001 | 1,6-Dihydroxycyclohexa-2,4-diene-1-carboxylate dehydrogenase | |
68310009 | Lucanthone | |
68321000 | Perthane | |
68326005 | Central myelin | |
68329003 | Fuller's earth | |
68332000 | Digoxin immune fab | |
68334004 | Pyrophosphate salt | |
68356001 | Chlorine compound | |
68357005 | Sodium hexafluorosilicate | |
68374005 | Blood group antibody Rg^a^ | |
68379000 | Cinnamon oil | |
68396004 | Ethyl butyl propanediol | |
68399006 | Fibrinogen Bondy | |
68420003 | HLA-Dw13 antigen | |
68429002 | Alanine-tRNA ligase | |
68430007 | 21-Hydroxysteroid dehydrogenase (NADP^+^) | |
68459007 | Crystal ponceau stain (substance) | |
68475005 | Intermediate-acting insulin | |
68484005 | Glyceraldehyde-3-phosphate dehydrogenase | |
68498002 | Antibody | |
68522008 | Blood group antigen Lucy | |
68524009 | Tragacanth | |
68527002 | Blood group antibody S1^b^ | |
68537007 | Anti DNA histone antibody | |
68540007 | Nicotine | |
68561000 | Hemoglobin Hirose | |
68580003 | ^59^Iron | |
68593008 | CDPabequose epimerase | |
68615006 | Bicarbonate | |
68617003 | N-Acetyllactosamine 3-alpha-galactosyltransferase | |
68620006 | Phosphorylase kinase | |
68630002 | ^125^Iodine | |
68639001 | Blood group antibody Wade | |
68657000 | CDPglucose 4,6-dehydratase | |
68669008 | Cyclobarbital | |
68674000 | Folpet | |
68680008 | Dexchlorpheniramine maleate | |
68691001 | Sabadine | |
68692008 | Complement component C3g | |
68699004 | Phenylephrine bitartrate | |
68715002 | Hexaethyl tetraphosphate | |
68725007 | NAD^+^ nucleosidase | |
68753007 | Amosite | |
68762009 | Blood group antigen In^a^ | |
68767003 | Blood group antibody Kp^b^ | |
68783003 | HLA-DRw13 antigen | |
68794004 | Uracil | |
68803005 | 1-Pyrroline-5-carboxylate dehydrogenase | |
68810004 | Methane monooxygenase | |
68826003 | Allyl-alcohol dehydrogenase | |
68831001 | Carbathiin | |
68836006 | Phosphoadenylylsulfatase | |
68837002 | Cadaverine | |
68839004 | 2',3'-Cyclic-nucleotide 2'-phosphodiesterase | |
68851002 | Lymphocyte antigen CD7 | |
68868003 | Clostripain | |
68871006 | Technetium isotope | |
68909008 | Hemoglobin Nagasaki | |
68929009 | Cadmium radioisotope | |
68941002 | Blood group antigen Vil | |
68945006 | Interleukin-2 | |
68967007 | Iodocholesterol I^131^ | |
68970006 | Glycerol-3-phosphate oxidase | |
68971005 | Coproantibody | |
68975001 | Blood group antibody Hey | |
68990002 | Blood group antibody Taylor | |
68991003 | Chromous salt | |
68992005 | Cellulose | |
69038000 | Biliverdin | |
69042002 | Immunoconglutinin | |
69049006 | Blood group antibody Meteja | |
69050006 | Physostigmine salicylate | |
69055001 | Acetate kinase (pyrophosphate) | |
69059007 | Cone | |
69076006 | Strontium chloride Sr^85^ | |
69084005 | Butilate | |
69088008 | Hemoglobin S-Antilles | |
69089000 | ^52^Iron | |
69091008 | Hemoglobin Rush | |
69095004 | Cinnamyl-alcohol dehydrogenase | |
69108009 | Hemoglobin Parchman | |
69118004 | Blood group antibody Greenlee | |
69122009 | Methyl dichlorfop | |
69133007 | Sudan IV stain (substance) | |
69136004 | Prostaglandin PGE3 alpha | |
69149009 | Blood group antigen Be^a^ | |
69151008 | Glutamate formiminotransferase | |
69169004 | Vitamin K>3< | |
69172006 | Cyclonite | |
69180004 | Threonine dehydratase | |
69184008 | Blood group antigen M^e^ | |
69187001 | Pseudouridine kinase | |
69211003 | Blood group antibody BOA 3150 | |
69225002 | Nail polish | |
69241001 | Butorphanol tartrate | |
69268001 | ^131m^Tellurium | |
69296007 | 2-Ethylhexyl-2-cyano-3,3-diphenylacrylate | |
69298008 | Phospholipase A>2< | |
69306002 | 6-Phytase | |
69307006 | Heterochromatin | |
69308001 | Vinylacetyl-CoA delta-isomerase | |
69311000 | Immunoglobulin, Fc fragment (substance) | |
69313002 | Fibronectin | |
69314008 | Benzophenone | |
69324000 | Phosphorus pentasulfide | |
69340002 | Napropamide | |
69342005 | Lymphocyte antigen CD27 | |
69351002 | Methoxyphenamine | |
69373009 | Blood group antigen Alda | |
69411001 | Lymphocyte antigen CD11a | |
69418007 | Platelet antigen HPA-5b | |
69419004 | 3-Oxoacyl-acyl-carrier-protein synthase | |
69433004 | Blood group antigen Lu7 | |
69435006 | Blood group antibody Go^a^ | |
69440003 | Cardiotonic drug | |
69451003 | beta-D-Fucosidase | |
69453000 | Hemoglobin Burke | |
69457004 | Candida albicans aspartic proteinase | |
69459001 | Thiamin-phosphate pyrophosphorylase | |
69467009 | Formylaspartate deformylase | |
69469007 | Lymphocyte antigen CD77 | |
69473005 | Kveim-Silzbach antigen | |
69504003 | beta-(9-Cytokinin)-alanine synthase | |
69506001 | Oxyphenonium | |
69507005 | Phthalic acid ester | |
69513001 | 5-Dehydro-4-deoxyglucarate dehydratase | |
69519002 | Ethylenediamine tetra-acetate | |
69522000 | Pine tar | |
69526002 | Noxious fumes | |
69542009 | Blood group antigen Gibson | |
69544005 | Hemoglobin Tours | |
69553003 | Geraniol dehydrogenase | |
69557002 | sn-Glycerol-3-phosphate 2-alpha-galactosyltransferase | |
69563006 | Heat labile alpha>1< glycoprotein | |
69583007 | Plant goitrogen | |
69594006 | Dinitro-o-cyclohexyl phenol | |
69606009 | Trimethyllysine,2-oxoglutarate dioxygenase | |
69612004 | Fetal antigen | |
69613009 | ^244^Plutonium | |
69637009 | Waxes | |
69644000 | Calcium arsenite | |
69654001 | 3-Hydroxyaspartate aldolase | |
69662009 | alpha Actinin | |
69674008 | Agmatinase | |
69680000 | Blood group antigen Co^a^ | |
69700005 | tRNA (adenine-N^6^)-methyltransferase | |
69703007 | Cesium radioisotope | |
69705000 | Fibrinogen Bicêtre | |
69719000 | Blood group antibody Le^b^ | |
69750003 | ^63^Nickel | |
69751004 | Galactinol-raffinose galactosyltransferase | |
69755008 | Blood group antigen Mathison | |
69756009 | Hemoglobin Vancouver | |
69760007 | Imidazo pyruvic acid | |
69764003 | (R)-3-Amino-2-methylpropionate aminotransferase | |
69770009 | Iron radioisotope | |
69780008 | Polynucleotide 5'-hydroxyl-kinase | |
69783005 | Meglumine iodipamide | |
69813006 | N-Acylglucosamine-6-phosphate 2-epimerase | |
69814000 | Methylenetetrahydrofolate dehydrogenase (NADP^+^) | |
69832000 | Lymphocyte antigen CD38 | |
69839009 | Iodinated I^125^ povidone | |
69844002 | 1-Chloro-1-nitroethane | |
69870001 | Thallium isotope | |
69871002 | Methylchlormethyl ether | |
69893007 | Cyanazine | |
69899006 | Oxymorphone hydrochloride | |
69900001 | Blood group antigen Haase | |
69901002 | Platelet-specific antibody | |
69904005 | 2,6-Dihydroxypyridine 3-monooxygenase | |
69908008 | Messenger RNA | |
69932001 | Potassium chromate | |
69936003 | Hemoglobin Tunis | |
69940007 | Blood group antigen Mit | |
69941006 | Blood group antibody Enriquez | |
69958001 | Sodium sulfate | |
69979001 | Blood group antibody Simon (substance) | |
69992003 | Blood group antigen T | |
69993008 | Mevaldate reductase | |
69995001 | 3-Hydroxyoctanoyl-[acyl-carrier-protein]-dehydratase | |
70001008 | Piperacetazine | |
70012008 | L-Lactate dehydrogenase | |
70016006 | Complementary DNA | |
70032009 | Phosphoribosylaminoimidazole carboxylase | |
70050002 | Hemoglobin H | |
70059001 | Blood group antigen At^a^ | |
70069007 | Patulin | |
70077006 | Colony-stimulating factor, granulocyte-monocyte | |
70078001 | Aromatic-hydroxylamine acetyltransferase | |
70084003 | Methyl (n-amyl) ketone | |
70086001 | Cholyl-carbon^14^ glycine | |
70088000 | Tyrosine 2,3-aminomutase | |
70095009 | Immunoglobulin isotype | |
70106000 | Lipid | |
70113000 | Branched-chain amino acid | |
70150004 | Bile | |
70154008 | Iodinated I^125^ sodium iodine | |
70155009 | Immunoglobulin dimer | |
70161007 | 3-Hydroxybutyryl-CoA dehydratase | |
70168001 | Copper sulfate | |
70169009 | Ciclopirox olamine | |
70170005 | Acetylornithine deacetylase | |
70184000 | Deoxycytidine monophosphate deaminase | |
70198008 | Mannitol-1-phosphate dehydrogenase | |
70203000 | Adenine | |
70213008 | Tryptophan synthase | |
70214002 | Hemoglobin Moskva | |
70221002 | Phosgene | |
70237008 | Glucosamine | |
70251008 | Ethyl di-(p-chlorophenyl) glycolate | |
70265005 | Lathosterol oxidase | |
70269004 | beta-Lysine 5,6-aminomutase | |
70271004 | Coagulation factor X Stuart variant | |
70276009 | Dimethylpropiothetin dethiomethylase | |
70282007 | Acetylspermidine deacetylase | |
70288006 | Methionine | |
70290007 | Indium compound | |
70304009 | Blood group antigen Crawford | |
70309004 | Calcidiol 1-monooxygenase | |
70319005 | Cobalt fumes | |
70335003 | Blood group antigen Bi | |
70338001 | Nepenthes aspartic proteinase | |
70352004 | Blood group antibody Gill | |
70354003 | Polypeptide | |
70365008 | ^239^Uranium | |
70367000 | Valine decarboxylase | |
70368005 | Guanidinoacetate methyltransferase | |
70391009 | Uridine diphosphate glucose | |
70392002 | Prolactin inhibiting factor | |
70400004 | Immunoglobulin, GM>4< allotype | |
70403002 | Ribonucleotide | |
70430007 | Blood group antigen Black | |
70434003 | Complement factor Ba | |
70438000 | ^88^Rubidium | |
70440005 | Coagulation factor XII | |
70444001 | Recessive gene | |
70454002 | Prolactin | |
70469001 | Blood group antigen L Harris | |
70487003 | Hexosamine | |
70489000 | Algal toxin | |
70496003 | Lipoic acid | |
70508008 | beta-Aspartyl-N-acetylglucosaminidase | |
70519006 | Hemoglobin G-Philadelphia | |
70520000 | Ponceau xylidine stain (substance) | |
70524009 | Chloroallyl diethyldithiocarbamate | |
70535004 | Arylamine glucosyltransferase | |
70544003 | ^199^Gold | |
70561000 | 2-Pivalyl-1,3- indandione | |
70562007 | Leuprolide acetate | |
70563002 | Blood group antibody Walin | |
70564008 | Allantoate deiminase | |
70565009 | Sulfur dioxygenase | |
70566005 | Glycine-oxaloacetate aminotransferase | |
70570002 | Sulfadoxine | |
70584007 | Blood group antigen Cr^a^ (substance) | |
70587000 | beta Alanine | |
70588005 | Acetoin dehydrogenase | |
70592003 | 2-Nitropropane dioxygenase | |
70597009 | Boron | |
70608003 | UDPglucuronate decarboxylase | |
70613004 | Zirconyl hydroxychloride | |
70620006 | Plant glycoside | |
70623008 | Fusion protein GAG-POL | |
70643002 | Lead tetroxide | |
70672001 | Glycerophosphocholine cholinephosphodiesterase | |
70675004 | Lipopolysaccharide glucosyltransferase II | |
70684004 | Oxybenzone and dioxybenzone | |
70695005 | Dihydropyrimidinase | |
70699004 | ^185^Tungsten | |
70706009 | Troxerutin | |
70724006 | Streptomycin 6-kinase | |
70725007 | Paecilomyces varioti aspartic proteinase | |
70726008 | Selenium compound | |
70732003 | Trimethadione | |
70734002 | alpha-L-Fucosidase | |
70741008 | Blood group antigen K16 | |
70744000 | Hemoglobin F-Jamaica | |
70748002 | Hemosiderin | |
70750005 | 3-Cyanoalanine hydratase | |
70773002 | Dimethylallylcistransferase | |
70785005 | Tryptophan-phenylpyruvate aminotransferase | |
70787002 | Alcohol dehydrogenase (NADP+) (substance) | |
70799009 | Pumiliotoxin B | |
70800008 | Ecdysone oxidase | |
70807006 | 1,2-Diacylglycerol 3-beta-galactosyltransferase | |
70813002 | Milk | |
70825004 | Somatomedin | |
70828002 | Major histocompatibility complex | |
70832008 | Immunoglobulin, GM>6< allotype | |
70844006 | Hemoglobin Necker Enfants-Malades | |
70846008 | Sarin | |
70863007 | Alkylamidase | |
70869006 | Blood group antigen Milne | |
70886000 | Dicloxacillin sodium | |
70888004 | Diethyl ketone | |
70906001 | bis-(Diethylthiocarbamyl) disulfide | |
70941002 | Chrome green | |
70961008 | Neomycin sulfate | |
70963006 | Antigen receptor | |
70972003 | Active C5b6789 (substance) | |
70990002 | Quinone | |
71006008 | Blood group antigen Sia-b1 | |
71012003 | UDParabinose 4-epimerase | |
71017009 | Blood group antigen Todd | |
71024005 | Blood group antigen Rh41 | |
71027003 | Xylose isomerase | |
71032002 | UDP-N-acetylmuramate dehydrogenase | |
71043005 | Dicyclomine hydrochloride (substance) | |
71058002 | Myxobacter AL-l proteinase I | |
71076009 | Strontium iodide | |
71079002 | Blood group antigen IA | |
71082007 | Hemoglobin O-Indonesia | |
71108007 | Cycrimine | |
71128006 | Molybdenum | |
71138001 | Sulfacytine (substance) | |
71146000 | Blood group antibody Pr>2< | |
71152004 | ^20^Neon | |
71159008 | Pregnanetriol | |
71165008 | Cycloheximide (substance) | |
71168005 | alpha,alpha-Trehalose phosphorylase | |
71183000 | Indomethacin sodium trihydrate (substance) | |
71185007 | Nucleoprotein | |
71211001 | Nucleotide | |
71227008 | Siderite | |
71230001 | Hemoglobin Mequon | |
71242006 | Prephenate dehydrogenase (NADP^+^) | |
71250002 | Butethamine | |
71251003 | ^192^Platinum | |
71263008 | Thioethanolamine acetyltransferase | |
71281006 | Coagulation factor X Padua 1 variant | |
71283009 | NADPH dehydrogenase (quinone) | |
71288000 | Oncogene protein GP120, V-FMS | |
71291000 | Superbine | |
71334007 | Ethyl mercaptan | |
71342008 | Mannan endo-1,6-beta-mannosidase | |
71348007 | Deblocking antibody | |
71365003 | beta Endorphin | |
71368001 | Complement component C3d | |
71370005 | HLA-DP antigen | |
71374001 | Sodium hypochlorite | |
71380009 | Benzarone | |
71391002 | Ethanolamine ammonia-lyase | |
71396007 | HLA-B17 antigen | |
71411004 | Blood group antibody Dahl | |
71415008 | Blood group antigen Wallin | |
71417000 | Doxycycline hyclate | |
71422000 | Clostridium perfringens toxin | |
71423005 | Hemoglobin Queens | |
71425003 | ^61^Copper | |
71428001 | Oil of copaiba | |
71430004 | Oil of pepper | |
71437001 | Histone-lysine methyltransferase | |
71454009 | Dimethylformamide | |
71459004 | Fibrinogen Bern I | |
71463006 | Polyethylene | |
71470006 | N-Methyl-L-amino-acid oxidase | |
71474002 | Immunoglobulin IgG3, H chain (substance) | |
71482002 | Iron compound | |
71494006 | Aspartate acetyltransferase | |
71499001 | Dioscin | |
71500005 | Hemoglobin S-Travis | |
71522003 | ^192^Mercury | |
71532005 | Indoleacetic acid | |
71533000 | Pentazocine lactate | |
71544008 | Polysaccharide | |
71549003 | Interchromatin granule | |
71560007 | ^129^Tellurium | |
71561006 | Chelonitoxin | |
71562004 | Mexicanain | |
71563009 | Diphenoxylate hydrochloride | |
71589009 | Benzidine | |
71611009 | Lactate 2-monooxygenase (substance) | |
71630009 | Coagulation factor IX Leyden variant | |
71633006 | ^22^Sodium | |
71636003 | Fibrinogen I^123^ | |
71640007 | Acid phosphatase isoenzyme | |
71647005 | ^14^Carbon | |
71656002 | Hemoglobin Iwata | |
71668006 | Chloroprocaine | |
71669003 | Alkyl aryl polyether sulfonate | |
71681004 | Blood group antigen Dugstad | |
71686009 | Matrix of fibrocartilage | |
71700008 | Hemoglobin J-Singa | |
71714008 | Calcium gluceptate (substance) | |
71726003 | Aflatoxin M | |
71730000 | 5alpha-Hydroxysteroid dehydratase | |
71756007 | Veratridine | |
71763007 | Thallium | |
71774003 | Gibberellin | |
71789007 | Technetium | |
71797000 | Lymphocyte antigen CD22 | |
71805008 | Isocitrate epimerase | |
71813009 | Methaqualone | |
71818000 | Herbicide | |
71823000 | Monomethyl hydrazine | |
71845004 | Epithelial antibody (substance) | |
71862009 | Antitoxin | |
71916002 | Hydrastine | |
71921004 | Hemoglobin G-Szuhu | |
71935002 | Hemoglobin A>2< | |
71957009 | Phloxin B stain (substance) | |
71971001 | Corticotropin releasing factor | |
71972008 | Blood group antibody Jc^a^ | |
71975005 | Pyruvate kinase | |
71976006 | Blood group antibody Lu14 | |
71992001 | Amine ethoxylate | |
72003002 | Biphenamine (substance) | |
72015003 | Iodinated I^125^ albumin | |
72024007 | Tetrahydrocannabinol | |
72025008 | Crotamine venom | |
72034003 | DNA beta-glucosyltransferase | |
72036001 | Blood group antigen Bell | |
72069001 | Cytosine | |
72081002 | Divinyl benzene | |
72084005 | GMP synthase | |
72088008 | HLA-Bw41 antigen | |
72113008 | Transcobalamin I | |
72131009 | Silver iodide | |
72134001 | Ankyrin | |
72138003 | Lysine acetyltransferase | |
72156003 | Protein-D-aspartate methyltransferase | |
72159005 | Cyanocobalamin Co^60^ | |
72164009 | Inositol | |
72165005 | Antibody to hepatitis C virus | |
72170003 | Blood group antigen Starcher | |
72179002 | Oxybenzone | |
72186005 | FAD pyrophosphatase | |
72192004 | (Deoxy)nucleoside phosphate kinase | |
72233001 | Galacturonokinase | |
72251000 | Arsenic trioxide | |
72271009 | Blood group antigen Fuller | |
72305003 | ^107^Cadmium | |
72309009 | Bioflavonoid | |
72322001 | Para-aminobenzoic acid esters in alcohol | |
72340002 | Plotolysin toxin | |
72341003 | Blood urea nitrogen | |
72344006 | Sodium psylliate | |
72358008 | Agglutinogen | |
72359000 | Gonyautoxin | |
72361009 | Blood group antigen Wimberly | |
72368003 | Citrullinase | |
72371006 | Fast violet B salt stain (substance) | |
72380006 | Blood group antigen Vel | |
72384002 | Alkylglycerone-phosphate synthase | |
72387009 | Acyclovir sodium | |
72393001 | Butyl acrylate | |
72400009 | Blood group antibody Swietlik | |
72433004 | 3beta-Hydroxy-4alpha-methylcholestenecarboxylate dehydrogenase (decarboxylating) | |
72444007 | Iron-cytochrome-c reductase | |
72453000 | Trimethylamine-N-oxide reductase | |
72454006 | ^99m^Technetium | |
72455007 | ^83^Rubidium | |
72460006 | 7,8-Dihydroxykynurenate 8,8a-dioxygenase | |
72464002 | Pantothenase | |
72469007 | Acetazolamide sodium | |
72499003 | Rubidium chloride | |
72507005 | 2-Ethylmalate synthase | |
72511004 | Fruit | |
72520008 | p-Aminophenol | |
72522000 | Mephenesin | |
72526002 | Blood group antibody Hil | |
72546007 | Hemoglobin G-Audhali | |
72551001 | Metal fumes | |
72559004 | Streptomyces alkalophilic keratinase | |
72563006 | Gastrin I | |
72571005 | Platelet antibody HPA-3 | |
72572003 | Diamond black stain (substance) | |
72578004 | Osmium | |
72582002 | Hemoglobin Sassari | |
72584001 | HLA-Dw5 antigen | |
72586004 | beta-Alanine-pyruvate aminotransferase | |
72590002 | Cerebronic acid | |
72602006 | Blood group antigen ENKT (substance) | |
72625007 | 3,4-Dihydroxyphenylacetate 2,3-dioxygenase | |
72636000 | Pinene | |
72675009 | Simple physiological organic compound | |
72685005 | Blood group antigen Maliff | |
72717003 | Magnesium | |
72737004 | (S)-Tricyclamol | |
72745009 | Flavodoxin | |
72748006 | Blood group antibody Mansfield (substance) | |
72750003 | Nucleoside-phosphate kinase | |
72752006 | Atracurium besylate (substance) | |
72763009 | Hydriodic acid | |
72766001 | 2',3'-Cyclic-nucleotide 3'-phosphodiesterase | |
72770009 | Metoprolol tartrate | |
72772001 | Blood group antigen Boston | |
72773006 | Linuron | |
72774000 | Potassium p-aminosalicylate | |
72778002 | Tyrosine-tRNA ligase | |
72784004 | Lactated potassic saline | |
72802008 | Acetal | |
72805005 | Chymopapain | |
72808007 | Trolamine salicylate | |
72812001 | Aspartate 4-decarboxylase (substance) | |
72822007 | Homogentisate 1,2-dioxygenase | |
72833005 | HLA-A30 antigen | |
72835003 | ^119m^Tin | |
72840006 | Valine | |
72843008 | 2-Hydroxy-2,2-bis-(4-chlorophenyl) ethyl acetate | |
72844002 | ^187^Platinum | |
72857005 | Methitural | |
72869002 | Upper respiratory fluids | |
72873004 | Blood group antigen I^T^P>1< | |
72886008 | Blood group antigen B 9724 | |
72887004 | Pirimicarb | |
72890005 | NAD(P)H dehydrogenase (quinone) | |
72891009 | Cytotropic antibody | |
72909000 | Tumor-associated antigen | |
72926006 | HLA-Bw48 antigen | |
72927002 | Radon | |
72929004 | Phosphate acetyltransferase | |
72949008 | Pepsin C | |
72955003 | Acetate-CoA ligase | |
72984007 | Muscarinic receptor | |
72989002 | Blood group antibody Th^a^ | |
72990006 | Alveolar air | |
72993008 | Triacylglycerol lipase | |
73010004 | Methyl silicate | |
73029005 | Fibrinogen Baltimore IV | |
73031001 | alpha Ketoglutarate | |
73040002 | Vanadium pentoxide fumes | |
73065000 | Gallium^67^ citrate | |
73076001 | Emylcamate | |
73084002 | Ethylene glycol ester | |
73085001 | Chlordane | |
73106004 | Cycle-phase nonspecific agent | |
73126000 | Digalloyl trioleate | |
73127009 | Hemoglobin Bougardirey-Mali | |
73129007 | ^131m^Xenon | |
73131003 | Carotene | |
73135007 | Soluble antigen (substance) | |
73187006 | Thyroxine | |
73195005 | Blood group antibody HLA-B15 | |
73196006 | Manganese compound | |
73204005 | Myosin ATPase | |
73213007 | Chlorphenesin carbamate | |
73236003 | Hemoglobin Detroit | |
73246001 | Streptomycin sulfate | |
73251007 | Auramine G stain (substance) | |
73254004 | CMP-N-acetylneuraminate-beta-galactoside alpha-2,6-sialyltransferase | |
73267001 | 1-1-bis-(p-chlorophenyl)-2-Nitrobutane | |
73268006 | Para-aminobenzoic acid and ethyl alcohol | |
73276008 | Staphylococcus aureus antibody test kit | |
73279001 | 2-Dehydropantoate reductase | |
73300004 | Hemoglobin F-Tokyo | |
73314004 | Blood group antibody Wolfe | |
73334003 | Scillaren A | |
73347008 | Blood group antibody JMH | |
73353008 | ^54^Manganese | |
73360002 | Hemoglobin M-Hyde Park | |
73362005 | Blood group antigen Rh37 | |
73377002 | Propyl diethyl succinamate | |
73386007 | Carbofuran | |
73388008 | 1,3-beta-Glucan phosphorylase | |
73389000 | Blood group antigen Groslouis | |
73393006 | Oil of balm | |
73404007 | Cyanamide compound | |
73407000 | Yohimbine | |
73417005 | Zetekitoxin | |
73421003 | Fusel oil | |
73427004 | Cholesterol ester (substance) | |
73434002 | Fonofos | |
73436000 | Lergotrile mesylate | |
73440009 | Methyl chloro methyl ether | |
73444000 | Procaine hydrochloride | |
73461002 | Fibrinogen London II | |
73469000 | Radium | |
73476005 | Mipafox | |
73520004 | Blood group antigen Bregi | |
73522007 | ^105^Ruthenium | |
73537006 | Purinergic receptor | |
73553009 | Rosemary oil | |
73559008 | Dialkyl dimethyl ammonium chloride | |
73563001 | Hexose-1-phosphate guanylyltransferase | |
73567000 | HLA-DQw antigen | |
73579000 | Carbidopa | |
73586008 | L-3-Cyanoalanine synthase | |
73591009 | Cytochalasin | |
73596004 | 2-Amino-5-nitrothiazole | |
73606003 | Gallate 1-beta-glucosyltransferase | |
73613003 | Orotate reductase (NADH) | |
73628003 | Progesterone 11alpha-monooxygenase | |
73637003 | Blood group antigen B 7358 | |
73640003 | ^188^Iridium | |
73656008 | Blood group antibody Langer | |
73661005 | Hepatitis B surface antigen subtype ayw | |
73667009 | N^6^-Acetyl-beta-lysine aminotransferase | |
73680007 | Oil of levant wormseed | |
73685002 | Thallous chloride Tl^201^ | |
73694008 | Blood group antibody A | |
73708009 | Diphenylchloroarsine | |
73709001 | Blood group antibody hr^B^ | |
73710006 | Blood group antibody K22 | |
73717009 | Muconate cycloisomerase | |
73722009 | Dibasic potassium phosphate | |
73723004 | Estriol | |
73734001 | ^8^Helium | |
73741007 | Zearalenone | |
73743005 | Oil of chamomile, German | |
73745003 | Iodinated I^125^ oleic acid and triolein | |
73748001 | alpha Ketobutyric acid | |
73755004 | Blood group antigen Neut | |
73758002 | ^117^Indium | |
73778005 | Hemoglobin M-Boston | |
73794003 | Folylpolyglutamate synthase | |
73801006 | Coagulation factor VIIa | |
73803009 | Glaucarubin | |
73827006 | Econazole nitrate | |
73828001 | Bilirubin-albumin complex | |
73838006 | Phosphatidyl myo-inositol alpha-mannosyltransferase | |
73842009 | Thymic ectopic endocrine substance | |
73846007 | Blood group antigen RASM | |
73858007 | Mandelate racemase | |
73875001 | UDPglucuronate 5'-epimerase | |
73880005 | Ribonuclease III | |
73892005 | Carmine stain (substance) | |
73909007 | Trifluoromonobromomethane | |
73916008 | 5-Hydroxy tryptophan | |
73923009 | Trinitrophenylmethylnitramine | |
73925002 | ^152^Gadolinium | |
73941001 | Chelated calcium | |
73946006 | Phenylephrine hydrochloride | |
73971009 | Dihydroorotate oxidase | |
73980009 | Blood group antigen Rh29 | |
73987007 | Oncogene | |
73991002 | Connective tissue protein | |
73992009 | 1-Alkylglycerophosphocholine acyltransferase | |
74000003 | Lead chromate | |
74002006 | Gliadin antibody | |
74014003 | Phenylalanine ammonia-lyase | |
74027004 | Protocatechuate 4,5-dioxygenase | |
74032003 | Steroid 17-alpha-monooxygenase | |
74054001 | Sodium 2,4-dichlorophenoxyethyl sulfate | |
74055000 | Plant ketone oil | |
74064005 | Blood group antibody JAL | |
74075009 | Americium radioisotope | |
74085005 | L-Fuculose-phosphate aldolase (substance) | |
74090008 | Dimozide | |
74124009 | alpha-1,4-Glucan-protein synthase (ADP-forming) | |
74130009 | ^71^Germanium | |
74131008 | 4-Deoxy-L-threo-5-hexosulose-uronate ketol-isomerase | |
74138002 | Interleukin-11 | |
74143009 | Lysine 2-monooxygenase | |
74144003 | Blood group antigen Sj | |
74145002 | Carnitine decarboxylase | |
74149008 | Blood group antibody Boldog | |
74171003 | 1,1-Dimethylhydrazine | |
74199007 | Galactosylceramide sulfotransferase | |
74209006 | Hemoglobin Aichi | |
74210001 | I-J region, MHC | |
74237004 | Atropine sulfate | |
74242007 | Food starch | |
74243002 | Prostaglandin-D>2< 11-ketoreductase | |
74271008 | Formaldehyde dehydrogenase (glutathione) | |
74273006 | Cocaine hydrochloride | |
74292008 | Blood group antibody Bullock | |
74306001 | Aspartate racemase | |
74330004 | Betaine-aldehyde dehydrogenase | |
74374002 | Blood group antibody Th (substance) | |
74405003 | Hemoglobin G-Waimanalo | |
74407006 | Hemoglobin Bethesda | |
74412007 | Blood group antibody Gero | |
74420009 | Galactosylgalactosylglucosylceramide beta-D-acetyl-galactosaminyltransferase | |
74426003 | Hemoglobin I | |
74452009 | ^248^Californium | |
74482003 | Lymphocyte antigen CD73 | |
74483008 | Urethral secretion (substance) | |
74484002 | Blood group antibody McKenney | |
74505001 | Hemoglobin Savannah | |
74510002 | Blood group antigen Xg^a^ | |
74515007 | Hemoglobin Port Phillip | |
74521006 | DNA-directed RNA polymerase | |
74523009 | Sulfadiazine | |
74526001 | D-Octopine dehydrogenase | |
74554008 | Iodophthalein | |
74564004 | Argininosuccinate lyase | |
74567006 | Blood group antibody Bg^a^ | |
74586003 | Streptococcus toxin | |
74589005 | Chlormerodrin | |
74600002 | Bisacodyl tannex | |
74605007 | Triphosphatase | |
74616000 | Sweat | |
74623004 | Hemoglobin Icaria | |
74628008 | Hydrolase | |
74634001 | Pituitary pars intermedia colloid | |
74639006 | D-Alanine-poly(phosphoribitol) ligase | |
74640008 | Mevalonate kinase | |
74643005 | Malate oxidase | |
74646002 | ^129^Barium | |
74652001 | Blood group antigen K | |
74656003 | ^177^Tantalum | |
74661001 | Blood group antibody c-like | |
74665005 | Aluminum welding fumes | |
74678005 | (R)-2-Methylmalate dehydratase | |
74684008 | ^182^Osmium | |
74690007 | Diiodophenylpyruvate reductase | |
74700009 | Fibrinogen Homberg II | |
74713003 | Thiopropazate | |
74718007 | Zinc arsenate | |
74719004 | ^99m^Rhodium | |
74722002 | Rectal contents | |
74727008 | Hydroxyproline | |
74750002 | Tetrachloronaphthalene | |
74755007 | Immunoglobulin IgG2, H chain | |
74794008 | Exodeoxyribonuclease (Lambda-induced) | |
74801000 | Sugar | |
74804008 | 3-Hydroxybenzoate 4-monooxygenase | |
74826009 | Hemoglobin Randwick | |
74835002 | Phosphoserine phosphatase | |
74849006 | Aspartoacylase | |
74860002 | Citrate CoA-transferase | |
74866008 | Deoxycytidylic acid | |
74868009 | Dihydrouracil dehydrogenase (NADP^+^) | |
74880001 | Yellow ointment | |
74889000 | Immunoglobulin M (substance) | |
74897007 | Bromine trifluoride (substance) | |
74905005 | Ethyl morphine | |
74913006 | Pelletierine | |
74916003 | Inorganic arsenic | |
74941005 | Lactaldehyde reductase (DADPH) | |
74947009 | Gaseous substance | |
74950007 | Apomorphine hydrochloride | |
74959008 | Protein disulfide-isomerase | |
74979000 | Anthranilate 3-monooxygenase | |
74981003 | Lewisite | |
74985007 | Glucokinase | |
74993007 | Low molecular weight kininogen | |
74994001 | Blood group antigen Jk3 | |
74997008 | Glucose dehydrogenase | |
75025002 | Adrenal medullary hormone | |
75026001 | Fluorine monoxide | |
75034007 | Blood group antigen BR 726750 | |
75044009 | Sisal fiber | |
75055009 | Nucleoside-triphosphate-hexose-1-phosphate nucleotidyltransferase | |
75062000 | 2-Oxoaldehyde dehydrogenase | |
75064004 | Plasmin inhibitor | |
75081008 | Candida lipolytica serine proteinase | |
75092009 | Histamine H1 receptor | |
75097003 | beta-Glucuronidase (substance) | |
75115009 | Fluoxetine hydrochloride | |
75139004 | Auxin B | |
75153004 | Blood group antigen Gerhany | |
75163007 | 2-Methylcitrate synthase | |
75175002 | Oil of cascarilla | |
75197000 | Ytterbium isotope | |
75214004 | Platelet antibody HPA-2b | |
75215003 | Blood group antigen AnWj (substance) | |
75225008 | Phosphoglucomutase (glucose-cofactor) | |
75228005 | Blood group antibody Vienna | |
75239008 | 3-Hydroxyacyl-CoA dehydrogenase | |
75247008 | Penicillin G benzathine (substance) | |
75265007 | Cytidine | |
75268009 | Mesoridazine besylate | |
75272008 | Aldehyde dehydrogenase [NAD(P)+] (substance) | |
75274009 | Fumarate reductase (NADH) | |
75277002 | Oncogene protein H-RAS | |
75284005 | Glutamate dehydrogenase | |
75285006 | D-Arabinokinase | |
75288008 | Cuprous salt | |
75289000 | Fusarinine-C ornithinesterase | |
75298002 | Proline-tRNA ligase | |
75322009 | Blood group antigen Arun | |
75327003 | Xylometazoline hydrochloride | |
75341007 | Ethacrynate sodium | |
75348001 | 4-Androstene-3,17-dione monooxygenase | |
75359005 | Timolol maleate | |
75362008 | Tetrachloroethylene | |
75363003 | Verrucarin | |
75368007 | 4-Hydroxyphenylpyruvate dioxygenase | |
75371004 | Theobromine | |
75384008 | Hemoglobin Volga | |
75399008 | Citric acid | |
75405006 | 5-Aminopentanamidase | |
75417008 | Cyclopiazonic acid | |
75421001 | Triose-phosphate isomerase | |
75466005 | Alkyl naphthyl methyl pyridinium chloride | |
75476008 | Bovine growth hormone | |
75495001 | Dimethylbenzene | |
75512004 | Hemoglobin City of Hope | |
75520002 | Hemoglobin Brigham | |
75536000 | Metaldehyde | |
75550005 | Chitin deacetylase | |
75553007 | Protease inhibitor venom | |
75560001 | 1-Nitropropane | |
75561002 | Dihydro-beta-ergocryptine (substance) | |
75563004 | alpha-1,3-Mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase | |
75574008 | 42-kDa Protein | |
75590008 | Liquefied petroleum gas | |
75604003 | ^105m^Rhodium | |
75619002 | Somatotropin binding globulin | |
75624004 | Aluminum-based antacid | |
75627006 | Insect repellent | |
75635009 | Urobilin | |
75645006 | Butaperazine | |
75665004 | Monosodium glutamate | |
75666003 | Blood group antibody M>2< | |
75678004 | ^206^Bismuth | |
75696008 | ^45^Titanium | |
75698009 | Hemoglobin F-Urumqi | |
75701001 | Deoxynucleotide 3'-phosphatase | |
75725009 | Hydroxyglutamate decarboxylase | |
75735003 | Blood group antigen M1^a^ | |
75750007 | Escherichia coli antigen test kit | |
75777003 | Cytokine | |
75799006 | Lysine | |
75808003 | Complement component C3b | |
75811002 | HLA-A26 antigen | |
75812009 | Blood group antibody Wr^a^ | |
75815006 | Zinc undecylenate | |
75816007 | Blood group antibody f | |
75819000 | Blood group antigen P^k^ | |
75820006 | Blood group antibody C^w^ | |
75828004 | Creatine kinase | |
75839001 | ^77^Arsenic | |
75840004 | Coagulation factor XIIa | |
75842007 | Azobenzene | |
75849003 | 3-Hydroxy-2-methylpyridine-4,5-dicarboxylate 4-decarboxylase | |
75850003 | L-Idonate dehydrogenase | |
75861006 | Hemoglobin Okazaki | |
75871008 | Argininosuccinic acid | |
75874000 | Krypton radioisotope | |
75876003 | Sodium alginate | |
75925000 | Vimentin | |
75951003 | Iodine monobromide | |
75956008 | Hematein stain (substance) | |
75966000 | Steroid-lactonase (substance) | |
75967009 | ^92^Strontium | |
75982004 | N-Acetyl-beta-glucosaminidase | |
75989008 | Pepsin B | |
75999003 | Diiodotyrosine aminotransferase | |
76001002 | Pyronine B stain (substance) | |
76002009 | Fibrinogen Vancouver | |
76003004 | Triiodobenzoic acid | |
76004005 | Dioxybenzone | |
76008008 | Blood group antibody Or^a^ | |
76044003 | Nasal mucus | |
76048000 | Azocarmine G (GX) stain (substance) | |
76071003 | Blood group antigen Kuhn | |
76088005 | alpha-L-Rhamnosidase | |
76128005 | Antibody to hepatitis B core antigen, IgG type | |
76134003 | Neurotensin | |
76136001 | Antibody to antigen in LW blood group system | |
76150006 | Bacteriorhodopsin | |
76159007 | ^193^Mercury | |
76176006 | Acrolein phenylhydrazine | |
76178007 | Mercuric cyanide | |
76190009 | Talbutal | |
76198002 | Ammonium hydroxide | |
76213002 | Exhaust fumes | |
76239004 | Hemoglobin San Diego | |
76250001 | Beta lysin | |
76252009 | Blood group antibody Lan | |
76269006 | Ferroxidase | |
76283008 | Cytisine | |
76297000 | Ethanolamine-phosphate cytidylyltransferase | |
76300005 | GTP pyrophosphokinase | |
76320006 | Fibrinogen London IV | |
76325001 | Phosphoribosylaminoimidazolecarboxamide formyltransferase | |
76370009 | Nomadic nitrogen | |
76389009 | Phosphomethylpyrimidine kinase | |
76411003 | Platelet antigen HPA-5a | |
76421006 | Nabam | |
76439002 | Fat red 7B stain (substance) | |
76442008 | Hydroxylamine hydrochloride | |
76448007 | Phosphoglycerate phosphatase | |
76470005 | Flavonoid 3'-monooxygenase | |
76488002 | Hemoglobin Camperdown | |
76501008 | Pyrogallol | |
76506003 | Fibrinogen Munich I | |
76525000 | Ephedrine sulfate | |
76526004 | ^194^Mercury | |
76527008 | Sodium radioisotope | |
76533004 | Mustard gas | |
76557004 | Hemoglobin C-Georgetown | |
76560006 | Ribulose-bisphosphate carboxylase | |
76575003 | Podophyllotoxin | |
76587005 | Ganciclovir sodium | |
76592007 | Monoterpenyl-pyrophosphatase | |
76595009 | Geranyltranstransferase | |
76596005 | N-Acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase | |
76600000 | ^102^Rhodium | |
76605005 | Biebrich scarlet stain (substance) | |
76607002 | Blood group antibody Bx^a^ | |
76613006 | Glycidol | |
76617007 | Ferrous chloride | |
76622007 | Alternansucrase | |
76633005 | Fast red TR salt stain (substance) | |
76638001 | N-Acylglucosamine 2-epimerase | |
76639009 | Chorionic fluid | |
76643008 | Isopentenyladenosine | |
76645001 | Prodigiosin | |
76655002 | Methylene chloride | |
76669002 | Cellobiose epimerase | |
76672009 | Cardiac lipoprotein | |
76674005 | Oil of fleabane | |
76688009 | Blood group antibody K19 | |
76698003 | Conjugate | |
76701006 | Pseudogene | |
76711004 | Adenosine triphosphate | |
76716009 | Membrane-bound antibody | |
76721007 | Blood group antigen Yh^a^ (substance) | |
76728001 | GDPmannose dehydrogenase | |
76731000 | Double stranded anti DNA antibody | |
76734008 | Blood group antigen Dalman | |
76736005 | Perinucleolar chromatin | |
76743004 | ^99^Technetium | |
76767007 | Peyote preparation | |
76770006 | N-Acetylgalactosamine-6-sulfatase | |
76781009 | Ketone body (substance) | |
76787008 | Tridihexethyl chloride | |
76829000 | Plant pyrrolizidine alkaloid | |
76861001 | Laminaribiose phosphorylase | |
76874007 | Blood group antibody Berrio | |
76881000 | Borate decahydrate | |
76885009 | Bleach | |
76897005 | Blood group antibody Tc^c^ | |
76898000 | Phenobarbital sodium | |
76904007 | ^75^Germanium | |
76907000 | Dodecenoyl -CoA delta-isomerase | |
76918000 | HLA-Bw53 antigen | |
76925007 | Alkali blue 5B (4B) stain (substance) | |
76958003 | Blood group antibody Le^d^ | |
76964005 | Blood group antigen Welsh | |
76965006 | Blood group antigen Inaba | |
76977001 | Aminopeptidase (human liver) | |
76979003 | Sugar-1-phosphate nucleotidyltransferase | |
77001006 | Protein-disulfide reductase (glutathione) | |
77004003 | ^18^Fluorine | |
77010003 | Blood group antigen BLe^d^ | |
77012006 | Amniotic fluid | |
77014007 | Fixed oil | |
77023005 | Cardiac muscle antibody (substance) | |
77025003 | Pentachlorophenol | |
77033002 | Diaminohydroxyphosphoribosylaminopyrimidine deaminase | |
77036005 | 2,4,5-Trimethoxyamphetamine | |
77037001 | Decylcitrate synthase | |
77042009 | Methyl mercaptan | |
77043004 | Ethyl nitrite | |
77073008 | Nile blue stain (substance) | |
77079007 | Hemoglobin G-Honolulu | |
77089006 | Rheumatoid factor | |
77101008 | Blood group antibody Mi^a^ | |
77118007 | Methyl ethyl ketone | |
77124001 | Hemoglobin Lyon | |
77132009 | Rocket fuel | |
77136007 | alpha-Melanocyte stimulating hormone | |
77148005 | Blood group antigen Cooper | |
77160006 | Private blood group antigen | |
77168004 | Phosphoribosylformylglycinamidine synthase | |
77190004 | Hemoglobin F-Victoria Jubilee | |
77192007 | Abrin | |
77200000 | Endo-1,4-beta-xylanase | |
77210009 | GMP reductase | |
77222007 | Spiperone | |
77242003 | 4-Hydroxyphenylacetate 3-monooxygenase | |
77245001 | 8-Hydroxyquinoline | |
77247009 | 3-Phytase | |
77249007 | Phthalic anhydride | |
77275006 | Blood group antibody Big | |
77313009 | Technetium Tc^99m^ exametazime | |
77314003 | Serine carboxypeptidase | |
77315002 | Antigen in LW blood group system | |
77321003 | Hemoglobin F-Meinohama | |
77322005 | 2-Oxoisovalerate dehydrogenase (lipoamide) | |
77328009 | Microbial serine proteinases | |
77339007 | Hemoglobin Ube-2 | |
77347007 | alpha-1,6-Mannosyl-glycoprotein beta-1,2-N-acetylglucosaminyltransferase | |
77353007 | Fenoprofen calcium | |
77370004 | Lactic acid | |
77387002 | 2-Acylglycerophosphocholine acyltransferase | |
77394004 | Cyclobutane | |
77400002 | Territrem | |
77404006 | Homoserine | |
77409001 | Intramitochondrial ferritin | |
77431009 | Potassium nitrate | |
77433007 | Fullerene | |
77438003 | C1q complement receptor | |
77454000 | Mannoheptulose | |
77473001 | Hemoglobin Contaldo | |
77481000 | Pentamidine diisothionate | |
77487001 | Blood group antibody VA | |
77496001 | gamma Benzene hexachloride | |
77499008 | Very high density lipoprotein | |
77504008 | Fatty-acyl-CoA synthase | |
77510008 | Indium^113^ oxoquinoline WBC label | |
77512000 | Blood group antibody HLA-B12 | |
77515003 | Curare | |
77523001 | Microbody matrix | |
77525008 | B cell antibody | |
77530007 | (S)-2-Methylmalate dehydratase | |
77536001 | Dinocap | |
77537005 | Blood group antigen Truax | |
77544001 | Nicotine polacrilex | |
77557009 | Lymphocyte antigen CD41b | |
77582009 | Fibrinogen Nijmegen | |
77586007 | D-Arabinose dehydrogenase | |
77594000 | 2-N-dibutylamino-ethanol | |
77597007 | 1,4-beta-D-Xylan synthase | |
77610004 | 1,4-Lactonase | |
77611000 | Inorganic dust | |
77617001 | Hemoglobin Olomouc | |
77625004 | Glycerol 2-phosphatase | |
77632008 | Quinidine gluconate | |
77662002 | Immunoprecipitate | |
77671006 | Antidiuretic hormone | |
77673009 | Norepinephrine bitartrate | |
77683008 | Amygdalin | |
77703004 | Amphotericin B | |
77710005 | Plasmalogen | |
77722008 | Poultry bone | |
77729004 | Tetrasodium pyrophosphate | |
77752000 | Hemoglobin K-Cameroon | |
77756002 | L-Ascorbate-cytochrome-b>5< reductase | |
77760004 | Neotran | |
77762007 | Desulfoheparin sulfotransferase | |
77764008 | Guanabenz acetate | |
77767001 | Anti viral antibody | |
77774006 | Blood group antibody Stowe | |
77793008 | Isoamyl acetate | |
77799007 | Aluminum phenolsulfonate | |
77812005 | C3a complement receptor | |
77824003 | Coprostanol | |
77828000 | myo-Inositol-1-phosphate synthase | |
77829008 | Hypotaurine dehydrogenase | |
77832006 | Acetyl-CoA carboxylase | |
77847002 | Ceramide glucosyltransferase | |
77849004 | Potassium bicarbonate | |
77850004 | Organic arsenic | |
77864004 | Antioncogene | |
77901009 | Cycloartenol synthase | |
77907008 | Blood group antibody To^a^ | |
77923008 | Phosphorus radioisotope | |
77927009 | ^128^Barium | |
77929007 | Hemoglobin Chicago | |
77932005 | O-Acetylhomoserine (thiol)-lyase | |
77934006 | Sulfurated lime solution | |
77942007 | Integrin leukocyte adhesive protein | |
77951004 | Aspartate carboxypeptidase | |
77963009 | Central myelin protein | |
77983005 | Lighter fluid | |
77998007 | Deoxythymidine diphosphate | |
78003007 | Fibrinogen New Orleans II | |
78014005 | Urine | |
78020006 | Blood group antigen Westerlund | |
78023008 | ^87m^Strontium | |
78032005 | Resorcinol | |
78036008 | Complement component fragment | |
78047001 | 1-1-bis-(p-chlorophenyl)-2-Nitropropane | |
78059002 | Bisulfite salt | |
78073006 | Acetyldiaminopimelate deacetylase | |
78075004 | 12alpha-Hydroxysteroid dehydrogenase (substance) | |
78116009 | Ceramide cholinephosphotransferase | |
78130004 | Dihydrostreptomycin-6-phosphate 3'alpha-kinase | |
78134008 | Piminodine | |
78137001 | Pumiliotoxin C | |
78151001 | Trichloroacetic acid | |
78173008 | T cell antibody | |
78175001 | Glutarate-semialdehyde dehydrogenase | |
78178004 | Anti rickettsial antibody | |
78215002 | Blood group antigen Rh35 | |
78219008 | Gelsemine | |
78221003 | Cobra venom | |
78228009 | ^129m^Tellurium | |
78231005 | Blood group antibody Js^a^ | |
78232003 | Acylglycerol kinase | |
78242001 | Oncogene protein KS3 | |
78249005 | Hemoglobin North Chicago | |
78252002 | Blood group antibody Finlay | |
78255000 | Coagulation factor II San Juan 1 variant | |
78257008 | Sternutator | |
78258003 | Deoxycholic acid | |
78263004 | Immunoglobulin, constant region | |
78286006 | Lantadene A | |
78316004 | Dehydroepiandrosterone | |
78327002 | Hypotaurocyamine kinase | |
78334000 | CMP-N-acylneuraminate phosphodiesterase | |
78339005 | HLA-B14 antigen | |
78343009 | Isopropylamine | |
78346001 | Spermidine dehydrogenase | |
78350008 | Triethylamine | |
78369003 | Alizarin 2-beta-glucosyltransferase | |
78386009 | Blood group antigen I^S^ | |
78388005 | Histidine-tRNA ligase | |
78400000 | Crotonoyl-[acyl-carrier-protein] hydratase | |
78404009 | Ethanolamine oxidase | |
78414000 | Rubber compound | |
78433005 | Methylaminoheptane | |
78445001 | Hemoglobin Jackson | |
78446000 | ^194^Osmium | |
78447009 | Phospholipid | |
78452004 | Xanthosine-5-phosphate | |
78454003 | Immunoglobulin, GM>11< allotype | |
78460003 | Antistreptolysin O | |
78462006 | ^134^Cesium | |
78467000 | Lymphocyte antigen CDw60 | |
78481003 | Iofetamine I^123^ hydrochloride | |
78491009 | Trinitrobenzene | |
78505007 | Glutamate-cysteine ligase | |
78520001 | Dazomet | |
78527003 | Fucose | |
78529000 | ^130^Iodine | |
78552001 | Chloral betaine (substance) | |
78556003 | Dihydroorotase | |
78570003 | Indium^111^ transferrin | |
78573001 | Lignoceric acid | |
78588006 | Fibrinolysin, human | |
78589003 | Diphenylcyanoarsine | |
78594003 | Blood group antigen Bonde | |
78597005 | Intracisternal material of known identity | |
78602003 | Shikimate kinase | |
78604002 | Sphingosine cholinephosphotransferase | |
78605001 | HLA-Dw15 antigen | |
78617004 | Barium hydroxide | |
78636009 | Aminopyridine | |
78637000 | 3-Ethylmalate synthase | |
78650004 | Adenosylhomocysteine nucleosidase | |
78655009 | Benzoyl chloride | |
78661007 | Blood group antibody Rb^a^ | |
78665003 | Hemoglobin Daneshgah-Tehran | |
78671009 | Zinc arsenite | |
78686003 | Copper^64^ acetate | |
78688002 | Blood group antigen Henry | |
78702007 | Thalidomide | |
78707001 | Blood group antibody Fl | |
78708006 | Sodium arsanilate | |
78709003 | Human leukocyte antigen Bw67 (substance) | |
78713005 | Caproic acid | |
78720003 | N-Acyl mannosamine kinase | |
78721004 | Nervonic acid | |
78730007 | ^189^Iridium | |
78736001 | alpha>2< HS glycoprotein | |
78744001 | Hydrogen dehydrogenase | |
78749006 | HLA-DQ antigen | |
78750006 | Blood group antibody Sc2 | |
78751005 | Kynurenine-oxoglutarate aminotransferase | |
78758004 | 2,3-Dimethylmalate lyase | |
78759007 | Pyridoxamine-phosphate aminotransferase | |
78760002 | Angiotensinase | |
78772008 | Phenanthrene | |
78774009 | FMN adenylyltransferase | |
78782009 | Silver chloride | |
78787003 | Hydroxyphenyl mercurichloride | |
78796003 | 7-Dehydrocholesterol reductase | |
78802001 | Blood group antigen Norlander | |
78825000 | Fibrinogen Leuven | |
78833004 | ^246^Californium | |
78834005 | Fucosylglycoprotein 3-alpha-galactosyltransferase | |
78837003 | Glycine benzoyltransferase | |
78851003 | Lipoprotein-X | |
78859001 | Morrhuate sodium | |
78866000 | HLA-Aw68 antigen | |
78869007 | Nuclear fast red stain (substance) | |
78870008 | Cobalt radioisotope | |
78903005 | Pancreatic elastase | |
78910004 | Solid substance | |
78924000 | Hemoglobin J-Cubujuqui | |
78936006 | Propoxycaine hydrochloride | |
78955006 | Blood group antibody Hollister | |
78959000 | Sulfathiourea | |
78966004 | Metham sodium | |
78971006 | Toluenediamine | |
79005005 | Immunoglobulin gene GM allotype | |
79006006 | Methylglutaconyl-CoA hydratase | |
79007002 | Industrial product | |
79008007 | Blood group antibody Dh^a^ | |
79018002 | Amylosucrase | |
79027001 | Hemoglobin J-Cairo | |
79029003 | Blood group antibody Mitch | |
79039009 | Methacrylic acid | |
79055002 | Hydroxylamine oxidase | |
79061004 | Germanium | |
79066009 | Hemoglobin Cranston | |
79080002 | Blood group antibody Rh39 | |
79084006 | Clostridial toxin | |
79098003 | Hemoglobin Beograd | |
79124006 | Blood group antigen To^a^ | |
79127004 | Fibrin monomer | |
79135001 | Promazine hydrochloride | |
79136000 | ^146^Gadolinium | |
79141008 | Crotalus adamanteus serine proteinase (substance) | |
79146003 | Citrated calcium carbimide | |
79166007 | Acyl-phosphate-hexose phosphotransferase | |
79176005 | Blood group antigen Rh40 | |
79193005 | Fibrinogen Homberg I | |
79197006 | ^82^Rubidium | |
79198001 | Alloalbumin | |
79209008 | Dicumarol (substance) | |
79211004 | Alcohol dehydrogenase [NAD(P)+] (substance) | |
79212006 | Proinsulin | |
79219002 | Hemoglobin Sunnybrook | |
79226002 | Blood group antigen Stairwalt | |
79242009 | [Acyl carrier-protein] acetyltransferase | |
79245006 | Glutamate synthase (ferredoxin) | |
79249000 | Lochia flava | |
79251001 | Glyceraldehyde-3-phosphate dehydrogenase (NADP^+^) (phosphorylating) | |
79271005 | Tremetol | |
79288003 | Cross reacting antigen | |
79293000 | Nucleoside-triphosphatase | |
79316006 | Alkyl aryl polyether sulfate | |
79326004 | Lymphocyte antigen CD23 | |
79328003 | Lysine decarboxylase | |
79329006 | Serum protein | |
79330001 | Zinc trichlorophenate | |
79331002 | Blood group antibody Hr | |
79338008 | ^97m^Technetium | |
79341004 | Lymphocyte antigen CD71 | |
79343001 | Oil of parsley | |
79370008 | Thiocyanate compound | |
79375003 | Proteoglycan | |
79380007 | Hydrocortisone acetate | |
79388000 | Aryl acylamidase | |
79391000 | ATP phosphoribosyltransferase | |
79396005 | Purine-nucleoside phosphorylase | |
79415006 | Procollagen-proline,2-oxoglutarate 4-dioxygenase | |
79422003 | Gadolinium radioisotope | |
79428004 | Dihydroxyaluminum aminoacetate | |
79446005 | Imidazole acetyltransferase | |
79448006 | ^91m^Yttrium | |
79477007 | ^66^Gallium | |
79482000 | ^174^Hafnium | |
79496006 | Blood group antigen Y. Bern | |
79498007 | Zeta-chain hemoglobin | |
79506002 | ^196m^Iridium | |
79514008 | Methylenetetrahydrofolate reductase (NADPH) | |
79522001 | Carbamate pesticide | |
79523006 | ^76^Bromine | |
79531001 | Aminopeptidase P | |
79545007 | trans-L-3-Hydroxyproline dehydratase | |
79549001 | Cyanoacrylate | |
79550001 | ^197^Gold | |
79568003 | Acetylornithine aminotransferase | |
79576001 | Titanium sulfate | |
79580006 | Adrenal hormone | |
79581005 | Hydrated sodium borate | |
79610008 | Technetium Tc^99m^ serum albumin | |
79612000 | Myelin | |
79625008 | Methylenetetrahydrofolate dehydrogenase (NAD^+^) | |
79630007 | Extracellular secretion material following exocytosis, luminal, exocrine | |
79638000 | Blood group antibody Hr^B^ | |
79640005 | Deoxythymidylic acid | |
79651005 | Naphthyl acetic acid | |
79657009 | Type III site-specific deoxyribonuclease | |
79680001 | Sporotrichum proteinase I | |
79685006 | 5-Aminolevulinate synthase | |
79689000 | Amprotropine | |
79691008 | Oximinotransferase | |
79697007 | Leukocyte-adhesion receptor | |
79706000 | Bilirubin | |
79721006 | Flavone apiosyltransferase | |
79744009 | beta-Lactamase | |
79761007 | Di-2-ethylhexyl phthalate | |
79769009 | Anti parasitic antibody | |
79773007 | Active C4b2a | |
79775000 | Terebene | |
79778003 | Acetylene | |
79784000 | Lead acetate | |
79796007 | Blood group antibody Pt^a^ | |
79798008 | Spleen exonuclease | |
79803004 | Chloroacetophenone | |
79813007 | Blood group antibody H | |
79846001 | Coagulation factor IX Cambridge variant | |
79850008 | Augusticeps-type venom | |
79862007 | Alanopine dehydrogenase | |
79900002 | Methionine S-methyltransferase | |
79907004 | Aminobenzoic acid derivative | |
79912003 | Squalene monooxygenase | |
79937008 | Sodium cacodylate | |
79943005 | Nucleoside-diphosphatase | |
79973001 | Complement component C9 | |
79976009 | 2-Isopropoxyethanol | |
80044001 | Polysaccharide methyltransferase (substance) | |
80048003 | Blood group antibody Walls | |
80086007 | Hemoglobin Toyoake | |
80105007 | Blood group antibody iP>1< | |
80120001 | Tryptophan 2,3-dioxygenase | |
80122009 | HLA-B40 antigen | |
80133007 | Blood group antibody Westerlund | |
80143005 | GMP synthase (glutamine-hydrolysing) | |
80164009 | Cinnabar | |
80188006 | HLA-C antigen | |
80189003 | Plant steroid alkaloid | |
80191006 | Protocatechuate 3,4-dioxygenase | |
80214006 | Micrococcus caseolyticus neutral proteinase | |
80222004 | 5'-Nucleotidase | |
80230003 | 2,6-Dichloro-4-nitrobenzenamine | |
80234007 | Matrix of cartilage | |
80237000 | Cocoa butter | |
80238005 | Prodipidine | |
80253002 | Aminometradine | |
80259003 | Food flavoring agent | |
80260008 | Iodinated I^125^ levothyroxine | |
80263005 | Aminotriazole | |
80269009 | Keratan-sulfate endo-1,4-beta-galactosidase | |
80276004 | Blood group antigen Savior | |
80283006 | UDPgalactopyranose mutase | |
80305003 | Pontamine sky blue 6BX stain (substance) | |
80312007 | Platinum isotope | |
80322001 | Synthetic alkaloid | |
80324000 | Stone dust | |
80343000 | Anti bacterial antibody | |
80344006 | ^85m^Krypton | |
80373009 | Sedoheptulokinase | |
80382003 | Hydrocarbon | |
80393001 | Diiodotyrosine | |
80403006 | Blood group antibody Clements | |
80413003 | Blood group antigen Stowe | |
80424001 | Blood group antigen McKenney | |
80429006 | UDP-N-acetylglucosamine pyrophosphorylase | |
80453000 | Proline racemase | |
80458009 | Aminoacyl-lysine dipeptidase | |
80464002 | Anthranilate 1,2-dioxygenase (deaminating, decarboxylating) | |
80465001 | Blood group antigen Lan | |
80472000 | Hemoglobin Strasbourg | |
80482004 | Blood group antigen Rh32 | |
80485002 | Sulfur monochloride | |
80492007 | Alkyl dimethyl ethylbenzyl ammonium chloride | |
80494008 | Reticulin | |
80506001 | Aldose dehydrogenase | |
80516009 | Blood group antigen Davis J | |
80517000 | Heparosan-N-sulfate-glucuronate 5-epimerase | |
80521007 | ^200^Platinum | |
80532007 | Aprobarbital | |
80537001 | Peptide YY | |
80539003 | Cobalt salt | |
80540001 | Succinyl-CoA hydrolase | |
80553003 | Tetrachloroquinone | |
80558007 | Blood group antibody HLA-A8 | |
80562001 | Deoxy guanosine triphosphate | |
80572003 | Colony-stimulating factor, granulocytic | |
80575001 | Blood group antigen Kaj | |
80582002 | Glycerol | |
80590002 | Lymphocyte antigen CDw12 | |
80591003 | N-Acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase | |
80605008 | Acokantherin | |
80613009 | Mannitol dehydrogenase (NADP^+^) | |
80616001 | Hemoglobin Radcliffe | |
80620002 | HLA-B35 antigen | |
80630006 | Sodium arsenite | |
80652002 | Phenyl mercuric salt | |
80688007 | Pro-opiomelanocortin | |
80705000 | Blood group antigen Knoebnchild | |
80706004 | Alkyl dimethyl ethyl ammonium chloride | |
80741000 | Plasma kinin | |
80743002 | Mustard black | |
80745009 | Barium thioglycolate | |
80751004 | ^133^Xenon | |
80754007 | Blood group antigen Hut | |
80760007 | Blood group antigen Nijhuis | |
80789009 | Diosgenin | |
80819005 | Proline carboxypeptidase | |
80832000 | Ketopantoaldolase | |
80837006 | Sialidase | |
80839009 | D-Amino-acid dehydrogenase (substance) | |
80854003 | ^211^Lead | |
80861004 | Nucleolus organizer region | |
80869002 | Immunoglobulin, GM>19< allotype | |
80873004 | Oxyhemoglobin | |
80876007 | Phosphomannan mannosephosphotransferase | |
80892002 | Blood group antibody Zd | |
80903004 | Haplotoxin | |
80911009 | Exodeoxyribonuclease III | |
80916004 | Potassium phosphate | |
80917008 | Toxin | |
80918003 | Protoporphyrin IX | |
80920000 | ^176^Tungsten | |
80929004 | Blood group antigen Cs^a^ | |
80946001 | Thromboxane | |
80959009 | Methylprednisolone acetate | |
80972005 | Cephazolin sodium | |
80987000 | Animal genome | |
80992003 | erythro-3-Hydroxyaspartate dehydratase | |
80994002 | 4-Aminopyridine | |
81017004 | Encainide hydrochloride | |
81044009 | 2-Ethoxyacetate | |
81053002 | Blood group antibody Welsh | |
81080009 | Blood group antigen En^a^FR | |
81100008 | Pentose | |
81111000 | Glycogen-synthase-D phosphatase | |
81114008 | Phosphatidylcholine-dolichol acyltransferase | |
81118006 | Gonadal hormone | |
81123006 | Interleukin-5 | |
81172004 | Creatinase | |
81176001 | Batrachotoxin | |
81181005 | Chitobiosyldiphosphodolichol alpha-mannosyltransferase | |
81195008 | Pentane | |
81205009 | Blood group antigen Do^a^ | |
81213005 | Blood group antigen Snyder | |
81222006 | Sutilains | |
81243007 | Isocitrate dehydrogenase (NADP^+^) | |
81255001 | Acetyl-CoA acyltransferase | |
81262005 | Blood group antibody Gy^a^ | |
81273003 | Fibrinogen Louisville | |
81286007 | Growth factor | |
81290009 | Tyrosine decarboxylase | |
81297007 | Blood group antibody Boil | |
81312003 | 5-Aminovalerate aminotransferase | |
81322009 | Phosphoamidase | |
81324005 | Zirconium radioisotope | |
81329000 | Blood group antibody PeCo | |
81332002 | Blood group antibody N>2< | |
81357007 | Aspartate ammonia-lyase | |
81362008 | Hexobarbital | |
81365005 | Levamisole hydrochloride | |
81384008 | Blood group antibody Dautriche | |
81394003 | Bence Jones protein | |
81395002 | Arachidonate 12-lipoxygenase | |
81397005 | Auramine O stain (substance) | |
81419006 | Chemical fumes | |
81426006 | Blood group antigen HLA-B8 | |
81430009 | Titanium oxide | |
81432001 | HLA-Dw18 antigen | |
81444003 | Coagulation factor X | |
81458001 | Eucatropine | |
81461000 | Fetal fibrinogen | |
81473000 | Sulfite reductase | |
81481004 | 4-Aminobutyrate aminotransferase | |
81494002 | Cholinephosphotransferase | |
81508005 | Doxycycline monohydrate | |
81522005 | Deoxythymidine triphosphate | |
81537009 | Tartronate-semialdehyde synthase | |
81578006 | Lymphocyte antigen CD25 | |
81582008 | Hemoglobin Santa Ana | |
81584009 | Brombenzyl cyanide | |
81589004 | Moniliformin | |
81599009 | Paraoxon | |
81600007 | Blood group antigen Gy^a^ | |
81602004 | Naled | |
81605002 | gamma Fetoprotein | |
81610003 | Blood group antigen Frando | |
81615008 | Hypercalcemic steroid preparation | |
81620008 | HLA-A23 antigen | |
81621007 | Indium^111^ red cell label | |
81625003 | 3beta-Hydroxy-delta 5-steroid dehydrogenase | |
81641002 | Blood group antigen Chase | |
81651001 | Diagnostic antiserum | |
81655005 | Protoporphyrinogen oxidase | |
81663006 | Glucuronokinase | |
81679007 | Blood group antibody Chase | |
81689006 | Prostatic secretions | |
81692005 | ATP deaminase | |
81702008 | Active C5b67 | |
81719005 | Tremorgenic mycotoxin | |
81732000 | Indolepyruvate methyltransferase | |
81761004 | Technetium Tc^99m^ microaggregated albumin | |
81778008 | Mercurophylline injection | |
81784006 | Blood group antibody Rod | |
81801009 | Alcohol oxidase | |
81809006 | Fumarylacetoacetase | |
81810001 | Vanillylmandelic acid | |
81816007 | Candicidin | |
81821005 | ^243^Americium | |
81837004 | Uridine kinase | |
81847001 | Hemoglobin Setif | |
81859002 | Dichlorophenarsine hydrochloride | |
81860007 | Isoetharine mesylate (substance) | |
81863009 | Watasemia-luciferin 2-monooxogenase | |
81867005 | Tantalum isotope | |
81868000 | Linolenic acid | |
81880008 | beta-Alanyl-CoA ammonia-lyase | |
81886002 | Ethylene glycol | |
81901008 | Hemoglobin Deer Lodge | |
81905004 | Globulin | |
81911001 | Chewing tobacco | |
81926004 | T-cell antigen receptor | |
81929006 | Hemoglobin Raleigh | |
81945008 | Chloromuconate cycloisomerase | |
81946009 | Dantrolene sodium | |
81948005 | Iron silicate | |
81963008 | Blood group antigen BOA 3150 (substance) | |
81969007 | Phosphoenolpyruvate carboxylase | |
81989008 | Nucleoside phosphoacylhydrolase | |
82004000 | Methyl acetate | |
82017002 | 5-Carboxymethyl-2-hydroxymuconate delta-isomerase | |
82021009 | Lotus aspartic proteinase | |
82026004 | Butyl methyl ketone | |
82055007 | Spermidine synthase | |
82061005 | Triphenylamine | |
82064002 | Coproporphyrinogen I | |
82075003 | Bismuth subsalicylate | |
82083009 | Phosphoprotein phosphatase | |
82100006 | IMP dehydrogenase | |
82122004 | Bacillus thuringiensis preparation | |
82131004 | Heptabarbital (substance) | |
82134007 | Apyrase | |
82149004 | Hemoglobin Hofu | |
82150004 | Diisopropyl-fluorophosphatase | |
82154008 | Rubber cis-polyprenylcistransferase | |
82160008 | Cathepsin L | |
82171009 | Blood group antibody Hoalzel | |
82175000 | tRNA (guanine-N^1^)-methyltransferase | |
82176004 | Blood group antigen Koopman | |
82183006 | Cytoadhesin receptor | |
82205007 | Tetrachloro-1,4- benzoquinone | |
82216000 | Metazocine | |
82220001 | Staphylococcal serine proteinase | |
82222009 | Acetoacetate-CoA ligase | |
82224005 | Ethyl mercury phosphate | |
82227003 | D-Lysopine dehydrogenase | |
82230005 | Quinidine sulfate | |
82239006 | Blood group antigen Naz | |
82246002 | Exoribonuclease H | |
82256003 | Human gene | |
82270003 | Blood group antibody Bi | |
82279002 | Blood group antibody Rh32 | |
82282007 | Apigenin O^4'^-methyltransferase | |
82299008 | Blood group antibody M^A^ | |
82322007 | Oil of dill | |
82332000 | Chlorodimethyl phenoxy ethanol | |
82335003 | Gluconolactonase | |
82337006 | Isopentyl alcohol | |
82359008 | Prulaurasin | |
82391009 | Hemoglobin F-Poole | |
82394001 | Glucose-1-phosphate adenylyltransferase | |
82395000 | CMP-N-acetylneuraminate-beta-galactoside alpha-2,3-sialyltransferase | |
82398003 | Chlorinated biphenyl oxide | |
82409003 | Antibody to hepatitis B core antigen | |
82411007 | Rose bengal stain (substance) | |
82412000 | Adenosylmethionine hydrolase | |
82444001 | 3-Hydroxybutyryl-CoA dehydrogenase | |
82450006 | Cottonseed oil | |
82469001 | Glutathione dehydrogenase (ascorbate) | |
82481002 | White phosphorus | |
82485006 | Pentamethonium bromide | |
82489000 | Blood group antibody IAB | |
82490009 | Chenodeoxycholic acid | |
82503004 | ^164^Ytterbium | |
82544003 | Hemoglobin Bibba | |
82549008 | Hemoglobin J-Broussais | |
82565009 | Mucopolysaccharide | |
82566005 | Animal feed | |
82570002 | Glucose-1-phosphatase | |
82571003 | Blood group antigen Zim | |
82572005 | Sulphenone | |
82592003 | Complement factor Bb | |
82594002 | Blood group antibody Riv | |
82604001 | Echis carnatus prothrombin-activating proteinase | |
82609006 | Haptoglobin 1-1 | |
82620006 | Blood group antigen M^g^ | |
82622003 | Vitamin A | |
82623008 | Dihydrodipicolinate synthase | |
82645009 | Antibody to hepatitis B surface antigen | |
82671008 | Alkylmercury lyase | |
82682000 | Victoria blue 4R stain (substance) | |
82693003 | Myoglobin | |
82720002 | Blood group antigen Lu16 | |
82753007 | Lymphocyte antigen CD20 | |
82759006 | Dihydrofolate synthase | |
82772007 | Formiminoaspartate deiminase | |
82778006 | Uroporphyrin III | |
82786006 | Citrate (re)-synthase | |
82787002 | Chloridazon-catechol dioxygenase | |
82792000 | Biotin-[methylmalonyl-CoA-carboxyltransferase] ligase | |
82798001 | Coagulation factor X Prower variant | |
82803005 | Blood group antibody Juneau | |
82846008 | L-Arabinitol dehydrogenase | |
82850001 | Fibrinogen Charlottsville | |
82855006 | ^115^Indium | |
82861009 | Blood group antigen Kelly | |
82863007 | Incomplete antibody | |
82873009 | Abnormal hemoglobin, extended chain | |
82885001 | Colistimethate | |
82890003 | Hemoglobin Tashikuergan | |
82906001 | Aldose-6-phosphate reductase (NADPH) | |
82912006 | Non-ionized calcium | |
82922000 | Coagulation factor II Poissy variant | |
82927006 | High molecular weight kininogen | |
82931000 | Sodium succinate | |
82937001 | Factor VII antibody | |
82963006 | Polygalacturonase | |
82981009 | Decaborane | |
82983007 | Euchromatin | |
82989006 | Decylhomocitrate synthase | |
83003003 | Lymphocyte antigen CD37 | |
83024008 | Oil of patchouli | |
83026005 | RNA uridylyltransferase | |
83034004 | Monocrotaline | |
83036002 | Lactate | |
83042003 | Erythropoietin | |
83051006 | Cimetidine hydrochloride | |
83054003 | Undecaprenol kinase | |
83055002 | Escin | |
83064007 | Hemoglobin J-Guantanamo | |
83066009 | Hemoglobin Harbin | |
83068005 | Factor XI antibody | |
83078008 | Blood group antibody Os^a^ | |
83087004 | 6-Phospho-beta-galactosidase | |
83098003 | Intracellular fibril | |
83102006 | Sorbitol-6-phosphatase | |
83108005 | Blood group antigen Vg^a^ | |
83109002 | Blood group antibody Baugh | |
83115002 | Dichlorophenazone | |
83131005 | Blood group antigen Perry | |
83143006 | Glutethimide | |
83149005 | Transaldolase | |
83177001 | Thallium compound | |
83180000 | Phenylpyruvate tautomerase | |
83182008 | 2-Dehydro-3-deoxy-L-arabinonate dehydratase | |
83184009 | Asparagine-tRNA ligase | |
83188007 | Adenylylsulfate-ammonia adenylyltransferase | |
83191007 | Organic sulfone compound | |
83205002 | ^76^Krypton | |
83235009 | Bovine growth hormone recombinant | |
83237001 | Titanium isotope | |
83261008 | myo-Inositol 1-kinase | |
83267007 | Phenacetin | |
83280005 | Fibrinogen Lille | |
83283007 | Chloramphenicol acetyltransferase | |
83298009 | Ethyl acetate | |
83309005 | Ethopropazine hydrochloride (substance) | |
83310000 | Cupric salt | |
83334005 | Adenine phosphoribosyltransferase | |
83342006 | Cyanate hydrolase | |
83348005 | Phosphatidylinositol-bisphosphatase | |
83349002 | Viomycin kinase | |
83357004 | Red veterinary petrolatum | |
83388000 | UDP-N-acetylglucosamine-dolichyl-phosphate-N-acetylglucosaminephosphotransferase | |
83391000 | HLA-Bw antigen | |
83399003 | Glycerone kinase | |
83400005 | Phosphoglycerate kinase (GTP) | |
83404001 | Blood group antibody K | |
83407008 | Protoveratrine A | |
83423008 | Sodium diprotrizoate | |
83432005 | Blood group antigen 1123K | |
83438009 | Dobesilate calcium | |
83446005 | Riboflavin synthase | |
83475004 | Desmin | |
83496006 | HLA class I antigen | |
83499004 | Blood group antibody Maliff | |
83515009 | HLA-DRw17 antigen | |
83534009 | Cyclopentolate hydrochloride | |
83539004 | Dihydrofolate reductase | |
83545007 | Fumitremorgen | |
83552009 | Pharyngeal mucus | |
83581005 | Silicon dioxide | |
83595008 | Goat's milk | |
83596009 | Iron oxide | |
83598005 | Xenon | |
83600004 | Spirit soluble eosin stain (substance) | |
83601000 | ^38^Sulfur | |
83614004 | ^229^Thorium | |
83615003 | Hemoglobin A>2< Fitzroy | |
83616002 | Thrombomodulin-thrombin complex (substance) | |
83619009 | Polyvinyl alcohol | |
83621004 | Complement receptor 5 | |
83625008 | Antimony thioglycolate | |
83640005 | UDP-N-acetylmuramoylalanyl-D-glutamate-2,6 diaminopimelate ligase | |
83667004 | Enterogastrone | |
83671001 | Hydroxylysine kinase | |
83672008 | Pentachloronitrobenzene (substance) | |
83682009 | Methylaspartate mutase (substance) | |
83688008 | Flumethrin | |
83695004 | Hemoglobin Spanish Town | |
83696003 | Oncogene protein LYL1 | |
83700006 | Glyceraldehyde-3-phosphate dehydrogenase (NADP^+^) | |
83701005 | Erythrulose reductase | |
83702003 | Bialamicol | |
83704002 | Pipethanate | |
83705001 | Nitrogenase | |
83717004 | Big big gastrin | |
83732006 | Hb 114(G16), Leu (substance) | |
83734007 | Blood group antigen Eggenberger | |
83737000 | Tedion | |
83749004 | Acid radical | |
83769009 | Phosphoglycolate phosphatase (substance) | |
83770005 | Phospho-2-dehydro-3-deoxygluconate aldolase | |
83792009 | Succinate-coenzyme A ligase (adenosine diphosphate-forming) (substance) | |
83797003 | Leucine (substance) | |
83814001 | Sorghum aspartic proteinase | |
83815000 | Hemoglobin E | |
83847005 | Palladium radioisotope | |
83849008 | 1,1-Dichloroethylene | |
83863002 | Deoxyguanosine kinase | |
83869003 | Blood group antibody Co3 | |
83871003 | Hemoglobin Sogn | |
83872005 | Phenyramidol (substance) | |
83873000 | Sodium monofluorophosphate | |
83881004 | Aluminium oxide | |
83882006 | Juniper oil (substance) | |
83884007 | Blood group antigen Lu4 | |
83897009 | Paralytic shellfish toxin (substance) | |
83912003 | ^129^Iodine | |
83933007 | Hydroxyzine pamoate | |
83945003 | Hydroxyzine hydrochloride | |
83963003 | Uranium nitrate | |
83968007 | Clemastine fumarate | |
83972006 | ^233^Uranium | |
83981000 | Erythromycin gluceptate | |
83989003 | Blood group antigen Messenger | |
84006004 | Dihydrodipicolinate reductase (substance) | |
84019000 | DNA alpha-glucosyltransferase | |
84024002 | Dolichyl-phosphate beta-glucosyltransferase | |
84035007 | Cystathionine | |
84055008 | ^204^Bismuth (substance) | |
84059002 | Pinguinain | |
84079005 | Blood group antigen Clements | |
84083005 | Hemoglobin Khartoum | |
84103009 | Phenoxyethanol | |
84123005 | Nitrofurfuryl methylether | |
84131000 | Urate oxidase (substance) | |
84136005 | Hemoglobin Stanleyville-II | |
84144005 | Sodium cyanide | |
84145006 | Cryptenamine | |
84147003 | Thymidine,2-oxoglutarate dioxygenase | |
84163006 | Blood group antigen Je^a^ | |
84164000 | Chloramben | |
84165004 | Cefoxitin sodium (substance) | |
84169005 | Collidine | |
84171005 | Blood group antibody Tc^b^ | |
84181009 | Styrene | |
84191003 | ^193^Platinum | |
84212004 | Ethylenimine | |
84213009 | Midazolam hydrochloride | |
84217005 | Titan yellow stain (substance) | |
84230006 | Plant sesquiterpene | |
84242001 | ^245^Plutonium | |
84250005 | Fumitoxin | |
84259006 | Blood group antigen Wb | |
84270004 | Cade oil | |
84274008 | Hydrobromic acid | |
84276005 | Lymphocyte antigen CD43 | |
84317008 | Phosphonacetic acid | |
84323003 | Mercocresols | |
84341006 | ^254^Californium | |
84342004 | Rubidium radioisotope | |
84345002 | Hemoglobin Saverne | |
84348000 | Fructose 5-dehydrogenase (NADP^+^) | |
84361000 | Fibrinogen Los Angeles | |
84363002 | Hydroxyketone dye | |
84372005 | Blood group antibody Hartley | |
84373000 | Hyaluronoglucuronidase (substance) | |
84375007 | Hemoglobin J-Sicilia | |
84377004 | Staphylococcal cysteine proteinase | |
84381004 | Menthyl anthranilate and titanium oxide | |
84386009 | Tribromoethanol | |
84406006 | HLA-DPw antigen | |
84424008 | Potassium cyanide | |
84429003 | Rubredoxin-nicotinamide adenine dinucleotide phosphate ^+^ reductase (substance) | |
84430008 | Cross reacting antibody | |
84433005 | HLA-Bw56 antigen | |
84443008 | ^225^Radium | |
84464007 | Lymphocyte antigen CD42b | |
84486008 | Mannose-1-phosphate guanylyltransferase (substance) | |
84488009 | Compound blood group antigen iH (substance) | |
84498003 | Pipe smoking tobacco (substance) | |
84509001 | Hemoglobin Siriraj | |
84520001 | Viral structural gene | |
84524005 | Iduronate 2-sulfatase | |
84536004 | Fibrinogen Metz | |
84538003 | Blood group antigen C | |
84547006 | L-Ascorbate oxidase | |
84553006 | ^93m^Molybdenum | |
84560000 | Leucine aminotransferase | |
84583002 | Active C5b | |
84601005 | Immunoglobulin, GM>24< allotype | |
84609007 | Blood group antibody Xg^a^ | |
84616008 | Dolichyl-xylosyl-phosphate-protein xylosyltransferase | |
84629008 | Androgen | |
84650004 | Intestinal contents (substance) | |
84653002 | Blood group antibody Swarts | |
84656005 | Atebrin FS stain (substance) | |
84658006 | Blood group antibody Elder | |
84671009 | Acyl-[acyl-carrier-protein] desaturase | |
84698008 | Cholesterol | |
84704008 | Pyridoxamine-oxaloacetate aminotransferase (substance) | |
84708006 | Blood group antigen Gill | |
84717006 | Diacylglycerol-sterol acyltransferase | |
84718001 | Alkyl dimethyl ethyl ammonium bromide | |
84720003 | Complement component C4a | |
84746004 | Pituitary hormone | |
84748003 | Doxapram hydrochloride | |
84761003 | Phosphodiesterase I | |
84770000 | Polyphosphate kinase (substance) | |
84771001 | D-Xylose dehydrogenase | |
84786007 | Dehydrogluconokinase | |
84791008 | Sodium metabisulfite | |
84802001 | Equinatoxin | |
84818007 | 17,21-Dihydroxypregnenolone | |
84822002 | Methyl methacrylate (substance) | |
84823007 | tRNA isopentenyltransferase | |
84835006 | Cyclic adenosine monophosphate (substance) | |
84847000 | Platinum | |
84865001 | Active C1r/C1s (substance) | |
84870008 | Blood group antibody Horn | |
84874004 | Iodohippurate I^123^ sodium | |
84896005 | Oncogene protein TCL3 | |
84905003 | Beta interferon (substance) | |
84922001 | Blood group antibody McAuley | |
84926003 | Homovanillic acid | |
84927007 | Fungal gene | |
84933003 | Germanium tetrahydride | |
84934009 | Hemoglobin Cowtown | |
84935005 | Tumor-angiogenesis factor | |
84960005 | Auxin A | |
84963007 | ^3^Helium | |
84973009 | Glucan 1,6-alpha-isomaltosidase | |
84987009 | Ethyl phosphate | |
84990003 | ^80^Bromine | |
85012003 | Protein-glutamate methyltransferase | |
85024005 | Plant estrogenic glycoside | |
85035000 | Griseofulvin microsize | |
85037008 | Doxepin hydrochloride (substance) | |
85043005 | D-Alanine aminotransferase | |
85060000 | Blood group antibody Duvall | |
85066006 | Azo black stain (substance) | |
85074007 | ^103m^Rhodium | |
85105005 | Hemoglobin Inkster | |
85112001 | Cellodextrin phosphorylase (substance) | |
85115004 | Methylmalonate-semialdehyde dehydrogenase (acylating) | |
85122007 | Globoside alpha-N-acetylgalactosaminyltransferase (substance) | |
85129003 | Blood group antigen Wr^a^ | |
85134004 | Phospholipase D | |
85137006 | Tetrachlorophenol | |
85142003 | Germanium isotope | |
85146000 | Thorium radioisotope | |
85155002 | Anti RANA antibody | |
85172009 | Bromine pentafluoride | |
85174005 | Phthalocyanine dye | |
85181003 | Fibrous protein | |
85185007 | p-Nitrobiphenyl (substance) | |
85190005 | Bismark brown Y stain (substance) | |
85197008 | Coagulation factor IX Vancouver variant | |
85205004 | beta-Adrenergic receptor | |
85214009 | Glutamic acid | |
85236007 | D region, MHC | |
85242006 | Levamphetamine (substance) | |
85246009 | Barbiturase | |
85252005 | Cuscohygrine | |
85253000 | Blood group antigen Bp^a^ | |
85254006 | Opheline kinase | |
85258009 | Chromic acid | |
85267009 | Angiotensin II | |
85268004 | 5-Dehydro-2-deoxygluconokinase | |
85270008 | Wood splinter | |
85283009 | Glutamine-phenylpyruvate aminotransferase | |
85287005 | Hypoxanthine | |
85294008 | Haptoglobin | |
85297001 | Maltose synthase | |
85310002 | Bis(5'-adenosyl)-triphosphatase | |
85335008 | beta Pyridyl carbinol | |
85347002 | Cardiotoxin venom | |
85351000 | Aldehyde oxidase | |
85364004 | Coagulation factor II Madrid variant (substance) | |
85369009 | Tin radioisotope (substance) | |
85374001 | Blood group antigen Donavieski | |
85378003 | Bromine (substance) | |
85391002 | Meralluride (substance) | |
85393004 | Blood group antigen ILe^bH^ | |
85404003 | ^131^Tellurium | |
85410003 | Hemoglobin Linkoping | |
85427006 | Hemoglobin Owari | |
85433002 | Butoconazole nitrate | |
85451001 | Nitrite reductase (cytochrome) | |
85459004 | Exophthalmos producing substance | |
85460009 | Oncogene protein K-RAS | |
85462001 | Pentanone | |
85475001 | Cypermethrin | |
85482002 | Sorbitol-6-phosphate dehydrogenase | |
85491003 | Catalase | |
85494006 | Gold sodium thiosulfate (substance) | |
85504001 | Complement component C5a | |
85508003 | 5-Pyridoxate dioxygenase | |
85565002 | Blood group antigen Fy5 | |
85574000 | Zinc oxide fumes | |
85577007 | Diaminobutyrate-pyruvate aminotransferase | |
85580008 | Capreomycin sulfate | |
85584004 | Achromobacter iophogus collagenase | |
85594009 | Blood group antigen Sc1 | |
85596006 | Fluorescein stain (substance) | |
85600001 | Triacylglycerol | |
85603004 | Triphenamyl | |
85608008 | Methacrylonitrile (substance) | |
85609000 | Methionine gamma-lyase | |
85612002 | Atrazine | |
85633006 | Para-nitrosulfathiazole (substance) | |
85643009 | Filicin | |
85661000 | 5-Methyltetrahydropteroyltriglutamate-homo-cysteine methyltransferase | |
85668006 | Starch powder | |
85673000 | Intracisternal material | |
85689002 | Coproporphyrinogen III | |
85693008 | Technetium Tc^99m^ aggregated albumin | |
85701007 | Ganglioside GM>2< (substance) | |
85717001 | Carbonate dehydratase | |
85724000 | Oxacillin sodium | |
85727007 | Xanthine phosphoribosyltransferase (substance) | |
85731001 | Immunoglobulin, secretory piece | |
85737002 | Chlorpheniramine maleate (substance) | |
85751002 | 17-Hydroxyprogesterone | |
85760005 | Hyperosmotic laxative | |
85766004 | myo-Inositol 3-methyltransferase | |
85773009 | Hemoglobin D-Ouled Rabah | |
85784002 | Cytosine deaminase | |
85788004 | Thioglycolic acid | |
85794007 | Blood group antibody Snyder | |
85822005 | Zeatin | |
85829001 | Left bronchial mucus | |
85834002 | Blood group antibody Cooper | |
85839007 | Glutamine-scyllo-inosose aminotransferase | |
85854001 | Alkane 1-monooxygenase | |
85860001 | Nervous system hormone-like substance | |
85877001 | Ethanolamine kinase | |
85886006 | Blood group antigen Peretz | |
85889004 | ^191^Platinum | |
85894004 | Ketol-acid reductoisomerase | |
85899009 | Lithium | |
85906005 | Bulbogastrone | |
85923001 | Oil of marjoram | |
85937005 | Acrolein | |
85943007 | Ca^2+^-transporting ATPase | |
85954002 | Blood group antigen Berrio | |
85955001 | Hemoglobin A>2< Zagreb | |
85958004 | ^72^Selenium | |
85969001 | Hemoglobin Rampa | |
85977002 | Crag herbicide | |
85981002 | Chromotrope 2R stain (substance) | |
85984005 | Hemoglobin Memphis | |
85988008 | Blood group antibody Jk^a^ | |
85997007 | Oncogene protein mas | |
85998002 | Blood group antibody Ull | |
86001006 | HLA-DPw2 antigen | |
86026002 | Hemoglobin Stanmore | |
86027006 | Argon isotope | |
86054009 | Riboflavinase | |
86076000 | Lymphocyte antigen CD45RO | |
86083007 | Blood group antigen Pantaysh | |
86108002 | mRNA (O^2^'-methyladenosine-N^6^)-methyltransferase | |
86120005 | Phosphoribulokinase | |
86132009 | Hemoglobin A>2< Honai | |
86141004 | UTP-glucose-1-phosphate uridylyltransferase | |
86155007 | Lanosterol | |
86180007 | Serpentine asbestos | |
86186001 | ^37^Argon | |
86202008 | NAD^+^ pyrophosphatase | |
86205005 | Carbon oxysulfide | |
86211008 | Free thyroxin | |
86218002 | Cantharidin | |
86223002 | Carboxypeptidase B | |
86227001 | Ytterbium | |
86233005 | Sulfur dioxide | |
86239009 | Galactoside 3(4)-L-fucosyltransferase | |
86241005 | ^66^Germanium | |
86243008 | ^109^Cadmium | |
86254003 | Blood group antigen Tichmeyer | |
86257005 | Ritodrine hydrochloride | |
86261004 | Decay accelerating factor | |
86272009 | HLA-Dw8 antigen | |
86281003 | 2-Nitropropane | |
86301004 | Posterior pituitary hormone | |
86315002 | Dibutyl succinate | |
86320002 | Fibrinogen Milano I | |
86332003 | Blood group antigen Yt^b^ | |
86336000 | Hemoglobin Chiapas | |
86340009 | Glucose 1-phosphate thymidylyltransferase | |
86355000 | Electrolyte | |
86383003 | Coccidioidin | |
86388007 | Mercuric oxide | |
86399009 | Nickel isotope | |
86416000 | Potassium arsenite | |
86420001 | Biotin-[propionyl-CoA-carboxylase,(ATP-hydrolysing)] ligase | |
86430005 | L-Iduronidase | |
86431009 | Pantothenic acid | |
86436004 | Ethyl nitrophenyl benzene thiophosphonate | |
86447006 | Phosphoglyceride | |
86460000 | D-Methionine-pyruvate aminotransferase | |
86461001 | Plant diterpene | |
86471004 | Tribasic copper sulfate | |
86478005 | Diisopropylamine | |
86506005 | Mercury (II) reductase | |
86518001 | Steroid sulfotransferase | |
86520003 | Hemoglobin J-Chicago | |
86521004 | ^77^Bromine | |
86526009 | Deoxyguanylic acid | |
86529002 | N-Sulfoglucosamine-3-sulfatase | |
86530007 | Blood group antibody Hu | |
86532004 | Blood group antibody Sj | |
86537005 | Penicillium roqueforti neutral proteinase | |
86541009 | Brilliant crocein stain (substance) | |
86549006 | Hypothalamic or pituitary hormone (substance) | |
86551005 | Hemoglobin Chad | |
86575005 | Nitrogen isotope | |
86579004 | Nitrogen gas | |
86584005 | Iodoalphionic acid (substance) | |
86600008 | Fish toxin | |
86609009 | Wood preservative | |
86613002 | Sarcosine oxidase | |
86621008 | Hamamelose kinase | |
86622001 | Blood group antibody Taur | |
86627007 | Haemoglobin F-Ube | |
86633003 | Cadmium salt | |
86637002 | ^81^Rubidium | |
86640002 | 3-Demethylubiquinone-9 3-methyltransferase | |
86659000 | Thiethylperazine malate | |
86668003 | Blood group antigen Barrett | |
86692006 | ^206^Thallium | |
86697000 | HLA-Aw36 antigen | |
86701002 | Nucleoside-triphosphate pyrophosphatase | |
86710005 | Nitrogen radioisotope | |
86712002 | (S)-2-Hydroxy-fatty-acid dehydrogenase | |
86739005 | Zinc | |
86742004 | Deoxycytidylate hydroxymethyltransferase | |
86750008 | Nitrazine yellow stain (substance) | |
86754004 | ^197^Platinum | |
86756002 | Tincture of green soap | |
86759009 | Blood group antibody Gallner | |
86778009 | Polyribonucleotide synthase (ATP) | |
86783001 | L-Galactonolactone oxidase | |
86790006 | Blood group antibody JL | |
86813000 | Oxalomalate lyase | |
86822004 | Neurine | |
86836009 | Hemoglobin J-Baltimore | |
86848007 | Penicillin amidase | |
86852007 | ^196m>2<^Gold | |
86865003 | ^65^Nickel | |
86878003 | Retinal dehydrogenase | |
86884000 | 2,4,5-Trichlorophenoxyacetic acid | |
86887007 | Hemoglobin I-Interlaken | |
86904001 | Cholestenone 5alpha-reductase | |
86913004 | Blood group antibody Milne | |
86922003 | Plant cardiac glycoside | |
86928004 | Sulfur tetrafluoride | |
86935007 | Blood group antigen An^a^ | |
86946005 | Trichlorophenoxy ethyl sulfate | |
86951004 | Blood group antibody Hands | |
86953001 | Zinc salt | |
86955008 | Glycobiarsol | |
86960007 | Epidermal growth factor-urogastrone receptor | |
86963009 | Lower respiratory tract mucus | |
86973006 | ^133m^Barium | |
86988001 | Ergotoxine | |
86990000 | Deoxycytidine kinase | |
86994009 | HLA-B38 antigen | |
87028007 | Hemp fiber | |
87032001 | Dipeptidyl peptidase II | |
87033006 | Itaconyl-CoA hydratase | |
87036003 | Blood group antibody R1^a^ | |
87039005 | Carbamoyl-serine ammonia-lyase | |
87044003 | Palmitic acid | |
87067001 | Sublimed sulfur | |
87090006 | Flavoxate hydrochloride | |
87097009 | Nitrofurazone (substance) | |
87112000 | Blood group antigen Zaw | |
87116002 | 5,25-Dihydroxy cholecalciferol | |
87122006 | Blood group antibody Covas | |
87136001 | Asparagine | |
87148003 | Amphetamine sulfate | |
87151005 | Neostigmine methylsulfate | |
87154002 | Cystine reductase (NADH) | |
87167004 | Oncogene protein int-2 | |
87171001 | ^127m^Tellurium | |
87174009 | Guaifenesin | |
87200008 | Lower respiratory fluids | |
87205003 | Malathion | |
87212007 | Lysine-tRNA ligase | |
87222001 | Citrate(si)-synthase | |
87236006 | Dihydroxyphenylalanine ammonia-lyase | |
87251002 | 4-Methoxyamphetamine | |
87283008 | Clidinium bromide | |
87300005 | 2,4-Dichlorophenol 6-monooxygenase | |
87303007 | Cephapirin (substance) | |
87304001 | Acetylglutamate kinase | |
87312009 | Colony-stimulating factor, multiple | |
87316007 | Immunoglobulin, light chain | |
87332005 | Homogentisic acid | |
87336008 | Alcohol dehydrogenase | |
87337004 | Sulfur iodide | |
87344008 | Pantothenate kinase | |
87347001 | Urocanic acid | |
87368000 | Blood group antibody En^a^FR | |
87371008 | Phosphoribosyl pyrophosphate | |
87399004 | Apolipoprotein A | |
87401005 | ^212^Lead | |
87403008 | Heptane | |
87410002 | Technetium Tc^99^ N-substituted iminodiacetate | |
87437000 | ^73^Selenium | |
87440000 | Tryptophan 5-monooxygenase | |
87444009 | Immunoglobulin, GM>12< allotype | |
87445005 | Ipodate | |
87452007 | Light metal compound | |
87453002 | Carbon | |
87468001 | Magnesium bromide | |
87472002 | Vecuronium bromide | |
87477008 | Phytanic acid | |
87478003 | ^239^Plutonium | |
87485004 | Strontium bromide | |
87499000 | Blood group antigen Mckeever | |
87504000 | Enoyl-CoA hydratase | |
87524001 | Immunoglobulin, hypervariable region | |
87526004 | Bilirubin oxidase | |
87542006 | Blood group antigen Rh33 | |
87549002 | Blood group antigen Gd | |
87568004 | Hormone | |
87574004 | o-Aminophenol oxidase | |
87585002 | ^41^Calcium | |
87593002 | Blood group antibody Er^a^ | |
87599003 | Metaxalone | |
87609004 | Hexokinase | |
87610009 | Aflatoxin B | |
87612001 | Blood | |
87624008 | L-Iditol dehydrogenase | |
87625009 | 4-Hydroxy-2-oxoglutarate aldolase | |
87629003 | Coagulation factor X variant | |
87645001 | Hexylene glycol | |
87657005 | Blood group antibody E. Amos | |
87661004 | Lymphocyte antigen CD59 | |
87664007 | Hemoglobin A>2< NYU | |
87672009 | Blood group antigen Mateen | |
87692002 | Wax-ester hydrolase | |
87708000 | Vitamin | |
87714007 | ^185^Iridium | |
87718005 | Acetyl-CoA carboxylase-phosphatase | |
87723005 | Cholestenone 5beta-reductase | |
87729009 | Sulfite oxidase | |
87738006 | Isopropyl cresol | |
87741002 | Hemoglobin D-Bushman | |
87744005 | Calcium arsenate | |
87802005 | ^33^Phosphorus | |
87805007 | Deoxycytidine deaminase | |
87811005 | Injectable fibrinolysin | |
87817009 | Glycerol-3-phosphate dehydrogenase (NAD^+^) | |
87831009 | Trimipramine maleate | |
87835000 | Blood group antibody Dantu | |
87847006 | Promoxolane | |
87853006 | Technetium Tc^99m^ iron ascorbate | |
87869004 | Manganese | |
87873001 | Ribonuclease U>2< | |
87882007 | 3-Isopropylmalate dehydratase | |
87889003 | Hemoglobin Chapel Hill | |
87896001 | Creosote | |
87897005 | Human antihemophilic plasma | |
87901004 | Catechol l,2 dioxygenase | |
87918000 | Mineral | |
87924006 | N-Acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase | |
87925007 | Biotin-CoA ligase | |
87926008 | dTDP4-amino-4,6-dideoxy-D-glucose aminotransferase | |
87929001 | Ribose dehydrogenase (NADP^+^) | |
87930006 | Fibrinogen Baltimore I | |
87931005 | Mimosine | |
87940009 | ^179^Tantalum | |
87946003 | Blood group antigen U^x^ | |
87954001 | Guanosine deaminase | |
87957008 | Calotropin | |
87958003 | Ferrous citrate Fe^59^ | |
87972007 | Blood group antibody Sadler | |
87981001 | o-Pyrocatechuate decarboxylase | |
87983003 | Rhodium salt | |
87990008 | Phospho-N-acetylmuramoyl-pentapeptide-transferase | |
88001004 | Chlorpropham | |
88005008 | Hemoglobin Helsinki | |
88007000 | Sodium tetrahydride | |
88014003 | Beryllium | |
88020002 | Ketoacid | |
88023000 | LYT antigen | |
88025007 | Silvex | |
88038004 | Fructuronate reductase | |
88043006 | Allose kinase | |
88064005 | Hemoglobin F-Forest Park | |
88074008 | Cytokinins | |
88087002 | Dodecylguanidine monoacetate | |
88090008 | Tellurium isotope | |
88097006 | Tin compound | |
88122008 | Passiflorine | |
88131008 | HLA-DRw12 antigen | |
88166005 | Copper^64^ versenate | |
88171003 | Cytidine deaminase | |
88179001 | Robin | |
88184007 | Acetyl chloride | |
88194002 | Clofenotane | |
88204001 | Antigen in Kidd (JK) blood group system | |
88222003 | Phosphatidylcholine 12-monooxygenase | |
88236008 | Phosphine | |
88237004 | ^82m^Rubidium | |
88245009 | Bacillus subtilis ribonuclease (substance) | |
88262004 | Phenylphosphine | |
88287006 | Sulfur radioisotope | |
88292008 | Blood group antigen Zt^a^ | |
88304003 | Lymphocyte antigen CD48 | |
88319002 | Prompt zinc insulin | |
88325003 | Calcium undecylenate | |
88330004 | Cevine | |
88337001 | Maleylacetoacetate isomerase | |
88341002 | Blood group antibody k | |
88342009 | HLA-D antigen | |
88352008 | Bromindione | |
88368002 | Angiotensin I | |
88375001 | Blood group antibody Van Buggenhout | |
88376000 | Carcinogen | |
88381009 | Methyl chloride | |
88383007 | Phosphoglucokinase | |
88404004 | alpha>2< Neuramino glycoprotein | |
88406002 | Chymotrypsin C | |
88408001 | D-Amino-acid oxidase | |
88426003 | Oncogene protein N-MYC | |
88427007 | Methyl acetylene | |
88432008 | Arabinose isomerase | |
88452009 | Steroid delta-isomerase | |
88453004 | Platelet antigen HPA-1a | |
88457003 | ^198^Lead | |
88462002 | HLA-Aw33 antigen | |
88468003 | Magnesium silicate | |
88473009 | Selenomethionine Se^75^ (substance) | |
88476001 | Urate | |
88480006 | Potassium | |
88485001 | Etidocaine | |
88486000 | Poly (ribitol-phosphate) beta-glucosyltransferase | |
88488004 | Lead | |
88502003 | Behenic acid | |
88525002 | 2-Coumarate O-beta-glucosyltransferase | |
88543003 | Hydroxyphenamate (substance) | |
88546006 | Sarcosine | |
88551000 | 5-Azacytidine | |
88555009 | Aminodeoxygluconate dehydratase | |
88557001 | Phosphatidylcholine-sterol acyltransferase | |
88574001 | Otic sulfonamide preparation | |
88583006 | Creatinine deiminase | |
88585004 | Chlorprothixene hydrochloride | |
88589005 | Cyclocumarol | |
88602005 | Glucagon-like peptide 2 | |
88605007 | ^224^Radium | |
88617009 | Magnesium isotope | |
88625006 | Water soluble aniline blue stain (substance) | |
88631009 | beta Sitosterol | |
88637008 | Hemoglobin A>2< Babinga | |
88640008 | Deoxyribodipyrimidine endonucleosidase | |
88660000 | Fast sulfon black F stain (substance) | |
88661001 | Platelet antibody HPA-4a | |
88662008 | Pyridoxine 5-dehydrogenase | |
88683002 | Active C4b2a3b | |
88689003 | Long-chain-alcohol dehydrogenase | |
88704000 | Bacterial insecticide | |
88709005 | dTMP kinase | |
88710000 | alpha-1,3-Mannosyl-glycoprotein beta-1,2-N-acetylglucosaminyltransferase | |
88724001 | Ptomatropine | |
88730001 | Fibrinogen Paris IV | |
88736007 | Betamethasone dipropionate | |
88754006 | alpha-Naphthyl thiourea | |
88757004 | Sulfisoxazole acetyl (substance) | |
88770008 | Indole-3-acetaldehyde reductase (NADH) | |
88781006 | Americium (substance) | |
88785002 | Nitroso dye | |
88792007 | Peptidoglycan glycosyltransferase | |
88802007 | Chlorazanil | |
88811007 | Witch hazel | |
88832004 | 3alpha-Hydroxycholanate dehydrogenase | |
88863000 | tert-Butyl alcohol | |
88864006 | ^250^Californium | |
88878007 | Protein | |
88881002 | Blood group antigen H | |
88896003 | Threonine racemase | |
88913006 | Blood group antigen Milano | |
88919005 | Fibroblast growth factor | |
88921000 | Fibril | |
88941005 | Hemoglobin Thailand | |
88949007 | 2-Alkyn-1-ol dehydrogenase | |
88954003 | ^55^Iron | |
88958000 | Blood group antibody Mo^a^ | |
88970001 | Eudermol | |
88983000 | Lymphocyte antigen CD61 | |
89006002 | Vipera russelli proteinase | |
89009009 | Methylphosphothioglycerate phosphatase | |
89015009 | Choleretic agent (substance) | |
89025004 | MCPA sodium salt | |
89028002 | Curcumin stain (substance) | |
89033003 | Blood-group-substance endo-1,4-beta-galactosidase | |
89041003 | Blood group antigen Sk^a^ | |
89043000 | Blood group antibody Geslin | |
89048009 | Collagen type IV | |
89055006 | Benzylpenicillin sodium | |
89064001 | Oncogene protein met | |
89067008 | Cinchonidine | |
89071006 | Phenylpyruvic acid | |
89074003 | Blood group antigen Wolfe | |
89086000 | Fibrin degradation product | |
89094007 | Thrombospondin | |
89095008 | Takabrucem salicylanilide | |
89119000 | Nitrate salt | |
89128004 | Xanthates | |
89139001 | Light green SF stain (substance) | |
89148006 | Fast garnet GBC salt stain (substance) | |
89152006 | Dynein ATPase | |
89177007 | Proton | |
89184004 | Vinbarbital | |
89189009 | Neurohumoral receptor | |
89191001 | 15-Hydroperoxy-5,8,11,13-eicosatetraenoic acid | |
89195005 | Octamethyl pyrophosphoramide | |
89197002 | Germanium compound | |
89201002 | Carbonyl reductase (NADPH) | |
89203004 | Acetolactate decarboxylase | |
89214001 | Chlorotoloxyacetic acid | |
89219006 | Potassium gluconate | |
89224009 | Glucan 1,6-alpha-glucosidase | |
89227002 | Paracrine substance | |
89249008 | Dipyrrole | |
89256002 | Formate dehydrogenase | |
89263002 | Glucose-1-phosphate cytidylyltransferase | |
89264008 | rRNA (adenine-N^6^)-methyltransferase | |
89272005 | ^58^Cobalt | |
89284007 | N^6^-Methyl-lysine oxidase | |
89289002 | [Hydroxymethylglutaryl-CoA reductase (NADPH)]-phosphatase | |
89301000 | 2-Oxoadipate reductase | |
89306005 | Imidazoleacetate-phosphoribosyldiphosphate ligase | |
89307001 | 15-Hydroxyprostaglandin dehydrogenase (NAD^+^) | |
89309003 | Organic sulfur compound | |
89326009 | Glucosulfone sodium | |
89335002 | Copper undecylenate | |
89336001 | Caffeate 3,4-dioxygenase | |
89349006 | Hexachloroacetone | |
89350006 | Blood group antibody O'Connor | |
89351005 | Potassium iodide | |
89364006 | Leucine dehydrogenase | |
89371001 | 5-Oxoprolyl-peptidase | |
89401004 | Potassium guaiacolsulfonate | |
89422005 | Allobarbital | |
89436000 | Blood group antigen Rich | |
89453007 | Citryl-CoA lyase | |
89457008 | Radioactive isotope | |
89468008 | Coagulation factor IX Seattle variant | |
89482008 | Histidinol-phosphate aminotransferase | |
89506006 | Oxalic acid | |
89515004 | Hypochlorite salt | |
89518002 | N-octylbicycloheptene dicarboximide | |
89526005 | HLA-B18 antigen | |
89543008 | Blood group antibody V | |
89553009 | Sulfite reductase (ferredoxin) | |
89564007 | Blood group antigen Cameron | |
89577003 | Pontamine sky blue 5BX stain (substance) | |
89588009 | Aryl-aldehyde dehydrogenase (NADP^+^) | |
89592002 | Blood group antibody Be^a^ | |
89595000 | Iodized oil | |
89612008 | Petrichloral | |
89619004 | Ubiquinol-cytochrome-c reductase | |
89632009 | ^227^Thorium | |
89668004 | Blood group antigen Terschurr | |
89669007 | Carboxypeptidase S | |
89678001 | Cefuroxime axetil | |
89701003 | Dithiazanine iodide | |
89702005 | Selenium salt | |
89707004 | Sesame oil | |
89717009 | Bilirubin Z transport protein | |
89735000 | Blood group antibody Kenneddy | |
89745003 | Somatotropin receptor (substance) | |
89750009 | Adonidin | |
89767002 | Blood group antibody Mateen | |
89771004 | Lymphocyte antigen CD34 | |
89772006 | Tranylcypromine sulfate | |
89775008 | Pipamazine | |
89781000 | Hydroxymandelonitrile lyase | |
89803009 | Blood group antigen Mackin | |
89811004 | Gluten | |
89818005 | Technetium Tc^99^ tagged red cells | |
89822000 | 4-Nitroso dimethylamine | |
89829009 | Etioporphyrin | |
89838006 | Coagulation factor IX Hilo variant | |
89841002 | Blood group antibody AY | |
89848008 | (S)-Norlaudanosoline synthase | |
89851001 | Thebaine | |
89853003 | Cortilymph | |
89856006 | Ponceau S stain (substance) | |
89864000 | Entomophthora collagenolytic proteinase | |
89866003 | Plotospasmin toxin | |
89867007 | Triorthocresyl phosphate | |
89875001 | Serogically-defined antigen | |
89889006 | Cotton fiber | |
89920007 | Blood group antibody Pr>1d< | |
89926001 | ^236^Uranium | |
89952007 | Blood group antigen s^D^ | |
89981008 | Nucleoside ribosyltransferase | |
90011005 | CDPglycerol pyrophosphatase | |
90018004 | 6-Phospho-beta-glucosidase | |
90019007 | (N-Acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase | |
90025006 | ^95^Zirconium | |
90026007 | Ajacine | |
90029000 | Tyrosine carboxypeptidase | |
90047006 | Aminobenzoate decarboxylase | |
90058002 | Bauxite fumes | |
90059005 | ^79^Krypton | |
90066006 | Oxalyl-CoA decarboxylase | |
90077000 | Progesterone monooxygenase | |
90086005 | Sphingosine | |
90088006 | HLA-B39 antigen | |
90095002 | Oil of angelica | |
90100000 | Isopropanol dehydrogenase (NADP^+^) | |
90106006 | Blood group antibody En^a^FS | |
90107002 | Alkylglycerone kinase | |
90118002 | Dobutamine hydrochloride | |
90136002 | Pink wine | |
90142003 | Calcium caseinate | |
90148004 | Succinate-hydroxymethylglutarate CoA-transferase | |
90150007 | ^117m^Tin | |
90156001 | Blood group antigen Becker | |
90160003 | Blood group antibody Bell | |
90170001 | Propargyl alcohol (substance) | |
90192002 | Aspergillus oryzae neutral proteinase | |
90193007 | Agmatine 4-coumaroyltransferase | |
90209005 | ^100^Rhodium | |
90220005 | Novobiocin | |
90234005 | Candicin toxin | |
90247000 | Blood group antibody Gould | |
90260006 | Allergen | |
90266000 | Hemoglobin D | |
90296005 | Blood group antibody Fy4 | |
90299003 | Blood group antigen U^z^ | |
90304002 | Blood group antibody Wetz | |
90311003 | Lymphocyte chemotactic factor | |
90317004 | Helium | |
90339002 | Germicide | |
90342008 | Carbazochrome salicylate | |
90344009 | Etazocine | |
90350004 | 1-Pyrroline-4-hydroxy-2-carboxylate deaminase | |
90355009 | Carbon radioisotope | |
90404003 | Fibrinogen Barcelona I | |
90495007 | Plant alcoholic oil | |
90529007 | ^77^Germanium | |
90534006 | (R)-Dehydropantoate dehydrogenase | |
90537004 | ^232^Plutonium | |
90544008 | Iodine monochloride | |
90567005 | Iron isotope | |
90581007 | Carbamide peroxide | |
90582000 | Cytidine triphosphate (substance) | |
90595005 | Silver bromide | |
90615000 | HLA-Bw61 antigen | |
90617008 | Indium^113^ bleomycin | |
90618003 | Gold compound | |
90624009 | Blood group antigen Mo^a^ | |
90633006 | Azobilirubin pigment | |
90644003 | L-Gulonate dehydrogenase | |
90656002 | Blood group antigen LW^a^ | |
90664008 | ^127^Tin | |
90666005 | Glyoxylate reductase (NADP^+^) | |
90667001 | Lymphocyte antigen CD72 | |
90668006 | Enzyme | |
90670002 | Deltamethrin | |
90671003 | Potassium thiocyanate | |
90677004 | Mustard white | |
90694002 | Asparagine synthase (glutamine-hydrolysing) | |
90696000 | Neosaxitonin | |
90698004 | Chondro-6-sulfatase | |
90714008 | HLA-Aw74 antigen | |
90720009 | Cytoplasmic antibody | |
90724000 | 3-Hydroxymethylcephem carbamoyltransferase | |
90733003 | Metrizamide | |
90737002 | Leaves | |
90743000 | Deoxycytidine triphosphate deaminase (substance) | |
90745007 | Bunamiodyl | |
90758008 | Coparaffinate | |
90762002 | Blood group antibody Jk3 | |
90812004 | Hot liquid | |
90836000 | Blood group antigen Reiter | |
90841008 | Thallium radioisotope | |
90847007 | Guanine tRNA-ribosyltransferase | |
90851009 | Coagulation factor Va | |
90865006 | Hemoglobin J-Cambridge | |
90867003 | Cytochrome-b>5< reductase | |
90872007 | Ephedrine dehydrogenase | |
90873002 | Malate dehydrogenase (acceptor) | |
90875009 | Doxorubicin hydrochloride | |
90879003 | Thorium compound | |
90902007 | (S)-2-Hydroxy-acid oxidase | |
90922006 | Protopine | |
90936001 | Hemoglobin Crete | |
90943007 | Carnitine dehydrogenase | |
90944001 | Coumarinic anhydride | |
90945000 | beta 2 microglobulin | |
90953008 | Gallium compound | |
90957009 | Thiosulfate sulfurtransferase | |
90960002 | Tartrate dehydrogenase | |
90971001 | beta-2 Adrenergic receptor | |
90977002 | Blood group antibody Driver | |
91004000 | Organic dust | |
91007007 | Sodium selenate | |
91013003 | Pentazocine hydrochloride | |
91016006 | Polydeoxyribonucleotide synthase (ATP) | |
91018007 | Cresylic acid | |
91023007 | Alverine citrate | |
91026004 | Sodium isopropyl xanthate | |
91067009 | Prostaglandin-E>2< 9-ketoreductase | |
91100006 | Allantoin racemase | |
91103008 | Blood group antigen IP | |
91132006 | Curcin | |
91137000 | Deuterium | |
91163005 | ^242^Californium | |
91166002 | Monoiodotyrosine | |
91171009 | Pesticide adjuvant | |
91185004 | Active C1q | |
91190001 | Dextran 1,6-alpha-isomaltotriosidase | |
91194005 | Cellulose synthase (GDP-forming) | |
91205007 | dTDPgalactose dehydrogenase | |
91215001 | Acetylene tetrabromite | |
91239006 | ^111m^Silver | |
91245003 | Oncogene protein C-MYC | |
91254000 | gamma-Glutamylcyclotransferase | |
91255004 | Copper fumes | |
91262008 | Guanosine triphosphate | |
91263003 | Blood group antigen Th^a^ | |
91266006 | Sulfoxone | |
91279002 | ^77^Krypton | |
91283002 | Glutathione peroxidase | |
91295002 | Fast blue BB salt stain (substance) | |
91306006 | Unclassified vasodilating agent | |
91309004 | Acute phase reactant | |
91312001 | Hemoglobin St. Etienne | |
91314000 | Furazolidone | |
91319005 | Levanase | |
91351006 | Hemoglobin Kenitra | |
91353009 | Cephalotoxin | |
91370001 | Peroxyacetic acid | |
91384006 | Dibenzoxepin derivative | |
91403002 | Lobeline | |
91410008 | Silicon compound | |
91423001 | Coagulation factor II Quick variant | |
91424007 | Nitrogen dioxide | |
91426009 | Antigen in Duffy (FY) blood group system | |
91455001 | Wood tar | |
91464006 | Lymphocyte antigen CD36 | |
91495004 | Palladium isotope | |
91518003 | Polybrominated biphenyl | |
91521001 | Corticosterone | |
91542004 | Blood group antibody Peretz | |
91543009 | Serine palmitoyltransferase | |
91548000 | Mandelate 4-monooxygenase | |
91560004 | Isopropyl benzene | |
91572005 | Blood group antibody rr-35 | |
91574006 | Hemoglobin British Columbia | |
91577004 | Fibrinogen Chapel Hill III | |
91594002 | Methohexital sodium | |
91598004 | Benzoyl peroxide | |
91606004 | Cochineal stain (substance) | |
91611002 | Iodide peroxidase | |
91616007 | Arsenic trisulfide | |
91619000 | Andirine | |
91626000 | Blood group antigen Sharp | |
91638009 | Hemoglobin Miyashiro | |
91639001 | Cold cream | |
91645009 | Thymine | |
91665002 | ^26^Aluminum | |
91668000 | Orcinol 2-monooxygenase | |
91677007 | Aplysiatoxin | |
91680008 | Formiminoglutamase (substance) | |
91720002 | Body substance | |
95969004 | Organic acid | |
95970003 | Trace element | |
95971004 | Urea nitrogen | |
95972006 | Ammonia nitrogen | |
95973001 | Protein nitrogen | |
95974007 | alpha-Amino acid nitrogen | |
95975008 | Inorganic sulfate | |
95976009 | Aluminum stearate | |
95977000 | Chelated iron | |
95978005 | Spot remover | |
95979002 | Trichloroethyl alcohol | |
95980004 | Creosol | |
95981000 | Paradimethylaminobenzaldehyde | |
95982007 | Methoxyacetate | |
95983002 | Adipic acid | |
95984008 | alpha-Aminoadipic acid | |
95985009 | 2,4 Toluenediamine | |
95986005 | 2,6 Toluenediamine | |
95987001 | Chloramine B | |
95988006 | Poloxalene | |
95989003 | Organic chloride compound | |
95990007 | Grubicide | |
95991006 | Famphur | |
95992004 | Cythioate | |
95993009 | Bromadiolone | |
95994003 | Camptothecin | |
95995002 | Capsaicin | |
95996001 | Kapok | |
95997005 | Capsanthin | |
95999008 | Bacterial enterotoxin | |
96001009 | Clostridium difficile toxin B | |
96002002 | Verotoxin 1 | |
96003007 | Verotoxin 2 | |
96004001 | Escherichia coli toxin | |
96007008 | Tazobactam | |
96008003 | Sulbactam | |
96009006 | Bacitracin methylene disalicylate | |
96010001 | Sulfomyxin | |
96012009 | Carbomycin A | |
96013004 | Carbomycin B | |
96016007 | Carbadox | |
96017003 | Thiostrepton | |
96019000 | Tiamulin fumarate | |
96021005 | Tylosin phosphate | |
96022003 | Tylosin tartrate | |
96024002 | Tilmicosin phosphate | |
96025001 | Butirosin | |
96026000 | Neomycin palmitate | |
96027009 | Neomycin undecylenate | |
96028004 | Dihydrostreptomycin sulfate | |
96030002 | Apramycin sulphate | |
96031003 | Sisomicin | |
96032005 | Erythromycin phosphate | |
96033000 | Erythromycin thiocyanate | |
96035007 | Dirithromycin | |
96036008 | Miokamycin | |
96037004 | Roxithromycin | |
96039001 | Mercaptobenzothiazole | |
96040004 | Mercaptobenzothiazole zinc | |
96041000 | Mercaptobenzothiazole sodium | |
96042007 | Cephalonium | |
96043002 | Cephapirin benzathine (substance) | |
96045009 | Ceftiofur sodium | |
96046005 | Ceftiofur hydrochloride | |
96048006 | Cefepime | |
96050003 | Cefpodoxime proxetil | |
96056009 | Cefatrizine (substance) | |
96058005 | Cilastatin | |
96059002 | Cefmetazole | |
96061006 | Loracarbef | |
96066001 | Cloxacillin benzathine | |
96068000 | Amoxicillin trihydrate (substance) | |
96070009 | Ampicillin sodium | |
96071008 | Ampicillin trihydrate | |
96075004 | Tetracycline phosphate complex | |
96076003 | Rolitetracycline | |
96078002 | Ormetoprin | |
96079005 | Pipemidic acid | |
96080008 | Enrofloxacin | |
96082000 | Sarafloxacin | |
96083005 | Clinafloxacin | |
96085003 | Fleroxacin | |
96089009 | Pefloxacin | |
96092008 | Trovafloxacin | |
96094009 | Sulfabromomethazine sodium | |
96095005 | Sulfaethoxypyridazine | |
96096006 | Sulfaquinoxaline | |
96098007 | Valacyclovir (substance) | |
96100007 | Foscarnet sodium | |
96101006 | Pirlimycin hydrochloride | |
96102004 | Carnidazole |
See the full registry of value sets defined as part of FHIR.
Explanation of the columns that may appear on this page:
Level | A few code lists that FHIR defines are hierarchical - each code is assigned a level. In this scheme, some codes are under other codes, and imply that the code they are under also applies |
Source | The source of the definition of the code (when the value set draws in codes defined elsewhere) |
Code | The code (used as the code in the resource instance) |
Display | The display (used in the display element of a Coding). If there is no display, implementers should not simply display the code, but map the concept into their application |
Definition | An explanation of the meaning of the concept |
Comments | Additional notes about how to use the code |