This value set has >1000 codes in it. In order to keep the publication size manageable, only a selection (1000 codes) of the whole set of codes is shown
| Code | Display |
| 102002 | Haemoglobin Okaloosa |
| 120006 | Ornithine racemase |
| 125001 | Ferrous sulphate Fe^59^ |
| 126000 | Galactosyl-N-acetylglucosaminylgalactosylglucosylceramide alpha-galactosyltransferase |
| 130002 | Haemoglobin Hopkins-II |
| 131003 | Dolichyl-phosphate mannosyltransferase |
| 159002 | Ferrocyanide salt |
| 164003 | Phosphoenolpyruvate-protein phosphotransferase |
| 178002 | Uridine diphosphate galactose |
| 186002 | HLA-Cw9 antigen |
| 187006 | Cyanocobalamin Co^57^ |
| 200001 | Berberine |
| 217008 | Blood group antigen IH |
| 231008 | 3-Hydroxyisobutyrate dehydrogenase |
| 238002 | Heptachlor |
| 261000 | Codeine phosphate |
| 296000 | Coumachlor |
| 322006 | Octylphenoxy P.H. ethanol |
| 327000 | ^76^Arsenic |
| 329002 | ^127^Antimony |
| 336001 | Fibrinogen Tokyo II |
| 340005 | Enzyme variant |
| 363000 | Fibrinogen San Juan |
| 370000 | beta>2S< Glycoprotein |
| 371001 | Acylcarnitine hydrolase |
| 377002 | Sparteine |
| 392001 | ^151^Gadolinium |
| 395004 | Immunoglobulin pentamer |
| 412004 | Ribose-5-phosphate isomerase |
| 424006 | Citramalyl-CoA lyase |
| 425007 | Haemoglobin Nagoya |
| 432003 | Carminic acid stain |
| 438004 | 2-Hydroxyglutarate dehydrogenase |
| 462009 | Urease (ATP-hydrolysing) |
| 472007 | Vegetable textile fibre |
| 476005 | Lymphocyte antigen CD1b |
| 498001 | Nitrilase |
| 501001 | Blood group antibody Sf^a^ |
| 505005 | Blood group antibody M' |
| 506006 | 3-Oxosteroid delta^1^-dehydrogenase |
| 515004 | Blood group antigen Giaigue |
| 519005 | Free protein S |
| 521000 | ^197^Mercury |
| 529003 | Guanosine |
| 538001 | 2,3-Dihydroxybenzoate 3,4-dioxygenase |
| 566009 | Acrosin |
| 576007 | Blood group antibody Duck |
| 578008 | Haemoglobin Jianghua |
| 584006 | Blood group antibody Wr^b^ |
| 585007 | Substance P |
| 591009 | 2-Oxoisovalerate dehydrogenase (acylating) |
| 593007 | Blood group antibody Holmes |
| 594001 | 2-Oxoglutarate synthase |
| 597008 | ^247^Californium |
| 604000 | Plant sapogenin glycoside |
| 611001 | Hippurate hydrolase |
| 620005 | Trichlorophenol |
| 648005 | Oil of calamus |
| 662003 | Aeromonas proteolytica aminopeptidase |
| 668004 | ^185^Osmium |
| 683009 | Mercuric acetate (substance) |
| 686001 | Plastoquinol-plastocyanin reductase |
| 693002 | Trichothecenes |
| 698006 | Erythromycin lactobionate |
| 699003 | Coal tar extract |
| 704006 | Blood group antigen Rx |
| 732002 | N-valeraldehyde |
| 735000 | Blood group antigen Jobbins |
| 747006 | Oxamniquine |
| 773001 | Haemoglobin M-Iwate |
| 785009 | Dextranase |
| 804003 | Creosotic acid |
| 819002 | Lytic antibody |
| 850000 | Stizolobate synthase |
| 859004 | Peptide-N^4^-(N-acetyl-b-glucosaminyl) asparagine amidase |
| 860009 | Immunoglobulin, aggregated |
| 873008 | Urethan |
| 876000 | Blood group antigen D |
| 877009 | Carboxypeptidase A |
| 889006 | (Acetyl-CoA carboxylase) kinase |
| 896008 | Ice |
| 905001 | o-Dihydroxycoumarin O^7^-glucosyltransferase |
| 923009 | Complement component C2 |
| 925002 | Sodium iodipamide |
| 963005 | Pyridoxine 4-dehydrogenase |
| 974001 | Adenosylmethionine decarboxylase |
| 979006 | Carbamate kinase |
| 993004 | Palladium compound |
| 1002007 | Mannotetraose 2-alpha-N-acetylglucosaminyltransferase |
| 1010008 | N-Acetylneuraminate monooxygenase |
| 1018001 | Nornicotine |
| 1025008 | ^93^Molybdenum |
| 1047008 | Guanine deaminase |
| 1050006 | Melilotate 3-monooxygenase |
| 1057009 | Phosphate salt |
| 1065007 | E. coli periplasmic proteinase |
| 1080001 | ^202^Thallium |
| 1091008 | Coagulation factor inhibitor |
| 1097007 | Blood group antigen M^A^ |
| 1105007 | Isochorismate synthase |
| 1113008 | Pancreatic ribonuclease |
| 1137008 | ^240^Uranium |
| 1149009 | Haemoglobin Barcelona |
| 1160000 | Antibody to antigen in Lutheran blood group system |
| 1166006 | Titanium |
| 1169004 | Haemoglobin Gower-2 |
| 1171004 | Fibrinogen Kawaguchi |
| 1185009 | Haemoglobin Roseau-Pointe à Pitre |
| 1189003 | Haemoglobin F-M-Osaka |
| 1190007 | Mephenoxalone |
| 1219001 | Diethyl xanthogen disulphide |
| 1223009 | Blood group antigen Marks |
| 1244009 | Fibrinogen Madrid I |
| 1248007 | Leucostoma neutral proteinase |
| 1269009 | Amikacin sulfate |
| 1272002 | Pteridine oxidase |
| 1273007 | Blood group antibody Evelyn |
| 1313002 | Nitrate reductase (cytochrome) |
| 1319003 | Blood group antibody K18 |
| 1320009 | Haemoglobin Manitoba |
| 1325004 | Metocurine iodide |
| 1331001 | Methamidophos |
| 1334009 | Oestradiol receptor |
| 1336006 | 11-Deoxycorticosterone |
| 1341003 | Haemoglobin Ta-li |
| 1346008 | Blue shade eosin stain |
| 1355006 | Coagulation factor IX Oxford 3 variant |
| 1368003 | ^131^Iodine |
| 1371006 | Blood group antigen Big |
| 1373009 | ^93^Zirconium |
| 1381005 | ^126^Iodine |
| 1394007 | Iron pentacarbonyl |
| 1396009 | Actinium |
| 1405004 | Blood group antibody M^e^ |
| 1408002 | Blood group antibody 1123K |
| 1416006 | Radium compound |
| 1450002 | Methylpentynol |
| 1466000 | Cyclomaltodextrinase |
| 1471007 | Elastin |
| 1472000 | Adenosine-phosphate deaminase |
| 1476002 | Codeine sulphate |
| 1477006 | Haemoglobin Yatsushiro |
| 1496005 | Proto-oncogene |
| 1506001 | Blood group antigen Ch1 |
| 1517000 | HLA-B21 antigen |
| 1530004 | 6-Carboxyhexanoate-CoA ligase |
| 1535009 | Nitrogen fluoride |
| 1536005 | Pargyline hydrochloride |
| 1540001 | Tellurium radioisotope |
| 1545006 | Uridine phosphorylase |
| 1557002 | Talc |
| 1565004 | Blood group antibody Buckalew |
| 1575001 | Maltose tetrapalmitate |
| 1603001 | Cobalt isotope |
| 1607000 | Homoserine kinase |
| 1609002 | N-octyl isosafrole sulphoxide |
| 1634002 | Blood group antigen Ven |
| 1649005 | Blood group antigen Sul |
| 1656004 | Haemoglobin Shaare Zedek |
| 1660001 | Plant seeds |
| 1668008 | Ceforanide |
| 1672007 | Ligase |
| 1673002 | Xylenol |
| 1675009 | ^86^Rubidium |
| 1676005 | Blood group antibody LW^ab^ |
| 1681001 | Blood group antibody BLe^b^ |
| 1696002 | 12-Hydroperoxy eicosatetraenoic acid |
| 1701009 | ^191^Gold |
| 1710001 | Uric acid |
| 1726000 | Diamond |
| 1727009 | Deoxylimonate A-ring-lactonase |
| 1740004 | Deoxy cytidine triphosphate |
| 1764003 | Saccharopine dehydrogenase (NADP^+^,L-glutamate-forming) |
| 1768000 | Sucrose phosphorylase |
| 1786002 | Leucine-tRNA ligase |
| 1793003 | Sodium trichloroacetate |
| 1795005 | Glyodin |
| 1798007 | Haemoglobin Hammersmith |
| 1799004 | L-Lysine oxidase |
| 1823002 | Haemoglobin Tochigi |
| 1827001 | Ribonuclease T>1< |
| 1886008 | Verdohaemoglobin |
| 1904005 | Galactoside 3-fucosyltransferase |
| 1914001 | von Willebrand factor antibody |
| 1916004 | Boroglycerin |
| 1940007 | Immunoglobulin, GM>21< allotype |
| 1944003 | Coagulation factor X Patient variant |
| 1956002 | Buclizine hydrochloride |
| 1971003 | Loxapine hydrochloride |
| 1975007 | Blood group antibody Niemetz |
| 1978009 | Site-specific methyltransferase (cytosine-specific) |
| 1985008 | Vomitus |
| 1991005 | Lignins |
| 2000001 | Heavy nitrogen |
| 2006007 | Inosine diphosphate |
| 2008008 | ^67^Gallium |
| 2009000 | Cobalt carbonyl |
| 2017008 | DNA topoisomerase |
| 2027002 | Alternaria serine proteinase |
| 2029004 | Fibrinogen Oslo II |
| 2038002 | Blood group antibody Bg^b^ |
| 2039005 | sym-Norspermidine synthase |
| 2050008 | Choloylglycine hydrolase |
| 2064008 | L-Xylulokinase |
| 2082006 | Lymphocyte antigen CD51 |
| 2085008 | Oncogene protein TCL |
| 2088005 | Page blue G-90 stain |
| 2096000 | NAD^+^ ADP-ribosyltransferase |
| 2100004 | Sulphonethylmethane |
| 2101000 | Yeast proteinase B |
| 2125008 | Betazole |
| 2130007 | Cyclohexane-1,2-diol dehydrogenase |
| 2141009 | Hydrogen |
| 2147008 | Blood group antigen Paular |
| 2151005 | Pyridoxamine-pyruvate aminotransferase |
| 2154002 | Tagaturonate reductase |
| 2159007 | Azorubin S stain |
| 2163000 | Dicofol |
| 2168009 | Bisphosphoglycerate mutase |
| 2179004 | Malonate-semialdehyde dehydratase |
| 2189000 | Haemoglobin F-Dammam |
| 2194000 | ^101^Rhodium |
| 2195004 | Tocainide hydrochloride |
| 2197007 | Boric acid topical preparation |
| 2201007 | Bacteriopurpurin |
| 2208001 | Phenylserine aldolase |
| 2212007 | Fibrinogen Bethesda II |
| 2215009 | Azuresin |
| 2240002 | Guanidinobutyrase |
| 2249001 | Gentamicin sulfate |
| 2254005 | Orotic acid |
| 2260005 | HLA-DRw18 antigen |
| 2262002 | Cellulose polysulphatase |
| 2264001 | Selenium isotope |
| 2309006 | Gold |
| 2311002 | Prostacyclin synthase |
| 2329007 | Blood group antibody Vel |
| 2331003 | Carbohydrate |
| 2338009 | Plant roots |
| 2343002 | Guthion |
| 2346005 | Vascormone |
| 2354007 | 3'-Nucleotidase |
| 2358005 | Glass fragment |
| 2369008 | Indole-3-acetate beta-glucosyltransferase |
| 2370009 | UDP-N-acetylmuramate-alanine ligase |
| 2376003 | Mercury compound |
| 2384004 | ^230^Uranium |
| 2404002 | Blood group antibody St^a^ |
| 2405001 | b- Propiolactone |
| 2414006 | Prolactin receptor |
| 2430003 | Silicon radioisotope |
| 2431004 | Blood group antibody Friedberg |
| 2441001 | Mercury radioisotope |
| 2444009 | HLA-Dw25 antigen |
| 2450004 | Mannosamine |
| 2462000 | Glucose dehydrogenase (NADP^+^) |
| 2466002 | Chloride peroxidase |
| 2500009 | Lymphocyte antigen CDw41b |
| 2509005 | D-Glutamate oxidase |
| 2516006 | Metallic sulphide compound |
| 2522002 | Extravascular blood |
| 2529006 | Haemoglobin Wood |
| 2537003 | Antituberculosis agent |
| 2568004 | Blood group antigen McAuley |
| 2573005 | Immunoglobulin, GM>13< allotype |
| 2575003 | Zinc alpha>2< glycoprotein |
| 2595009 | ^119m^Tellurium |
| 2597001 | alpha 1 globulin |
| 2611008 | Blood group antibody La Fave |
| 2637006 | Indium isotope |
| 2648004 | Bile vomitus |
| 2649007 | Azo dye |
| 2660003 | Sodium dehydrocholate |
| 2671002 | 3-Methyl-2-oxobutanoate hydroxy-methyltransferase |
| 2674005 | ^128^Caesium |
| 2676007 | C3(H20) |
| 2678008 | Haemoglobin New Mexico |
| 2680002 | Factor XIII antibody |
| 2698003 | Natural gas |
| 2705002 | ^72^Arsenic |
| 2706001 | Blood group antigen Vennera |
| 2719002 | Tartrate dehydratase |
| 2721007 | Blood group antigen McC^f^ |
| 2728001 | Antigen in Lewis (Le) blood group system |
| 2753003 | Blood group antibody M>1< |
| 2754009 | Haemoglobin F-Kennestone |
| 2765004 | Blood group antigen Sc3 |
| 2778004 | Pleural fluid |
| 2796008 | Methanthelinium |
| 2799001 | Methylbenzethonium chloride |
| 2823004 | Haemoglobin Bristol |
| 2832002 | Molybdenum compound |
| 2846002 | Haemoglobin Saitama |
| 2869004 | Acetic acid |
| 2878005 | Pethidine hydrochloride |
| 2880004 | Calcium sulphate |
| 2883002 | Exopolygalacturonate lyase |
| 2913009 | Immunoglobulin E, H chain |
| 2916001 | ^22^Neon |
| 2925007 | Fluorometholone |
| 2927004 | Rescinnamine |
| 2938004 | Pyrazole |
| 2942001 | Carbon^14^ D-xylose |
| 2950005 | Haemoglobin L-Persian Gulf |
| 2958003 | Zinc caprylate |
| 2964005 | Dimethoxyamphetamine |
| 2974008 | Trichophyton schoenleinii collagenase |
| 2988007 | HLA-Aw antigen |
| 2991007 | Mecamylamine hydrochloride |
| 2995003 | Arecoline |
| 3027009 | ^133^Barium |
| 3031003 | Dihydroxyaluminium sodium carbonate |
| 3040004 | Technetium Tc^99m^ disofenin |
| 3045009 | Nitrochlorobenzene |
| 3052006 | Ornithine-oxo-acid aminotransferase |
| 3066001 | Triiodothyroacetic acid |
| 3070009 | Aspartate-ammonia ligase |
| 3087006 | Oil of male fern |
| 3107005 | Haemoglobin Shuangfeng |
| 3108000 | Aspergillus deoxyribonuclease K>1< |
| 3131000 | Blood group antigen Middel |
| 3136005 | Cefoperazone sodium |
| 3142009 | Azacyclonol |
| 3145006 | Penicillic acid |
| 3150000 | Sialate O-acetylesterase |
| 3151001 | Left upper lobe mucus |
| 3155005 | 3-Phosphoglyceroyl-phosphate-polyphosphate phosphotransferase |
| 3161008 | 3-Methyl histidine |
| 3167007 | Hard coal |
| 3187008 | Blood group antigen Nielsen |
| 3193000 | alpha-1,4-Glucan-protein synthase (UDP-forming) |
| 3197004 | Inosine monophosphate |
| 3209002 | Pancuronium sodium |
| 3212004 | Manganese sulphate |
| 3225007 | Fibrinogen Seattle I |
| 3232003 | o-Benzyl-parachlorophenol |
| 3271000 | Haemoglobin Southampton |
| 3273002 | Tyrosine-ester sulphotransferase |
| 3300001 | Euphorbain |
| 3318003 | Vaginal secretions |
| 3325005 | Lipopolysaccharide |
| 3339005 | (R)-20-Hydroxysteroid dehydrogenase |
| 3340007 | alpha-Amylase |
| 3342004 | Copper isotope |
| 3346001 | Haemoglobin Brest |
| 3378009 | Imipramine hydrochloride |
| 3379001 | Thimerosal |
| 3392003 | Aldehyde dehydrogenase (acceptor) |
| 3405005 | 2-Hydroxy-3-oxoadipate synthase |
| 3411008 | bis-(Dimethylthiocarbamyl) disulphide |
| 3437006 | Hydroxymethylglutaryl-CoA hydrolase |
| 3440006 | Biotin carboxylase |
| 3455002 | Discontinued pesticide |
| 3463001 | L-Amino-acid dehydrogenase |
| 3465008 | DNA topoisomerase (ATP-hydrolysing) |
| 3466009 | Dimethylamine |
| 3492002 | Galactinol-sucrose galactosyltransferase |
| 3493007 | Smegma clitoridis |
| 3495000 | Cystyl-aminopeptidase |
| 3501003 | Isoxsuprine hydrochloride |
| 3523004 | Haemoglobin Q-India |
| 3532002 | Laryngeal mucus |
| 3555004 | Blood group antigen Morrison |
| 3579002 | ^129^Caesium |
| 3581000 | Glucose-6-phosphatase |
| 3587001 | Malate dehydrogenase (decarboxylating) |
| 3588006 | Complement enzyme |
| 3592004 | Short-acting thyroid stimulator |
| 3597005 | Acebutolol hydrochloride |
| 3601005 | Ether |
| 3602003 | Warm antibody |
| 3610002 | Epoxide hydrolase |
| 3617004 | ^79^Selenium |
| 3648007 | Glucocorticoid receptor |
| 3655009 | Haemoglobin Constant Springs |
| 3672002 | Fibrinogen Caracas |
| 3684000 | Phenylacetic acid |
| 3689005 | Haemoglobin Mizushi |
| 3692009 | Sodium sulphite |
| 3693004 | Fibrinogen Dusard |
| 3702007 | CDPglycerol glycerophosphotransferase |
| 3710008 | Prostaglandin synthase |
| 3718001 | Cow's milk |
| 3726009 | Valine-tRNA ligase |
| 3727000 | Haemoglobin F-Port Royal |
| 3730007 | Blood group antigen Tr^a^ |
| 3737005 | Nitrate reductase (NADH) |
| 3742002 | Extracellular crystal |
| 3757009 | Gossypol |
| 3771001 | Neuromelanin |
| 3775005 | Choline dehydrogenase |
| 3776006 | Xanthine dehydrogenase |
| 3792001 | Arachidonic acid |
| 3793006 | Soluble barium compound |
| 3800009 | Acetate kinase |
| 3807007 | Blood group antigen c |
| 3811001 | Magnesium-protoporphyrin methyltransferase |
| 3812008 | Beryllium isotope |
| 3816006 | Vanadium isotope |
| 3823007 | Prochlorperazine edisylate |
| 3829006 | Iron |
| 3834005 | CMP-N-acetylneuraminate-(alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetyl-galactosaminide alpha-2,6-sialyltransferase |
| 3836007 | Glutaminase |
| 3844007 | Protoaphin-aglucone dehydratase (cyclising) |
| 3848005 | Nitrotoluene |
| 3849002 | Carbon black |
| 3854006 | bis-Chloro methyl ether |
| 3874004 | Hydrocodone bitartrate |
| 3892007 | Thymidine |
| 3896005 | p-Hydroxybenzoate ester |
| 3897001 | Blood group antigen 'N' |
| 3906002 | Rectified birch tar oil |
| 3920009 | Haemoglobin Atago |
| 3930000 | Manufactured gas |
| 3932008 | ^64^Copper |
| 3941003 | Metronidazole hydrochloride |
| 3945007 | Tin isotope |
| 3958008 | ^245^Californium |
| 3961009 | Blood group antigen Ritherford |
| 3976001 | Blood group antigen HEMPAS |
| 3982003 | Oxaloacetate decarboxylase |
| 3983008 | N,-N-dimethyltryptamine |
| 3990003 | Alkaline phosphatase isoenzyme, bone fraction |
| 3994007 | Haemoglobin Tampa |
| 4014000 | Sulphisomidine |
| 4024008 | Soft metal |
| 4025009 | Captodiame |
| 4043008 | Etidocaine hydrochloride |
| 4047009 | cis-1,2-Dihydrobenzene-1,2-diol dehydrogenase |
| 4048004 | 1,1,2,2-Tetrachloro-1,2- difluoroethane |
| 4067000 | Chorismate mutase |
| 4076007 | Parathyroid hormone |
| 4077003 | Dihydrolipoamide succinyltransferase |
| 4080002 | Haemoglobin Grady, Dakar |
| 4091009 | Enteropeptidase |
| 4097008 | Apo-SAA complex |
| 4104007 | Chondroitin sulphate |
| 4105008 | Adenylate cyclase |
| 4115002 | Blood group antibody Norlander |
| 4137009 | sec-Butyl acetate |
| 4153007 | Long-chain-enoyl-CoA hydratase |
| 4167003 | Lymphocyte antigen CD31 |
| 4169000 | Blood group antibody Le^bH^ |
| 4177001 | Haemoglobin Long Island-Marseille |
| 4182008 | CDPdiacylglycerol-serine O-phosphatidyl-transferase |
| 4188007 | Fibrinogen Sydney II |
| 4200007 | Neriifolin |
| 4201006 | 6-Aminohexanoate-dimer hydrolase |
| 4203009 | Imipramine pamoate |
| 4207005 | Cortisone beta-reductase |
| 4217000 | Fluorosilicate salt |
| 4218005 | Immunoglobulin, GM>23< allotype |
| 4231000 | Gallium isotope |
| 4239003 | Glycerol dehydrogenase |
| 4255005 | ^241^Americium |
| 4289006 | Keyhole-limpet hemocyanin |
| 4290002 | Linamarin synthase |
| 4314009 | Blood group antibody Allchurch |
| 4334005 | Tar oil |
| 4342006 | 2-Aminopyridine |
| 4353000 | Dibutyl phthalate |
| 4355007 | Coagulation factor IX San Dimas variant |
| 4362003 | 4-Coumarate-CoA ligase |
| 4370008 | Acetone |
| 4393002 | Blood group antigen Fedor |
| 4401009 | Blood group antibody H>T< |
| 4413004 | Benzypyrinium |
| 4422003 | Blood group antigen |
| 4423008 | Fibrinogen New York II |
| 4425001 | Blood group antibody Binge |
| 4435007 | Sulphuryl fluoride |
| 4437004 | ^127^Caesium |
| 4471008 | ^244^Californium |
| 4479005 | Haemoglobin Brockton |
| 4480008 | Sulphaethidole |
| 4509009 | Plant phenanthrene toxin |
| 4518006 | Buthenal |
| 4534009 | ^208^Bismuth |
| 4540002 | ADP deaminase |
| 4546008 | Myristic acid |
| 4555006 | Blood group antibody Rils |
| 4560005 | Haemoglobin Mizuho |
| 4561009 | Arginine decarboxylase |
| 4564001 | Blood group antibody Sisson |
| 4567008 | Galactose-1-phosphate thymidylyltransferase |
| 4582003 | Blood group antigen N^A^ |
| 4591004 | Blood group antigen Far |
| 4610008 | Senile cardiac protein |
| 4616002 | Triclobisonium chloride |
| 4629002 | Hypoglycin B |
| 4635002 | Arterial blood |
| 4643007 | Calf thymus ribonuclease H |
| 4656000 | Alcian blue 8GX stain |
| 4674009 | 2,3-Dihydroxybenzoate serine ligase |
| 4681002 | Potassium permanganate |
| 4693006 | Chromium^51^ albumin |
| 4700006 | Bovine insulin |
| 4706000 | Chlorine monoxide |
| 4714006 | ^183m^Osmium |
| 4728000 | Scopulariopsis proteinase |
| 4731004 | Aluminium pyro powder |
| 4732006 | Oncogene protein P55, V-MYC |
| 4746006 | Haemoglobin Mito |
| 4761007 | Lymphocyte antigen CD30 |
| 4762000 | Platelet antigen HPA-3b |
| 4777008 | Fluroxene |
| 4780009 | Secbutabarbital sodium |
| 4786003 | beta-1,4-Mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase |
| 4789005 | Blood group antibody Bultar |
| 4793004 | Azobenzene reductase |
| 4814001 | Valethamate |
| 4824009 | Amine oxidase (flavin-containing) |
| 4825005 | Peptidyl-glycinamidase |
| 4831008 | Arabinose-5-phosphate isomerase |
| 4832001 | Technetium Tc^99m^ mebrofenin |
| 4833006 | Glucan endo-1,3-alpha-glucosidase |
| 4844003 | 3,3' Diiodothyronine |
| 4864008 | Adenylic acid |
| 4872005 | Glucosulphone |
| 4878009 | HLA-Dw3 antigen |
| 4882006 | Ichthyoallyeinotoxin |
| 4889002 | Xylulokinase |
| 4901003 | Pyruvate oxidase (CoA-acetylating) |
| 4925006 | Oncogene protein V-ABC |
| 4933007 | Lymphocyte antigen CD15 |
| 4940008 | Tattoo dye |
| 4955004 | Neoplastic structural gene |
| 4962008 | Tree bark |
| 4963003 | Neutral amino acid |
| 4965005 | Glutathione reductase (NAD(P)H) |
| 4968007 | Acumentin |
| 4986005 | Magnesium borate |
| 5003005 | Haemoglobin Swan River |
| 5004004 | Blood group antibody Panzar |
| 5007006 | Papain |
| 5024000 | Fresh water |
| 5031001 | 3-3'Dichlorobenzidine |
| 5040002 | Caesium |
| 5043000 | Erythrosin Y stain |
| 5045007 | Oncogene protein TCL4 |
| 5059000 | ^97^Technetium |
| 5060005 | ^132^Caesium |
| 5061009 | Protein-methionine-S-oxide reductase |
| 5064001 | Blood group antibody D 1276 |
| 5081005 | Blood group antigen hr^B^ |
| 5086000 | Gelsolin |
| 5094007 | Blood group antigen Rios |
| 5098005 | Fennel oil |
| 5109006 | Methylated-DNA-protein-cysteine methyltransferase |
| 5142007 | Coagulation factor II Houston variant |
| 5160007 | Metallic compound |
| 5163009 | Scombrotoxin |
| 5167005 | Zinc chloride fumes |
| 5172001 | Coagulation factor Xa |
| 5179005 | Connective tissue fibre |
| 5200001 | trans-Epoxysuccinate hydrolase |
| 5206007 | Cyanate compound |
| 5220000 | Bacitracin |
| 5226006 | Flavone O^7^-beta-glucosyltransferase |
| 5250008 | Thymus-independent antigen |
| 5252000 | Hafnium radioisotope |
| 5253005 | Haemoglobin Woodville |
| 5259009 | Blood group antigen Braden |
| 5289002 | Scilliroside |
| 5303002 | Haemoglobin Hoshida |
| 5305009 | Polynucleotide |
| 5307001 | Blood group antigen Hamet |
| 5312000 | ^65^Zinc |
| 5323001 | Uridine diphosphate glucuronic acid |
| 5330007 | Actin-binding protein |
| 5339008 | L-Glycol dehydrogenase |
| 5340005 | Blood group antigen Swietlik |
| 5392001 | Propylene glycol monomethyl ether |
| 5395004 | Pyridoxamine-phosphate oxidase |
| 5404007 | Lymphocyte antigen CD45RA |
| 5405008 | ^60^Cobalt |
| 5406009 | beta-L-Arabinosidase |
| 5420002 | Accessory sinus mucus |
| 5439007 | Blood group antibody Do^a^ |
| 5442001 | Page blue 83 stain |
| 5453007 | Iridium isotope |
| 5471000 | Haemoglobin G-Coushatta |
| 5474008 | Propionate-CoA ligase |
| 5477001 | Ferric subsulphate |
| 5483003 | Oxalate CoA-transferase |
| 5504009 | Blood group antigen Fuerhart |
| 5511008 | Inosinate nucleosidase |
| 5513006 | Immunoglobulin A, H chain |
| 5515004 | Rhodium fumes |
| 5533005 | Blood group antibody Kp^a^ |
| 5537006 | Immunoglobulin D, H chain |
| 5540006 | Calcium |
| 5547009 | ^233^Plutonium |
| 5548004 | 2-Dehydro-3-deoxy-D-pentonate aldolase |
| 5568005 | Haemoglobin Hijiyama |
| 5573004 | Blood group antigen Oca |
| 5589001 | Licodione O^2'^-methyltransferase |
| 5590005 | Beryllium radioisotope |
| 5628003 | Haemoglobin I-High Wycombe |
| 5629006 | Cytidylic acid |
| 5637003 | HLA-DQw6 antigen |
| 5641004 | Valproate semisodium |
| 5647000 | Griseofulvin ultramicrosize |
| 5656008 | ^116m^Antimony |
| 5657004 | Coal tar solution |
| 5659001 | Haemoglobin J-Tongariki |
| 5670008 | Gold isotope |
| 5681006 | Ceftizoxime sodium |
| 5691000 | Absorbable gelatin sponge |
| 5692007 | Cyanocobalamin Co^58^ |
| 5699003 | Somatomedin C |
| 5700002 | Blood group antibody Gomez |
| 5702005 | ^106m^Silver |
| 5704006 | Galactokinase |
| 5705007 | 1,3-Propanediol dehydrogenase |
| 5739006 | Stramonium |
| 5746002 | ^118m^Antimony |
| 5757007 | HLA-Cw8 antigen |
| 5762008 | Heterogeneous nuclear RNA |
| 5764009 | ^242^Plutonium |
| 5767002 | Sulphamerazine |
| 5774007 | White petrolatum |
| 5800007 | tRNA (5-methylaminomethyl-2-thiouridylate)-methyltransferase |
| 5813001 | Malate dehydrogenase |
| 5826002 | Ethyl-4-bis-(hydroxypropyl)-1-aminobenzoate |
| 5827006 | Crotonaldehyde |
| 5829009 | Haemoglobin Vaasa |
| 5830004 | Haemoglobin Bart |
| 5840001 | Blood group antibody Wj |
| 5858007 | ^110m^Indium |
| 5863006 | Vitexin beta-glucosyltransferase |
| 5896008 | Hellebrin |
| 5899001 | Bacterial structural gene |
| 5907009 | Quinidine polygalacturonate |
| 5910002 | Oncogene protein PP60, V-SRC |
| 5915007 | Blood group antigen Gladding |
| 5927005 | Lactaldehyde dehydrogenase |
| 5931004 | Technetium Tc^99m^ sulphur colloid |
| 5932006 | Cysteine |
| 5950004 | 3',5'-Cyclic-nucleotide phosphodiesterase |
| 5955009 | Diethylene glycol |
| 5977008 | Blood group antigen Bullock |
| 5989005 | Immunoglobulin, GM>17< allotype |
| 5991002 | D-Fuconate dehydratase |
| 6021003 | ^88^Yttrium |
| 6038004 | Oxygen radioisotope |
| 6043006 | Bone cement |
| 6044000 | Carbon disulphide |
| 6054001 | Doxylamine succinate |
| 6056004 | Blood group antibody Wk^a^ |
| 6068008 | Blood group antigen Mil |
| 6083003 | Hydroxylysine |
| 6085005 | Synovial fluid |
| 6088007 | Benzfetamine hydrochloride |
| 6089004 | Lochia alba |
| 6091007 | Blood group antibody L Harris |
| 6107003 | Asparagusate reductase (NADH) |
| 6109000 | Aromatic-amino-acid aminotransferase |
| 6115000 | Blood group antibody Anuszewska |
| 6135004 | Blood group antigen Duck |
| 6138002 | Blood group antigen Le Provost |
| 6162007 | Meclocycline |
| 6170002 | Heat labile antibody |
| 6172005 | Fatty-acid methyltransferase |
| 6178009 | Lymphocyte antigen CD63 |
| 6179001 | o-Methy-bufotenine |
| 6182006 | Chloroacetone |
| 6197009 | Blood group antigen Zd |
| 6237004 | Bemegride |
| 6249003 | Potassium metabisulphite |
| 6256009 | Ribose isomerase |
| 6257000 | Sodium chloride Na^22^ |
| 6260007 | Protokylol |
| 6261006 | Flurotyl |
| 6263009 | Plant residue |
| 6264003 | Diazinon |
| 6287006 | Methidathion |
| 6291001 | N-Acetylglucosamine-1-phosphodiester N-acetylglucosaminidase |
| 6301006 | ^178^Tantalum |
| 6310003 | Particulate antigen |
| 6314007 | Phenol beta-glucosyltransferase |
| 6333002 | Squill extract |
| 6338006 | Imidazolonepropionase |
| 6356006 | Chlorodiallylacetamide |
| 6360009 | Kallidin II |
| 6367007 | ^95m^Technetium |
| 6386004 | N-Acetylneuraminate O^4^-acetyltransferase |
| 6394006 | Phentermine hydrochloride |
| 6401007 | Lichenase |
| 6409009 | Morpholine |
| 6411000 | Interleukin-12 |
| 6422001 | HLA-DRw14 antigen |
| 6451002 | Chlorobenzilate |
| 6455006 | Chloroprene |
| 6469006 | delta^1^-Piperideine-2-carboxylate reductase |
| 6478000 | 6-Phosphofructokinase |
| 6495008 | Fibrinogen Montreal II |
| 6507009 | Blood group antigen Lu12 |
| 6513000 | Flumethiazide |
| 6516008 | Indium^111^-Fe(OH)>3< |
| 6524003 | Distilled spirits |
| 6529008 | Blood group antigen Cl^a^ |
| 6532006 | Macrophage activating factor |
| 6590001 | Galactosylceramidase |
| 6592009 | HLA-Dw12 antigen |
| 6602005 | Aminacrine |
| 6611005 | Diethylaminoethanol |
| 6612003 | Chloramphenicol sodium succinate |
| 6619007 | Bilirubin Y transport protein |
| 6642000 | Opsonin |
| 6644004 | Homoserine dehydrogenase |
| 6671004 | Blood group antigen Caw |
| 6672006 | Phosphoadenylate 3'-nucleotidase |
| 6699008 | Titanium radioisotope |
| 6701008 | Lissamine fast red B stain |
| 6702001 | Ethyl mercaptoethyl diethyl thiophosphate |
| 6709005 | Gentamicin 2''-nucleotidyltransferase |
| 6710000 | Nitric oxide |
| 6713003 | ^91^Yttrium |
| 6717002 | Nifuroxime |
| 6725000 | Methylene blue |
| 6730001 | ^234^Uranium |
| 6741004 | Anti DNA antibody |
| 6755007 | TL antigen |
| 6786001 | Silver difluoride |
| 6790004 | Aminopterin |
| 6792007 | Veratrine |
| 6808006 | Ferrous iron compound |
| 6809003 | Phomopsin |
| 6814004 | Discadenine synthase |
| 6817006 | Oxidised glutathione |
| 6826009 | Sterol hormone |
| 6837005 | Dextropropoxyphene napsylate |
| 6854002 | ^188^Platinum |
| 6865007 | Theophylline calcium salicylate |
| 6873003 | Cefapirin sodium |
| 6879004 | 5,8,11-Eicosatrienoic acid |
| 6881002 | Magnesium fumes |
| 6884005 | (S)-3-Amino-2-methylpropionate aminotransferase |
| 6890009 | 3-Deoxy-manno-octulosonate-8-phosphatase |
| 6896003 | Thiopurine methyltransferase |
| 6910009 | Sodium fluoride |
| 6911008 | Deoxycytidylate methyltransferase |
| 6916003 | Bowieine |
| 6924008 | Exopolyphosphatase |
| 6925009 | Leucine acetyltransferase |
| 6927001 | ^121^Tin |
| 6937006 | Thymidylate synthase |
| 6945001 | Blood group antigen Le^bH^ |
| 6952004 | ^121m^Tin |
| 6958000 | Blood group antibody Frando |
| 6961004 | Lysolecithin acylmutase |
| 6970001 | 4-Hydroxyproline epimerase |
| 6973004 | Chromium^51^ chloride |
| 6983000 | Acrylamide |
| 6992002 | Triflupromazine hydrochloride |
| 6993007 | Seminal fluid |
| 6999006 | Ammonium compound |
| 7008002 | beta-Carotene 15,15'-dioxygenase |
| 7018007 | Malate-CoA ligase |
| 7029006 | Blood group antigen Greenlee |
| 7030001 | Globoside |
| 7034005 | Diclofenac (substance) |
| 7045008 | Lycorine |
| 7047000 | Asphyxiant atmosphere |
| 7049002 | Pyruvate carboxylase |
| 7054006 | Haemoglobin Poissy |
| 7056008 | 3-Propylmalate synthase |
| 7059001 | N-Acylneuraminate-9-phosphatase |
| 7061005 | Anthocyanidin O^3^-glucosyltransferase (substance) |
| 7070008 | Convallamarin |
| 7084003 | Fibrinogen Buenos Aires II |
| 7110002 | ^69^Germanium |
| 7120007 | Antigen |
| 7132006 | ^73^Gallium |
| 7139002 | Acid-CoA ligase (GDP-forming) |
| 7146006 | Cyclohexene oxide |
| 7152007 | Chlorthion |
| 7156005 | Phosphorus isotope |
| 7158006 | HLA-Dw19 antigen |
| 7161007 | Complement component C2a |
| 7179006 | Prekallikrein |
| 7191002 | Methenyltetrahydrofolate cyclohydrolase |
| 7208009 | Thiol oxidase |
| 7211005 | Blood group antibody Haakestad |
| 7237008 | Galactonate dehydratase (substance) |
| 7243005 | Methyl isocyanate |
| 7269004 | Thorium |
| 7271004 | Mixed dust |
| 7280004 | dTDP4-dehydrorhamnose reductase |
| 7281000 | Technetium Tc^99m^ lidofenin |
| 7284008 | Mercaptan compound |
| 7294003 | tert-Butyl acetate |
| 7302008 | Ambuphylline |
| 7318002 | Bacteriochlorophyll |
| 7321000 | Pyrimidine |
| 7325009 | Calcium hydroxide |
| 7327001 | Sulphurous acid |
| 7328006 | Red petrolatum |
| 7330008 | Shellac |
| 7337006 | Blood group antibody Tr^a^ |
| 7348004 | Factor II |
| 7382005 | Aminoalcohol ester (substance) |
| 7401000 | Haem-haemopexin complex |
| 7411007 | Blood group antibody HLA-B8 |
| 7427000 | Sepiapterin reductase |
| 7434003 | Erythrosin B stain |
| 7446004 | Ruthenium |
| 7451005 | Tobramycin ophthalmic preparation |
| 7460002 | ^127^Tellurium |
| 7470000 | p-tert-Butyltoluene |
| 7489000 | Homocytotropic antibody |
| 7503004 | ^72^Gallium |
| 7509000 | Mannitol hexanitrate |
| 7515000 | Hepatotoxic mycotoxin |
| 7537007 | Stizolobinate synthase |
| 7547005 | Haemoglobin Lincoln Park |
| 7549008 | Fibrinogen Bethesda I |
| 7588005 | Blood group antibody Sk^a^ |
| 7608003 | Triethylene glycol |
| 7616007 | Blood group antibody Pruitt |
| 7648006 | HLA-Bw70 antigen |
| 7661006 | Fish bone |
| 7670009 | Aminobutyraldehyde dehydrogenase |
| 7675004 | Blood group antigen Towey |
| 7679005 | Strong oxidising compound |
| 7685003 | Blood group antibody Bg^c^ |
| 7696006 | Ferrovanadium dust |
| 7716001 | Isovaleryl-CoA dehydrogenase |
| 7737009 | Chlortetracycline hydrochloride |
| 7738004 | HLA-B49 antigen |
| 7761002 | ^111^Silver |
| 7770004 | ^89^Strontium |
| 7774008 | Neo-b-vitamin A>1< |
| 7779003 | ^103^Ruthenium |
| 7785005 | Sphingomyelin phosphodiesterase D |
| 7790008 | 1-Monoacylglycerol |
| 7791007 | Soy protein |
| 7795003 | Oxalate oxidase |
| 7801007 | Tetrahydroxypteridine cycloisomerase |
| 7816005 | Antazoline hydrochloride |
| 7834009 | Acetyldigitoxin |
| 7846008 | Sphingomyelin phosphodiesterase |
| 7848009 | 1-Phosphatidylinositol phosphodiesterase |
| 7868003 | beta-Cyclopiazonate dehydrogenase |
| 7879008 | ^218^Radon |
| 7900007 | Haemoglobin Presbyterian |
| 7904003 | Deanol |
| 7909008 | Arginine carboxypeptidase |
| 7924004 | Diflorasone |
| 7938006 | D-Arabinitol dehydrogenase |
| 7945006 | Orsellinate-depside hydrolase |
| 7948008 | Reed-Sternberg antibody |
| 7953003 | Thioneb (substance) |
| 7957002 | Phosphatidate cytidylyltransferase |
| 7961008 | Haemoglobin F-Shanghai |
| 7970006 | Allograft |
| 7974002 | Blood group antibody Dalman |
| 7975001 | Amiphenazole |
| 7979007 | 3'-Phosphoadenylylsulphate 3'-phosphatase |
| 7983007 | Sodium rhodanide |
| 7985000 | Sulphur isotope |
| 7997004 | Butyl mercaptan |
| 8000007 | Cucurbitacin delta^23^-reductase |
| 8002004 | Blood group antibody Fleming |
| 8025003 | Blood group antibody Gibson |
| 8029009 | Allyl glycidyl ether |
| 8030004 | Macrogol |
| 8035009 | Cholestenol delta-isomerase |
| 8048008 | Blood group antigen Th |
| 8054009 | Orotate reductase (NADPH) |
| 8055005 | Galactoside acetyltransferase |
| 8105004 | Haemoglobin Leiden |
| 8108002 | Undecaprenyl-diphosphatase |
| 8123007 | Blood group antibody Schuppenhauer |
| 8132009 | Magnesium acetylsalicylate |
| 8143001 | Diosmin |
| 8153000 | Pipecolic acid |
| 8156008 | Immunoglobulin, Fd fragment |
| 8164002 | Lymphocyte antigen CD67 |
| 8168004 | Uracil-5-carboxylate decarboxylase |
| 8179009 | Cevadilline |
| 8184003 | Convallamarogenin |
| 8190004 | Diaminopimelate epimerase |
| 8202008 | ^43^Potassium |
| 8203003 | Human menopausal gonadotrophin |
| 8204009 | Polyester |
| 8222007 | Coagulation factor II Padua variant |
| 8227001 | ^106^Ruthenium |
| 8230008 | Streptococcal cysteine proteinase |
| 8237006 | Strobane |
| 8252004 | Chlorothiazide sodium |
| 8257005 | Abnormal haemoglobin |
| 8261004 | Potassium thiosulphate |
| 8268005 | Blood group antibody Hildebrandt |
| 8270001 | tRNA adenylyltransferase |
| 8275006 | Methionine-S-oxide reductase |
| 8295000 | Uromucoid protein |
| 8300003 | Cyclohexanol |
| 8310007 | Haemoglobin Madrid |
| 8313009 | RNA-directed DNA polymerase |
| 8340009 | Procollagen-lysine,2-oxoglutarate 5-dioxygenase |
| 8342001 | Brilliant cresyl blue stain |
| 8343006 | Blood group antibody Re^a^ |
| 8354001 | Manganese ethylene bis-dithiocarbamate |
| 8355000 | Hafnium isotope |
| 8362009 | Blood group antibody c |
| 8365006 | Oil of pennyroyal-European |
| 8368008 | Xylan 1,44-beta-xylosidase |
| 8376005 | Antibody to antigen in Duffy blood group system |
| 8385005 | Glucan 1,4-alpha-glucosidase |
| 8397006 | Nicotine resin complex |
| 8406008 | Nitroethane oxidase |
| 8429000 | Brilliant orange stain |
| 8450009 | Oil of lemon grass |
| 8452001 | Blood group antigen Sisson |
| 8456003 | Methyl ethyl ketone peroxide |
| 8460000 | Blood group antibody Vg^a^ |
| 8473001 | Homocysteine methyltransferase |
| 8474007 | Lead oleate |
| 8484008 | Blood group antigen Mur |
| 8485009 | Oncogene protein P210, BCR-ABL |
| 8486005 | HLA-DRw15 antigen |
| 8487001 | ^48^Vanadium |
| 8491006 | Complement inhibitor |
| 8492004 | Allantoicase |
| 8498000 | Short neurotoxin venom |
| 8507001 | Cyclohexane |
| 8514004 | Ornithine |
| 8520003 | Haemoglobin Machida |
| 8525008 | ^183^Osmium |
| 8529002 | Urinary protein of low molecular weight |
| 8534003 | ^110^Tin |
| 8537005 | Solution |
| 8578007 | Potassium cyanate |
| 8591008 | Dichlorodifluoromethane |
| 8612007 | Tumour necrosis factor |
| 8620009 | Oncogene protein TCL6 |
| 8631001 | Potassium chloride |
| 8653004 | Rubijervine |
| 8660005 | Complement component C3c |
| 8687009 | Gum arabic |
| 8689007 | Kanamycin sulphate |
| 8701002 | Sulphachlorpyridazine |
| 8705006 | 4-Hydroxybenzoate decarboxylase |
| 8731008 | Blood group antibody Austin |
| 8740007 | C3(H20)Bb |
| 8761000 | Adenylylsulphate kinase |
| 8767001 | Santonin |
| 8785008 | Chlorine dioxide |
| 8786009 | Blood group antigen Wd^a^ |
| 8795001 | Haemoglobin F |
| 8817004 | LH receptor site |
| 8818009 | Blood group antibody Tri W |
| 8822004 | Linoleic acid |
| 8830003 | Nitrate reductase [NAD(P)H] |
| 8836009 | Gallocyanine stain |
| 8844009 | Hydroxybutyrate-dimer hydrolase |
| 8858006 | Strontium nitrate Sr^85^ |
| 8865003 | Natural graphite |
| 8878003 | Blood group antigen Evelyn |
| 8882001 | 3-Hydroxybenzoate 6-monooxygenase |
| 8886003 | Flecainide acetate |
| 8908003 | Blood group antibody I^T^ |
| 8914005 | Endolymph |
| 8919000 | Biotin |
| 8926000 | Azure B stain |
| 8945009 | Phosphopantothenate-cysteine ligase |
| 8953001 | 2,3-Dihydroxyindole 2,3-dioxygenase |
| 8963009 | N-Acetylmuramoyl-L-alanine amidase |
| 8969008 | Bulbourethral secretions |
| 8977007 | Blood group antibody Tarplee |
| 8982000 | Oleate hydratase |
| 8987006 | Cycle-phase specific agent |
| 8991001 | Ribulokinase |
| 9010006 | Methyl blue stain |
| 9013008 | Dephospho-CoA kinase |
| 9021002 | Carbaryl |
| 9024005 | Glucose-6-phosphate dehydrogenase |
| 9045003 | Radon radioisotope |
| 9052001 | Allspice oil |
| 9054000 | Blood group antigen HLA-B15 |
| 9103003 | Retinol fatty-acyltransferase |
| 9110009 | Mercuric compound |
| 9125009 | Sempervirine |
| 9159008 | Triacetate-lactonase |
| 9172009 | Blood group antibody Alda |
| 9174005 | Fibrinogen Poitiers |
| 9183000 | beta-N-Acetylgalactosaminidase |
| 9189001 | CMP-N-acetylneuraminate-lactosylceramide alpha-2,3-sialyltransferase |
| 9195000 | Immunoglobulin gene INV allotype |
| 9197008 | Apiose reductase |
| 9205004 | Haemoglobin Tarrant |
| 9220005 | Plant phenol oil |
| 9223007 | Borneol dehydrogenase |
| 9234005 | Chlorbutol |
| 9246009 | ^118^Tellurium |
| 9253000 | HLA-DRw16 antigen |
| 9270008 | Catecholamine receptor |
| 9271007 | Fibrinogen Pontoise |
| 9296005 | Gamma interferon |
| 9301005 | Lens neutral proteinase |
| 9302003 | Gentisate decarboxylase |
| 9315007 | Spearmint oil |
| 9319001 | Blood group antibody Vennera |
| 9334007 | Isopropyl glycidyl ether |
| 9349004 | Nitrobenzene |
| 9351000 | ^103^Palladium |
| 9355009 | Haemoglobin F-Alexandra |
| 9392009 | Blood group antibody Pollio |
| 9396007 | ^60^Iron |
| 9398008 | Blood group antigen Pillsbury |
| 9410003 | Bromoform |
| 9422000 | HDL |
| 9457002 | Fibrinogen Almeria |
| 9471005 | Polypropylene glycol |
| 9472003 | Blood group antigen Schneider |
| 9477009 | ATP pyrophosphatase |
| 9485000 | Glucuronosyl-disulphoglucosamine glucuronidase |
| 9493000 | Homologous antigen |
| 9507008 | ^238^Uranium |
| 9508003 | Haemoglobin F-Kotobuki |
| 9530002 | Amine hormone |
| 9532005 | Coagulation factor XIIIa |
| 9539001 | Chlorprothixene lactate |
| 9549003 | Haemoglobin F-Albaicin |
| 9556009 | Cholesterol acyltransferase |
| 9582000 | Alanine racemase |
| 9588001 | beta-Phosphoglucomutase |
| 9608008 | Blood group antigen Noble |
| 9623003 | 6-Phosphofructo-2-kinase |
| 9630009 | Poly(ribitol-phosphate) N-acetylglucosaminyltransferase |
| 9639005 | Bromine compound |
| 9643009 | Chlorphentermine |
| 9663002 | Pecazine |
| 9664008 | Di-sec-octyl phthalate |
| 9672005 | Blood group antigen S |
| 9675007 | Coniferyl-alcohol glucosyltransferase |
| 9676008 | Fibrinogen New York III |
| 9680003 | Central depressant |
| 9695001 | Haemoglobin J-Camaguey |
| 9701007 | Blood group antibody Pr>3< |
| 9716005 | Blood group antibody Luke |
| 9721008 | Phencyclidine |
| 9765000 | Lithium salt |
| 9797000 | Phosphorus trichloride |
| 9817005 | Mycoplasma pulmonis antibody test kit |
| 9821003 | Methylthioadenosine nucleosidase |
| 9830006 | ^200^Thallium |
| 9865006 | Deoxyhaemoglobin |
| 9871000 | D-Amino-acid acetyltransferase |
| 9885005 | Mannitol-1-phosphatase |
| 9890008 | Unspecific monooxygenase |
| 9900004 | Phenylalanine (histidine) aminotransferase |
| 9910008 | Oxymetazoline hydrochloride |
| 9913005 | Arachidic acid |
| 9921004 | Blood group antibody 'N' |
| 9923001 | Phenylalanine 4-monooxygenase |
| 9928005 | alpha-Dextrin endo-1,6-alpha-glucosidase |
| 9930007 | Blood group antigen Hartley |
| 9955001 | Oil of juniper wood |
| 9969001 | alpha-Glutamyl-glutamate dipeptidase |
| 9974009 | Angiotensin |
| 9975005 | Arabinan endo-1,5-alpha-L-arabinosidase |
| 9980001 | Lymphocyte antigen CDw75 |
| 9981002 | Lactate-malate transhydrogenase |
| 9985006 | Desarginisated complement enzyme |
| 9986007 | Tryptophanase |
| 9992001 | Molybdenum radioisotope |
| 10016008 | Bithionol |
| 10020007 | Biperiden hydrochloride |
| 10031004 | Vulvar secretions |
| 10034007 | Formyltetrahydrofolate deformylase |
| 10039002 | ^210m^Bismuth |
| 10043003 | D-Alanine-alanyl-poly(glycerolphosphate) ligase |
| 10063005 | Inorganic pyrophosphatase |
| 10067006 | Phosphatidylethanolamine methyltransferase |
| 10097003 | Ribose-5-phosphate-ammonia ligase |
| 10102000 | Plant enzyme |
| 10105003 | Active C3bBbC3b |
| 10109009 | Fibrinogen London III |
| 10126003 | Awn |
| 10133003 | Cyclizine lactate |
| 10150001 | Uraninite |
| 10158008 | Blood group antigen K13 |
| 10160005 | Formiminotetrahydrofolate cyclodeaminase |
| 10162002 | 3beta-Hydroxysteroid dehydrogenase |
| 10168003 | Immunoglobulin kappa light chain gene |
| 10174003 | Procarbazine hydrochloride |
| 10189007 | Conglutinin |
| 10192006 | Prostaglandin PGF2 |
| 10202007 | Prostaglandin PGE3 |
| 10228005 | Blood group antibody Mil |
| 10229002 | Haemoglobin Kenya |
| 10240005 | Lethanes |
| 10247008 | Chrysoidine R stain |
| 10249006 | Agar |
| 10265007 | Blood group antibody Jobbins |
| 10270000 | Erythromycin estolate |
| 10282009 | Betahistidine |
| 10308009 | ^42^Argon |
| 10313008 | Phenylmercuric nitrate |
| 10324005 | Demeclocycline hydrochloride |
| 10329000 | Zinc insulin |
| 10333007 | Clobenoside |
| 10336004 | Ribosylnicotinamide kinase |
| 10342000 | Heparin cofactor II |
| 10354000 | Somantin |
| 10357007 | Arsenite compound |
| 10373001 | beta-1,3-Galactosyl-o-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase |
| 10377000 | Sodium nitrite |
| 10393009 | HLA-Dw20 antigen |
| 10397005 | Protein-lysine 6-oxidase |
| 10398000 | Blood group antibody iH |
| 10407003 | Haemoglobin F-Xin-Su |
| 10419006 | Thorium isotope |
| 10424009 | Maprotiline hydrochloride |
| 10430009 | Benzpyrene |
| 10436003 | Blood group antibody Ad |
| 10440007 | HLA class II antigen |
| 10450008 | Glucose-1-phosphate phosphodismutase (substance) |
| 10466005 | Phosphide compound |
| 10471003 | Fibrinogen Vienna |
| 10473000 | Complement component C3 |
| 10488005 | Haemoglobin F-Cobb |
| 10490006 | Thymidine-triphosphatase |
| 10500003 | Xanthinol |
| 10508005 | Tetramine toxin |
| 10511006 | Monuron |
| 10534002 | Thyrotropin releasing factor |
| 10550005 | Dipotassium salt of endothall |
| 10560001 | Blood group antibody By |
| 10570004 | Blood group antigen Sf^a^ |
| 10581001 | Haemoglobin Grange-Blanche |
| 10595003 | Pseudoephedrine sulfate |
| 10622000 | Blood group antibody Gilbraith |
| 10627006 | Gliocladium proteinase |
| 10641002 | 3-Phosphoshikimate 1-carboxyvinyltransferase |
| 10644005 | Black phosphorus |
| 10645006 | ^207m^Lead |
| 10660009 | Luteoskyrin |
| 10669005 | Lectin |
| 10682002 | Fibrinogen Grand Rapids |
| 10685000 | Type I site-specific deoxyribonuclease |
| 10691003 | Biliverdin reductase |
| 10710009 | Anilazine |
| 10730008 | Azlocillin sodium |
| 10738001 | ^86^Yttrium |
| 10740006 | Sudan blue stain |
| 10750007 | Neurotoxic mycotoxin |
| 10751006 | Netilmicin sulphate |
| 10767000 | Calcium phosphate dibasic |
| 10781003 | Sodium phosphate P^32^ |
| 10782005 | Pentagastrin |
| 10790005 | ^53^Manganese |
| 10796004 | Glucose-6-phosphate |
| 10827009 | Milk protein |
| 10838009 | ADPphosphoglycerate phosphatase |
| 10843002 | Anterior pituitary hormone |
| 10862004 | Oncogene protein neu |
| 10889009 | Blood group antigen Tc^a^ |
| 10912008 | Blood group antigen Le^a^ |
| 10914009 | Cyanamide hydratase |
| 10931002 | Tryptophan 2'-dioxygenase |
| 10938008 | Sulphurous oxychloride |
| 10944007 | Taurine |
| 10949002 | alpha-Mannosidase |
| 10952005 | Antimony compound |
| 10955007 | Factor X antibody |
| 10976002 | Dinitrobenzene isomer |
| 10987005 | Platelet-derived growth factor |
| 11004008 | Blood group antigen Ge3 |
| 11022006 | Blood group antibody Cr2 |
| 11036001 | Alum |
| 11038000 | Limonene |
| 11041009 | Blood group antibody Dr^a^ |
| 11058004 | ^111^Palladium |
| 11064006 | Blood group antigen Lu^b^ |
| 11066008 | Sodium ethyl xanthate |
| 11069001 | Azure C stain |
| 11085006 | D-Alanine hydroxymethyltransferase |
| 11091008 | Blood group antibody Madden |
| 11111005 | Fructan beta-fructosidase |
| 11115001 | Thromboxane A>2< |
| 11121002 | ^135^Iodine |
| 11123004 | Blood group antigen Simpson |
| 11136004 | Methoxyflurane |
| 11137008 | Chymotrypsin |
| 11151008 | Immunoglobulin D |
| 11170003 | Vanillin |
| 11199008 | Phosphatidyl glycerol |
| 11201005 | Solochrome black 6B stain |
| 11202003 | Manganese salt |
| 11203008 | Methane |
| 11206000 | Haemoglobin Hikari |
| 11220007 | Ileal juice |
| 11222004 | Blood group antigen Ge1 |
| 11233001 | Public blood group antigen |
| 11238005 | Caprolactam |
| 11239002 | Urate-ribonucleotide phosphorylase |
| 11252007 | Blood group antigen Sa |
| 11253002 | Boron trioxide |
| 11257001 | Nitrogen compound |
| 11259003 | Cassaine |
| 11264004 | Sulphated fatty alcohol |
| 11267006 | Interleukin-10 |
| 11289005 | CMP-N-acetylneuraminate-monosialoganglioside sialyltransferase |
| 11298008 | Haemoglobin Riyadh |
| 11307006 | 2-Acetyl amino fluorine |
| 11311000 | Pus |
| 11312007 | Malate dehydrogenase (oxaloacetate-decarboxylating) |
| 11320009 | Sucrose |
| 11323006 | Methyl mercuric dicyanodiamine |
| 11330000 | Platelet antibody HPA-4b |
| 11331001 | ^56^Cobalt |
| 11345007 | Tribromsalan |
| 11353004 | Glomerular basement membrane antibody |
| 11355006 | Haemoglobin Alabama |
| 11370007 | Carbarsone |
| 11392006 | Aminoglycoside N^6'^-acetyltransferase |
| 11416006 | Cypridina-luciferin 2-monooxygenase |
| 11420005 | Rhubarb preparation |
| 11425000 | Glycopeptide alpha-N-acetylgalactosaminidase |
| 11427008 | 2-Hydroxy-4-carboxymuconate-6-semialdehyde dehydrogenase |
| 11439000 | Vas deferens secretions |
| 11447000 | Antibody to hepatitis B core antigen, IgM type |
| 11453000 | Cerebroventricular fluid |
| 11462003 | Ostomy appliance adhesive |
| 11473005 | Trichlormethiazide |
| 11474004 | Blood group antibody French |
| 11479009 | Blood group antibody Ok^a^ |
| 11489008 | Blood group antigen Nickolai |
| 11490004 | Haemoglobin Bari |
| 11496005 | Mercuric chloride |
| 11504003 | Edrophonium chloride |
| 11525003 | Silver citrate |
| 11526002 | Aspartame (substance) |
| 11555005 | Boron compound |
| 11566003 | Blood group antibody Braden |
| 11576000 | Cyclohexylamine |
| 11587008 | dTDP4-amino-4,6-dideoxygalactose aminotransferase |
| 11589006 | Copper acetoarsenite |
| 11594006 | Blood group antigen hr^s^ |
| 11600003 | Blood group antibody Terrell |
| 11605008 | UDPglucose 4-epimerase |
| 11621003 | Organic metallic compound |
| 11622005 | Cyclopamine |
| 11633008 | Flurbiprofen sodium |
| 11643006 | Phosphoenolpyruvate carboxykinase (ATP) |
| 11644000 | Piperacillin sodium |
| 11645004 | Spirit soluble aniline blue stain |
| 11652002 | Vasoactive intestinal peptide |
| 11684009 | Blood group antigen Kennedy |
| 11699009 | Petroleum |
| 11702002 | bis-(p-Chlorophenyl) ethanol |
| 11713004 | Water |
| 11714005 | Strong silver protein |
| 11715006 | ^4^Helium |
| 11725001 | Blood group antigen Gould |
| 11727009 | Indophenol from naphthol stain |
| 11734006 | Bis (5'-guanosyl) tetraphosphatase |
| 11735007 | T>2<-induced deoxynucleotide kinase |
| 11741000 | 2-Nitro-1,1-bis (p-chlorophenyl) propane |
| 11742007 | Samarandin toxin |
| 11744008 | Blood group antigen Knudsen |
| 11761006 | Haemoglobin Duarte |
| 11770009 | Blood group antigen Fy^a^ |
| 11780008 | Durazol red stain |
| 11799004 | Blood group antibody Donaldson |
| 11825009 | Endomysial antibody |
| 11831007 | Dichloroethyl ether |
| 11863001 | Blood group antigen Ls^a^ |
| 11869002 | 2,4-Diaminophenol hydrochloride |
| 11873004 | Carbon monoxide dehydrogenase |
| 11877003 | HLA-DRw10 antigen |
| 11880002 | Haemoglobin Andrew-Minneapolis |
| 11886008 | Blood group antibody Mckeever |
| 11891009 | Breath |
| 11894001 | Clostridium botulinum toxin |
| 11907003 | Ethylamine |
| 11943009 | Hydroxydione |
| 11965009 | Difluorodibromomethane |
| 11966005 | Dimethylaniline |
| 11968006 | Formate dehydrogenase (cytochrome) |
| 11984007 | 1, Hydroxy cholecalciferol |
| 11986009 | Penicillin G potassium |
| 11989002 | Plant azoxy glycoside |
| 11996000 | Platinum compound |
| 12001002 | Thionine stain |
| 12009000 | Coagulation factor IX Chapel Hill variant |
| 12015000 | Magnesium carbonate hydroxide |
| 12016004 | Creatine kinase isoenzyme, MB fraction |
| 12018003 | Trichophyton extract skin test |
| 12030009 | Sudan II stain |
| 12034000 | Coagulation factor II Salatka variant |
| 12079001 | Haemoglobin J-Meerut |
| 12085008 | 1,3-beta-Glucan synthase |
| 12086009 | Haemoglobin G-Hsi-Tsou |
| 12103002 | HLA-B45 antigen |
| 12112000 | Neon |
| 12117006 | 5-Methyltetrahydrofolate-homocysteine methyltransferase |
| 12119009 | Water soluble nigrosine stain |
| 12147008 | Serratia marcescans nuclease |
| 12148003 | Haemoglobin Avicenna |
| 12160002 | Loganate methyltransferase |
| 12171001 | Cutting oil |
| 12177002 | Pseudoephedrine hydrochloride |
| 12186007 | Radioactive gas |
| 12190009 | Blood group antibody Lazicki |
| 12194000 | Leukotriene |
| 12203005 | Prenyl-pyrophosphatase |
| 12206002 | Glutamine-fructose-6-phosphate aminotransferase (isomerising) |
| 12208001 | Syrosingopine |
| 12216005 | Haemoglobin F-Malta I |
| 12218006 | Diltiazem hydrochloride |
| 12233003 | Diphenylamine |
| 12235005 | Haemoglobin Zambia |
| 12290003 | Emetine hydrochloride |
| 12292006 | Californium |
| 12315006 | Halazone |
| 12353001 | AMP deaminase |
| 12358005 | Citronella oil |
| 12366001 | Haemoglobin Hope |
| 12374000 | Haemoglobin Pasadena |
| 12375004 | Krypton |
| 12379005 | Blood group antibody Do^b^ |
| 12391001 | Dextran 70 |
| 12414006 | Osmium isotope |
| 12426001 | Methylglutamate dehydrogenase |
| 12433001 | p-Chlorophenyl-p-chlorobenzyl sulphide |
| 12438005 | Dilan |
| 12439002 | Carnosine N-methyltransferase |
| 12448007 | Whelk poison |
| 12457001 | Haemoglobin Evanston |
| 12465003 | Haemoglobin Suan-Dok |
| 12474001 | Long neurotoxin venom |
| 12485004 | Glycerol-1,2-cyclic-phosphate 2-phosphodiesterase |
| 12487007 | Printing ink |
| 12490001 | Potassium hypochlorite |
| 12498008 | Blood group antibody Kn^b^ |
| 12499000 | Cord blood |
| 12502001 | Cedar oil |
| 12503006 | Aluminium |
| 12509005 | Galactoside 2-L-fucosyltransferase |
| 12510000 | Eucalyptus oil |
| 12525000 | Tybamate (substance) |
| 12542006 | Ethyl butyl ketone |
| 12564002 | HLA class III antigen |
| 12567009 | Fire retardant |
| 12568004 | Belladonnine |
| 12577006 | Blood group antibody Ch^a^ |
| 12578001 | Erythromycin ethylsuccinate |
| 12597001 | Tin |
| 12598006 | Arachidonate 5-lipoxygenase |
| 12614000 | Serine-tRNA ligase |
| 12627001 | Macrophage chemotactic factor |
| 12641005 | Boron tribromide |
| 12642003 | Artificial antigen |
| 12648004 | LFA-1 leucocyte adhesive protein |
| 12671002 | Clostridium difficile toxin |
| 12684006 | Glutamate-ammonia ligase |
| 12685007 | Blood group antigen Wiley (substance) |
| 12689001 | Magnesium radioisotope |
| 12710003 | Haematoxylin stain |
| 12714007 | Cysteine dioxygenase |
| 12716009 | Aluminium carbonate |
| 12743004 | Thorium oxide |
| 12750000 | ^182^Hafnium |
| 12752008 | Blood group antibody HLA-A7 |
| 12753003 | Blood group antibody Fr^a^ |
| 12754009 | L-Lactate dehydrogenase (cytochrome) |
| 12788003 | Haemoglobin Sunshine Seth |
| 12790002 | (S)-6-Hydroxynicotine oxidase |
| 12798009 | Cicutoxin |
| 12801003 | Iodamide meglumine |
| 12821002 | Clemizole |
| 12823004 | Altronate dehydratase |
| 12860000 | Haemoglobin Shepherds Bush |
| 12870003 | Coagulation factor IX Durham variant |
| 12878005 | Thiophene |
| 12899008 | Blood group antibody Lu^a^ |
| 12915002 | Nerve growth factor |
| 12917005 | Steryl-sulphatase |
| 12930006 | Calcium phosphate dibasic dihydrate |
| 12934002 | HLA-Cw7 antigen |
| 12937009 | Glucoside 3-dehydrogenase |
| 12940009 | ^7^Beryllium |
| 12950005 | Putrescine methyltransferase |
| 12970004 | Inositol hexanitrate |
| 12977001 | Deuterium oxide |
| 12984009 | Inulin fructotransferase (depolymerising) |
| 12995003 | Bagasse |
| 12998001 | Blood group antibody Mineo |
| 13005000 | Haemoglobin New York |
| 13006004 | Cajuput oil |
| 13012009 | Nucleoside phosphotransferase |
| 13016007 | Blood group antigen Li^a^ |
| 13030002 | Piperocaine |
| 13032005 | Pentanamidase |
| 13074000 | Acetoin racemase |
| 13083005 | Eosinophilic chemotactic factor |
| 13105002 | Hepatitis B surface antigen subtype ayr |
| 13121007 | gamma-Linolenic acid |
| 13134008 | trans-1,2-Dihydrobenzene-1,2-diol dehydrogenase |
| 13143004 | Glycosaminoglycan galactosyltransferase |
| 13150000 | Animal fat |
| 13185000 | Pyrogallol 1,2-oxygenase |
| 13188003 | Tobramycin sulfate |
| 13195007 | Immunoglobulin IgA2, H chain |
| 13198009 | UDP-N-acetylmuramoylpentapeptide-lysine N^6^-alanyltransferase |
| 13230006 | Farnesyl-diphosphate farnesyltransferase |
| 13232003 | Achromobacter proteinase I |
| 13235001 | Riboflavin |
| 13237009 | ^131^Caesium |
| 13240009 | Haemoglobin Warwickshire |
| 13241008 | ^106m^Rhodium |
| 13245004 | Aspartate kinase |
| 13287002 | Bromoxynil |
| 13293005 | Galactarate dehydratase |
| 13294004 | ^242^Americium |
| 13295003 | Urocanate hydratase |
| 13304005 | Ribose-phosphate pyrophosphokinase |
| 13305006 | Perillyl-alcohol dehydrogenase |
| 13342004 | Diethyl 2-chlorovinyl phosphate |
| 13373000 | Serine-phosphoethanolamine synthase |
| 13377004 | Blood group antigen Vw |
| 13393008 | Antimony trichloride |
| 13400000 | HLA-Bw65 antigen |
| 13422007 | ^117^Tellurium |
| 13435003 | Blood group antibody Cs^a^ |
| 13477003 | Lysozyme |
| 13484006 | Blood group antibody NOR |
| 13489001 | Methoxyethyl mercuriacetate |
| 13492002 | Blood group antibody Di^b^ (substance) |
| 13494001 | Kynurenine-glyoxylate aminotransferase |
| 13501003 | Erythritol kinase |
| 13502005 | Hydroxychloroquine sulfate |
| 13523004 | Protium |
| 13524005 | Grease |
| 13531009 | Butyl alcohol |
| 13539006 | Blood group antibody Sharp |
| 13541007 | N-Acetylneuraminate lyase |
| 13571004 | Blood group antibody Stevenson |
| 13577000 | Nut |
| 13579002 | 1-Naththylamine |
| 13585009 | Cefotetan |
| 13590007 | Blood group antibody Kosis |
| 13597005 | Dihydroxy-acid dehydratase |
| 13598000 | CMP-N-acetylneuraminate-N-acetyllactosaminide alpha-2,3-sialyltransferase |
| 13602003 | ^209^Thallium |
| 13618009 | Haemoglobin Twin Peaks |
| 13625002 | HLA-A24 antigen |
| 13626001 | Selenium^75^ HCAT |
| 13634007 | Fructose-6-phosphate phosphoketolase |
| 13652007 | Silicone |
| 13659003 | Benzquinamide |
| 13668001 | Propylene glycol |
| 13676004 | Creolin |
| 13696007 | Immunoglobulin lambda light chain gene |
| 13701000 | Blood group antigen E. Amos |
| 13708006 | Rectified pine tar oil |
| 13717006 | Blood group antibody McCall |
| 13718001 | Immunoglobulin, variable region |
| 13722006 | Cymarin |
| 13723001 | Blood group antigen Man |
| 13727000 | HIV receptor |
| 13739008 | Gallate decarboxylase |
| 13744001 | Methyl red stain |
| 13772008 | Blood group antibody Middel |
| 13774009 | Ribosomal RNA |
| 13780001 | Sphinganine-1-phosphate aldolase |
| 13781002 | alpha Amino isobutyric acid |
| 13784005 | Pyruvic acid |
| 13786007 | Pyrophosphate-fructose-6-phosphate 1-phosphotransferase |
| 13787003 | Protein secretory trypsin inhibitor |
| 13788008 | Dinitrobutyl phenol |
| 13789000 | Coal tar creosote |
| 13799005 | Plasmanylethanolamine desaturase |
| 13804000 | Amidinoaspartase |
| 13818007 | Cork |
| 13827008 | Boron trifluoride |
| 13833004 | Daminozide |
| 13835006 | Bile-salt sulphotransferase |
| 13841004 | Leukotriene C |
| 13858009 | alpha>1x< Glycoprotein |
| 13863008 | Arabinose |
| 13864002 | Haemoglobin A>2< Roosevelt |
| 13872000 | Blood group antibody Fuller |
| 13884003 | Phenylmercuric acetate |
| 13887005 | ^190m^Osmium |
| 13903005 | Pectinesterase |
| 13919003 | Indole 2,3-dioxygenase |
| 13925004 | Deoxyribonucleic acid, double stranded |
| 13931001 | Osmium tetroxide |
| 13932008 | Undecaprenyl-phosphate mannosyltransferase |
| 13952009 | Oil of hops |
| 13961009 | Haemoglobin Wayne |
| 13967008 | Methylcholanthrene |
| 13979008 | Bromic acid |
| 13999002 | Thetin-homocysteine methyltransferase |
| 14006006 | Ethylene oxide |
| 14013006 | Guanadrel sulphate |
| 14057005 | Ficin |
| 14060003 | Catechol |
| 14071002 | ^90^Strontium |
| 14090005 | Blood group antigen N |
| 14092002 | Tyramine |
| 14097008 | Halogen compound |
| 14101004 | Indoleacetylglucose-inositol acyltransferase |
| 14104007 | Blood group antigen O'Connor |
| 14120002 | Rodenticide (substance) |
| 14125007 | Serine |
| 14132003 | Silicon carbide |
| 14139007 | Arginine glutamate |
| 14146003 | Potassium isotope |
| 14148002 | L-Pipecolate dehydrogenase |
| 14172007 | Intrinsic factor concentrate preparation |
| 14190008 | Blood group antibody T |
| 14193005 | Sulphobromophthalein |
| 14195003 | Mercury isotope |
| 14213001 | ^47^Calcium |
| 14226002 | Blood group antigen Friedberg |
| 14228001 | Dolichyl-phosphate-mannose-protein mannosyltransferase |
| 14231000 | Aliphatic unsaturated hydrocarbon |
| 14263006 | Prepared fish |
| 14271005 | Blood group antigen Gon (substance) |
| 14279007 | Blood group antibody Epi |
| 14285000 | Coagulation factor XI variant type III |
| 14306003 | 1L-myo-Inositol-1-phosphatase |
| 14312008 | Vitamin L>2< |
| 14321009 | Captafol |
| 14330001 | Gold radioisotope |
| 14334005 | tRNA (uracil-5)-methyltransferase |
| 14338008 | Peptidoglycan beta-N-acetylmuramidase |
| 14340003 | Verapamil hydrochloride |
| 14349002 | Fibrinogen Seattle II |
| 14360006 | Trinitroaniline |
| 14376002 | Adenylylsulphatase |
| 14388000 | Cyanide hydratase |
| 14396005 | Blood group antibody Ls^a^ |
| 14399003 | Iodine radioisotope |
| 14401009 | Indium |
| 14402002 | Wood |
| 14409006 | Neocinchophen |
| 14436008 | Peripheral myelin |
| 14438009 | Carbenicillin disodium |
| 14439001 | Pyrazolylalanine synthase (substance) |
| 14443002 | Aminoglycoside -class of antibiotic- |
| 14444008 | Blood group antibody Todd |
| 14458005 | Ketohexokinase |
| 14461006 | Aluminium phosphate |
| 14464003 | HLA-Cw3 antigen |
| 14472001 | Dehydroacetic acid |
| 14503005 | Sucrose 1^F^-fructosyltransferase |
| 14507006 | Arsthinol (substance) |
| 14517001 | Blood group antibody Jordan |
| 14529005 | ^153^Gadolinium |
| 14539004 | Dimethylaniline-N-oxide aldolase |
| 14543000 | Glycosulphatase |
| 14544006 | Methyl violet 6B stain |
| 14550001 | ^131^Barium |
| 14558008 | Malate dehydrogenase oxaloacetate-decarboxylating (NADP^+^) |
| 14564001 | Amylopectin |
| 14574003 | Blood group antibody Bovet |
| 14583008 | Oxyuranus scutellotus prothrombin-activating proteinase |
| 14585001 | Benzquinamide hydrochloride |
| 14586000 | Phospho-5-dehydro-2-deoxygluconate aldolase |
| 14602007 | Chlorophyll |
| 14604008 | Blood group antibody Hg^a^ |
| 14611007 | Haemoglobin Yoshizuka |
| 14616002 | Heteroglycan alpha-mannosyltransferase |
| 14620003 | Blood group antibody B 9724 |
| 14638000 | Thiobarbiturate |
| 14645000 | Zinc phenolsulphonate |
| 14655001 | Histidinol-phosphatase |
| 14660002 | Actinidin |
| 14665007 | Blood group antigen Parra |
| 14668009 | Haemoglobin Tak |
| 14674009 | Azinphos-methyl |
| 14691008 | ^90^Yttrium |
| 14699005 | Dichloronaphthoquinone |
| 14702003 | Threonine-tRNA ligase |
| 14708004 | Haemoglobin Noko |
| 14711003 | Blood group antigen A |
| 14715007 | Dextran 75 |
| 14726001 | Antibody to antigen in Lewis blood group system |
| 14733001 | 2-Enoate reductase |
| 14743003 | Cinchonine |
| 14767006 | alpha>1< Anti-trypsin |
| 14796007 | Amfecloral |
| 14802009 | Acetoacetyl-CoA reductase |
| 14804005 | Creatine |
| 14805006 | Cucumisin |
| 14809000 | Dihydroxyacetone |
| 14813007 | ^177^Tungsten |
| 14815000 | Phosphorylase |
| 14819006 | Aspidium |
| 14827002 | Blood group antigen Di^a^ |
| 14839005 | Hafnium dust |
| 14843009 | Adenosine-tetraphosphatase |
| 14846001 | Glycerol-3-phosphate 1-dehydrogenase (NADP^+^) |
| 14849008 | HLA-Bw77 antigen |
| 14860004 | ADPsugar pyrophosphatase |
| 14863002 | Arsenic radioisotope |
| 14873000 | Structural gene |
| 14898004 | Nicotinate phosphoribosyltransferase |
| 14903000 | Antimony sodium thioglycolate |
| 14905007 | Promethazine hydrochloride |
| 14931009 | Glycine-tRNA ligase |
| 14958002 | Naphthol green B stain |
| 14971004 | Isoleucine |
| 14976009 | Succinate-semialdehyde dehydrogenase |
| 14986005 | Blood group antigen Wilson |
| 14996001 | Glucose dehydrogenase (acceptor) (substance) |
| 15009009 | Meprylcaine |
| 15011000 | Blood group antibody Ts |
| 15017001 | Beeswax |
| 15021008 | Neoantigen |
| 15047004 | ^93^Yttrium |
| 15052009 | Diphenoxylate |
| 15061009 | Formate dehydrogenase (NADP^+^) |
| 15072004 | Diethylene glycol monobutyl ether |
| 15073009 | Antigen excess immune complex |
| 15085001 | (S)-Usnate reductase |
| 15092006 | Malonyl-CoA decarboxylase |
| 15093001 | Glutathione-homocystine transhydrogenase |
| 15098005 | Alseroxylon |
| 15116007 | Mycodextranase |
| 15126000 | Ruthenium isotope |
| 15129007 | Zinc propionate |
| 15145009 | N-Acetylglucosamine-6-sulphatase |
| 15150003 | Thallium salt |
| 15158005 | Air |
| 15186002 | Haemoglobin A,b |
| 15217008 | 6-Aminohexanoate-cyclic-dimer hydrolase |
| 15234000 | Dihydrouracil dehydrogenase (NAD^+^) |
| 15245002 | n-Acetyl galactosamine |
| 15248000 | Fluoropolymer |
| 15249008 | Ethylidene diacetate |
| 15254004 | Thiamin kinase |
| 15272005 | ^197^Thallium |
| 15275007 | Blood group antibody FR |
| 15286009 | HLA-Cw2 antigen |
| 15287000 | trans-Hexaprenyltranstransferase |
| 15294002 | Haemoglobin Bushwick |
| 15297009 | ATP citrate (pro-3S)-lyase |
| 15298004 | 1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase |
| 15308006 | Dibasic copper sulphate |
| 15313005 | Blood group antibody Gf |
| 15322006 | Benzoquinonium |
| 15327000 | 7beta-Hydroxysteroid dehydrogenase (NADP^+^) |
| 15331006 | Glycine |
| 15352003 | Cyproheptadine hydrochloride |
| 15369001 | Disodium salt of endothall |
| 15373003 | Creatinine |
| 15379004 | Aryl-aldehyde dehydrogenase |
| 15392001 | Blood group antigen Jo^a^ |
| 15399005 | 2-Methyleneglutarate mutase |
| 15416001 | Blood group antigen Pruitt |
| 15424006 | ^243^Californium |
| 15450005 | ^244m^Americium |
| 15451009 | Haemoglobin Geelong |
| 15455000 | Haemoglobin Lepore-Washington-Boston |
| 15458003 | Boron isotope |
| 15469000 | Blood group antibody p |
| 15472007 | Disaccharide |
| 15495003 | CDPdiacylglycerol-glycerol-3-phosphate 3-phosphatidyltransferase |
| 15505005 | Preprodynorphin |
| 15529003 | Rosolic acid sodium salt stain |
| 15551006 | Complement component, alternate pathway |
| 15563001 | Cyclopentanone monooxygenase (substance) |
| 15571002 | Mezlocillin sodium |
| 15595000 | Amorphous or granular extracellular material |
| 15612008 | Porphobilinogen synthase |
| 15620005 | Blood group antigen Yk^a^ |
| 15623007 | Oil of cumin |
| 15653000 | Lymphocyte antigen CD76 |
| 15658009 | Cytidine diphosphate |
| 15660006 | Bleomycin sulfate |
| 15666000 | Chlorine isotope |
| 15668004 | 3,4,5-Trihydroxybenzoic acid |
| 15683009 | Blood group antigen Robert |
| 15698006 | Lysergic acid diethylamide |
| 15730005 | Porphyrin |
| 15735000 | Solanine |
| 15752001 | Immunoglobulin M, H chain |
| 15754000 | Interleukin-7 |
| 15764009 | Cyclohexanone |
| 15769004 | Aspartate 1-decarboxylase |
| 15781000 | Blood group antigen K20 |
| 15785009 | Phenazopyridine |
| 15790007 | NAD^+^ synthase (glutamine-hydrolysing) |
| 15797005 | Blood group antigen A. Owens |
| 15798000 | Blood group antibody Bp^a^ |
| 15800007 | Haemoglobin Mobile |
| 15810003 | Tuaminoheptane |
| 15817000 | Phosphomevalonate kinase |
| 15821007 | Brackish water |
| 15826002 | Dihydrorotenone |
| 15833002 | 4-Aminobiphenyl |
| 15835009 | Haemoglobin Moabit |
| 15879007 | Autograft |
| 15882002 | n-Butyric acid |
| 15895007 | Fibrinogen London I |
| 15896008 | Methyl violet 2B stain |
| 15901005 | Fibrinogen Paris III |
| 15909007 | Blood group antibody Yk^a^ |
| 15917004 | 4-Methyloxaloacetate esterase |
| 15928000 | Donovan's solution |
| 15942008 | Blood group antibody Lanthois |
| 15943003 | Guanylic acid |
| 15951000 | 2-Methylcitrate dehydratase |
| 16011006 | Technetium Tc^99m^ albumin colloid |
| 16017005 | Haemoglobin Syracuse |
| 16019008 | Blood group antibody Fy^x^ |
| 16022005 | Abnormal haemoglobin, multiple point mutation |
| 16024006 | ^204^Thallium |
| 16025007 | HLA-DQw8 antigen |
| 16045004 | Catechol 2,3-dioxygenase |
| 16073002 | Mercurous compound |
| 16074008 | Immune complex at equivalence |
| 16082008 | Tritium |
| 16085005 | 2-Furoyl-CoA dehydrogenase |
| 16103004 | L-Arabinose dehydrogenase |
| 16106007 | Sulfametoxydiazine |
| 16122008 | Blood group antibody hr^H^ |
| 16125005 | Styramate |
| 16128007 | Anionic detergent |
| 16130009 | Deoxyribonuclease IV (Phage T>4<-induced) |
| 16133006 | Blood group antigen Kamiya |
| 16136003 | Sterol |
| 16138002 | Blood group antigen M' |
| 16159009 | Tracheal mucus |
| 16164008 | 4-Oxoproline reductase |
| 16165009 | Saccharopine dehydrogenase (NAD^+^,L-glutamate-forming) |
| 16179001 | Diethanolamine-p-methoxycinnamate |
| 16202002 | Ribitol-5-phosphate dehydrogenase |
| 16213004 | Glycine acetyltransferase |
| 16214005 | Deslanoside |
| 16229007 | 5-Amino-6-(5-phosphoribosylamino) uracil reductase |
| 16230002 | Blood group antigen Madden |
| 16236008 | Fetoprotein |
| 16243002 | ^166^Ytterbium |
| 16257000 | Dopamine hydrochloride |
| 16265002 | ^172^Hafnium |
| 16267005 | Carrier protein |
| 16270009 | Prephenate dehydrogenase |
| 16272001 | Succinate-semialdehyde dehydrogenase (NAD(P)^+^) |
| 16274000 | Tantalum radioisotope |
| 16276003 | Coagulation factor IX Eagle Rock variant |
| 16285003 | Isoamyl salicylate |
| 16290000 | ^184^Iridium |
| 16296006 | Prostaglandin receptor |
| 16303009 | D-Proline reductase (dithiol) |
| 16309008 | Carboxy-cis,cis-muconate cyclase |
| 16313001 | Tea |
| 16318005 | Dibenzothiepin |
| 16321007 | Ovex |
| 16355005 | Tetracycline hydrochloride |
| 16359004 | Phthalylsulphathiazole |
| 16368002 | Cadmium fumes |
| 16369005 | Asbestos |
| 16392005 | Hexylcaine |
| 16395007 | Pituitary gonadotropin |
| 16405003 | Chlorophenol |
| 16441003 | N-Acetyllactosamine synthase |
| 16456007 | Haemoglobin P-Galveston |
| 16458008 | 2-Isopropylmalate synthase |
| 16462002 | Alpha neoendorphin |
| 16469006 | Haemoglobin Edmonton |
| 16472004 | Guanylate kinase |
| 16477005 | Diagnostic vaccine |
| 16480006 | Aminoacyl-histidine dipeptidase |
| 16482003 | Monobutyl biphenyl sodium monosulphonate |
| 16492006 | Cloxacillin sodium |
| 16502003 | Molecular oxygen |
| 16503008 | Glycine formiminotransferase |
| 16509007 | Haemoglobin Ankara |
| 16515007 | ^188^Tungsten |
| 16519001 | Blood group antibody Ny^a^ |
| 16520007 | Pyridoxine 4-oxidase |
| 16522004 | Fludroxycortide |
| 16526001 | ^173^Tantalum |
| 16546006 | Palmitoleic acid |
| 16586003 | ^86^Zirconium |
| 16605007 | n-Butyl acetate |
| 16610006 | Cyclohexanone monooxygenase |
| 16613008 | Prostaglandin PGD2 |
| 16624005 | Bromide salt |
| 16628008 | Somatotropin releasing factor |
| 16633007 | Methyl mercuric cyanoguanidine |
| 16641007 | Bonellinin |
| 16642000 | Glutamate-ethylamine ligase |
| 16660000 | Cholesterol monooxygenase (side-chain cleaving) |
| 16670003 | Fibrinopeptide B-beta 1-42 |
| 16683002 | Progesterone |
| 16693009 | Caesium compound |
| 16696001 | Plant pigment |
| 16705004 | HLA-Bw47 antigen |
| 16712008 | Saccharopine dehydrogenase (NADP^+^,L-lysine-forming) |
| 16716006 | Glutamate 5-kinase |
| 16717002 | Dehydrocorticosterone |
| 16719004 | Flowers |
| 16729006 | Phosphogluconate dehydrogenase (decarboxylating) |
| 16734005 | Blood group antibody S>2< |
| 16739000 | Ethane |
| 16744007 | Lactobacillus acidophilus agent |
| 16745008 | Xenon isotope |
| 16748005 | Zolamine |
| 16752005 | Blood group antigen Pearl |
| 16774004 | Dry cleaning agent |
| 16778001 | Octachlorocyclohexenone |
| 16783009 | alpha-Glucosidase |
| 16788000 | Naphthalene black 12B stain |
| 16803002 | Thyrotropin receptor |
| 16808006 | Trichloroethylene |
| 16826009 | Pentamidine isethionate |
| 16836001 | Azure A stain |
| 16840005 | Haemoglobin Hekinan |
| 16842002 | Acyl-[acyl-carrier-protein]-phospholipid acyltransferase |
| 16847008 | o-Demethylpuromycin methyltransferase |
| 16848003 | Haemoglobin Vicksburg |
| 16850006 | Ribose |
| 16878007 | Blood group antibody E |
| 16885006 | Trimellitic acid |
| 16906006 | Clostridium histolyticum aminopeptidase |
| 16915004 | Streptozocin |
| 16923002 | Lupus anticoagulant |
| 16927001 | Sodium-n-methyl dithiocarbamate |
| 16943008 | Chrysoidine Y stain |
| 16946000 | Triacetin |
| 16951006 | Antigen in Rh blood group system |
| 16968005 | Diethyltoluamide |
| 16969002 | (R)-2-Hydroxy-fatty-acid dehydrogenase |
| 16984006 | Phosphocreatine |
| 16989001 | Polygalacturonate 4-alpha-galacturonosyltransferase |
| 16995000 | Haemoglobin Osu Christiansborg |
| 16996004 | Blood group antibody Gd |
| 17003006 | alpha-1- Acid glycoprotein |
| 17008002 | Levallorphan |
| 17023007 | Soluble metallo-endopeptidase |
| 17032009 | Xylosylprotein 4-beta-galactosyltransferase |
| 17033004 | Lysine 2,3-aminomutase |
| 17047000 | Aniline |
| 17053000 | Pterin deaminase |
| 17058009 | Argemone oil |
| 17062003 | Nafoxidine hydrochloride |
| 17069007 | Chromic phosphate P^32^ |
| 17072000 | Cathepsin D |
| 17074004 | Blood group antigen Pelletier |
| 17108004 | Blood group antibody En^a^TS |
| 17117004 | Androsterone |
| 17119001 | Blood group antibody Yh^a^ |
| 17147002 | Cholic acid |
| 17152007 | Blood group antibody I^D^ |
| 17165003 | Blood group antigen 754 |
| 17171009 | Chlorine monofluoride |
| 17172002 | Dibromofluorescein stain |
| 17174001 | (R)-3-Amino-2-methylpropionate-pyruvate aminotransferase |
| 17178003 | Dolichyl-phosphate xylosyltransferase |
| 17199000 | ^195^Iridium |
| 17212003 | Bismuth subcarbonate |
| 17223004 | Insulin receptor |
| 17224005 | ^177^Ytterbium |
| 17229000 | Acetonitrile |
| 17240008 | Oil in water agent |
| 17243005 | Uramustine |
| 17244004 | Apraclonidine hydrochloride |
| 17253006 | Hypoderma collagenase |
| 17255004 | D-threo-Aldose dehydrogenase |
| 17257007 | Idoxuridine ophthalmic preparation |
| 17265005 | ^191^Osmium |
| 17270003 | Amino-acid acetyltransferase |
| 17334004 | Acetate CoA-transferase |
| 17356001 | Pralidoxime chloride |
| 17371002 | Haemoglobin Cordele |
| 17377003 | Glucan 1,3-beta-glucosidase |
| 17387004 | Pancreatic fluid |
| 17400004 | ^202m^Lead |
| 17430007 | Blood group antigen Hey |
| 17445000 | Trichloronaphthalene |
| 17455001 | Lipopolysaccharide galactosyltransferase |
| 17462005 | Blood group antigen K12 |
| 17483004 | Trichlorobenzene |
| 17485006 | Methoxypsoralen solution |
| 17486007 | Mecrilate |
| 17497007 | Pseudomonas cytochrome oxidase |
| 17503004 | Clocortolone pivalate |
| 17524009 | Phosphoacetylglucosamine mutase |
| 17534000 | Chylomicrons |
| 17546001 | L-Aspartate oxidase |
| 17574006 | Haemoglobin A>2< Melbourne |
| 17577004 | Exo-poly-alpha-galacturonosidase |
| 17595001 | Lymphocyte antigen CD32 |
| 17597009 | Protein-N-pi-phosphohistidine-sugar phosphotransferase |
| 17598004 | L-Arabinonate dehydratase |
| 17603007 | Cob(I)alamin adenosyltransferase |
| 17614005 | Fibrinogen Buenos Aires I |
| 17626000 | L-Serine dehydratase |
| 17627009 | Antibody to hepatitis Be antigen |
| 17628004 | Indole-3-glycerol-phosphate synthase |
| 17635007 | ^111m^Palladium |
| 17637004 | Dimethylhistidine methyltransferase |
| 17640004 | Blood group antibody Savery |
| 17643002 | Hafnium compound |
| 17644008 | Enoyl-[acyl-carrier-protein] reductase (NADH) |
| 17646005 | ^107m^Silver |
| 17659002 | Blood group antigen R.M. |
| 17666001 | Calcium thioglycolate |
| 17676003 | Lactoylglutathione lyase |
| 17677007 | Haemoglobin F-Columbus-Ga |
| 17678002 | Zirconium |
| 17685003 | Urushiol |
| 17693003 | Acriflavine stain |
| 17694009 | Anthraquinone dye |
| 17701004 | Brucella protein nucleate |
| 17707000 | Blood group antibody Ritter |
| 17708005 | Nitrate reductase |
| 17728009 | Tellurium dioxide |
| 17730006 | Mannuronate reductase |
| 17731005 | Coagulation factor IX London variant |
| 17733008 | Carnitine palmitoyltransferase |
| 17740009 | Blood group antigen Epi |
| 17750005 | Naphthalene |
| 17761002 | ^120^Antimony |
| 17764005 | Platinum salt |
| 17768008 | Oxamate carbamoyltransferase |
| 17773002 | 8-Hydroxyfuranocoumarin O^8^-methyltransferase |
| 17777001 | Blastomycin |
| 17784009 | Petroleum distillate |
| 17798001 | Coagulation factor II Cardeza variant |
| 17830000 | Hydroxyethylthiazole kinase |
| 17836006 | Aromatic ammonia spirit |
| 17838007 | Haemoglobin South Florida |
| 17848009 | Thioperazine |
| 17853004 | Antibody excess immune complex |
| 17870007 | Xylidine |
| 17874003 | Bergamot oil |
| 17895008 | Haemoglobin A>2< Manzanares |
| 17898005 | Succinchlorimide |
| 17900007 | 4-Carboxymuconolactone decarboxylase |
| 17903009 | Abnormal haemoglobin, gamma-chain variant |
| 17906001 | ^92^Yttrium |
| 17908000 | Betamethasone benzoate |
| 17909008 | Glucuronate-1-phosphate uridylyltransferase |
| 17910003 | ^75^Bromine |
| 17913001 | Allantoic fluid |
| 17916009 | Propylene glycol dinitrate |
| 17917000 | Activated attapulgite |
| 17927006 | Haemoglobin Dallas |
| 17932007 | Fibrinogen Vicenza |
| 17936005 | Alkyl phenol polyglycol ether |
| 17942009 | Fibrinogen Houston |
| 17948008 | Haematopoietic factor |
| 17965004 | Dihydroxyphenylalanine aminotransferase |
| 17990002 | Melarsoprol |
| 17991003 | Fibrinogen Adelaide |
| 17997004 | L-Xylose dehydrogenase |
| 18004003 | Cholinesterase |
| 18015008 | ^128^Antimony |
| 18017000 | Phenyl glycidyl ether |
| 18025003 | Binary chemical warfare agent |
| 18030004 | Blood group antibody Balkin |
| 18039003 | Alkyl mercuric phosphate |
| 18082002 | Blood group antigen V |
| 18093000 | Halogenated hydrocarbon-organic oxygen insecticide |
| 18094006 | Haemoglobin J-Norfolk |
| 18124001 | Histamine methyltransferase |
| 18127008 | Bacterial endotoxin |
| 18128003 | Keratan sulphate |
| 18143001 | Fibrinogen Quebec II |
| 18150002 | Blood group antibody A,B |
| 18164002 | Gentisate 1,2-dioxygenase |
| 18180007 | Haemoglobin J-Auckland |
| 18195009 | HLA-DR9 antigen |
| 18202008 | beta-Mannosidase |
| 18211008 | Hydroxymethylglutaryl-CoA reductase |
| 18220004 | Thyroid hormone |
| 18230008 | Deoxy adenosine triphosphate |
| 18247009 | Technetium radioisotope |
| 18287004 | Plastic polymer |
| 18288009 | von Willebrand factor |
| 18290005 | 3-Dehydroquinate synthase |
| 18298003 | Thromboxane B>2< |
| 18300003 | Thiodimeton |
| 18303001 | Amidase |
| 18321003 | Thiethylperazine maleate |
| 18324006 | D-Arabinonolactonase |
| 18328009 | Mannose isomerase |
| 18344000 | 2,4-Dichlorophenoxyacetic acid |
| 18350005 | Ribonuclease IV |
| 18359006 | Blood group antibody Fedor |
| 18368008 | Chyle |
| 18380000 | Blood group antibody K^w^ |
| 18394004 | Collagenase preparation |
| 18395003 | Hydroxypyruvate decarboxylase |
| 18397006 | Sulphatide |
| 18406008 | Haemoglobin Summer Hill |
| 18414002 | Colecalciferol |
| 18421002 | 3-Hydroxydecanoyl-[acyl-carrier-protein]-dehydratase |
| 18426007 | Blood group antibody MZ 443 |
| 18436004 | Lymphocyte antigen CD58 |
| 18449009 | Lincomycin hydrochloride |
| 18454000 | 3-Oxo-5beta-steroid delta^4^-dehydrogenase |
| 18462008 | Methdilazine |
| 18468007 | Blood group antibody M^g^ |
| 18470003 | Genome |
| 18486005 | Blood group antigen BLe^b^ |
| 18490007 | NAD(P)^+^ nucleosidase |
| 18501000 | HLA-B51 antigen |
| 18509003 | Angiogenesis growth factor |
| 18532004 | Sassafras oil |
| 18533009 | Blood group antigen Rh34 |
| 18535002 | Hypothalamic releasing factor |
| 18550006 | Thioridazine hydrochloride |
| 18566008 | Dodecarbonium chloride |
| 18569001 | Potassium chlorate |
| 18574009 | Dichloroethylene |
| 18594000 | Immunoglobulin, GM>16< allotype |
| 18600008 | Glucurolactone |
| 18611000 | Blood group antigen Hr |
| 18616005 | Lithium hydride |
| 18617001 | Thrombopoietin |
| 18622001 | Pyridoxal dehydrogenase |
| 18627007 | Blood group antigen iP>1< |
| 18633003 | Trimethylamine dehydrogenase |
| 18659000 | Anti fungal antibody |
| 18667008 | Haemoglobin Indianapolis |
| 18681005 | Isopropyl-n-(3-chlorophenyl) carbamate |
| 18712002 | Phenacemide |
| 18732001 | Trimethylamine-oxide aldolase |
| 18737007 | Blood group antigen Duclos |
| 18743009 | ^228^Actinium |
| 18754004 | Ytterbium radioisotope |
| 18759009 | Sodium thioglycolate |
| 18761000 | Lymphocyte antigen CD69 |
| 18763002 | Blood group antigen Dropik |
| 18774006 | Arylamine acetyltransferase |
| 18786009 | Aspartate carbamoyltransferase |
| 18800006 | Crotalus atrox metalloproteinase |
| 18815007 | Diethyl phthalate |
| 18819001 | Cryoglobulin |
| 18832006 | Butylphenamide |
| 18836009 | Bacterial toxin |
| 18838005 | Pentachloronaphthalene |
| 18847002 | Tryptamines |
| 18852007 | Fibrinogen New York IV |
| 18853002 | Lymphocyte antigen CD2 |
| 18858006 | Indole |
| 18916007 | Oxaloacetase |
| 18924002 | Alkyl dimethyl ethylbenzyl ammonium bromide |
| 18925001 | Vanadium |
| 18959002 | Dibenzazepine derivative |
| 18970009 | Prolactin releasing factor |
| 18975004 | beta-L-Rhamnosidase |
| 18989009 | Carbon compound |
| 18992008 | Triturus species toxin |
| 19004006 | Dichloro-chloroaniline-triazine |
| 19007004 | Glycolate dehydrogenase |
| 19009001 | Lymphocyte antigen CD18 |
| 19011005 | Blood group antibody N |
| 19012003 | Fibrinogen Tokyo I |
| 19013008 | Sulphoacetaldehyde lyase |
| 19016000 | Copper arsenate |
| 19022009 | Blood group antigen Jopson |
| 19023004 | Acetoacetate decarboxylase |
| 19035000 | Blood group antibody Hall J |
| 19041007 | Tolazoline hydrochloride |
| 19046002 | Fibrinogen Pamplona |
| 19064009 | ^110^Indium |
| 19066006 | Dimethylaniline monooxygenase (N-oxide-forming) |
| 19089003 | Lymphocyte antigen CD16 |
| 19097005 | w-Amidase |
| 19113006 | Cellulose 1,4-beta-cellobiosidase |
| 19114000 | Mafenide acetate |
| 19126005 | Merbromin |
| 19136002 | Blood group antibody S1^a^ |
| 19142003 | Hyaluronate lyase |
| 19151006 | 3-Hydroxyanthranilate 3,4-dioxygenase |
| 19152004 | Biotin-[acetyl-CoA-carboxylase] ligase |
| 19160003 | Xylose |
| 19163001 | Prohormone |
| 19173004 | Pyrophosphate-serine phosphotransferase |
| 19178008 | Blood group antibody U |
| 19182005 | C>5b67< inhibitor |
| 19186008 | Krypton isotope |
| 19205004 | Secretin |
| 19209005 | Fungicide |
| 19238008 | Glycolipid |
| 19277006 | Leucocyte elastase |
| 19298006 | Calpain |
| 19299003 | Aminolaevulinate aminotransferase |
| 19323009 | alpha,alpha-Phosphotrehalase |
| 19331004 | Blood group antigen Rb^a^ |
| 19395006 | Blood group antigen Pe |
| 19400007 | Blood group antibody Baumler |
| 19421007 | Chloroprocaine hydrochloride |
| 19427006 | ^59^Nickel |
| 19456006 | Glucosamine-6-phosphate isomerase |
| 19462001 | Carbon dioxide absorbent |
| 19495007 | Sodium pertechnetate Tc^99m^ |
| 19499001 | Carbinoxamine maleate |
| 19501009 | Haemoglobin Singapore |
| 19509006 | Bryonidin |
| 19510001 | Diphenhydramine hydrochloride |
| 19516007 | ^98^Technetium |
| 19521005 | Phosphatidylglycerophosphatase |
| 19524002 | Penthienate |
| 19530002 | Blood group antibody P>1< |
| 19543002 | Pantetheine-phosphate adenylyltransferase |
| 19545009 | ^114m^Indium |
| 19565002 | Blood group antibody Rios |
| 19574000 | Immunoglobulin, KM allotype |
| 19595005 | Phenolphthalein |
| 19622008 | ^48^Chromium |
| 19635004 | Rhodium isotope |
| 19638002 | Formylmethionine deformylase |
| 19677004 | Lymphocyte antigen CD45 |
| 19710004 | Plant lectin |
| 19728002 | Lymphocyte antigen CD17 |
| 19734009 | 4-Trimethylammoniobutyraldehyde dehydrogenase |
| 19736006 | ^103^Silver |
| 19737002 | Renilla-luciferin sulphotransferase |
| 19747004 | Chlorine radioisotope |
| 19751002 | Potassium compound |
| 19755006 | Blood group antibody Shannon |
| 19759000 | Dipropyl ketone |
| 19767008 | ^175^Ytterbium |
| 19775002 | Oil of cubeb |
| 19783008 | Blood group antibody Groslouis |
| 19814003 | Endogalactosaminidase |
| 19823000 | Glucose-1,6-bisphosphate synthase |
| 19830006 | Blood group antibody |
| 19839007 | Sorbitol |
| 19868008 | Lymphocyte antigen CDw78 |
| 19872007 | Pyocyanin |
| 19879003 | Di-isobutyl phenoxy ethoxy ethyl dimethyl benzyl ammonium chloride |
| 19893005 | Potassium dichromate |
| 19901000 | Pentetrazol |
| 19917006 | Hydroperoxy eicosatetraenoic acid |
| 19918001 | Dihydroergocornine |
| 19945000 | Blood group antigen M |
| 19950006 | Brevetoxin |
| 19964006 | Dinitrophenol |
| 19967004 | Viomycin |
| 19971001 | Glucuronate isomerase |
| 19975005 | Phosphoribosyl-AMP cyclohydrolase |
| 19978007 | Hexafluorenium |
| 19985006 | N-Acetyl-gamma-glutamyl-phosphate reductase |
| 19986007 | Urease |
| 20009008 | Blood group antigen Rg1 |
| 20024004 | Demeton |
| 20028001 | Diborane |
| 20040001 | Blood group antigen Di^b^ |
| 20056006 | Dibromosalicylaldehyde |
| 20057002 | Complement component C6 |
| 20076000 | Phenylethanolamine N-methyltransferase |
| 20077009 | Streptomycin-6-phosphatase |
| 20083007 | Di-isobutyl cresolyl ethoxy ethyl dimethyl benzyl ammonium chloride |
| 20096008 | Trichlorobenzoic acid |
| 20120005 | ^230^Thorium |
| 20125000 | Intracellular fluid |
| 20138008 | Lethal gene |
| 20150002 | Haemoglobin J-Luhe |
| 20160006 | Glucose oxidase |
| 20170008 | Lung surfactant |
| 20183009 | Nicotinate-nucleotide-dimethylbenz-imidazole phosphoribosyltransferase |
| 20211008 | Methylglyoxal synthase |
| 20214000 | N-Acetylglucosamine-6-phosphate deacetylase |
| 20217007 | Trimetaphan camsilate |
| 20221000 | Profilin |
| 20228006 | Blood group antigen Ku |
| 20229003 | Pyrrobutamine |
| 20230008 | Vital new red stain |
| 20231007 | Aminosalicylic sodium |
| 20238001 | Chlorinated lime |
| 20265008 | Perchlorate salt |
| 20296004 | Nitroaniline |
| 20304007 | Blood group antibody P |
| 20309002 | Dichloronitroethane |
| 20327004 | Sodium caprylate |
| 20337009 | Glycerone-phosphate acyltransferase |
| 20340009 | Methysergide maleate |
| 20355000 | Granulocyte antibody |
| 20368008 | Diphenadione |
| 20371000 | Acetylenecarboxylate hydratase |
| 20378006 | Methyldimethoxyamphetamine |
| 20379003 | Neomycin C |
| 20383003 | Blood group antibody Duclos |
| 20386006 | Aminoacyl-tRNA hydrolase |
| 20413008 | Levopropoxyphene |
| 20450009 | Ciprofloxacin hydrochloride |
| 20459005 | Abalone viscera poison |
| 20468007 | Isopropamide |
| 20478005 | Diaminopimelate decarboxylase |
| 20493009 | HLA-Dw24 antigen |
| 20495002 | Fibrinogen Bergamo II |
| 20507001 | Oil of garlic |
| 20515003 | Oncogene protein c-ets |
| 20524007 | Rhamnulokinase |
| 20527000 | Haemoglobin Willamette |
| 20532004 | beta-1,3-Galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase |
| 20539008 | Tyrosine aminotransferase |
| 20560002 | Cerebroside-sulphatase |
| 20564006 | Toluene-2-4-diisocyanate |
| 20569001 | Imidazoleacetate 4-monooxygenase |
| 20574009 | Prostaglandin-D 15-dehydrogenase (NADP^+^) |
| 20576006 | Blood group antigen Santano |
| 20591008 | Blood group antibody Nielsen |
| 20611000 | Haemoglobin Hotel-Dieu |
| 20631001 | Convallarin |
| 20642005 | mRNA guanylyltransferase |
| 20643000 | 1,2-Dichloropropane |
| 20645007 | Aspulvinone dimethylallyltransferase |
| 20651002 | Pyridoxal kinase |
| 20672004 | Guanine |
| 20675002 | Inulosucrase |
| 20685001 | Cholinergic receptor |
| 20686000 | Fibrinogen Christchurg II |
| 20732001 | Arthrobacter serine proteinase |
| 20742004 | Glutaconate CoA-transferase |
| 20748000 | Blood group antigen VK |
| 20751007 | Deoxyadenylic acid |
| 20752000 | Prothrombin antibody |
| 20761000 | Ketene |
| 20764008 | Lymphocyte antigen CD57 |
| 20771003 | Congenital dysfibrinogen |
| 20777004 | Blood group antibody Margaret |
| 20792003 | Glucan 1,4-alpha-maltotetraohydrolase |
| 20807009 | Anti nucleolus antibody |
| 20821006 | Isopullulanase |
| 20822004 | rRNA (adenosine-O^2'^)-methyltransferase |
| 20823009 | Complement |
| 20832006 | Farnesyl-diphosphate kinase |
| 20844009 | Oxyprocaine |
| 20847002 | Streptokinase agent |
| 20878003 | Blood group antibody Hut |
| 20887007 | Tretamine |
| 20898008 | Lymphocyte antigen CD44 |
| 20907008 | Blood group antibody Cipriano |
| 20914005 | Adenylate kinase |
| 20918008 | 3-Mercaptopyruvate sulphurtransferase |
| 20925001 | Calcium glycerophosphate |
| 20966001 | ^125^Antimony |
| 20989009 | Cyanide compound |
| 20993003 | Oncogene protein P53 |
| 20994009 | Dinitro-o-amyl phenol |
| 21004009 | ^199^Thallium |
| 21023002 | Blood group antigen Rh42 |
| 21028006 | Fibrinogen Bergamo I |
| 21064007 | Blood group antibody Rm |
| 21066009 | Buprenorphine hydrochloride |
| 21074005 | Fucosylgalactose alpha-N-acetylgalactosaminyltransferase |
| 21075006 | ^61^Cobalt |
| 21094001 | Coal tar ointment |
| 21102006 | Blood group antigen McC^d^ |
| 21140009 | Mannose-6-phosphate isomerase |
| 21141008 | ^95^Ruthenium |
| 21145004 | Blood group antibody Hr>o< |
| 21149005 | Blood group antibody Pr>1h< |
| 21158003 | Independent high incidence blood group antibody |
| 21166007 | Lymphocyte antigen CD21 |
| 21168008 | Acetosulphone |
| 21175009 | Methanthelinium bromide |
| 21204003 | Pantetheine kinase |
| 21209008 | Long-chain-alcohol oxidase |
| 21231000 | Corticosteroid side-chain-isomerase |
| 21235009 | Piperoxan |
| 21239003 | beta-D-fructopyranose |
| 21246007 | Fibrinogen Detroit |
| 21256006 | HLA-Dw23 antigen |
| 21275001 | Plasmalogen synthase |
| 21289006 | Platelet factor 4 |
| 21292005 | Mannan endo-1,4-beta-mannosidase |
| 21302001 | Haemoglobin Denmark Hill |
| 21303006 | Methoxamine hydrochloride |
| 21309005 | Oestradiol 17beta-dehydrogenase |
| 21315005 | Blood group antigen St^a^ |
| 21317002 | Sodium fluoroacetate |
| 21319004 | Ribulose-phosphate 3-epimerase |
| 21325000 | beta-Glucosidase |
| 21373005 | Soap enema |
| 21378001 | Iodinated I^125^ Rose Bengal |
| 21380007 | 4-Methoxybenzoate monooxygenase (O-demethylating) |
| 21383009 | Immunoglobulin, KM>3< allotype |
| 21394008 | Adiphenine |
| 21410001 | Protocatechuate decarboxylase |
| 21416007 | Lead arsenite |
| 21438009 | Ureidoglycolate dehydrogenase |
| 21456009 | Glucarate dehydratase |
| 21458005 | Glucose-6-phosphate isomerase |
| 21495005 | Glutaryl-CoA dehydrogenase |
| 21500008 | Dimethoate |
| 21518006 | Naloxone hydrochloride |
| 21521008 | HLA-Bw71 antigen |
| 21533003 | Lyase |
| 21540002 | Endosulphan |
| 21541003 | Oncogene protein TCRD |
| 21556007 | p-Methylaminophenol sulphate |
| 21559000 | ^69m^Zinc |
| 21564001 | Thyme oil |
| 21566004 | Methyldopate hydrochloride |
| 21568003 | Adrenal cortical hormone |
| 21572004 | ^123^Iodine |
| 21576001 | ^13^ Nitrogen |
| 21585001 | Lysyltransferase |
| 21592006 | Tartrazine stain |
| 21607001 | Agmatine kinase |
| 21609003 | Gastric vomitus |
| 21611007 | Boric acid |
| 21614004 | Phenelzine sulfate |
| 21621004 | Copying ink |
| 21625008 | Unsaturated fatty acid |
| 21627000 | Haemoglobin Beirut |
| 21632004 | Titanium compound |
| 21642002 | Blood group antigen G |
| 21660002 | Taxifolin 8-monooxygenase |
| 21677002 | Colonic contents |
| 21680001 | Haemoglobin G-Pest |
| 21697007 | Rectal mucus |
| 21706000 | Tetrahydrofolic acid |
| 21712005 | Polyribonucleotide nucleotidyltransferase |
| 21713000 | Thermomycolin |
| 21716008 | 1-Chloro-3-bromopropene-1 |
| 21728000 | Haemoglobin G-Ferrara |
| 21729008 | Immunoglobulin, GM>15< allotype |
| 21733001 | Prolyl endopeptidase |
| 21736009 | Amine dehydrogenase |
| 21743003 | N-Acetylglucosamine kinase |
| 21750004 | Metmyoglobin |
| 21760008 | Radiogold colloid |
| 21774001 | Complement component, precursor |
| 21790001 | Operon gene |
| 21802009 | Blood group antibody HEMPAS |
| 21803004 | Alkyl aryl ammonium chloride |
| 21822008 | Haemoglobin A>2<^1^ (B>2<) |
| 21847005 | Oil |
| 21873000 | Blood group antibody Griffith |
| 21876008 | Blood group antigen NOR |
| 21880003 | Aurothioglucose |
| 21888005 | Nickel carbonyl |
| 21891005 | Digestive enzyme |
| 21899007 | Thiocarbarsone |
| 21903000 | Bismuth violet |
| 21907004 | Haemoglobin Pitie-Salpetriere |
| 21919007 | Opium |
| 21920001 | Blood group antigen Lu14 |
| 21936004 | Plutonium radioisotope |
| 21951008 | Alizarin cyanine green stain |
| 21961001 | Oil of spruce |
| 21966006 | Aldose 1-epimerase |
| 21977000 | ^121m^Tellurium |
| 21988006 | Bacterial genome |
| 21990007 | Phospholipase A venom |
| 21999008 | 3-Hydroxy-3-isohexenylglutaryl-CoA lyase |
| 22005007 | Ethyl chloride |
| 22008009 | Fenclofos |
| 22018004 | Tropine dehydrogenase |
| 22021002 | Methyl green stain |
| 22023004 | Blood group antigen Le^x^ |
| 22038003 | Selenium |
| 22065005 | Paraquat |
| 22078005 | Pterins |
| 22086005 | Sodium antimonyl gluconate |
| 22088006 | 3-Hydroxyanthranilate oxidase |
| 22092004 | Endopolyphosphatase |
| 22100000 | Haemoglobin Zürich |
| 22105005 | Sucrose-1,6-a-glucan 3(6)-alpha-glucosyltransferase |
| 22110009 | Carnosine synthase |
| 22129003 | ^123m^Tellurium |
| 22141005 | Limonin-D-ring-lactonase |
| 22147009 | Cyclohexylamine oxidase |
| 22158000 | Sinapine esterase |
| 22160003 | ^87^Yttrium |
| 22165008 | Metamizole sodium |
| 22175006 | Haemoglobin Natal |
| 22179000 | Lysophospholipase |
| 22183000 | ^119^Tellurium |
| 22185007 | G protein |
| 22192002 | Salicylamide |
| 22196004 | NADPH dehydrogenase (flavin) |
| 22219004 | Haemoglobin Riverdale-Bronx |
| 22224001 | Chorismate synthase |
| 22236007 | Acetarsol |
| 22242006 | Glutaraldehyde |
| 22244007 | LDL |
| 22250002 | Fibrinogen Birmingham |
| 22269007 | Blood group antibody Sa |
| 22284003 | Glucosyl-DNA beta-glucosyltransferase |
| 22290004 | Hepatitis B surface antigen |
| 22308004 | ^116^Tellurium |
| 22322004 | Steroid receptor |
| 22332006 | Blood group antibody McC^e^ |
| 22340000 | Sodium ricinoleate |
| 22348007 | HLA-DR5 antigen |
| 22360008 | Dimethoxane |
| 22362000 | Calcium hydrogen phosphate anhydrous |
| 22377008 | Alkaline phosphatase isoenzyme, intestinal fraction |
| 22392009 | Diffusely mineralised extracellular matrix |
| 22403009 | 5-Oxopent-3-ene-1,2,5-tricarboxylate decarboxylase |
| 22422000 | Maltose phosphorylase |
| 22424004 | Ochratoxins |
| 22453003 | Cathepsin G |
| 22463006 | Haemoglobin G-San Jose |
| 22479007 | ^71^Arsenic |
| 22492005 | Haemoglobin Alamo |
| 22496008 | Fibrinogen Cleveland I |
| 22503007 | HLA-Bw50 antigen |
| 22518008 | Hydrogen telluride |
| 22538009 | Lead arsenate |
| 22551004 | Dichlorophenyl dimethyl urea |
| 22553001 | Mascara |
| 22555008 | Sorbose |
| 22559002 | Glycoasparagine |
| 22568000 | Blood group antigen Hr>o< |
| 22579005 | Heparan-alpha-glucosaminide acetyltransferase |
| 22584004 | Haemoglobin Sydney |
| 22604005 | Uridine triphosphate |
| 22606007 | Vitamin K>2< |
| 22627002 | Blood group antibody Barrett |
| 22635004 | Factor V antibody |
| 22643009 | Haemoglobin Belfast |
| 22654004 | Propantheline bromide |
| 22691005 | Urea carboxylase (hydrolysing) |
| 22703005 | Brucine |
| 22712007 | K-Carrageenase |
| 22723006 | GABA-benzodiazepine receptor |
| 22726003 | Cyclohexene |
| 22727007 | Serum amyloid protein |
| 22732008 | Pseudomonas aeruginosa alkaline proteinase |
| 22746008 | Perbromate salt |
| 22749001 | Victoria blue B stain |
| 22769006 | Penthienate bromide |
| 22771006 | Cellobiose dehydrogenase (quinone) |
| 22779008 | Coagulation factor II Habana variant |
| 22790003 | Physostigmine sulphate |
| 22792006 | Tripelennamine citrate |
| 22796009 | Haemoglobin D-Iran |
| 22804007 | Haemoglobin D-Granada |
| 22827004 | Prochlorperazine maleate |
| 22836000 | Vegetable |
| 22839007 | Blood group antibody Au^a^ |
| 22840009 | Tetraethyl pyrophosphate |
| 22842001 | Indene |
| 22864005 | Phosphorylase phosphatase |
| 22865006 | Anthophyllite |
| 22880000 | 3-Hydroxypalmitoyl-[acyl-carrier-protein]-dehydratase |
| 22882008 | Coagulation factor II Molise variant |
| 22893005 | Inert matter |
| 22904008 | Haemoglobin K-Ibadan |
| 22907001 | Heavy metal |
| 22908006 | Phorbol-diester hydrolase |
| 22917006 | Haemoglobin D-Los Angeles |
| 22931006 | Evans blue stain |
| 22939008 | Blood group antibody Messenger |
| 22941009 | 11-Deoxycortisol |
| 22944001 | ^246^Plutonium |
| 22947008 | Testosterone 17beta-dehydrogenase |
| 22951005 | Screening smoke |
| 22967004 | Drug receptor |
| 22968009 | Sunset yellow FCF stain |
| 22971001 | Blood group antibody I |
| 22976006 | Aluminium acetate |
| 22979004 | Oleic acid I^125^ |
| 22987003 | Phosphopantothenoylcysteine decarboxylase |
| 23003008 | Ribosylpyrimidine nucleosidase |
| 23005001 | Glucose dehydrogenase (NAD) |
| 23016008 | HLA-DPw1 antigen |
| 23038005 | Myosin |
| 23050004 | Small intestinal juice |
| 23052007 | Haemoglobin O-Padova |
| 23053002 | Iophenoic acid |
| 23064004 | Blood group antigen Jn^a^ |
| 23068001 | Caffeine citrate |
| 23077008 | Barbituric acid |
| 23095006 | Thevetin |
| 23101007 | Blood group antigen Dr^a^ |
| 23103005 | Blood group antigen Niemetz |
| 23113002 | Glutamine-tRNA ligase |
| 23126003 | Haemoglobin G-Georgia |
| 23134009 | Organic sulphide compound |
| 23164001 | Sp40/40 |
| 23165000 | Blood group antigen Terrano |
| 23169006 | Poly (glycerol-phosphate) alpha-glucosyltransferase |
| 23172004 | Bismuth |
| 23176001 | Bacampicillin hydrochloride |
| 23182003 | Cereal |
| 23200004 | Blood group antigen Fy3 |
| 23208006 | N-butyl acetanilide |
| 23216002 | Suppressor gene |
| 23217006 | Arsenic compound |
| 23219009 | Haemoglobin Legnano |
| 23240005 | Homologous restriction factor |
| 23243007 | Oligonucleotide |
| 23254002 | Squalene |
| 23295004 | Fibrinogen |
| 23303000 | Silver isotope |
| 23307004 | Oestrogen receptor |
| 23308009 | Taurine aminotransferase |
| 23314002 | Blood group antibody Schwend |
| 23317009 | Saxitoxin |
| 23318004 | Anti neutrophilic cytoplasm antibody |
| 23324005 | trans-Pentaprenyltranstransferase |
| 23349009 | Phosphatidyl ethanolamine |
| 23367002 | Monofluoroacetate salt |
| 23369004 | Immune complex |
| 23375008 | Colistin sulphate |
| 23378005 | Male genital fluid |
| 23380004 | Blood group antigen Kp^a^ |
| 23385009 | Blood group antibody ALe^b^ |
| 23396001 | Blood group antibody Green |
| 23408008 | ^236^Plutonium |
| 23423003 | Sodium hydroxide |
| 23433006 | Ergocalciferol |
| 23434000 | Blood group antigen Or |
| 23459009 | Selenium radioisotope |
| 23465009 | 2-Dehydro-3-deoxygalactonokinase |
| 23475007 | ^73m^Germanium |
| 23504007 | 2-Deoxy-D-gluconate dehydrogenase |
| 23519008 | ^180m^Tantalum |
| 23555000 | Dethiobiotin synthase |
| 23563004 | Very late antigen receptor |
| 23564005 | Dyclonine |
| 23570004 | ^219^Radon |
| 23571000 | ^115^Cadmium |
| 23573002 | Acetylcholinesterase |
| 23590008 | Sialoprotein |
| 23599009 | Allosteric site |
| 23601006 | Mesityl oxide |
| 23603009 | Blood group antigen Ge4 |
| 23647003 | Haemoglobin Kawachi |
| 23677009 | 4-Hydroxyglutamate aminotransferase |
| 23689006 | Platelet antigen HPA-3a |
| 23692005 | Tribasic calcium phosphate |
| 23696008 | Catechol oxidase |
| 23701001 | Trichlorocarbanilide |
| 23711008 | Alkyl quaternary ammonium chloride |
| 23733005 | Haemoglobin I-Toulouse |
| 23734004 | D-Ornithine 4,5-aminomutase |
| 23736002 | Na^+^/K^+^-transporting ATPase |
| 23760003 | Blood group antibody Wb |
| 23774005 | HLA-Dw9 antigen |
| 23775006 | Blood group antibody Tar |
| 23783000 | Harmaline |
| 23788009 | ^97^Ruthenium |
| 23814005 | Guanethidine monosulphate |
| 23816007 | Tetrahydrocortisol |
| 23832005 | Lavender oil |
| 23841000 | Acid phosphatase isoenzyme, tartrate-sensitive fraction |
| 23845009 | Phenylalanine acetyltransferase |
| 23847001 | UDPglucose dehydrogenase |
| 23861006 | Phenolsulphonphthalein |
| 23862004 | Fibrinogen Bethesda III |
| 23866001 | Fluoroacetic acid |
| 23878002 | Blood group antibody Whittle |
| 23883005 | Methadone hydrochloride |
| 23893003 | Blood group antigen La Fave |
| 23904000 | Xanthopterin |
| 23921009 | Zirconium silicate |
| 23923007 | 3-Hydroxy-2-methylpyridinecarboxylate dioxygenase |
| 23929006 | Haemoglobin Tacoma |
| 23942006 | Haemoglobin Titusville |
| 23956008 | 2,2-Dialkylglycine decarboxylase (pyruvate) |
| 23959001 | Thyroglobulin |
| 23964002 | Pumiliotoxin A |
| 23969007 | Tryparsamide |
| 23974004 | Haemoglobin J-Abidjan |
| 23989008 | Indanol dehydrogenase |
| 24002009 | Blood group antigen Kn^b^ |
| 24004005 | Haemoglobin St. Mande |
| 24008008 | Blood group antibody Laine |
| 24012002 | Sugar-phosphatase |
| 24022008 | Bupivacaine hydrochloride |
| 24023003 | Properdin native |
| 24032001 | Arginine aminopeptidase |
| 24037007 | Dihydrocoumarin hydrolase |
| 24041006 | Immunoglobulin, GM>1< allotype |
| 24049008 | Uronate dehydrogenase |
| 24070002 | Phosphorylcholine |
| 24099007 | Oxygen |
| 24102007 | Chlorothalonil |
| 24143007 | Platelet antibody HPA-2a |
| 24156000 | Organic boron compound |
| 24161003 | ^171^Hafnium |
| 24167004 | Fast green FCF stain |
| 24185006 | Histidine ammonia-lyase |
| 24186007 | Abnormal pigment |
| 24189000 | ^189^Platinum |
| 24202000 | Ranitidine hydrochloride |
| 24207006 | Blood group antigen Tri W |
| 24213002 | Lead carbonate |
| 24215009 | Picric acid |
| 24237002 | Prostaglandin PGF1 |
| 24243000 | Mercurous iodide |
| 24248009 | Complete antibody |
| 24254005 | Cerolipoid |
| 24261009 | Trimethobenzamide hydrochloride |
| 24276001 | ^132^Tellurium |
| 24282003 | Hydroxymethylpyrimidine kinase |
| 24301009 | ^198^Gold |
| 24304001 | Blood group antibody K11 |
| 24307008 | Retinyl-palmitate esterase |
| 24331003 | ^181^Hafnium |
| 24336008 | Aminophylline anhydrous |
| 24352006 | Chondroitin ABC lyase |
| 24357000 | Colony-stimulating factor, macrophage |
| 24371008 | Mercuric arsenate |
| 24375004 | Haemoglobin Ottawa |
| 24391001 | Platelet antigen HPA-4a |
| 24404002 | Blood group antigen A,B |
| 24411003 | Sodium metaborate |
| 24427005 | Metadrenaline |
| 24434007 | Sodium tartrate |
| 24435008 | Fibrinogen Versailles |
| 24479006 | Blood group antibody Kollogo |
| 24487007 | High incidence antigen |
| 24492009 | Immunoglobulin, GM>7< allotype |
| 24503006 | Blood group antibody Vr |
| 24511001 | Technetium Tc^99m^ succimer |
| 24515005 | Spice |
| 24516006 | Meldola blue stain |
| 24517002 | Rhamnulose-1-phosphate aldolase |
| 24521009 | Plastic monomer |
| 24537003 | Laccase |
| 24539000 | ^115m^Indium |
| 24540003 | Blood group antibody En^a^KT |
| 24544007 | L-erythro-3,5-Diaminohexanoate dehydrogenase |
| 24545008 | 2-Hydroxyglutarate synthase |
| 24556008 | N-butyl glycidyl ether |
| 24570008 | Cathartic |
| 24574004 | Blood group antigen Fy^b^ |
| 24583009 | Terbutaline sulfate |
| 24589008 | Rhodium radioisotope |
| 24605005 | Mica |
| 24615004 | Tryptophan aminotransferase |
| 24634004 | Histone acetyltransferase |
| 24648004 | Metabolite AND/OR marker of neoplasm |
| 24650007 | Dihydro-alpha-ergocryptine |
| 24655002 | Lymphocyte antigen CD4 |
| 24660003 | Adenosylmethionine cyclotransferase |
| 24665008 | Cocillana |
| 24671002 | alpha,alpha-Trehalose-phosphate synthase UDP-forming |
| 24673004 | HLA-Dw11 antigen |
| 24675006 | Glial fibrillary acidic protein |
| 24686008 | Acaricide |
| 24701006 | Aliphatic saturated hydrocarbon |
| 24710003 | Blood group antibody Pr^a^ |
| 24721007 | Chlorothymol |
| 24732007 | Maleylacetate reductase |
| 24733002 | ^104^Silver |
| 24751001 | Oxymorphone |
| 24756006 | Dimetan |
| 24769005 | Hydroxypyruvate reductase |
| 24772003 | Sodium citrate and citric acid |
| 24778004 | ^101m^Rhodium |
| 24791003 | Citramalate lyase |
| 24809001 | Spectinomycin hydrochloride |
| 24821002 | Blood group antibody Tx |
| 24823004 | Pipobroman |
| 24824005 | 3-(Imidazol-5-yl)lactate dehydrogenase |
| 24837008 | Dinitro-o-cresol |
| 24838003 | Undecylenic acid and zinc undecylenate |
| 24839006 | Polynucleotide 3'-phosphatase |
| 24851008 | Deoxyribonucleic acid |
| 24853006 | ^223^Radium |
| 24857007 | Complement fixing antibody |
| 24860000 | Blood group antibody Don E. W. |
| 24862008 | Ureidosuccinase |
| 24869004 | Nifurtimox |
| 24873001 | Intramitochondrial cell metabolite |
| 24877000 | Alkyl aryl ammonium bromide |
| 24898000 | Independent low incidence blood group antibody |
| 24900003 | Procion brilliant blue MRS stain |
| 24903001 | Deoxyribonucleoside |
| 24908005 | Organic sulphonic acid |
| 24922005 | Haemoglobin Garden State |
| 24926008 | Blood group antigen LW^ab^ |
| 24938004 | Zirconium isotope |
| 24939007 | Normetadrenaline |
| 24945004 | Acetylpyruvate hydrolase |
| 24953007 | Arabinogalactan endo-1,3-beta galactosidase |
| 24972007 | ^240^Plutonium |
| 24978006 | Blood group antigen Bert |
| 24995003 | Blood group antigen Bg^c^ |
| 25001008 | Lead radioisotope |
| 25002001 | Perazine |
| 25013003 | Pyrantel pamoate |
| 25027008 | Glycoprotein hormone |
| 25059001 | Methyl oxydemeton |
| 25071007 | Vaccenic acid |
| 25077006 | Transketolase |
| 25079009 | Lissamine fast yellow stain |
| 25089008 | Enolase |
| 25090004 | Nitramine |
| 25091000 | Solochrome cyanine R stain |
| 25095009 | Blood group antigen Ol^a^ |
| 25108004 | Glutathione synthase |
| 25111003 | L-Rhamnose dehydrogenase |
| 25115007 | Haemoglobin Richmond |
| 25128000 | ^72^Zinc |
| 25130003 | Methylal |
| 25141001 | Tubocurarine chloride |
| 25153002 | Cysteine-tRNA ligase |
| 25172002 | p-Nitroaniline |
| 25175000 | UDPgalacturonate decarboxylase |
| 25176004 | Mumps skin test antigen |
| 25183006 | Manganese chloride |
| 25195006 | Endothall |
| 25204006 | Aluminium soluble salt |
| 25205007 | Fluorine radioisotope |
| 25213008 | Bicyclic antidepressant |
| 25217009 | Pituitary follicle stimulating hormone |
| 25222009 | Geranylgeranyl-diphosphate geranylgeranyltransferase |
| 25234001 | Shikimate dehydrogenase |
| 25249009 | N-Acetylneuraminate O^7^-acetyltransferase |
| 25254000 | Procainamide hydrochloride |
| 25282007 | HLA-Bw55 antigen |
| 25292004 | Haemoglobin Strumica |
| 25293009 | Fluorine perchlorate |
| 25305005 | Long-acting insulin |
| 25307002 | Petrolatum |
| 25315004 | HLA-Aw34 antigen |
| 25329003 | Haemoglobin Ty Gard |
| 25339009 | Inulinase |
| 25351006 | Fluorescein sodium |
| 25356001 | myo-Inositol 2-dehydrogenase |
| 25386008 | Alanine-glyoxylate aminotransferase |
| 25390005 | Acid phosphatase |
| 25399006 | Glycerol dehydrogenase (NADP^+^) |
| 25400004 | Blood group antibody Yt^b^ |
| 25401000 | Barbiturate analogue |
| 25403002 | ^106^Rhodium |
| 25414004 | Haemoglobin Handa |
| 25426009 | Blood group antigen Bridgewater |
| 25438000 | Haemoglobin Seattle |
| 25453008 | Antibody to antigen in Kidd blood group system |
| 25454002 | D-Pinitol dehydrogenase |
| 25486007 | Sodium thiosalicylate |
| 25494000 | Glucuronic acid |
| 25500001 | ^40^Potassium |
| 25513007 | Blood group antigen Stewart |
| 25525005 | Protein C |
| 25531008 | Protoberberine |
| 25538002 | Tiotixene hydrochloride |
| 25557006 | Blood group antigen Langer |
| 25571003 | Clodantoin |
| 25574006 | 1-Aminocyclopropane-1-carboxylate deaminase |
| 25589002 | Phenylpyruvate decarboxylase |
| 25597009 | Haemoglobin Shimonoseki |
| 25607008 | D-dimer |
| 25608003 | Haemoglobin Ann Arbor |
| 25620006 | Bitter orange oil |
| 25644008 | Protein kinase |
| 25650003 | Tryptophan-tRNA ligase |
| 25670009 | Fetal fluids |
| 25701004 | Disodium 3,6-endoxohexahydrophthalate |
| 25705008 | Cadmium dust |
| 25709002 | ^170^Hafnium |
| 25710007 | ^113^Tin |
| 25717005 | Myeloid-macrophage antibody |
| 25719008 | MCPA amine |
| 25722005 | War gas |
| 25743006 | Skim milk |
| 25745004 | Dehydrogluconate dehydrogenase |
| 25747007 | ^135m^Xenon |
| 25752002 | ^78^Germanium |
| 25761002 | Glutamine |
| 25770004 | Octyl alcohol |
| 25773002 | Blood group antigen Elder |
| 25780000 | Soap |
| 25793005 | Poly(A)-specific ribonuclease |
| 25796002 | Aluminium aspirin |
| 25818006 | Precipitated sulphur |
| 25826003 | Platelet antibody HPA-5a |
| 25833003 | Blood group antigen Lu^a^ |
| 25838007 | 2,3-Dihydro-2,3-dihydroxybenzoate dehydrogenase |
| 25843000 | Leaded petrol |
| 25867008 | Blood group antigen Haven |
| 25886000 | Fibrinogen Bergamo III |
| 25911004 | Prostaglandin PGH2 |
| 25926002 | 3-Oxolaurate decarboxylase |
| 25931000 | Nitrosamine |
| 25941002 | Orange II stain |
| 25946007 | Dichlorophenyl methyl butyl urea |
| 25958007 | Cobalt compound |
| 25964000 | Blood group antigen Wk^a^ |
| 25977009 | Bulan |
| 25978004 | 3',5'-Cyclic-GMP phosphodiesterase |
| 25981009 | Barrier grease |
| 25992005 | Propyl acetate |
| 26005009 | Blood group antigen Tajama |
| 26012000 | Cholecystokinin receptor |
| 26021004 | Blood group antibody Sd^a^ |
| 26024007 | Pituitary hormone receptor |
| 26066008 | Blood group antigen U |
| 26069001 | Homoserine succinyltransferase |
| 26070000 | Halogenated hydrocarbon-organic sulphur insecticide |
| 26091008 | Aspartate aminotransferase |
| 26093006 | Platelet antigen HPA-4b |
| 26095004 | Gallium radioisotope |
| 26101003 | Glucan endo-1,3-beta-glucosidase |
| 26104006 | Maleic acid |
| 26109001 | Piperazine citrate |
| 26120001 | Desipramine hydrochloride |
| 26131009 | Lead tetramethyl |
| 26134001 | L-Lysine 6-aminotransferase |
| 26148001 | Aryl-alcohol dehydrogenase (NADP^+^) |
| 26159005 | Clostridium tetani toxin |
| 26160000 | Isomerase |
| 26161001 | dATP(dGTP)-DNA purinetransferase |
| 26181000 | CDPdiacylglycerol-inositol 3-phosphatidyltransferase |
| 26191006 | Bromazine hydrochloride |
| 26192004 | Haemoglobin Maputo |
| 26194003 | Tungsten |
| 26227005 | Mineral dust |
| 26233001 | Thioredoxin reductase (NADPH) |
| 26238005 | Nitrite reductase (NAD(P)H) |
| 26240000 | Oil of chamomile, Roman |
| 26258006 | Sarcosine dehydrogenase |
| 26261007 | DNA (cytosine-5)-methyltransferase |
| 26266002 | Arginine deiminase |
| 26271009 | Glucosaminylgalactosylglucosylceramide beta-galactosyltransferase |
| 26274001 | Hydroxyeicosatetraenoic acid |
| 26277008 | Dynorphin |
| 26282001 | ^231^Thorium |
| 26288002 | Mitotane |
| 26304004 | Alliin lyase |
| 26312007 | Phosphatidylcholine |
| 26327007 | Red phosphorus |
| 26346008 | Ethambutol hydrochloride |
| 26351002 | Prostaglandin |
| 26353004 | Boron radioisotope |
| 26355006 | Blood group antibody Cameron |
| 26371006 | Chlorophacinone |
| 26379008 | Quinisocaine |
| 26387009 | Threonine synthase |
| 26405004 | Haemoglobin Brisbane |
| 26414009 | Haemoglobin Knossos |
| 26426004 | Ciguatoxin |
| 26430001 | Taurocyamine kinase |
| 26434005 | Indium radioisotope |
| 26437003 | Oil of mustard |
| 26441004 | Blood group antigen Bg^a^ |
| 26469007 | Prepro-opiomelanocortin |
| 26470008 | Haemoglobin Gun Hill |
| 26473005 | Sucrose-phosphatase |
| 26490004 | Glucose-6-phosphate 1-epimerase |
| 26497001 | Viral genome |
| 26518005 | Coagulation factor XIa |
| 26521007 | Glycolipid 3-alpha-mannosyltransferase |
| 26524004 | Catechol oxidase (dimerising) |
| 26539003 | N-Acetyllactosaminide alpha-1,3-galactosyltransferase |
| 26557002 | Pentachloroethane |
| 26567007 | Haemoglobin Port de France |
| 26569005 | Gonadotropin receptor |
| 26575001 | Myrcia oil |
| 26591003 | Kininogen |
| 26598009 | 8-Amino-7-oxononanoate synthase |
| 26645004 | Homocystine |
| 26647007 | Blood group antibody Coates |
| 26651009 | Blood group antigen Rd |
| 26656004 | Aromatic castor oil |
| 26663004 | Cigar smoking tobacco |
| 26674008 | Heptachlorocyclopentadiene |
| 26709006 | Immunoglobulin monomer |
| 26712009 | Mannan 1,2-(1,3)-alpha-mannosidase |
| 26720006 | Blood group antibody McC^c^ |
| 26721005 | Cellular proto-oncogene MYC |
| 26740004 | Eosinophilic derived inhibitor |
| 26749003 | Blood group antibody Kaj |
| 26753001 | Aryl-alcohol dehydrogenase |
| 26756009 | ^87^Zirconium |
| 26766001 | Starch glycerite |
| 26775004 | Dioxin |
| 26798007 | Haemoglobin P-Nilotic |
| 26817007 | Methylated naphthalene |
| 26821000 | Apolipoprotein B |
| 26822007 | 2-Naphthylamine |
| 26841005 | DDT-dehydrochlorinase |
| 26855002 | Blood group antigen K14 |
| 26856001 | Small intestine contents |
| 26858000 | Spermine |
| 26859008 | Cervical mucus |
| 26898003 | Immunoglobulin IgA1 |
| 26926006 | Alkyl toluyl methyl trimethyl ammonium chloride |
| 26930009 | Quercetin 2,3-dioxygenase |
| 26937007 | Blood group antigen Hil |
| 26945002 | Phendimetrazine tartrate |
| 26952000 | Formyl-CoA hydrolase |
| 26956002 | Glutamate-1-semialdehyde 2,1-aminomutase |
| 26959009 | Phosphoribosylformylglycinamidine cyclo-ligase |
| 26961000 | Benzyl chloride |
| 26967001 | Sulfate salt |
| 26979001 | Phenylalanine racemase (ATP-hydrolysing) |
| 26992003 | Chlorisondamine |
| 27013004 | Haemoglobin McKees Rocks |
| 27014005 | Diacylglycerol acyltransferase |
| 27016007 | Alizarin yellow GG stain |
| 27024002 | Blood group antigen By |
| 27044008 | Blood group antibody Becker |
| 27045009 | UDP-N-acetylglucosamine 4-epimerase |
| 27047001 | Blood group antigen Schwend |
| 27048006 | Blood group antigen Can |
| 27054007 | ^57^Cobalt |
| 27076003 | Blood group antibody Rich |
| 27079005 | Meclocycline sulphosalicylate |
| 27081007 | ^127^Xenon |
| 27082000 | Sulphapyridine |
| 27089009 | Blood group antibody Ce |
| 27109008 | ^126^Barium |
| 27119002 | Trimellitic anhydride |
| 27120008 | Malachite green stain |
| 27122000 | ^56^Nickel |
| 27127006 | Thymidylate 5'-phosphatase |
| 27130004 | Lymphocyte antigen CD11b |
| 27138006 | Saccharin |
| 27177009 | Steam |
| 27184001 | 17-Hydroxypregnenolone |
| 27188003 | Cephalosporin-C deacetylase |
| 27192005 | Aminosalicylic acid |
| 27200003 | Haemoglobin Doha |
| 27205008 | Blood group antigen IAB |
| 27244000 | Lithium isotope |
| 27247007 | Dioxane |
| 27248002 | Coagulation factor X R.E.D. variant |
| 27273002 | Complement component C1s |
| 27316004 | ^49^Vanadium |
| 27319006 | Haemoglobin Pierre-Benite |
| 27332001 | NMN nucleosidase |
| 27340007 | Blood group antigen HLA-A10 |
| 27341006 | Pokeweed mitogen |
| 27345002 | Haemin |
| 27347005 | Lymphocyte antigen CD4 receptor |
| 27349008 | ^135m^Barium |
| 27361000 | Barium salt |
| 27363002 | 2-Dehydro-3-deoxy-D-gluconate 6-dehydrogenase |
| 27370002 | Sulphinoalanine decarboxylase |
| 27378009 | Tyrosine |
| 27380003 | Nucleic acid |
| 27384007 | Blood group antigen LKE |
| 27390006 | Hydrogen sulphide |
| 27412001 | D-Glutamate cyclase |
| 27417007 | Blood group antigen Geslin |
| 27425009 | Platelet antigen HPA-2a |
| 27430008 | Chlorobenzene |
| 27432000 | Guanosine phosphorylase |
| 27440006 | Convalescent phase reactant |
| 27453009 | Blood group antigen John Smith |
| 27459008 | Blood group antigen Co^b^ |
| 27470001 | Butoxypolypropylene glycol |
| 27487004 | Blood group antigen Talbert |
| 27488009 | 1-Phosphatidylinositol kinase |
| 27489001 | Blood group antigen Don |
| 27499006 | Oxyphencyclimine |
| 27512003 | Haemoglobin J-Paris-I |
| 27562008 | Superoxide dismutase |
| 27565005 | D-Xylose dehydrogenase (NADP^+^) |
| 27569004 | Haemoglobin Hirosaki |
| 27586005 | Undecoylium chloride iodine |
| 27594003 | Ferric pyrophosphate |
| 27595002 | Haemoglobin Heathrow |
| 27602003 | Dichloromonofluoromethane |
| 27607009 | Blood group antigen Ts |
| 27610002 | NADPH dehydrogenase |
| 27626001 | Blood group antibody S |
| 27631004 | Oligonucleotidase |
| 27647002 | L-Lysine-lactamase |
| 27656005 | Gitalin amorphous |
| 27671009 | Rhodamine B stain |
| 27674001 | Fungal structural gene |
| 27675000 | Haemoglobin Chesapeake |
| 27730007 | Merodicein |
| 27736001 | Bacitracin A |
| 27747008 | NAD(P)^+^ transhydrogenase |
| 27758004 | delta^24^-Sterol methyltransferase |
| 27763000 | Hydrochloric acid |
| 27766008 | Prothipendyl |
| 27800009 | Blood group antibody BLe^d^ |
| 27822002 | Phenylpropylmethylamine |
| 27831002 | Snake venom |
| 27840003 | Methaemoglobin |
| 27844007 | Benzo fast scarlet stain |
| 27847000 | Ceroid |
| 27850002 | Calycanthine |
| 27862003 | Blocking antibody |
| 27888000 | Ribonucleic acid |
| 27894008 | Amino sugar |
| 27897001 | Jejunal juice |
| 27899003 | Blood group antibody Ol^a^ |
| 27914008 | Haemoglobin Hasharon |
| 27928002 | Flurazepam hydrochloride |
| 27931001 | Dipeptidyl peptidase I |
| 27961009 | Homoaconitate hydratase |
| 27963007 | Blood group antibody Toms |
| 27980006 | Ferri-haemoglobin |
| 27989007 | Coagulation factor II Segovia variant |
| 27995008 | Haemoglobin Dhofar |
| 27999002 | Blood group antigen Hands |
| 28015009 | D-Glutamate (D-aspartate) oxidase |
| 28021008 | Ethyl acrylate |
| 28025004 | L-Rhamnose isomerase |
| 28027007 | Uranium radioisotope |
| 28029005 | Metescufylline |
| 28069006 | Refrigerant anaesthetic |
| 28095008 | Haemoglobin Complutense |
| 28112009 | Meconium stool |
| 28113004 | Actinolite |
| 28117003 | Carvone |
| 28118008 | tRNA-queuosine beta-mannosyltransferase |
| 28121005 | Iofendylate |
| 28142007 | (S,S)-Butanediol dehydrogenase |
| 28145009 | Blood group antibody Cr3 |
| 28162004 | Vinyl bromide |
| 28176003 | Dipeptidyl peptidase III |
| 28203004 | 3-Oxoacyl-[acyl-carrier-protein] reductase |
| 28223003 | Cycloguanil |
| 28227002 | Halogen |
| 28230009 | Poultry |
| 28243009 | ^226^Radium |
| 28251007 | Phosphatidylcholine desaturase |
| 28252000 | Glycine N-choloyltransferase |
| 28262007 | Blood group antibody Robert |
| 28268006 | Pregnanediol |
| 28298004 | Pan-leucocyte antibody |
| 28344001 | Mephenytoin |
| 28356000 | Sulphite dehydrogenase |
| 28361003 | Blood group antibody Mathison |
| 28406009 | Immunoglobulin IgG1 |
| 28408005 | Blood group antigen LW^b^ |
| 28421003 | Sorbic acid |
| 28424006 | Lymphocyte antigen CD62 |
| 28427004 | HLA-DQw9 antigen |
| 28430006 | Methylsterol monooxygenase |
| 28444000 | Haemoglobin J-Iran |
| 28451009 | 4-Hydroxymandelate oxidase |
| 28464005 | Dioxyline |
| 28469000 | Intracisternal material, periodic |
| 28495003 | Blood group antibody El |
| 28511008 | Biotin-[methylcrotonoyl-CoA-carboxylase] ligase |
| 28521000 | Coagulation factor II Denver variant |
| 28525009 | ^193m^Iridium |
| 28530008 | Tilactase |
| 28538001 | Haemoglobin Dagestan |
| 28539009 | Auxin |
| 28546000 | Aminopeptidase A |
| 28549007 | Phosphoketolase |
| 28564007 | Blood group antibody Reiter |
| 28577003 | Blood group antibody Chr^a^ |
| 28580002 | Diprenorphine |
| 28585007 | Platelet-specific antigen |
| 28588009 | Cefaloridine |
| 28589001 | cis-1,2-Dihydro-1,2-dihydroxynaphthalene dehydrogenase |
| 28598003 | Fructose-bisphosphate aldolase |
| 28622002 | Alizarin yellow R stain |
| 28632009 | Focally mineralised extracellular matrix |
| 28647000 | Meat |
| 28648005 | Oncogene protein TAL 1 |
| 28649002 | Secondary-alcohol oxidase |
| 28662003 | Hydralazine hydrochloride |
| 28666000 | Bentazon |
| 28673005 | Antiribosomal antibody |
| 28675003 | UDP-N-acetylglucosamine 1-carboxyvinyltransferase |
| 28679009 | Lymphocyte antigen CD28 |
| 28702005 | Ambutonium |
| 28708009 | Blood group antigen Bovet |
| 28716000 | Lymphocyte antigen CDw65 |
| 28721002 | ^99^Rhodium |
| 28731009 | Blood group antibody Morrison |
| 28747006 | Kinetins |
| 28752001 | Pectate lyase |
| 28767002 | Oligogalacturonide lyase |
| 28779002 | Blood group antibody Savior |
| 28785009 | Arginyltransferase |
| 28787001 | Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase |
| 28793009 | Right bronchial mucus |
| 28808000 | Blood group antigen Stevenson |
| 28819002 | Blood group antibody K12 |
| 28823005 | Terpineol |
| 28824004 | ^214^Lead |
| 28825003 | Sterigmatocystin |
| 28829009 | Coal tar naphtha |
| 28832007 | Phenylalanine-tRNA ligase |
| 28848008 | Haemoglobin O-Arab |
| 28881009 | Blood group antibody B 9208 |
| 28917004 | Hydroxy-mercurichlorophenol |
| 28927005 | Diphenylheptane derivative |
| 28935008 | Transfer RNA |
| 28942008 | Coconut oil |
| 28954008 | Guanylate cyclase |
| 28957001 | Polypeptide N-acetylgalactosaminyltransferase |
| 28963005 | Abnormal haemoglobin, deleted residue |
| 28973007 | Methyl phenol |
| 28983006 | 6-Ketoprostaglandin PGF>1< |
| 28999000 | Fusarin |
| 29004007 | Huratoxin |
| 29011006 | Manganese trioxide |
| 29043006 | Cadmium isotope |
| 29053007 | Chlorodiethylacetamide |
| 29091007 | Haemoglobin F-La Grande |
| 29102009 | Methyl chlorophenoxyacetic acid |
| 29107003 | Platinum radioisotope |
| 29109000 | Formamide |
| 29128007 | Karathane |
| 29135004 | Flax fibre |
| 29154004 | 3-(p-Chlorophenyl)-1, 1-dimethyl urea |
| 29157006 | Thiazosulfone |
| 29170002 | Antimony isotope |
| 29181004 | Haloacetate dehalogenase |
| 29183001 | Fluorine compound |
| 29184007 | Diphemanil methylsulfate |
| 29190006 | Fentanyl citrate |
| 29204001 | Alkyl trimethyl ammonium bromide |
| 29218008 | Indium^111^ pentetate |
| 29229007 | Haemoglobin Rothschild |
| 29234006 | Arylamine sulphotransferase |
| 29244008 | Blood group antibody Lu4 |
| 29246005 | Immunoglobulin G |
| 29247001 | D-Aspartate oxidase |
| 29252006 | Acridine orange stain |
| 29253001 | Nicotinamide phosphoribosyltransferase |
| 29262004 | UTP-hexose-1-phosphate uridylyltransferase |
| 29263009 | Coffee |
| 29266001 | Blood group antigen Sadler |
| 29275004 | Blood group antibody Tollefsen-Oyen |
| 29276003 | Chlorine |
| 29279005 | Glycerophosphocholine phosphodiesterase |
| 29282000 | 17alpha-Hydroxyprogesterone aldolase |
| 29285003 | Agarase |
| 29301006 | Isoprenaline hydrochloride |
| 29308000 | tert-Pentyl alcohol |
| 29327006 | Chloramphenicol palmitate |
| 29332007 | Acylmuramoyl-alanine carboxypeptidase |
| 29336005 | Hippuric acid |
| 29342009 | Kenacid blue R stain |
| 29348008 | Pentetate calcium trisodium Yb^169^ |
| 29349000 | Hydroxy-mercurinitrophenol |
| 29360009 | Varnish |
| 29363006 | Diethanolamine |
| 29377009 | 3-Hydroxyisobutyryl CoA hydrolase |
| 29382002 | ^5^Helium |
| 29393000 | Extracellular secretion material following exocytosis, interstitial, endocrine |
| 29398009 | Oncogene protein TCRB |
| 29403005 | Aryl sulphotransferase |
| 29406002 | alpha-Amylase preparation |
| 29412007 | Dihydrobunolol dehydrogenase |
| 29414008 | 1D-1-Guanidino-3-amino-1,3-dideoxy-scyllo-inositol aminotransferase |
| 29436006 | Haemoglobin A>2< Indonesia |
| 29455006 | Algicide |
| 29460005 | Copper^67^ caeruloplasmin |
| 29461009 | Crotin |
| 29467008 | Tannase |
| 29468003 | Blood group antigen ELO |
| 29496009 | Polyolefin |
| 29497000 | alpha-N-Acetylglucosaminidase |
| 29502003 | Blood group antigen IBH |
| 29516008 | Venerupin shellfish toxin |
| 29520007 | Protoanemonin |
| 29522004 | Toluidine blue stain |
| 29527005 | Benztropine mesylate |
| 29531004 | Nickel radioisotope |
| 29552007 | Hydroxymethylglutaryl-CoA reductase (NADPH) |
| 29554008 | Glycine amidinotransferase |
| 29573007 | Blood group antigen Wade |
| 29579006 | Choline kinase |
| 29584000 | Diagnostic antigen |
| 29588002 | Brompheniramine maleate |
| 29607004 | tRNA-uridine aminocarboxypropyltransferase |
| 29614002 | Glyceryl-p-aminobenzoate |
| 29622009 | Octyl salicylate |
| 29649009 | Rhodium compound |
| 29652001 | Blood group antibody Noble |
| 29661001 | Immunoglobulin A secretory (substance) |
| 29666006 | Nortriptyline hydrochloride |
| 29671004 | Lithium bromide |
| 29676009 | 16-alpha-Hydroxysteroid dehydrogenase |
| 29677000 | Haemoglobin Pyrgos |
| 29678005 | ^136^Caesium |
| 29698000 | Photinus-luciferin 4-monooxygenase (ATP-hydrolysing) |
| 29705004 | Dimethylaminobenzene |
| 29706003 | ^102m^Rhodium |
| 29719004 | Blood group antibody Dav |
| 29725000 | Heparin calcium |
| 29735006 | Lymphocyte antigen CD33 |
| 29750002 | Bacterial exotoxin |
| 29754006 | ADPribose pyrophosphatase |
| 29763008 | Deoxy guanosine diphosphate |
| 29765001 | Fumagillin |
| 29776002 | Complement component C7 |
| 29783009 | Chromocarb |
| 29784003 | Hexachloroethane |
| 29791000 | ^196^Gold |
| 29794008 | Diisobutyl ketone |
| 29797001 | Pyroglobulin |
| 29805009 | Potassium perchlorate |
| 29817006 | Indican |
| 29831006 | Blood group antigen Taylor |
| 29842002 | Nicotine dehydrogenase |
| 29876006 | ^129m^Xenon |
| 29890009 | Blue-green algae product |
| 29900000 | Pantoate dehydrogenase |
| 29910009 | GTP cyclohydrolase II |
| 29917007 | Phosphorous acid |
| 29919005 | ^100^Palladium |
| 29925009 | Antimony radioisotope |
| 29945001 | Liquid oxygen |
| 29953009 | Haemoglobin Bourmeds |
| 29973004 | ^235^Plutonium |
| 29974005 | (R,R)-Butanediol dehydrogenase |
| 29985007 | Immunoglobulin, L chain, lambda |
| 29986008 | Immunoglobulin A>1< proteinase |
| 29988009 | Blood group antibody McC^f^ |
| 29991009 | Methyl malonyl-CoA epimerase |
| 29992002 | Cob(II)alamin reductase |
| 29998003 | ^31^Silicon |
| 30022007 | Citrulline |
| 30030008 | Interleukin-9 |
| 30034004 | Dimethoxanate |
| 30040006 | Chloro-o-phenyl phenol |
| 30053009 | Brefeldin |
| 30056001 | Aromatic-amino-acid-glyoxylate aminotransferase |
| 30065008 | Adenosine deaminase |
| 30094001 | Riboflavin dinucleotide |
| 30095000 | Cassaidine |
| 30096004 | Ricin |
| 30103001 | Butylamine |
| 30109002 | Phosphogluconate dehydrogenase |
| 30137009 | Blood group antigen CE |
| 30145004 | Activin hormone |
| 30158003 | Deoxyribose-phosphate aldolase |
| 30159006 | Haemeprotein |
| 30178006 | Vitamin D |
| 30179003 | Carbonyl fluoride |
| 30192000 | Oncogene protein V-FMS |
| 30203009 | Paromomycin sulphate |
| 30205002 | Thymic T lymphocyte factor |
| 30209008 | Blood group antibody Gladding |
| 30236005 | Tilorone |
| 30245006 | Blood group antibody Kelly |
| 30286004 | Acylglycerol palmitoyltransferase |
| 30302001 | Hydroxylamine sulphate |
| 30324001 | ^132^Iodine |
| 30325000 | Chlorfenvinphos |
| 30326004 | A-type natriuretic peptide |
| 30329006 | Triflupromazine |
| 30333004 | Mercaptomerin sodium |
| 30357004 | Blood group antibody Santano |
| 30363008 | Aldehyde dehydrogenase [NADP+] |
| 30364002 | Non-mineralised extracellular matrix |
| 30375003 | Clinically relevant isoenzyme |
| 30395009 | UDP-N-acetylglucosamine dehydrogenase |
| 30403007 | Glycine acyltransferase |
| 30411002 | 6-Phosphogluconolactonase |
| 30413004 | Blood group antigen Cad |
| 30424002 | Proxymetacaine hydrochloride |
| 30443002 | H^+^/K^+^-transporting ATPase |
| 30485003 | Methylamine glutamate methyltransferase |
| 30487006 | Formaldehyde dehydrogenase |
| 30498007 | Blood group antigen Emm |
| 30499004 | ^83m^Krypton |
| 30511000 | Gold salt |
| 30525004 | Leucyltransferase |
| 30531001 | Calcium oxalate |
| 30540002 | Blood group antibody Simpson |
| 30551002 | Thioglycolate salt |
| 30559000 | Glycerol 2-dehydrogenase (NADP^+^) |
| 30563007 | Haemoglobin Lepore-Hollandia |
| 30589007 | Dibutyl phosphate |
| 30594007 | Lymphocyte antigen CD5 |
| 30603002 | Tyrosine 3-monooxygenase |
| 30604008 | Platelet antigen HPA-2b |
| 30607001 | Blood group antigen Lu3 |
| 30609003 | Blood group antibody Terrano |
| 30616002 | Malonate CoA-transferase |
| 30621004 | Autoantibody |
| 30656000 | Glyoxylate oxidase |
| 30658004 | Turacoporphyrin |
| 30676006 | Metharbital |
| 30690009 | Porphobilinogen deaminase |
| 30702003 | Blood group antibody D^w^ |
| 30703008 | Metaphosphoric acid |
| 30708004 | alpha-Galactosidase |
| 30723009 | Blood group antigen Payer |
| 30734007 | Proline dehydrogenase |
| 30745005 | Loxapine succinate |
| 30749004 | Nitrous acid |
| 30774001 | Mitogen receptor |
| 30787007 | ^194^Iridium |
| 30792009 | Haemoglobin Prato |
| 30797003 | Blood group antigen Tc^c^ |
| 30804005 | Factor VII |
| 30805006 | Gluconate dehydratase |
| 30820000 | Phosphorus |
| 30825005 | Colloidal Indium^111^ |
| 30827002 | Azapetine |
| 30841006 | CDP-4-dehydro-6-deoxyglucose reductase |
| 30848000 | Fibrinogen Oslo III |
| 30853005 | ^97^Zirconium |
| 30861000 | Steroid 11-beta-monooxygenase |
| 30863002 | Desiccated whole bile |
| 30906008 | Transcobalamin II |
| 30907004 | Haemoglobin Tokoname |
| 30932002 | Phylloquinone monooxygenase (2,3-epoxidising) |
| 30939006 | ^137m^Barium |
| 30954000 | Blood group antigen Charles |
| 30960000 | 1,1,1,2-Tetrachloro-2,2- difluoroethane |
| 30965005 | Interleukin-6 |
| 30986005 | 2-Ethoxyethanol |
| 30987001 | Blood group antibody Rh35 |
| 30990007 | Abnormal fibrinogen |
| 31001006 | Lymphocyte antigen CD68 |
| 31008000 | Blood group antibody Talbert |
| 31011004 | 4-hydroxycoumarin |
| 31024004 | Blood group antigen Good |
| 31034008 | Isoleucine-tRNA ligase |
| 31036005 | Blood group antigen Mansfield |
| 31039003 | Cysteamine dioxygenase |
| 31042009 | Plant structural gene |
| 31046007 | Cation |
| 31052008 | Pectin lyase |
| 31055005 | Gastrointestinal hormone |
| 31086004 | Petrol |
| 31088003 | Chlorophyllase |
| 31109005 | Acylglycerone-phosphate reductase |
| 31111001 | Apoatropine |
| 31119004 | Hypoglycin A |
| 31121009 | gamma Aminoisobutyric acid |
| 31147000 | Metoclopramide hydrochloride |
| 31178001 | Bethanechol chloride |
| 31182004 | Diethylene glycol monoethyl ether |
| 31192007 | Ferrous chloride Fe^59^ |
| 31202008 | Pseudomonas serine proteinase |
| 31212001 | Calcium compound |
| 31245001 | Blood group antibody Oca |
| 31252004 | Haemoglobin Nunobiki |
| 31260003 | Methylene violet stain (Bernthsen) |
| 31278008 | 1,4-alpha-Glucan 6alpha-glucosyltransferase |
| 31299006 | Haemoglobin A |
| 31310007 | Ganglioside |
| 31317005 | Blood group antigen C^w^ |
| 31324006 | Colloidal oatmeal powder with oil |
| 31328009 | L-Threonate dehydrogenase |
| 31347007 | Glycyrrhiza |
| 31349005 | Aspergillus oryzae aspartic proteinase |
| 31357008 | Blood group antibody Sc3 |
| 31369000 | Purine nucleosidase |
| 31370004 | Dopamine-beta-monooxygenase |
| 31381001 | Vesicating gas |
| 31395003 | 3,4-Dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione 4,5-dioxygenase |
| 31400002 | HLA-Bw63 antigen |
| 31405007 | Glutamate dehydrogenase [NAD(P)+] |
| 31409001 | Valine-3-methyl-2-oxovalerate aminotransferase |
| 31414002 | Amide |
| 31422009 | Ox bile extract |
| 31433007 | Cortisol acetyltransferase |
| 31444004 | Plant product insecticide |
| 31480004 | Chlorpyrifos |
| 31503002 | Steroid 21-monooxygenase |
| 31522006 | Mild silver protein |
| 31527000 | Sodium chloride Na^24^ |
| 31528005 | Nitrite salt |
| 31538000 | CoA-glutathione reductase (NADPH) |
| 31539008 | Magnesium compound |
| 31540005 | Extracellular fibre |
| 31543007 | 6-Acetylglucose deacetylase |
| 31555001 | ^234^Plutonium |
| 31559007 | Ribonuclease P |
| 31576006 | N-Sulphoglucosamine sulphohydrolase |
| 31579004 | Oil of champaca |
| 31603005 | ^190^Iridium |
| 31617001 | Hydrophilic petrolatum |
| 31618006 | Difenamide |
| 31622001 | ^127m^Xenon |
| 31662002 | Orange flower oil |
| 31675002 | Capillary blood |
| 31706007 | Ketamine hydrochloride |
| 31707003 | Bacitracin zinc |
| 31714001 | New fuchsin stain |
| 31720000 | Diacylglycerol kinase |
| 31731008 | Magnesium phosphate |
| 31744003 | Orotate phosphoribosyltransferase |
| 31756002 | Methionine racemase |
| 31773000 | Gastric juice |
| 31775007 | Haemoglobin F-Melbourne |
| 31780003 | Preproenkephalin |
| 31787000 | Coagulation factor IX Alabama variant |
| 31790006 | Malic acid |
| 31799007 | Mephentermine sulphate |
| 31801005 | Benzonatate |
| 31811003 | Carbon dioxide |
| 31815007 | Oxybutynin hydrochloride |
| 31818009 | Deoxyribonuclease (pyrimidine dimer) |
| 31827005 | Ristocetin |
| 31849004 | Succinate-citramalate CoA-transferase |
| 31854008 | Blood group antibody Terschurr |
| 31856005 | Dimethyl-1,1-dibromo-2-2-dichloroethyl phosphate |
| 31857001 | (2-Aminoethyl) phosphonate-pyruvate aminotransferase |
| 31862000 | Galactonolactone dehydrogenase |
| 31876004 | 6-Methylsalicylate decarboxylase |
| 31880009 | ^6^Helium |
| 31895006 | Gonadotropin |
| 31896007 | Barium radioisotope |
| 31897003 | Blood group antigen Hop |
| 31936008 | Sodium isotope |
| 31947001 | Carbon isotope |
| 31953001 | Strontium nitrate Sr^87^ |
| 31960007 | Anti SS-B antibody |
| 31963009 | beta-Butoxy beta-thiocyano-diethyl ether |
| 31979005 | Fatty acid |
| 31990000 | Fibrinogen Cleveland II |
| 32027009 | Haemoglobin A>2< Flatbush |
| 32030002 | Difenidol hydrochloride |
| 32039001 | Glass |
| 32040004 | Putrescine acetyltransferase |
| 32049003 | Rhodium dust |
| 32050003 | Pine oil |
| 32059002 | ^225^Actinium |
| 32068000 | Serine-glyoxylate aminotransferase |
| 32072001 | Dalapon |
| 32073006 | HLA-Bw60 antigen |
| 32079005 | Blood group antigen Ramskin |
| 32083005 | Oxanamide |
| 32089009 | Blood group antibody VS |
| 32100007 | Haptoglobin 2-1 |
| 32103009 | Thyroid hormone receptor |
| 32120008 | Camphorated oil |
| 32131000 | Carboxymethylhydantoinase |
| 32133002 | Microarazide nitrate |
| 32138006 | Bile pigment |
| 32147003 | Blood group antigen Suhany |
| 32154009 | Inulin |
| 32157002 | Cathepsin B |
| 32165004 | N-Acetylneuraminate synthase |
| 32167007 | Blood group antibody Nickolai |
| 32180005 | Nicotinic receptor |
| 32197004 | Clobetasol propionate |
| 32216001 | Acylamino-acid-releasing enzyme |
| 32228009 | Butadiene |
| 32233008 | Blood group antibody Kasamatsuo |
| 32235001 | Blood group antibody A 8306 |
| 32237009 | Blood group antibody IBH |
| 32241008 | Blood group antigen Wr^b^ |
| 32245004 | Cystathionine gamma-lyase |
| 32261002 | Blood group antibody Lu6 |
| 32269000 | Uranium compound |
| 32277001 | Soluble immune complex |
| 32281001 | Fibrinogen Oslo IV |
| 32291007 | Steryl-beta-glucosidase |
| 32302009 | Ornithine decarboxylase |
| 32305006 | Blood group antibody Rd^a^ |
| 32314001 | Blood group antibody Marriott |
| 32317008 | Haemoglobin J-Bangkok |
| 32324009 | Blood group antibody BR 726750 |
| 32329004 | Blood group antigen I^F^ |
| 32335004 | Sodium fluoroacetamide |
| 32338002 | Systemic poison chemical warfare agent |
| 32340007 | Piperonyl butoxide |
| 32351007 | Thymus-dependent antigen |
| 32364008 | Blood group antigen Tm |
| 32370002 | Diprophylline |
| 32378009 | ^147^Gadolinium |
| 32396000 | Blood group antibody Lu5 |
| 32403003 | Blood group antibody Pr>a< |
| 32431007 | ^193m^Platinum |
| 32436002 | Phentolamine mesylate |
| 32437006 | Triphenyl phosphate |
| 32445001 | Calcium glubionate |
| 32457005 | Body fluid |
| 32459008 | Haemoglobin Nigeria |
| 32467000 | ^204m^Lead |
| 32481003 | Blood group antibody Mackin |
| 32498003 | Cortisone |
| 32500002 | Shellfish toxin |
| 32505007 | ^32^Phosphorus |
| 32519007 | Activated charcoal |
| 32533007 | Endrin |
| 32536004 | Glutamate-ammonia-ligase adenylyltransferase |
| 32601005 | alpha-Chloroacetophenone |
| 32609007 | Antibody to hepatitis A virus |
| 32616008 | Blood group antibody Zim |
| 32627005 | Eburnetoxin |
| 32633001 | Phosphatidate phosphatase |
| 32657001 | D-Malate dehydrogenase (decarboxylating) |
| 32663005 | Allyl alcohol |
| 32668001 | Viral oncogene protein |
| 32669009 | Tryptophan dimethylallyltransferase |
| 32685004 | Lactose synthase |
| 32699000 | Blood group antigen R>2<R>2<-202 |
| 32707001 | Deoxyribonuclease I |
| 32714004 | Magnesium dust |
| 32717006 | Haemoglobin J-Lens |
| 32725008 | Glycolipid 2-alpha-mannosyltransferase |
| 32741009 | d-Xylulose |
| 32757009 | Dibenzepin |
| 32759007 | Agmatine deiminase |
| 32770000 | Deoxyuridine phosphorylase |
| 32784005 | N-Acetyl-beta-alanine deacetylase |
| 32789000 | Ferritin |
| 32800009 | Ethionamide |
| 32824001 | Ergot alkaloid |
| 32826004 | L-Aminoadipate-semialdehyde dehydrogenase |
| 32830001 | trans-Acenaphthene-1,2-diol dehydrogenase |
| 32832009 | ^110m^Silver |
| 32836007 | Sodium acetrizoate |
| 32842006 | Blood group antibody Rh42 |
| 32852005 | beta-Melanocyte stimulating hormone |
| 32860006 | Blood group antigen HLA-A9 |
| 32863008 | Methylamine |
| 32882004 | Coriander oil |
| 32898006 | Fibrinogen San Francisco |
| 32901007 | Prostaglandin PGA2 |
| 32922001 | ^227^Actinium |
| 32926003 | Iridium |
| 32932008 | Extracorporeal blood |
| 32943000 | Lymphocyte antigen CD24 |
| 32946008 | Fallopian tube secretions |
| 32948009 | Radical |
| 32954005 | Iron carbonyl |
| 32969006 | Ubiquitin |
| 32974003 | Blood group antigen Banks |
| 32990003 | Factor H |
| 33008008 | Dust |
| 33019006 | Pancreatic amylase |
| 33029004 | Blood group antibody Bowyer |
| 33034000 | Oncogene protein sis |
| 33037007 | Blood group antigen Austin |
| 33053005 | Blood group antigen Bruno |
| 33055003 | Trichlorotrifluoroethane |
| 33057006 | Macrophage antibody |
| 33063002 | Blood group antigen Lu13 |
| 33073000 | Gluconate 5-dehydrogenase |
| 33082006 | Nitroethane |
| 33119009 | Sugar-1-phosphate adenylyltransferase |
| 33137005 | Calcium radioisotope |
| 33161003 | alpha,alpha-Trehalose-phosphate synthase (GDP-forming) |
| 33166008 | Intramitochondrial lipid |
| 33174009 | ^175^Hafnium |
| 33188008 | Blood group antigen Chr^a^ |
| 33190009 | Hydroxylamine |
| 33193006 | Physarum polycephalum ribonuclease |
| 33201007 | Long-chain-fatty-acid-CoA ligase |
| 33204004 | alpha Sitosterol |
| 33206002 | Haemoglobin F-Beech Island |
| 33210004 | Blood group antibody P^k^ |
| 33218006 | Arsenic isotope |
| 33238007 | Mesangial matrix |
| 33239004 | Iridium radioisotope |
| 33263007 | Trichophyton mentagrophytes keratinase |
| 33271006 | Iodohippurate I^131^ sodium |
| 33273009 | CTP synthase |
| 33278000 | Insecticide |
| 33280006 | Medicinal zinc peroxide |
| 33291004 | trans-Octaprenyltranstransferase |
| 33307008 | Sodium meralein |
| 33309006 | HLA-DQw5 antigen |
| 33324002 | Glutamine acyltransferase |
| 33355008 | Blood group antibody Banks |
| 33362004 | Cinoxate |
| 33373006 | Cyclopentane |
| 33395005 | Monomethyl mercury |
| 33396006 | Nickel |
| 33404002 | Endo-1,3(4)-beta-glucanase |
| 33414006 | Isopropyl-n-phenylcarbamate |
| 33417004 | Citrate(pro-3S)-lyase |
| 33418009 | Haemoglobin Cocody |
| 33435008 | Capillary active drug |
| 33440000 | Ceftriaxone sodium |
| 33443003 | Polynucleotide 5'-phosphatase |
| 33447002 | Bephenium hydroxynaphthoate |
| 33463005 | Liquid substance |
| 33465003 | Acridine dye |
| 33492009 | Heparitin sulphotransferase |
| 33509005 | Blood group antibody Mur |
| 33519004 | Animal structural gene |
| 33524001 | 5-Methyldeoxycytidine-5'-phosphate kinase |
| 33535006 | Renal hormone |
| 33545008 | Procollagen glucosyltransferase |
| 33550002 | Blood group antigen Kirkpatrick |
| 33566000 | Phosphoglycerate dehydrogenase |
| 33601001 | Glycosylated haemoglobin A |
| 33604009 | Blood group antigen Burrett |
| 33619005 | Plasminogen activator |
| 33635003 | Serotonin |
| 33638001 | Isotope |
| 33642003 | Fibrinogen Sydney I |
| 33643008 | Nucleoside deoxyribosyltransferase |
| 33667000 | Mercumatilin |
| 33680002 | Blood group antigen HLA-B12 |
| 33691009 | Blood group antibody Co^b^ |
| 33695000 | Camphor 1,2-monooxygenase |
| 33709008 | Aryl-alcohol oxidase |
| 33752008 | Motilin |
| 33780005 | Dimethyl carbamate |
| 33785000 | Iodinated I^125^ liothyronine |
| 33791003 | ^199^Lead |
| 33797004 | 3-Carboxy-2-hydroxyadipate dehydrogenase |
| 33817009 | Infusorial earth |
| 33825006 | Blood group antigen Jk^b^ |
| 33837008 | Aluminium glycinate |
| 33844004 | Alginate lyase |
| 33865005 | Blood group antibody Baltzer |
| 33922005 | Vitamin L |
| 33936000 | Toad toxin |
| 33963004 | Angiotensin III |
| 33977001 | Microbial aspartic proteinases |
| 33984009 | Dihydropteroate synthase |
| 33987002 | Public blood group antibody |
| 34003008 | Phospho-2-dehydro-3-deoxyoctonate aldolase |
| 34007009 | Cholelitholytic agent |
| 34011003 | Acetoarsenite |
| 34027005 | Inorganic sulphide compound |
| 34049004 | Blood group antibody Lu9 |
| 34053002 | Diphenyl |
| 34057001 | Acetyl-CoA hydrolase |
| 34060008 | ^84^Rubidium |
| 34070005 | Fibrinogen Nagoya |
| 34074001 | Borate salt |
| 34086003 | Antithrombin III |
| 34101007 | Phycoerythrin |
| 34113002 | Acrisorcin |
| 34119003 | Delphinine |
| 34120009 | Fibrinogen Amsterdam |
| 34127007 | ^85^Krypton |
| 34128002 | Chrome azurol S stain |
| 34143000 | Immunoglobulin, GM>10< allotype |
| 34156007 | Haemoglobin Savaria |
| 34158008 | Bromine isotope |
| 34161009 | Blood group antibody Ku |
| 34174003 | ^224^Actinium |
| 34180006 | Blood group antibody Min |
| 34198005 | Folescutol |
| 34204008 | Blood group antibody Warren |
| 34208006 | Oxalate salt |
| 34211007 | ^83^Strontium |
| 34219009 | Terbufos |
| 34221004 | Haemoglobin A>2< Yokoshima |
| 34239008 | Castor oil |
| 34261003 | Potassium oxalate |
| 34274009 | Iodine pentafluoride |
| 34302005 | Uracil dehydrogenase |
| 34316000 | Blood group antibody Ge1 |
| 34323004 | Coal |
| 34329000 | Immunoglobulin, GM>14< allotype |
| 34330005 | Calcium oxide |
| 34332002 | Nitrophenol |
| 34354000 | Octachloronaphthalene |
| 34355004 | Inactivated complement enzyme |
| 34358002 | ^228^Thorium |
| 34370003 | Glucocerebroside |
| 34388006 | Blood group antibody Fuerhart |
| 34392004 | Haemoglobin F-Pordenone |
| 34400001 | Blood group antibody Teremok |
| 34410005 | Camphor 5-monooxygenase |
| 34425005 | Amolanone |
| 34428007 | Cyclopentadiene |
| 34429004 | Pericardial fluid |
| 34443009 | Haemoglobin F-Baskent |
| 34453005 | HLA-B27 antigen |
| 34465009 | HLA-DQw7 antigen |
| 34471003 | ^121^Iodine |
| 34505008 | Dental adhesive |
| 34510007 | Clonal inhibitory factor |
| 34548002 | Toxaphene |
| 34549005 | Haemoglobin Palmerston North |
| 34569000 | Blood group antibody Jn^a^ |
| 34575009 | Guanidinodeoxy-scyllo-inositol-4-phosphatase |
| 34582008 | Catecholamine |
| 34641002 | Hydrazine |
| 34654009 | Iodine solution |
| 34657002 | Isopropamide iodide |
| 34658007 | Met-enkephalin |
| 34659004 | Lysine dehydrogenase |
| 34690002 | 3-Hydroxybenzyl-alcohol dehydrogenase |
| 34692005 | Haemoglobin Miyada |
| 34700000 | Fast blue B salt stain |
| 34722007 | Haemoglobin K-Woolwich |
| 34737006 | C1 esterase inhibitor |
| 34744002 | Plant asparagine |
| 34745001 | Slow reacting substance-A of anaphylaxis |
| 34750007 | Blood group antigen Panzar |
| 34754003 | Myxobacter b-lytic proteinase |
| 34757005 | Cystathionine beta-lyase |
| 34763001 | Potassium hydroxide |
| 34768005 | Cholestanetetraol 26-dehydrogenase |
| 34771002 | Haemoglobin Quin-Hai |
| 34788009 | Tartrate epimerase |
| 34792002 | Coniine |
| 34793007 | Octanol dehydrogenase |
| 34800005 | beta-Nitroacrylate reductase |
| 34820006 | Kynurenate 7,8-hydroxylase |
| 34829007 | Complement component |
| 34832005 | Blood group antibody I^s^ |
| 34848006 | Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase |
| 34856009 | UDPglucuronate 4-epimerase |
| 34862004 | Aromatic hydrocarbon |
| 34864003 | Benzoyl formate decarboxylase |
| 34865002 | Chromium compound |
| 34868000 | HLA-DQw3 antigen |
| 34888001 | Aspartate-ammonia ligase (ADP-forming) |
| 34895005 | Basic cupric sulphate |
| 34900009 | Blood group antigen B |
| 34904000 | Beryllium compound |
| 34912008 | Blood group antibody Ramskin |
| 34914009 | Serine-pyruvate aminotransferase |
| 34915005 | Pyridostigmine bromide |
| 34919004 | Potassium tartrate |
| 34940003 | Phosphoserine aminotransferase |
| 34946009 | Calcium sulphide |
| 34953000 | Colocynth |
| 34957004 | Acid |
| 34968004 | Blood group antigen Lee |
| 34970008 | Blood group antigen JAL |
| 34978001 | Perchloromethyl mercaptan |
| 34982004 | Uroporphyrinogen decarboxylase |
| 34983009 | Epicillin |
| 34999003 | tRNA (guanine-N^2^)-methyltransferase |
| 35000003 | Hurain |
| 35003001 | Maleate isomerase |
| 35012004 | Blood group antibody HLA-A9 |
| 35016001 | Argon radioisotope |
| 35027004 | Pyrophosphoric acid |
| 35040009 | Blood group antibody Rh29 |
| 35059006 | Nicotinate-nucleotide pyrophosphorylase (carboxylating) |
| 35060001 | Testicular hormone |
| 35068008 | Blood group antibody C |
| 35069000 | Neurotransmitter |
| 35072007 | HLA-B16 antigen |
| 35077001 | Nerve gas |
| 35079003 | Volatile oil |
| 35092000 | Lymphocyte antigen CD70 |
| 35094004 | Tropaeolin O stain |
| 35098001 | Imidazole |
| 35118003 | Blood group antibody Fy5 |
| 35124009 | Clupeotoxin |
| 35131008 | Histidine decarboxylase |
| 35133006 | Immunoglobulin IgG4, H chain |
| 35135004 | Aglycone |
| 35148000 | Protein-glutamine glutaminase |
| 35150008 | Glucocorticoid hormone |
| 35151007 | Ruthenium radioisotope |
| 35181004 | Maleate hydratase |
| 35190006 | Depilatory |
| 35192003 | 2,3-Diaminopropionate oxalyltransferase |
| 35196000 | Ethyl iodide |
| 35206004 | ^242m^Americium |
| 35213004 | Blood group antibody Wallin |
| 35215006 | Scarlet fever streptococcus toxin |
| 35231003 | Sphingosine acyltransferase |
| 35233000 | Polyvinyl chloride |
| 35234006 | Ethylene chlorobromide |
| 35236008 | Thenyldiamine |
| 35251004 | Chlordecone |
| 35257000 | Entsulphon |
| 35281007 | Acetophenazine |
| 35292008 | Lipoxygenase |
| 35293003 | 3-Carboxyethylcatechol 2,3-dioxygenase |
| 35296006 | S-Alkylcysteine lyase |
| 35297002 | Alkyl hydroxyethyl imidazolinium chloride |
| 35310003 | Polyclonal antibody |
| 35312006 | Gluconokinase |
| 35318005 | Esmolol hydrochloride |
| 35321007 | Fluorodeoxyglucose F^18^ |
| 35331000 | Toxic substance |
| 35337001 | ^68^Gallium |
| 35342009 | 1-Acylglycerophosphocholine acyltransferase |
| 35343004 | Cefonicid sodium |
| 35344005 | Ribulose |
| 35352008 | Fluorescent stain |
| 35353003 | Zygacine |
| 35367007 | Blood group antigen McC^e^ |
| 35406002 | Clocortolone |
| 35410004 | Blood group antibody Kp^c^ |
| 35415009 | Homocysteine desulphydrase |
| 35416005 | Sex-linked gene |
| 35422001 | Haemoglobin Bundury |
| 35431001 | Adenosine |
| 35432008 | ^87^Rubidium |
| 35457003 | Narcotic drug receptor |
| 35464001 | Trioxsalen |
| 35466004 | Relaxin |
| 35467008 | Pseudouridylate synthase |
| 35473009 | Fibrinogen St. Louis |
| 35477005 | Phenol methyltransferase |
| 35479008 | Haemoglobin Mozhaisk |
| 35488004 | Abnormal haemoglobin, alpha-chain variant |
| 35499002 | 3-Hydroxypropionate dehydrogenase |
| 35503008 | Cationic detergent |
| 35527005 | Sanguinarine |
| 35530003 | Haemoglobin J-Lome |
| 35556005 | Sessile antibody |
| 35573007 | Haemoglobin Las Palmas |
| 35584000 | Sodium bitartrate |
| 35589005 | Gadolinium isotope |
| 35605007 | Wool fat |
| 35609001 | Azophloxin stain |
| 35614002 | Blood group antigen Lu17 |
| 35617009 | Isotomin |
| 35628008 | Animal gene |
| 35645003 | Blood group antigen French |
| 35651008 | Cholest-5ene-3beta,7alpha-diol 3beta dehydrogenase |
| 35659005 | Dinitrocresol |
| 35663003 | Asphalt |
| 35668007 | Endometrial secretions |
| 35677000 | Heat stable bacterial toxin |
| 35684008 | Tetranitromethane |
| 35690007 | Hypochlorous acid |
| 35724001 | Lacmoid stain |
| 35733004 | Fat-soluble vitamin |
| 35740003 | Stable isotope |
| 35747000 | Osmium compound |
| 35748005 | Wine |
| 35760006 | Myeloid antibody |
| 35765001 | Sincalide |
| 35780007 | Isochorismatase |
| 35798006 | Elastic fibre |
| 35808006 | Ornithine cyclodeaminase |
| 35815003 | Cadmium sulphide |
| 35825008 | Cat scratch disease antigen |
| 35841009 | Macrophage inhibitory factor |
| 35864006 | Parathiazine |
| 35866008 | Acyl-CoA desaturase |
| 35867004 | Cytochrome-c>3< hydrogenase |
| 35871001 | Oleandrin |
| 35878007 | Thyroid-hormone aminotransferase |
| 35883004 | Fluorine |
| 35884005 | Iodine^131^ polyvinylpyrrolidone |
| 35891008 | Liquid cyanamide |
| 35895004 | Aspartyltransferase |
| 35903003 | Potassium bromide |
| 35906006 | Blood group antibody MPD |
| 35922007 | Blood group antibody Black |
| 35946000 | Pentolinium |
| 35952004 | Blood group antibody Block |
| 35954003 | Coagulation factor II variant |
| 35960003 | Arachidonate-CoA ligase |
| 35966009 | Ouabain |
| 35976007 | Pancreatic peptide |
| 35978008 | ^252^Californium |
| 35997008 | Metacresylacetate |
| 36005003 | Blood group antibody Tofts |
| 36012007 | Nitrogen |
| 36016005 | Blood group antibody Haase |
| 36020009 | Factor IX antibody |
| 36021008 | Cefadroxil monohydrate |
| 36022001 | Fibrinogen Freiberg |
| 36028002 | Aldehyde reductase |
| 36058008 | Oil of myrtle |
| 36062002 | Xanthurenic acid |
| 36065000 | Oxine benzoate |
| 36066004 | Coumarate reductase |
| 36085001 | Pantoate-beta-alanine ligase |
| 36093001 | Crotonic acid |
| 36095008 | Glycine aminotransferase |
| 36098005 | Malate synthase |
| 36100005 | Blood group antigen Do^b^ |
| 36130002 | dTDP-4-dehydrorhamnose 3,5-epimerase |
| 36136008 | Penitrem-A |
| 36137004 | Triacylglycerol-sterol acyltransferase |
| 36156009 | Oxynervonic acid |
| 36167005 | Fibrinogen Torino |
| 36173006 | Tetraiodothyroacetic acid |
| 36176003 | Thrombin |
| 36178002 | Chromate salt |
| 36197002 | Ecdysone 20-monooxygenase |
| 36212002 | Myxobacter-a-lytic proteinase |
| 36220000 | Chloric acid |
| 36231008 | Proteinglutamine gamma-glutamyltransferase |
| 36232001 | Mucinaminylserine mucinaminidase |
| 36235004 | Pine needle oil |
| 36238002 | Chlorobromomethane |
| 36240007 | Alkyl sodium n-methyltaurate |
| 36260004 | Blood group antibody Raison |
| 36264008 | Lupinine |
| 36270002 | Arylformamidase |
| 36301000 | ^198m^Thallium |
| 36312000 | Xylan 1,3-beta-xylosidase |
| 36322006 | Acetylindoxyl oxidase |
| 36326009 | Pteridine |
| 36343007 | beta>2B< Glycoprotein |
| 36345000 | 1-Phosphatidylinositol-4-phosphate kinase |
| 36372008 | GDP-6-deoxy-D-talose dehydrogenase |
| 36377002 | Isomaltulose synthase |
| 36378007 | Lithium compound |
| 36380001 | Oxyphencyclimine hydrochloride |
| 36381002 | Haemoglobin P-Congo |
| 36385006 | Synaptic receptor |
| 36387003 | DNA-directed DNA polymerase |
| 36393006 | Nonionic detergent |
| 36396003 | Blood group antigen Van Buggenhout |
| 36397007 | Muramic acid |
| 36403001 | Blood group antibody ELO |
| 36410007 | Lactone dye |
| 36413009 | CDPribitol ribitolphosphotransferase |
| 36418000 | Blood group antigen McC^b^ |
| 36434002 | 1-Methyl histidine |
| 36443006 | Haemoglobin E-Saskatoon |
| 36445004 | Spectrin |
| 36461002 | Oncogene protein TAL |
| 36466007 | Furocoumarin |
| 36494004 | Galactose dehydrogenase |
| 36513006 | Boron carbide |
| 36516003 | Pyrilamine maleate |
| 36541005 | Mercuric iodide |
| 36562006 | Haemolysin |
| 36567000 | Prostaglandin-H>2< E-isomerase |
| 36569002 | Isocyanide compound |
| 36572009 | Sudan black B stain |
| 36613003 | Blood group antigen Pr>1h< |
| 36632009 | Mannokinase |
| 36636007 | Thiamine-triphosphatase |
| 36641004 | Potassium chloride K^42^ |
| 36651003 | Bismuth salt |
| 36652005 | Blood group antigen H>T< |
| 36661005 | Tyrothricin |
| 36663008 | ^121^Tellurium |
| 36671007 | Nitrogen pentoxide |
| 36677006 | Phenylalanine decarboxylase |
| 36687005 | Uronolactonase |
| 36690004 | Nitrate reductase (NADPH) |
| 36694008 | Haemoglobin Bologna |
| 36704006 | 5' Acylphosphoadenosine hydrolase |
| 36707004 | Polydeoxyribonucleotide synthase (NAD^+^) |
| 36712003 | Factor XII antibody |
| 36713008 | Blood group antibody McC^d^ |
| 36726007 | Nicotinate methyltransferase |
| 36744004 | Blood group antigen E |
| 36747006 | Psychosine sulphotransferase |
| 36757007 | Blood group antigen Raison |
| 36759005 | HLA-Bw6 antigen |
| 36766006 | Succinyldiaminopimelate desuccinylase |
| 36774007 | Cadmium compound |
| 36801006 | Tagatose kinase |
| 36804003 | Blood group antigen Tasich |
| 36806001 | Bhilawanol oil |
| 36816009 | Glucose-1-phosphate |
| 36824004 | Dauricine |
| 36842009 | HLA-Dw16 antigen |
| 36848008 | Citrate dehydratase |
| 36853003 | Blood group antigen Vienna |
| 36856006 | Flavanone 3-dioxygenase |
| 36863006 | 2-Dehydro-3-deoxy-D-gluconate 5-dehydrogenase (NAD(P)^+^) |
| 36864000 | Paint |
| 36872003 | Tridihexethyl |
| 36879007 | Water soluble eosin stain |
| 36887008 | Mineralocorticoid hormone |
| 36888003 | Exodeoxyribonuclease VII |
| 36900006 | Iodohippurate I^125^ sodium |
| 36907009 | Blood group antibody Kennedy |
| 36933001 | Antibody to antigen in Rh blood group system |
| 36934007 | Alkylglycerol kinase |
| 36953002 | Fibrinogen Nancy |
| 36993004 | Fucokinase |
| 36998008 | Glycogen |
| 37000002 | ^35^Sulphur |
| 37004006 | Immunoglobulin, Fc' fragment |
| 37006008 | Cyclothiazide |
| 37010006 | Tetraphylline |
| 37013008 | Dipivefrine hydrochloride |
| 37015001 | UDP-N-acetyl muramoylalanine-D-glutamate ligase |
| 37023004 | Deoxyribodipyrimidine photo-lyase |
| 37052001 | Tellurium hexafluoride |
| 37067002 | Blood group antibody Shier |
| 37077000 | ^122^Xenon |
| 37078005 | Nitromersol |
| 37080004 | Phoabol |
| 37086005 | Oil of pennyroyal-American |
| 37094003 | Chlorotoluene |
| 37100000 | Blood group antigen Bradford |
| 37112001 | Ceramide |
| 37123002 | Copper dust and mist |
| 37148004 | Haemoglobin F-Malaysia |
| 37150007 | Streptomycin 3''-adenylyltransferase |
| 37162006 | Polypeptide receptor |
| 37177003 | Deoxyribonucleic acid, single stranded |
| 37196004 | L-Glutamate oxidase |
| 37202001 | Plant fibre |
| 37225000 | ^52^Manganese |
| 37237003 | Tocopherol |
| 37241004 | Corticosterone 18-monooxygenase |
| 37243001 | Haemoglobin A>2< Coburg |
| 37262003 | Phenyl p-aminosalicylate |
| 37264002 | Glucomannan 4-beta-mannosyltransferase |
| 37276002 | Polypeptide hormone |
| 37282004 | Blood group antibody B 7358 |
| 37287005 | HLA-A1 antigen |
| 37300006 | Blood group antibody h |
| 37315007 | n-Acetyl mannosamine |
| 37318009 | Ethylene chlorohydrin |
| 37329008 | Haemoglobin J-Taichung |
| 37334007 | Thyroxine deiodinase |
| 37346006 | Adenylosuccinate synthase |
| 37352007 | Fungus antigenic product |
| 37357001 | L-Arabinonolactonase |
| 37365003 | Fibrinogen Rouen |
| 37375000 | L-Arabinitol dehydrogenase (ribulose-forming) |
| 37379006 | ^191m^Osmium |
| 37411004 | Tissue plasminogen activator |
| 37433002 | Polycarbophil |
| 37437001 | Iodinated I^125^ sealed source |
| 37451001 | Opium tincture |
| 37462001 | Oncogene protein c-fes |
| 37484001 | Dopamine receptor |
| 37489006 | Fructokinase |
| 37513004 | Haemoglobin Lepore-Baltimore |
| 37526000 | Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6N-acetylglucosaminyltransferase |
| 37527009 | Sufentanil citrate |
| 37536008 | Dehydrobufotenine |
| 37566001 | Dinitrochlorobenzene |
| 37569008 | Galactose-6-sulphurylase |
| 37575004 | Carmoisine A stain |
| 37583005 | Blood group antigen Buckalew |
| 37588001 | Immunoglobulin polymer |
| 37595005 | Suspension |
| 37620000 | Lipopolysaccharide glucosyltransferase I |
| 37624009 | Cyclomaltodextrin glucanotransferase |
| 37648000 | Clindamycin phosphate |
| 37654004 | Blood group antigen K19 |
| 37656002 | Thiamazole |
| 37662007 | 5,10-Methylenetetrahydrofolate reductase (FADH>2<) |
| 37663002 | Venom |
| 37681004 | S-Formylglutathione hydrolase |
| 37683001 | Tanghin extract |
| 37691005 | Hetacillin |
| 37704004 | Perichromatin granule |
| 37713002 | Blood group antigen Dautriche |
| 37716005 | White ointment |
| 37751002 | Beta 2 blocking agent |
| 37756007 | Gastric inhibitory polypeptide |
| 37758008 | Drug-induced coagulation inhibitor |
| 37765000 | Diethylpropion hydrochloride |
| 37784002 | Striatoxin |
| 37838004 | Haemoglobin F-Minoo |
| 37841008 | Menstrual fluid |
| 37850005 | 2-Acetolactate mutase |
| 37852002 | Indirect reacting bilirubin |
| 37861002 | Blood group antigen Js^b^ |
| 37863004 | Pyruvate,orthophosphate dikinase |
| 37881001 | Dolichyl-diphosphooligosaccharide-protein glycotransferase |
| 37889004 | Gonadoliberin receptor |
| 37892000 | Exodeoxyribonuclease (Phage SP>3<-induced) |
| 37902007 | Blood group antigen A.M. |
| 37905009 | Copper 3-phenyl salicylate |
| 37912000 | Heterotricyclic dye |
| 37915003 | Protein-tyrosine-phosphatase |
| 37927000 | Cystine |
| 37930007 | Neon isotope |
| 37932004 | LDL receptor |
| 37938000 | Carbonic acid |
| 37947008 | Colloidal gold Au^198^ |
| 37950006 | sn-Glycerol-3-phosphate 1-galactosyltransferase |
| 37951005 | Fibrinogen Paris I |
| 37957009 | Pentoxyverine |
| 37959007 | Prealbumin |
| 37969001 | ^119^Antimony |
| 37970000 | Phosphogluconate dehydratase |
| 37978007 | Nitrofurantoin sodium |
| 37984005 | Blood group antibody Don |
| 37986007 | Tremorgen |
| 37994000 | Fibrinogen Hanover |
| 38000004 | Lymph |
| 38019009 | Plastic object |
| 38044001 | Paromomycin |
| 38065007 | Haemoglobin G-Copenhagen |
| 38082009 | Haemoglobin |
| 38088008 | 2-Dehydro-3-deoxygluconokinase |
| 38100002 | Isopropyl acetone |
| 38120001 | Progesterone 5alpha-reductase |
| 38122009 | Anisindione |
| 38123004 | Trichlorofluoromethane |
| 38132002 | (+)-Neomenthol dehydrogenase |
| 38148001 | Ribosylhomocysteinase |
| 38154000 | ^239^Americium |
| 38156003 | Haemoglobin Tottori |
| 38167002 | Aquacobalamin reductase |
| 38174007 | ^237^Americium |
| 38182007 | Galactose |
| 38207009 | Haemoglobin Regina |
| 38218009 | Hyaluronic acid |
| 38227005 | Blood group antigen He |
| 38229008 | UDP-N-acetylgalactosamine-4-sulphate sulphotransferase |
| 38245005 | Thymic hormone |
| 38262000 | Active C5b678 |
| 38263005 | N-ethylmercuri-p-toluene sulphonanilide |
| 38269009 | Lymphocyte antigen CD1c |
| 38271009 | Saffron stain |
| 38289005 | ^200^Lead |
| 38319003 | Mercuric sulphide |
| 38327007 | Plutonium |
| 38344006 | Sodium iodomethamate |
| 38347004 | 2,5-Diaminovalerate aminotransferase |
| 38348009 | Body water |
| 38367008 | Blood group antigen Hoalzel |
| 38373009 | Glutathione-CoA-glutathione transhydrogenase |
| 38379008 | Alcohol sulphotransferase |
| 38399002 | ^135^Xenon |
| 38401008 | Crocidolite |
| 38408002 | Paregoric |
| 38410000 | Acyl-CoA dehydrogenase |
| 38415005 | ^44^Titanium |
| 38424001 | Strontium chloride Sr^87^ |
| 38445008 | Blood group antigen Rils |
| 38446009 | Diflorasone diacetate |
| 38457004 | Kerasin |
| 38476002 | Interleukin |
| 38482004 | Apocrine sweat |
| 38496005 | Phenyl dimethyl urea |
| 38499003 | Blood group antibody Naz |
| 38519002 | Blood group antigen Donaldson |
| 38543004 | Lissamine green B stain |
| 38553003 | Blood group antigen Schuppenhauer |
| 38554009 | HLA-B5 antigen |
| 38558007 | Blood group antibody Ghawiler |
| 38588003 | bis-(Dimethylamino)-phosphorous anhydride |
| 38595007 | Trimethyl phosphite |
| 38612004 | Chitin synthase |
| 38622005 | Aluminium oxide ore |
| 38623000 | ^69^Zinc |
| 38647007 | Ribonucleoside-diphosphate reductase |
| 38648002 | Mephentermine |
| 38649005 | Dichloroethane |
| 38652002 | Acylglycerol lipase |
| 38684009 | Alclometasone dipropionate |
| 38686006 | Colistimethate sodium |
| 38705000 | Acetaldehyde |
| 38707008 | Coelestine blue B stain |
| 38710001 | Procollagen N-proteinase |
| 38714005 | Somatomedin A |
| 38726000 | Haemoglobin G-Taiwan Ami |
| 38730002 | p-Methylaminophenol hydrochloride |
| 38733000 | ^207^Bismuth |
| 38744008 | Progesterone binding protein |
| 38747001 | Penicillium notatum extracellular proteinase |
| 38758005 | ^229^Actinium |
| 38765002 | Haemoglobin Nottingham |
| 38771008 | HLA-DPw6 antigen |
| 38778002 | Deacetyl-[citrate-(pro-3S)-lyase] acetyltransferase |
| 38779005 | Blood group antibody Ht^a^ |
| 38794009 | Molybdenum isotope |
| 38808007 | Glutathione transferase |
| 38810009 | Haemoglobin Olympia |
| 38833005 | Vinyl chloride |
| 38834004 | Glutamate 1-kinase |
| 38839009 | Glycerol teichoic acid |
| 38854003 | Adenosinetriphosphatase |
| 38874005 | Blood group antigen V.G. |
| 38899006 | Haemoglobin North Shore |
| 38902009 | Solochrome dark blue stain |
| 38908008 | Blood group antigen Lu6 |
| 38909000 | Glutamic acid hydrochloride |
| 38914001 | Thymol iodide |
| 38922008 | Urinary tract fluid |
| 38932001 | Haemoglobin J-Nayanza |
| 38937007 | Water in oil agent |
| 38947005 | Pyrithiamin deaminase |
| 38957006 | Haemoglobin Kofu |
| 38990006 | Hydrogen-sulphide acetyltransferase |
| 39004000 | Haemoglobin Ypsilanti |
| 39006003 | 3alpha,7alpha,12alpha-Trihydroxycholestan-26-al 26-dehydrogenase |
| 39012008 | Thiram |
| 39013003 | Galactocerebroside |
| 39022002 | Deoxycytidine diphosphate |
| 39024001 | Blood group antibody Yt^a^ |
| 39044007 | Aluminium alkyl |
| 39049002 | Nasopharyngeal mucus |
| 39053000 | Complement factor D |
| 39081006 | Iron ore |
| 39082004 | Hepatitis B core antigen |
| 39102003 | Food particle |
| 39110002 | Protein-arginine deiminase |
| 39118009 | High incidence antibody |
| 39123009 | Cefaloglycin |
| 39135008 | Phosphoribosylaminoimidazole-succinocarboxamide synthase |
| 39138005 | Blood group antibody Milano |
| 39152007 | Erythromycin stearate |
| 39162000 | Bronsted-Lowry acid |
| 39173007 | Oestradiol 6beta-monooxygenase |
| 39192009 | ^235m^Uranium |
| 39200002 | Iodinated I^131^ albumin |
| 39203000 | Conanine |
| 39212003 | Acylpyruvate hydrolase |
| 39223004 | Stipitatonate decarboxylase |
| 39240008 | Haemoglobin Sherwood Forest |
| 39241007 | HLA-Dw1 antigen |
| 39254000 | S-Succinylglutathione hydrolase |
| 39263003 | Amisometradine |
| 39265005 | Free radical |
| 39276009 | Aldehyde dehydrogenase (NAD^+^) |
| 39290007 | Barium |
| 39292004 | Iodine trichloride |
| 39294003 | Iron carbohydrate complex |
| 39313006 | Phosphonoacetaldehyde hydrolase |
| 39318002 | Haemoglobin Yokohama |
| 39327001 | Blood group antibody Craw |
| 39331007 | Haemoglobin Djelfa |
| 39337006 | Blood group antibody Es^a^ |
| 39339009 | Oil of linaloe |
| 39340006 | Cycloate |
| 39360003 | Starch |
| 39368005 | Arsenate compound |
| 39378008 | Hydrastinine |
| 39383000 | Dihydrolipoamide dehydrogenase |
| 39385007 | Riboflavin kinase |
| 39411007 | Glycocyaminase |
| 39428005 | Deuteroporphyrin |
| 39442002 | Antibody binding site |
| 39467004 | ^124^Antimony |
| 39469001 | beta-Phenylisopropylamine |
| 39477002 | Faeces |
| 39494000 | Indole-3-acetaldehyde reductase (NADPH) |
| 39505006 | Haemoglobin Chongqing |
| 39514001 | Decamethonium |
| 39515000 | Blood group antigen Ht^a^ |
| 39522008 | ^253^Californium |
| 39525005 | Tumour necrosis factor alpha |
| 39529004 | Chromous sulphate |
| 39546001 | Manganese isotope |
| 39552000 | Scabicide |
| 39554004 | Propane |
| 39560004 | Haemoglobin Bicetre |
| 39576008 | Galactose dehydrogenase (NADP^+^) |
| 39580003 | Benzoate 4-monooxygenase |
| 39581004 | Trimethyl benzene |
| 39588005 | Lipstick |
| 39605000 | Haemoglobin Niteroi |
| 39635007 | ^195m^Platinum |
| 39650003 | HLA-Bw54 antigen |
| 39665002 | Blood group antigen Pr>2< |
| 39669008 | ^202^Bismuth |
| 39678002 | Blood group antigen Kominarek |
| 39694009 | Kynurenic acid |
| 39701004 | Metabolite AND/OR marker of carcinogen |
| 39705008 | ^238^Americium |
| 39736000 | Sodium sulphide |
| 39757008 | Cinnamoyl-CoA reductase |
| 39765006 | Uroporphyrinogen-III synthase |
| 39769000 | Inert gas |
| 39777001 | Sudan III stain |
| 39789004 | Snuff tobacco |
| 39805003 | Haemoglobin Aztec |
| 39806002 | Oil of niaouli |
| 39808001 | Cinchocaine hydrochloride |
| 39815009 | Clorazepate |
| 39817001 | Prothrombin fragment 1.2 |
| 39830000 | N-Sulphoglucosamine-6-sulphatase |
| 39840002 | Blood group antibody Di^a^ |
| 39862002 | Imino acid |
| 39867008 | Haemoglobin F-Xinjiang |
| 39909008 | dGTPase |
| 39932007 | ^117^Cadmium |
| 39933002 | Pancreatic hormone |
| 39953003 | Tobacco |
| 39954009 | Cellobiose phosphorylase |
| 39962001 | Coagulation factor II Barcelona variant |
| 39972003 | Sodium |
| 39973008 | C peptide |
| 39979007 | T-2 fungal toxin |
| 39985000 | Beryllium oxide |
| 39988003 | Skin reactive factor |
| 39989006 | Serotonin receptor |
| 39999001 | Blood group antigen C^G^ |
| 40012004 | Methionine adenosyltransferase |
| 40018000 | Blood group antibody Oliver |
| 40030006 | Blood group antigen M^c^ |
| 40034002 | Haemoglobin Minneapolis-Laos |
| 40036000 | Sulfadimidine |
| 40044000 | HLA-DRw11 antigen |
| 40048002 | Blood group antigen Englund |
| 40057008 | Ozone |
| 40065006 | HLA-Bw73 antigen |
| 40076005 | Erie garnet stain |
| 40078006 | Quercitrinase |
| 40082008 | Prostaglandin-A>1< delta-isomerase |
| 40112002 | Ichthyotoxin |
| 40115000 | Aluminium hydroxychloride |
| 40140007 | Blood group antibody Kirkpatrick |
| 40147005 | Diphenylmethane dye |
| 40154004 | Blood group antibody Singleton |
| 40164008 | Glycerol-3-phosphate cytidylyltransferase |
| 40179001 | Tremolite |
| 40185008 | Serum amyloid A protein |
| 40200005 | Cytochrome-c peroxidase |
| 40205000 | Haemoglobin Cheverly |
| 40217003 | Glucan 1,4-alpha-maltohexaosidase |
| 40235007 | Hydroxymalonate dehydrogenase |
| 40239001 | Oesophageal mucus |
| 40256009 | Indole-3-acetaldehyde oxidase |
| 40263009 | ^231^Uranium |
| 40270009 | Blood group antibody Truax |
| 40327006 | Haemoglobin Petah Tikva |
| 40342009 | Thiamylal sodium |
| 40346007 | ^207^Thallium |
| 40351001 | Isocyanate compound |
| 40352008 | Ryanodine |
| 40356006 | beta Fetoprotein |
| 40364000 | Blood group antigen A>1< Le^b^ |
| 40404004 | Papaverine hydrochloride |
| 40414008 | Haemoglobin Peterborough |
| 40424000 | dUTP pyrophosphatase |
| 40426003 | Sucrose phosphate synthase |
| 40431001 | Tears |
| 40438007 | Antimony sodium tartrate |
| 40447004 | Blood group antibody Hy |
| 40456007 | Blood group antigen IB |
| 40469006 | Parathion |
| 40471006 | Magnesium stearate |
| 40479008 | Fructose-1-phosphate |
| 40534007 | Aflatrem |
| 40545005 | Amphotericin A |
| 40558006 | Blood group antigen VA |
| 40565003 | ^11^Carbon |
| 40569009 | Aminomethyltransferase |
| 40581008 | Alanylphosphatidylglycerol synthase |
| 40584000 | Uranium |
| 40588002 | Hexadecanal dehydrogenase (acylating) |
| 40601003 | Chlordiazepoxide hydrochloride |
| 40621002 | Blood group antigen Vr |
| 40647006 | Hexane |
| 40660000 | Organic silicon compound |
| 40699008 | Barium fluorosilicate |
| 40706003 | Blood group antigen Toms |
| 40710000 | Diodone |
| 40718007 | Fast red B salt stain |
| 40728003 | ^201m^Lead |
| 40730001 | Haemoglobin Kariya |
| 40734005 | Rhus toxin |
| 40744007 | Alanine carboxypeptidase |
| 40755007 | Haemoglobin J-Kurosh |
| 40756008 | Membrane lipid |
| 40763008 | Oil of petitgrain |
| 40776002 | Strictosidine beta-glucosidase |
| 40783009 | Sec-hexyl acetate |
| 40789008 | ACTH - Adrenocorticotrophic hormone |
| 40808006 | Oil red O stain |
| 40813005 | Cardamom oil |
| 40817006 | Rubidium compound |
| 40830007 | Abnormal haemoglobin, beta-chain variant |
| 40840005 | Glycerol-1-phosphatase |
| 40848003 | Malate dehydrogenase (NADP^+^) |
| 40856000 | Leukotriene A |
| 40879004 | NADH dehydrogenase (ubiquinon) |
| 40922007 | Nylon 46 |
| 40924008 | Water-soluble vitamin |
| 40937006 | ^124^Iodine |
| 40940006 | Human chorionic gonadotropin, beta subunit |
| 40942003 | Taurine dehydrogenase |
| 40955002 | Haemoglobin Wien |
| 40968005 | Silver nitrate ophthalmic preparation |
| 40971002 | Adenylyl-[glutamate-ammonia ligase] hydrolase |
| 40991009 | alpha-L-Arabinofuranosidase |
| 40992002 | Lymphocyte antigen |
| 40996004 | Glutamin-(asparagin-)ase |
| 41043002 | Chemical solution |
| 41044008 | Blood group antigen Woit |
| 41062004 | Methoxsalen |
| 41067005 | Oxiconazole nitrate |
| 41091001 | Mebutamate |
| 41093003 | Blood group antibody E^w^ |
| 41094009 | Cyanidin-3-rhamnosylglucoside O^5^-glucosyltransferase |
| 41096006 | Blood group antibody Y. Bern |
| 41097002 | Haemoglobin F-Kingston |
| 41105002 | Halogenated hydrocarbon |
| 41126002 | Glycerate dehydrogenase |
| 41143004 | Ursodesoxycholic acid |
| 41153003 | Amyl nitrate |
| 41175001 | Organic compound |
| 41198009 | ^117^Antimony |
| 41199001 | Melatonin |
| 41220002 | Dugaldin |
| 41233008 | Chlorophenyl dimethyl urea trichloroacetate |
| 41247007 | Dephospho-[reductase kinase] kinase |
| 41255000 | Dihydrolipoamide acetyltransferase |
| 41261002 | Quinethazone |
| 41268008 | Pyruvate,water dikinase |
| 41282008 | Haemoglobin Boras |
| 41285005 | Blood group antigen Jones |
| 41301002 | H-2 locus |
| 41311009 | Haemoglobin F-Auckland |
| 41317008 | Asterosaponin |
| 41318003 | Blood group antibody Js^b^ |
| 41322008 | Haemoglobin Shenyang |
| 41332001 | Oleandomycin |
| 41343009 | ^222^Radium |
| 41372005 | Anthranilate phosphoribosyltransferase |
| 41383001 | Haemoglobin York |
| 41389002 | Ethyl hexanediol |
| 41395001 | Tamoxifen citrate |
| 41401001 | 1,2-alpha-L-Fucosidase |
| 41403003 | Blood group antigen Mt^a^ |
| 41410009 | Intrinsic factor |
| 41412001 | Tannic acid |
| 41414000 | Methylmalonyl-CoA decarboxylase |
| 41420004 | Content of exocytic membrane invagination |
| 41433005 | Aluminium compound |
| 41441005 | Erythrose |
| 41459008 | Sodium bisulphite |
| 41464007 | ^90^Molybdenum |
| 41465008 | Glutamate decarboxylase |
| 41469002 | Oncogene protein |
| 41485007 | Leuc-enkephalin |
| 41492002 | Satratoxins |
| 41499006 | 3-Hydroxybenzoate 2-monooxygenase |
| 41503000 | Zinc compound |
| 41504006 | Lauric acid |
| 41508009 | Cerumen |
| 41509001 | Potassium warfarin |
| 41528008 | 2-Hydroxyacylsphingosine 1-beta-galactosyltransferase |
| 41540008 | Ribonucleoside-triphosphate reductase |
| 41548001 | Protochlorophyllide reductase |
| 41551008 | Right lower lobe mucus |
| 41558002 | Immunoglobulin, GM>8< allotype |
| 41562008 | Blood group antibody Tm |
| 41568007 | Arabinonate dehydratase |
| 41573001 | Linseed oil |
| 41576009 | Blood group antigen Rh26 |
| 41577000 | Tellurium |
| 41579002 | beta-N-acetylhexosaminidase |
| 41583002 | ^32^Silicon |
| 41592004 | ^82^Strontium |
| 41598000 | Oestrogen |
| 41606000 | Tetrahydrofuran |
| 41612005 | 3-Chloro-D-alanine dehydrochlorinase |
| 41613000 | Adenylosuccinate lyase |
| 41623009 | Syntenic gene |
| 41641001 | ^196^Thallium |
| 41644009 | Blood group antigen Baltzer |
| 41646006 | Corticotropin binding globulin |
| 41649004 | Calmodulin |
| 41667006 | Blood group antigen Begovitch |
| 41691002 | ^210^Radon |
| 41692009 | Haemoglobin Ube-4 |
| 41711007 | Thymidine phosphorylase |
| 41718001 | N-(5'-Phospho-D-ribosylformimino)-5-amino-1-(5''-phosphoribosyl)-4-imidazole-carboxamide isomerase |
| 41722006 | Cefotaxime sodium |
| 41748003 | Organic tin compound |
| 41750006 | Brazilin stain |
| 41758004 | ^169^Ytterbium |
| 41759007 | Trimetaphosphatase |
| 41761003 | Blood group antibody Stewart |
| 41771001 | Blood group antigen Gallner |
| 41773003 | Formiminoglutamate deiminase |
| 41793006 | Calcium cyanamide |
| 41805004 | Lipoprotein lipase |
| 41810000 | beta Aminoisobutyric acid |
| 41830001 | Aromatic-L-amino-acid decarboxylase |
| 41834005 | Olive oil |
| 41856008 | Dioxotetrahydropyrimidine phosphoribosyltransferase |
| 41858009 | Blood group antigen Wetz |
| 41861005 | 2-Hydroxy-3-oxopropionate reductase |
| 41875003 | Glutathione-cystine transhydrogenase |
| 41886001 | Blood group antigen Kenneddy |
| 41896005 | Haemoglobin Toyama |
| 41903005 | Hexapradol |
| 41917001 | Haemoglobin Potomac |
| 41924000 | NAD^+^ kinase |
| 41926003 | Cholesterol 7alpha-monooxygenase |
| 41930000 | Blood group antigen McDermott |
| 41937002 | Haemoglobin Gower-1 |
| 41940002 | Mannosyl-oligosaccharide glucosidase |
| 41945007 | Alkylpiperidine derivative of phenothiazine |
| 41956007 | Propylene imide |
| 41967008 | Silver |
| 41978000 | Blood group antibody V.G. |
| 41989007 | Lolitrem |
| 41990003 | Mannosyl-glycoprotein endo-beta-N-acetyl-glucosaminidase |
| 41994007 | Animal alkaloid |
| 41999002 | Blood group antibody Joslin |
| 42001007 | Polychlorinated biphenyl |
| 42013002 | Banisterine |
| 42027007 | Alcohol radical |
| 42033003 | Sterculia |
| 42038007 | HLA-Bw62 antigen |
| 42048009 | Blood group antibody Terry |
| 42053004 | Plant teratogen |
| 42056007 | Placental hormone |
| 42076001 | Crystallin |
| 42078000 | Blood group antigen Kursteiner |
| 42092006 | Blood group antigen Allchurch |
| 42104001 | L-Fuculokinase |
| 42107008 | HLA-Cw antigen |
| 42121005 | Haemopexin |
| 42122003 | Blood group antibody M^v^ |
| 42124002 | Glutamate-tRNA ligase |
| 42130002 | Prephenate dehydratase |
| 42133000 | Sulphur pentafluoride |
| 42144008 | Bisulphate salt |
| 42145009 | Fibrinogen Copenhagen |
| 42146005 | Iodide salt |
| 42151004 | ^73^Arsenic |
| 42159002 | Mushroom poison |
| 42163009 | Methylphenidate hydrochloride |
| 42165002 | Immunoglobulin gene |
| 42166001 | Blood group antigen Kx |
| 42172001 | Uca pugilator collagenolytic proteinase |
| 42180008 | Vitamin D>2<, phosphate ester |
| 42184004 | Haemoglobin G-Norfolk |
| 42193003 | Stannous fluoride |
| 42204005 | Cyclic guanosine monophosphate |
| 42210005 | Leucocyte-membrane neutral endopeptidase |
| 42212002 | Sodium pentachlorophenate |
| 42230009 | Bentonite |
| 42231008 | Bilirubin diglucuronide |
| 42240007 | Duplicating ink |
| 42242004 | Aminomuconate-semialdehyde dehydrogenase |
| 42244003 | Debromoaplysiatoxin |
| 42248000 | Methyl orange stain |
| 42255003 | Blood group antibody Zaw |
| 42257006 | ^183^Iridium |
| 42281004 | Cellobiose dehydrogenase (acceptor) |
| 42303002 | Phytolaccigenin |
| 42319009 | Lipotropin |
| 42325008 | Lacrimator gas |
| 42328005 | o-Chlorobenzylidenemalononitrile |
| 42333009 | Blood group antibody LW^b^ |
| 42342002 | Aspartate-semialdehyde dehydrogenase |
| 42363000 | Ethyl mercury chloride |
| 42370000 | Mannitol dehydrogenase (cytochrome) |
| 42371001 | Heterocytotropic antibody |
| 42382009 | 4-Ipomeanol |
| 42416001 | Lanolin |
| 42417005 | Carbon^14^ triolein |
| 42428009 | Haemoglobin N-Baltimore |
| 42435001 | Haemoglobin Saint Jacques |
| 42449005 | Antimony |
| 42464005 | p-Phenylenediamine |
| 42465006 | 3-Dehydroquinate dehydratase |
| 42473002 | Blood group antibody Cross |
| 42489004 | Cysteine aminotransferase |
| 42490008 | Blood group antibody Tn |
| 42503003 | AMP thymidine kinase |
| 42507002 | Calmodulin-lysine methyltransferase |
| 42520004 | Bulrush millet ergot alkaloid |
| 42549007 | alpha 2 macroglobulin |
| 42558000 | Californium radioisotope |
| 42564007 | Bensulphide |
| 42566009 | Toluidine |
| 42580002 | Haemoglobin Etobicoke |
| 42589001 | ^176^Tantalum |
| 42605004 | Aldosterone |
| 42607007 | Carbamoyl-phosphate synthase (ammonia) |
| 42634005 | GTP cyclohydrolase I |
| 42657004 | Cyclamate sulphohydrolase |
| 42664002 | HLA-Dw17 antigen |
| 42671007 | Rye ergot alkaloid |
| 42674004 | Sucrose synthase |
| 42692007 | Naproxen sodium |
| 42702005 | ^237^Plutonium |
| 42710006 | Coagulation factor XI variant type II |
| 42722009 | Hydrogenase |
| 42728008 | Indium^113^ pentetate |
| 42730005 | Periodate salt |
| 42732002 | Lymphocyte antigen CD1a |
| 42735000 | Carbamoyl-phosphate synthase (glutamine-hydrolysing) |
| 42753006 | Dextrin dextranase |
| 42757007 | Hydrofluoric acid |
| 42761001 | Pyrocatechol |
| 42768007 | Blood group antigen En^a^TS |
| 42784008 | Blood group antibody Wd^a^ |
| 42789003 | ^95^Technetium |
| 42799008 | Immunoglobulin idiotype |
| 42804003 | Microsomal aminopeptidase |
| 42830004 | Blood group antibody Wilson |
| 42831000 | ^87m^Yttrium |
| 42832007 | 2-Dehydro-3-deoxyglucarate aldolase |
| 42841002 | Zinc oxide |
| 42848008 | Blood group antigen MPD |
| 42850000 | Fluorinated hydrocarbon |
| 42860009 | Haemoglobin Mexico |
| 42877009 | Anhydrous borate |
| 42884001 | Neuraminic acid |
| 42885000 | dTDP-6-deoxy-L-talose dehydrogenase |
| 42888003 | Blood group antigen Cipriano |
| 42891003 | Lymphocyte antigen CD56 |
| 42897004 | Blood group antigen Donati |
| 42907009 | Carboxylic acid |
| 42918009 | Arginine 2-monooxygenase |
| 42922004 | Methaemalbumin |
| 42926001 | Blood group antigen Seymour |
| 42934007 | Hydroxy phenylpyruvic acid, ortho |
| 42938005 | alpha-Adrenergic receptor |
| 42951000 | Methomyl |
| 42958006 | 5-methyl-3-heptanone |
| 43004008 | Glucagon-like peptide 1 |
| 43013005 | Haemoglobin Fannin-Lubbock |
| 43024007 | Iron salt |
| 43032004 | Anabasine |
| 43041009 | Acetate-CoA ligase (ADP-forming) |
| 43042002 | Platelet antibody HPA-5b |
| 43048003 | Amfomycin |
| 43076006 | Blood group antibody Evans |
| 43095004 | Complement receptor CRI |
| 43097007 | Pantothenoylcysteine decarboxylase |
| 43106008 | Pyronine G stain |
| 43117009 | Imidazoleglycerol-phosphate dehydratase |
| 43136004 | Strontium |
| 43161001 | Fluoroacetate salt |
| 43169004 | N-Methyl-2-oxoglutaramate hydrolase |
| 43171004 | Ovarian hormone |
| 43181000 | Blood group antibody Cl^a^ |
| 43201005 | Amine |
| 43211003 | n-Acetyl neuraminic acid |
| 43212005 | Concanavalin A |
| 43215007 | Glucan 1,3-alpha-glucosidase |
| 43230003 | Rubber |
| 43237000 | Succinyldiaminopimelate aminotransferase |
| 43239002 | ^75^Selenium |
| 43241001 | Blood group antibody Pelletier |
| 43268001 | Copper compound |
| 43278003 | Platelet activating factor |
| 43289005 | Dihydrofolic acid |
| 43290001 | Sedoheptulose-bisphosphatase |
| 43305003 | Protein-tyrosine kinase |
| 43314008 | Extracellular material |
| 43328002 | Oxalate-CoA ligase |
| 43332008 | Coagulation factor IX Lake Elsinor variant |
| 43342005 | Capric acid |
| 43347004 | Blood group antigen A>1< Le^d^ |
| 43356007 | Betaine |
| 43357003 | Haemoglobin Baylor |
| 43360005 | Aconitine |
| 43365000 | L-Threonine 3-dehydrogenase |
| 43374003 | [Pyruvate dehydrogenase (lipoamide)] kinase |
| 43397000 | Idiotope |
| 43417002 | Blood group antibody IH |
| 43419004 | Bitter almond oil |
| 43425000 | Blood group antigen Dahl |
| 43431002 | Maltose |
| 43436007 | Chromic salt |
| 43440003 | Melanocyte stimulating hormone releasing factor |
| 43461005 | Bryonal |
| 43462003 | Para-aminohippuric acid |
| 43494008 | Acetoacetyl-CoA hydrolase |
| 43506001 | Tephrosin |
| 43514007 | Disodium ethylene bis-(dithiocarbonate) |
| 43538006 | Non radiopaque medium |
| 43541002 | Pentapiperide |
| 43549000 | Solochrome azurine (BS) stain |
| 43564000 | Haematite |
| 43576000 | Blood group antibody N^A^ |
| 43585000 | Sulphonamide diuretic |
| 43588003 | Immunoglobulin, GM>9< allotype |
| 43592005 | Cactinomycin |
| 43596008 | HLA-Bw64 antigen |
| 43597004 | Chymodenin |
| 43605008 | Haemoglobin C-Makassar |
| 43613009 | Phosphorous pentachloride |
| 43621003 | Coagulation factor IX Oxford 2 variant |
| 43625007 | Cholesterol oxidase |
| 43632003 | Blood group antibody K14 |
| 43677001 | ^148^Gadolinium |
| 43678006 | Blood group antigen Pr>3< |
| 43687002 | Haemoglobin Quong Sze |
| 43688007 | Testosterone |
| 43698001 | Hydroxystilbamidine isethionate |
| 43706004 | Ascorbic acid |
| 43708003 | Animal feed additive |
| 43709006 | Phosphatidyl 3-0-alanylglycerol |
| 43710001 | Butylidene chloride |
| 43713004 | NAD^+^ synthase |
| 43723008 | Tributyl phosphate |
| 43728004 | beta-D-fructofuranose |
| 43735007 | Sulfur |
| 43740004 | ^210^Lead |
| 43743002 | Polyvinyl acetate |
| 43751004 | RNA-directed RNA polymerase |
| 43775004 | CMP-N-acetylneuraminate-alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase |
| 43784004 | Thymic lymphopoietin suppressing factor |
| 43788001 | Blood group antibody Davis |
| 43803003 | 2-(Acetamidomethylene) succinate hydrolase |
| 43804009 | Ethyl silicate |
| 43807002 | Blood group antigen In^b^ |
| 43813006 | Phosphoribosylglycinamide formyltransferase |
| 43819005 | Haemoglobin Kansas |
| 43821000 | Alcohol dehydrogenase (acceptor) |
| 43827001 | Blood group antigen Mineo |
| 43835003 | Zinc gelatin |
| 43839009 | Aminocarboxymuconate-semialdehyde decarboxylase |
| 43848004 | Agkistrodon serine proteinase |
| 43850007 | ^105^Rhodium |
| 43862006 | Isovitexin beta-glucosyltransferase |
| 43864007 | Blood group antigen Ull |
| 43866009 | UDP-N-acetylglucosamine-lysosomal-enzyme-N-acetylglucosaminephosphotransferase |
| 43871002 | HLA-Dw7 antigen |
| 43880002 | Chloroacetamide |
| 43886008 | Boron oxide |
| 43896004 | p-Dichlorobenzene |
| 43897008 | ^56^Manganese |
| 43909000 | Thiamine triphosphate |
| 43920000 | Haemoglobin A,a |
| 43921001 | Nickel compound |
| 43936003 | Oncogene protein fins |
| 43953005 | Ammonia |
| 43965009 | Phenothioxin |
| 43974006 | Alkyl sodium sulphates |
| 43984007 | Alpha amino acid |
| 43987000 | Acacia |
| 43989002 | 3,4-Methylenedioxybenzyl methyl ketone |
| 44007007 | Padimate O |
| 44027008 | Seafood |
| 44033004 | Anthracene |
| 44035006 | Nitromethane |
| 44040003 | HLA-Bw57 antigen |
| 44044007 | Calcium phosphate |
| 44045008 | Blood group antibody Tasich |
| 44046009 | Blood group antibody Paular |
| 44048005 | Geranoyl-CoA carboxylase |
| 44049002 | Blood group antigen Lindsay |
| 44059001 | Gamboge |
| 44063008 | Blood group antigen Pt^a^ |
| 44068004 | Doxylamine |
| 44079009 | Urobilinogen |
| 44090004 | Haemoglobin Handsworth |
| 44093002 | Blood group antibody KL |
| 44112005 | Blood group antigen Lu11 |
| 44120007 | 2,5-Diokovalerate dehydrogenase |
| 44121006 | Transferase |
| 44125002 | Aconitate delta-isomerase |
| 44127005 | alpha, alpha-Trehalase |
| 44139002 | Blood group antigen Don E. W. |
| 44142008 | Haemoglobin Ocho Rios |
| 44153002 | Cytokinin 7-beta-glucosyltransferase |
| 44158006 | Lymphocyte antigen CD64 |
| 44159003 | Barium oxide |
| 44179006 | Renilla-luciferin 2-monooxygenase |
| 44205007 | Grayanotoxin |
| 44207004 | Methylaspartate ammonia-lyase |
| 44212003 | Anti SS-A antibody |
| 44220001 | Formate acetyltransferase |
| 44225006 | Oncogene protein N-RAS |
| 44234001 | Strontium isotope |
| 44239006 | Platelet antibody HPA-1 |
| 44262008 | Oxidised cellulose |
| 44293009 | Phenoxybenzamine hydrochloride |
| 44302008 | Peptidyl-glutaminase |
| 44320004 | alpha-Naphthol |
| 44330008 | Pyrvinium pamoate |
| 44331007 | Blood group antibody In^b^ |
| 44344002 | Abscisic acid |
| 44347009 | Lergotrile |
| 44368005 | Oncogene protein HER-2/neu |
| 44369002 | Anaphylatoxin |
| 44370001 | Oncogene protein c-fos |
| 44394001 | Copper naphthenate |
| 44404008 | Sulphoxide |
| 44406005 | Polyethylene glycol alkyl ether |
| 44407001 | [Acyl-carrier-protein] malonyltransferase |
| 44411007 | GC globulin |
| 44413005 | beta-Thiocyanoethyl fatty acid ester |
| 44417006 | Monoterpenol beta-glucosyltransferase |
| 44439008 | Blood group antigen Smith |
| 44446004 | Petroleum product |
| 44447008 | Blood group antigen Fleming |
| 44459007 | Interleukin-8 |
| 44461003 | Homoserine acetyltransferase |
| 44469001 | Fibrinogen Petoskey |
| 44472008 | Blood group antibody Begovitch |
| 44475005 | Fucoidanase |
| 44488008 | Bismark brown R stain |
| 44495004 | ^126^Antimony |
| 44506007 | ^112^Silver |
| 44508008 | Hydromorphone |
| 44510005 | UDPglucose-hexose-1-phosphate uridylyltransferase |
| 44517008 | Glycerol-3-phosphate dehydrogenase |
| 44520000 | Buphenine hydrochloride |
| 44533006 | Benzaldehyde dehydrogenase (NAD^+^) |
| 44555003 | Methylenedioxyamphetamine |
| 44556002 | Pyruvate decarboxylase |
| 44581004 | 1-1-Dichloro-1-nitroethane |
| 44588005 | Iodine |
| 44590006 | Callistin toxin |
| 44603007 | Iodinated glycerol |
| 44609006 | Calcitonin gene-related peptide |
| 44611002 | Nitrosyl chloride |
| 44624002 | Fibrinogen New Orleans I |
| 44632005 | 4,7,10,13,16,19-Docosahexaenoic acid |
| 44639001 | Solid carbon dioxide |
| 44644008 | Mycotoxin |
| 44675004 | Blood group antibody Nou |
| 44680008 | Factor VIII antigen |
| 44681007 | Hypothalamic inhibiting factor |
| 44686002 | Blood group antigen Lud |
| 44706009 | Lymphocyte antigen CD3 |
| 44711006 | Gastrin II |
| 44719008 | Mediator of immune response |
| 44728009 | Complement component C1 |
| 44740009 | Choline oxidase |
| 44742001 | Haemoglobin Louisville |
| 44746003 | Bufotalin |
| 44753007 | Thymine,2-oxoglutarate dioxygenase |
| 44770004 | Intracisternal granule of ER |
| 44776005 | Xenon radioisotope |
| 44822001 | Ethyl bromide |
| 44824000 | Blood group antibody Pearl |
| 44837002 | Cyclopropane |
| 44839004 | Armillaria mellea neutral proteinase |
| 44858008 | Haemoglobin Q-Iran |
| 44896009 | Haemoglobin Hamilton |
| 44908000 | Chlorzoxozone |
| 44924004 | Endorphin receptor |
| 44931000 | Adenosylhomocysteinase |
| 44937001 | beta-Ureidopropionase |
| 44954009 | Oncogene protein TCRG |
| 44970006 | Aspartic acid |
| 44971005 | Thromboxane synthase |
| 44973008 | ^182^Tantalum |
| 44976000 | Hydroxy-mercuricresol |
| 45001002 | Bone matrix |
| 45003004 | Virus receptor |
| 45011009 | Tyramine N-methyltransferase |
| 45018003 | Steroid N-acetylglucosaminyltransferase |
| 45025005 | Permanganic acid |
| 45026006 | Blood group antigen M^v^ |
| 45032001 | Haemoglobin D-Ibadan |
| 45041006 | Dicycloxylamine |
| 45044003 | Blood group antibody Lud |
| 45047005 | Lymphokine |
| 45060004 | Yttrium compound |
| 45065009 | myo-Inosose-2 dehydratase |
| 45068006 | 3-Hydroxybutyryl-CoA epimerase |
| 45084007 | Fibrin degradation product, D fragment |
| 45087000 | Oleoyl-[acyl-carrier-protein] hydrolase |
| 45095001 | Blood group antigen K18 |
| 45106005 | Congo red stain |
| 45108006 | Lysosomal carboxypeptidase B |
| 45119009 | Glycine salt of bile acid |
| 45120003 | Ester |
| 45137005 | Haemoglobin Suresnes |
| 45141009 | Ornithine carbamoyltransferase |
| 45158004 | Fluorine isotope |
| 45159007 | Azatadine maleate |
| 45160002 | Oxazine dye |
| 45174009 | Alkylglycerophosphoethanolamine phosphodiesterase |
| 45193006 | Blood group antibody Horw |
| 45199005 | Oil of geranium |
| 45207006 | Dexamphetamine sulfate |
| 45209009 | Epsilon-chain haemoglobin |
| 45215009 | Tantalum |
| 45219003 | Sodium monofluoroacetate |
| 45246008 | C4bp complement protein |
| 45262002 | Mercury |
| 45266004 | Antiplasmin |
| 45273009 | Blood group antigen hr^H^ |
| 45285001 | Haemoglobin Arya |
| 45321005 | Blood group antibody M |
| 45333000 | Blood group antigen Sl^a^ |
| 45345009 | Haemoglobin A>2< Victoria |
| 45367005 | Tungsten radioisotope |
| 45373006 | NADH peroxidase |
| 45375004 | Haemoglobin F-Carlton |
| 45380008 | ^134m^Caesium |
| 45386002 | Purine |
| 45388001 | Blood group antigen Laine |
| 45389009 | Tissue stain |
| 45394009 | Monophenol monooxygenase |
| 45396006 | Cardiolipin antibody |
| 45397002 | Haemoglobin Matsue-Oki |
| 45407009 | Blood group antigen Ghawiler |
| 45425002 | Tellurium compound |
| 45428000 | Blood group antibody Perry |
| 45436009 | Tenebrio alpha-proteinase |
| 45441001 | Blood group antigen Tk |
| 45442008 | Phenyl mercuric chloride |
| 45454008 | Cerebrin |
| 45457001 | Lipopolysaccharide N-acetylglucosaminyltransferase |
| 45470005 | Bromacil |
| 45475000 | Indigo carmine stain |
| 45483006 | Psilocin |
| 45487007 | Trifluridine ophthalmic preparation |
| 45510000 | Blood group antibody Jopson |
| 45524001 | Dextranomer |
| 45528003 | Blood group antibody Dugstad |
| 45530001 | Antinuclear antibody |
| 45537003 | Farnesyltranstransferase |
| 45539000 | Succinate dehydrogenase (ubiquinone) |
| 45542006 | Thiosulphate salt |
| 45555007 | Noradrenaline |
| 45570008 | Mevaldate reductase (NADPH) |
| 45585002 | beta-1 Adrenergic receptor |
| 45601001 | Blood group antibody A.M. |
| 45604009 | Tranquilliser |
| 45609004 | Haemoglobin F-Pendergrass |
| 45620004 | Pyrethrin |
| 45622007 | 3-Deoxy-D-manno-octulosonate aldolase |
| 45627001 | ^41^Argon |
| 45637006 | Blood group antibody Bonde |
| 45641005 | Haemoglobin Atlanta |
| 45648004 | Angiotensin receptor |
| 45656001 | HLA-Bw22 antigen |
| 45668005 | Blood group antigen Bouteille |
| 45672009 | Blood group antibody Lu11 |
| 45695000 | Plant alkaloid |
| 45698003 | Putrescine |
| 45710003 | Sputum |
| 45717000 | Coniferyl-alcohol dehydrogenase |
| 45729009 | Glucosamine-phosphate acetyltransferase |
| 45733002 | Magnesium chloride |
| 45737001 | Glycolic acid |
| 45754009 | Alpha interferon |
| 45784001 | Xanthine oxidase |
| 45791003 | Mannose-1-phosphate guanylyltransferase (GDP) |
| 45799001 | Tissue-endopeptidase degrading collagenase-synthetic-substrate |
| 45800002 | L-Arabinose isomerase |
| 45807004 | Coagulation factor IX variant |
| 45849009 | Technetium Tc^99m^ sodium glucoheptonate |
| 45857007 | Antilysosomal antibody |
| 45867002 | Glyoxylate dehydrogenase (acylating) |
| 45878005 | Immunologic receptor |
| 45883002 | Mitochondrial RNA |
| 45922005 | Amphibole asbestos |
| 45932003 | Anti Jo-1 antibody |
| 45934002 | Blood group antigen Os^a^ |
| 45940009 | Theophylline anhydrous |
| 45946003 | Proglucagon |
| 45947007 | Amylo-1,6-glucosidase |
| 45952002 | 1-Acylglycerol-3-phosphate acyltransferase |
| 45954001 | Arginine racemase |
| 45957008 | Vinyl acetate |
| 45960001 | Naepaine |
| 45962009 | Collodion |
| 45969000 | Blood group antibody i |
| 45986006 | Teratogenic substance |
| 45992000 | Blood group antigen s |
| 45996002 | CDPacylglycerol arachidonyltransferase |
| 45997006 | Omega amino acid |
| 46015007 | Melanocyte stimulating hormone |
| 46016008 | Mancozeb |
| 46021006 | ^91^Strontium |
| 46031004 | Salt water |
| 46046006 | Immunoglobulin A |
| 46058006 | Prostaglandin PGG2 |
| 46064004 | Asparagine-oxo-acid aminotransferase |
| 46066002 | dTDPglucose 4,6 dehydratase |
| 46075000 | Oligosaccharide |
| 46084000 | 2-Aminoadipate aminotransferase |
| 46096007 | Blood group antibody Knudsen |
| 46097003 | Lactated Ringer's solution |
| 46120009 | 17-Ketosteroid |
| 46122001 | Antitreponemal agent |
| 46134009 | Prostaglandin PGA1 |
| 46137002 | Borneol |
| 46139004 | Martius yellow stain |
| 46146008 | Cefotetan disodium |
| 46150001 | HLA-Bw4 antigen |
| 46158008 | HLA-Dw14 antigen |
| 46164001 | ^109^Indium |
| 46187009 | Abequosyltransferase |
| 46188004 | D-Glutamyltransferase |
| 46191004 | Cataglykin |
| 46195008 | Blood group antibody Smith |
| 46201000 | Piperidolate |
| 46225008 | Cholecystokinin |
| 46234003 | Blood group antigen Nob |
| 46242002 | Body secretion |
| 46243007 | Methyl sulphate difenzoquat |
| 46245000 | Haemoglobin Korle-Bu |
| 46250006 | Slaframine |
| 46257009 | Iodoform |
| 46261003 | Blood group antigen C^x^ |
| 46281002 | Caffeate o-methyltransferase |
| 46290009 | Bisphosphoglycerate phosphatase |
| 46293006 | Bromocriptine mesylate |
| 46310006 | Glycine dehydrogenase (decarboxylating) |
| 46320001 | N-Acylsphingosine galactosyltransferase |
| 46321002 | Asterotoxin |
| 46329000 | Chocolate milk |
| 46331009 | Blood group antibody K13 |
| 46335000 | Sulisobenzone |
| 46336004 | Complement component C2b |
| 46338003 | Cysteine-S-conjugate N-acetyltransferase |
| 46344004 | Alginate synthase |
| 46346002 | Tabernamontanain |
| 46358002 | ^118^Antimony |
| 46384008 | Ink |
| 46407003 | GDPmannose 4,6 dehydratase |
| 46409000 | Bilirubin-glucuronoside glucuronosyltransferase |
| 46417008 | Chlorate salt |
| 46425005 | Intestinal vomitus |
| 46445002 | 11beta-Hydroxysteroid dehydrogenase |
| 46461000 | Fucose-1-phosphate guanylyltransferase |
| 46469003 | Properdin convertase, complement component |
| 46484007 | Bleaching powder |
| 46491005 | Menthyl anthranilate |
| 46492003 | Nivalenol |
| 46509002 | 1-Phosphofructokinase |
| 46512004 | Tertiary butyl chromate |
| 46514003 | Calcium mandelate |
| 46519008 | Blood group antibody ILe^bH^ |
| 46520002 | Immunoglobulin, GM>2< allotype |
| 46539007 | Complement component C1r |
| 46543006 | ^107^Palladium |
| 46548002 | Leukotriene B |
| 46558003 | Imipenem |
| 46566007 | Arylamine N-methyltransferase |
| 46572007 | Coagulation factor XI |
| 46583003 | Actin |
| 46591007 | Superfatted soap |
| 46601006 | Diazomethane |
| 46602004 | Electron |
| 46610003 | 3-Dehydrosphinganine reductase |
| 46613001 | HLA-Bw58 antigen |
| 46654009 | Tetrahydrocortisone |
| 46663006 | Blood group antibody Lee |
| 46668002 | Homatropine methylbromide |
| 46682002 | Ribonuclease T>2< |
| 46684001 | Haemoglobin N-Seattle |
| 46685000 | Serine-ethanolaminephosphate phosphodiesterase |
| 46691003 | Organoalkyl mercury |
| 46711008 | Diglycol hydroiodide |
| 46730008 | Blood group antigen Bio-5 |
| 46736002 | Glutamate racemase |
| 46743008 | Nucleotide pyrophosphatase |
| 46749007 | Medicinal iodine |
| 46755002 | Blood group antigen Schor |
| 46757005 | Haemoglobin St. Antoine |
| 46769002 | Immune suppressor gene |
| 46810001 | Flint |
| 46815006 | Connective tissue matrix |
| 46840004 | Animal oil |
| 46841000 | Blood group antigen BOW |
| 46843002 | Xanthine |
| 46845009 | Tyrosine phenol-lyase |
| 46859002 | Septicine |
| 46861006 | Deoxynivalenol |
| 46864003 | Thiocyanate isomerase |
| 46887006 | Ambenonium chloride |
| 46921009 | Quinoline dye |
| 46932009 | Thyroid colloid |
| 46942006 | Oxamic acid |
| 46943001 | Cortolone |
| 46950002 | Protriptyline hydrochloride |
| 46959001 | Lymphocyte antigen CD11c |
| 46961005 | Hydroxypyruvate isomerase |
| 46974004 | Haemoglobin Oleander |
| 46978001 | Cyclopentanol dehydrogenase |
| 46985002 | 1,2-Dichloroethene |
| 47019005 | Blood group antigen Hildebrandt |
| 47023002 | Lymphocyte antigen CD66 |
| 47026005 | Thymol oxide |
| 47030008 | Insoluble berlin blue stain |
| 47038001 | HLA antigen |
| 47052004 | Chemical suspension |
| 47053009 | ^193^Gold |
| 47068005 | Blood group antibody Jr^a^ |
| 47088009 | Carboxymethylenebutenolidase |
| 47097008 | Oxaloacetic acid |
| 47104007 | Blood group antigen Co3 |
| 47121003 | Bismuth isotope |
| 47136000 | Blood group antigen Manley |
| 47151009 | Blood group antibody Win |
| 47167003 | Glyceraldehyde-3-phosphate |
| 47169000 | Aminoacyl-methylhistidine dipeptidase |
| 47172007 | Sulfuric acid |
| 47174008 | Glutamine-pyruvate aminotransferase |
| 47176005 | Methdilazine hydrochloride |
| 47180000 | Metisazone |
| 47184009 | Silver compound |
| 47189004 | ^195^Thallium |
| 47192000 | Meglumine diatrizoate |
| 47201006 | 5-Hydroperoxy-6,8,11,14-eicosatetraenoic acid |
| 47204003 | Ferbam |
| 47205002 | Cobalt blue |
| 47215008 | Blood group antigen Sc2 |
| 47218005 | Fibrinogen Giessen II |
| 47232007 | Alkyl quaternary ammonium bromide |
| 47245006 | Dolichyl-phosphate alpha-N-acetylglucosaminyltransferase |
| 47247003 | Fibrinogen Kyoto |
| 47280005 | Macrocyclic trichothecenes |
| 47291003 | Mucor pusillus aspartic proteinase |
| 47310000 | Exoribonuclease II |
| 47313003 | Haemoglobin A>2< Adria |
| 47336007 | Fibrinogen Manchester |
| 47341004 | Blood group antigen Driver |
| 47343001 | N-Formyl methionylaminoacyl-tRNA deformylase |
| 47349002 | beta Neoendorphin |
| 47350002 | Pregnenolone |
| 47355007 | Benzodiazepine nucleus |
| 47358009 | Polystyrene |
| 47364002 | Blood group antigen Ryan |
| 47368004 | Nucleoside |
| 47379009 | Technetium compound |
| 47380007 | ^210^Bismuth |
| 47383009 | Cephaeline |
| 47389008 | Methyl tert-butyl ether |
| 47407008 | Sphingolipid |
| 47408003 | Naftifine hydrochloride |
| 47413004 | Fat emulsion |
| 47414005 | Trimethidinium |
| 47419000 | Long-chain-alcohol fatty-acyltransferase |
| 47425001 | ^187^Iridium |
| 47431003 | Dichlorobenzene |
| 47448006 | Hot water |
| 47463009 | ^209^Lead |
| 47464003 | Blood group antibody Woit |
| 47469008 | Blood group antibody Seymour |
| 47472001 | 4-Hydroxy-3-methoxy mandelic acid |
| 47486002 | Fast red ITR stain |
| 47500008 | Borate pentahydrate |
| 47521008 | ^109^Palladium |
| 47543000 | Exodeoxyribonuclease I |
| 47553004 | Blood group antibody Sul |
| 47562002 | 4-Hydroxybutyrate dehydrogenase |
| 47565000 | I region, MHC |
| 47581005 | Type 1 chain precursor structure (lacto-N-tetraosylceramide) |
| 47588004 | ^203^Lead |
| 47601000 | Blood group antigen Savery |
| 47603002 | Blood group antibody Pillsbury |
| 47617006 | Basic amino acid |
| 47618001 | (R)-Aminopropanol dehydrogenase |
| 47619009 | Phosphoramidate-hexose phosphotransferase |
| 47626009 | Blood group antibody Kemma |
| 47635002 | Lauryl isoquinolinium bromide |
| 47646004 | Antiarin |
| 47662005 | Blood group antigen h |
| 47663000 | Clindamycin palmitate hydrochloride |
| 47670000 | Colonic mucus |
| 47674009 | Blood group antigen Pr>1d< |
| 47676006 | ^39^Chlorine |
| 47677002 | Orange oil |
| 47691008 | Fibrin degradation product, first derivative |
| 47692001 | Blood group antigen Rm |
| 47702003 | Carboxylesterase |
| 47703008 | Lactose |
| 47707009 | Anion |
| 47711003 | Allyl chloride |
| 47714006 | Fibrinogen Troyes |
| 47716008 | Nucleotide pyrophosphokinase |
| 47729008 | Potassium chloride K^43^ |
| 47733001 | Blood group antibody Bradford |
| 47735008 | Chalcone isomerase |
| 47737000 | Valine dehydrogenase (NADP^+^) |
| 47769009 | Platelet antibody HPA-5 |
| 47773007 | D-Nopaline dehydrogenase |
| 47784000 | Blood group antibody IP |
| 47786003 | Haemoglobin Austin |
| 47788002 | Haemoglobin J-Medellin |
| 47799000 | ^126^Caesium |
| 47809000 | Arsenic |
| 47826006 | Thiourea |
| 47832001 | Alkaline phosphatase isoenzyme |
| 47834000 | Oxophenarsine hydrochloride |
| 47845002 | Glycoprotein 4-beta-galactosyltransferase |
| 47851007 | HLA-Aw69 antigen |
| 47853005 | Parachlorophenol |
| 47857006 | Quinine sulfate |
| 47860004 | HLA-A3 antigen |
| 47862007 | Schizozygine |
| 47888005 | Propionyl-CoA carboxylase |
| 47894002 | Tumour necrosis factor beta |
| 47899007 | Oxyhaemoglobin F |
| 47900002 | Adenylylsulphate reductase |
| 47901003 | 5-Trimethoxyamphetamine |
| 47910006 | Neurophysin |
| 47929000 | Haemoglobin M-Milwaukee-I |
| 47937008 | Ipecac syrup |
| 47946002 | Haemoglobin F-Heather |
| 47950009 | Taurocholic acid |
| 47974007 | Blood group antibody Tg^a^ |
| 47994003 | Immunoglobulin, GM>25< allotype |
| 47995002 | Alcohol soluble nigrosine stain |
| 47998000 | Haemoglobin Connecticut |
| 48006008 | Ion |
| 48041007 | Benomyl |
| 48050009 | Glycosylceramidase |
| 48051008 | Carnitine acetyltransferase |
| 48052001 | Enalaprilat |
| 48060000 | Blood group antigen Ritter |
| 48070003 | Phenylpiperidine derivative |
| 48078005 | Butyl aminobenzoate |
| 48095002 | Nicotinate dehydrogenase |
| 48102008 | 3alpha-Hydroxysteroid dehydrogenase |
| 48109004 | Blood group antigen Js^a^ |
| 48110009 | 4-Hydroxyphenylacetate 1-monooxygenase |
| 48111008 | Immunoglobulin, J piece |
| 48116003 | Blood group antigen Paris |
| 48131007 | Blood group antibody Neut |
| 48132000 | Fibrinogen New York I |
| 48140006 | Blood group antibody Whittaker |
| 48154003 | Blood group antibody Zwal |
| 48161004 | Galactosylgalactosylglucosylceramidase |
| 48170001 | HLA-Cw1 antigen |
| 48172009 | Cefamandole nafate |
| 48175006 | Sea-urchin-hatching proteinase |
| 48179000 | Haemoglobin T-Cambodia |
| 48181003 | Trimethylamine |
| 48184006 | Tropomyosin |
| 48199006 | Dimazole |
| 48207007 | Methylcytisine |
| 48209005 | ^232^Thorium |
| 48212008 | Haemoglobin Chemilly |
| 48214009 | Oncogene protein TCL5 |
| 48217002 | Complement regulator |
| 48244007 | L-Xylulose reductase |
| 48265001 | 1,3-Dichloro-5,5- dimethylhydantoin |
| 48270008 | Lymphocyte antigen CDw49f |
| 48271007 | ^105^Silver |
| 48282004 | Sorbose dehydrogenase |
| 48284003 | Antigen in Kell (KEL) blood group system |
| 48302003 | Methylcyclohexanone |
| 48323009 | Blood group antibody Schneider |
| 48324003 | Vinyl cyclohexene dioxide |
| 48332006 | Plant cyanogenic glycoside |
| 48341001 | ^192^Iridium |
| 48358006 | Haem oxygenase (decyclising) |
| 48366002 | Blood group antigen Rh39 |
| 48369009 | ^183^Tantalum |
| 48384000 | Amitriptyline hydrochloride |
| 48401006 | Blood group antigen I |
| 48416009 | Blood group antigen Green |
| 48417000 | HLA-Dw26 antigen |
| 48444005 | Freund's adjuvant |
| 48464000 | Blood group antibody Sw^a^ |
| 48474002 | Salbutamol sulfate |
| 48478004 | Aminoglycoside N^3'^-acetyltransferase |
| 48486004 | Immunoglobulin IgG4 |
| 48494006 | N-Acetylgalactosamine-4-sulphatase |
| 48517003 | Pepsin |
| 48540004 | Patent blue V sodium salt stain |
| 48551004 | Fusion oncogene protein |
| 48562004 | Monobutyl phenyl phenol sodium monosulphonate |
| 48581007 | Plastic reagent |
| 48583005 | Immunoglobulin E |
| 48590000 | 1,2-Cyclic-inositol-phosphate phospho-diesterase |
| 48593003 | Safrol |
| 48605006 | Glycolaldehyde dehydrogenase |
| 48618003 | Sodium para-aminohippurate |
| 48650008 | Procollagen galactosyltransferase |
| 48663002 | Alkylhalidase |
| 48682006 | Metridium proteinase A |
| 48686009 | Aluminium radioisotope |
| 48693008 | Phenaglycodol |
| 48699007 | Blood group antigen Carson |
| 48714008 | Palladium |
| 48727007 | Interleukin-4 |
| 48736006 | Ribitol teichoic acid |
| 48741003 | Toothpaste |
| 48751002 | Blood group antibody Can |
| 48753004 | Cefuroxime sodium |
| 48766004 | Glycerate kinase |
| 48779008 | Blood group antibody Hamet |
| 48798005 | Antigen in Lutheran (LU) blood group system |
| 48802006 | Chlorogenate hydrolase |
| 48815002 | Blood group antigen Shannon |
| 48821003 | Lymphocyte antigen CD19 |
| 48824006 | Aminoimidazolase |
| 48830006 | 2-Acylglycerol-3-phosphate acyltransferase |
| 48847007 | Haemolysin venom |
| 48861002 | ^99^Molybdenum |
| 48869000 | Blood group antigen Jordan |
| 48885005 | Vanadium pentoxide dust |
| 48893005 | Sodium dinitro-ortho-cresylate |
| 48895003 | ^113m^Indium |
| 48898001 | Haemoglobin Buenos Aires |
| 48910008 | ^21^Neon |
| 48915003 | Chitinase |
| 48919009 | Blood group antigen Block |
| 48931006 | Enoyl-[acyl-carrier-protein] reductase (NADPH) |
| 48940005 | Methopromazine |
| 48945000 | Oxalate decarboxylase |
| 48949006 | Haemoglobin Duan |
| 48968009 | Histidine aminotransferase |
| 48978007 | Caesium hydroxide |
| 48988008 | Prostaglandin PGE1 |
| 49003009 | Osmium radioisotope |
| 49009008 | NAPH cytochrome-c>2< reductase |
| 49010003 | Paraprotein |
| 49022000 | Merethoxylline procaine |
| 49028001 | Blood group antibody K16 |
| 49046007 | Human structural gene |
| 49053003 | Tuftsin |
| 49056006 | Sucrose alpha-glucosidase |
| 49060009 | mRNA (guanine-N^7^)-methyltransferase |
| 49067007 | Thymic neuromuscular function blocking agent |
| 49069005 | Lead isotope |
| 49106003 | HLA-DR1 antigen |
| 49115005 | Polyphosphate-glucose phosphotransferase |
| 49119004 | Blood group antigen Bryant |
| 49143001 | ^201m^Bismuth |
| 49145008 | Demecarium bromide |
| 49146009 | Cutaneous fluid |
| 49148005 | HLA-Cw11 antigen |
| 49163008 | Blood group antigen Sd^a^ |
| 49173005 | Oil of spike |
| 49174004 | ^85^Yttrium |
| 49185002 | Germanium radioisotope |
| 49193002 | Pyranose oxidase |
| 49208007 | Cinerin |
| 49212001 | Blood group antigen D 1276 |
| 49214000 | Concanavalin receptor |
| 49251006 | scyllo-Inosamine kinase |
| 49254003 | ^201^Bismuth |
| 49291009 | Glycine dehydrogenase (cytochrome) |
| 49313009 | Nialamide |
| 49314003 | Flavonol O^3^-glucosyltransferase |
| 49318000 | ^173^Hafnium |
| 49322005 | Haemoglobin F-Sardinia |
| 49327004 | Interferon |
| 49328009 | myo-Inositol 1-methyltransferase |
| 49344000 | Blood group antibody VK |
| 49352002 | Mediator of inflammation |
| 49354001 | Acetolactate synthase |
| 49358003 | Linoleate isomerase |
| 49371000 | Methscopolamine bromide |
| 49377001 | Blood group antigen Davis |
| 49378006 | Eccrine sweat |
| 49382008 | Oil of cherry laurel |
| 49383003 | Maltose acetyltransferase |
| 49389004 | Protoporphyrinogen III |
| 49399009 | Magnesium salicylate |
| 49419007 | Active C4b |
| 49426007 | Lewis acid |
| 49427003 | 3,5 Diiodothyronine |
| 49444004 | Maleic hydrazide |
| 49449009 | Blood group antibody Wimberly |
| 49451008 | Ethaverine |
| 49461001 | Haemoglobin Hobart |
| 49469004 | Phosphoribokinase |
| 49471004 | Diacetoxyscirpenol |
| 49477000 | Phosalone |
| 49478005 | ^195m^Mercury |
| 49495002 | HLA-A antigen |
| 49506005 | Gluconic acid |
| 49508006 | Heparitin-sulphate lyase |
| 49519009 | Immunoglobulin, F(ab')>2< fragment |
| 49529002 | UDP glucose 4,6-dehydratase |
| 49543007 | Succinate dehydrogenase |
| 49551005 | Oil of organum |
| 49559007 | Zinc pelargonate |
| 49560002 | Heptachloro-camphene |
| 49565007 | Disopyramide phosphate |
| 49568009 | Blood group antigen Terrell |
| 49576006 | 1,1,1-Trichloroethane |
| 49582009 | Blood group antigen Dantu |
| 49599005 | Private blood group antibody |
| 49602000 | Isoprenaline sulfate |
| 49613002 | Haemoglobin Malmo |
| 49616005 | Monoclonal antibody |
| 49633003 | Prolyl dipeptidase |
| 49636006 | Lochia |
| 49643000 | Oil of cypress |
| 49653004 | Blood group antigen Taur |
| 49660005 | Methylmalonyl-CoA carboxyltransferase |
| 49677005 | HLA-Dw22 antigen |
| 49686000 | Propanediol dehydratase |
| 49687009 | Coriphosphine stain |
| 49695008 | Lead sulphide |
| 49702009 | Phenylacetaldehyde dehydrogenase |
| 49722008 | Somatostatin |
| 49724009 | Pyrvinium chloride |
| 49733006 | 2-Oxopent-4-enoate hydratase |
| 49739005 | n-1-Naphthyl-phthalamic acid |
| 49743009 | ^241^Californium |
| 49744003 | Blood group antibody M1^a^ |
| 49745002 | Adenosine diphosphate |
| 49772005 | Blood group antigen Simon |
| 49775007 | 15-Hydroxyprostaglandin dehydrogenase (NADP^+^) |
| 49777004 | bis-(Isopropylamido) fluorophosphate |
| 49797009 | ^193^Osmium |
| 49821006 | Immunoglobulin, KM>1< allotype |
| 49837000 | Blood group antigen Horn |
| 49839002 | Hexamethonium |
| 49846006 | Carboxymethyloxysuccinate lyase |
| 49849004 | Metrifonate |
| 49858006 | Lymphocyte antigen CDw52 |
| 49867006 | Leucine 2,3-aminomutase |
| 49869009 | Gonadotropin releasing factor |
| 49873007 | Tetrahymena aspartic proteinase |
| 49884000 | Barium isotope |
| 49889005 | Formiminoglutamic acid |
| 49893004 | Polyamine methylene resin |
| 49902002 | Haemoglobin Himeji |
| 49909006 | Mucus |
| 49912009 | Blood group antigen D^w^ |
| 49944008 | alpha Fetoprotein |
| 49952006 | 4-Dimethylaminoazobenzene |
| 49977007 | Lead compound |
| 49991001 | Blood group antigen Mateja |
| 49997002 | HLA-Bw59 antigen |
| 49998007 | Sufentanil |
| 50010001 | 4-Nitrobiphenyl |
| 50028004 | Blood group antibody Boston |
| 50045009 | Heparin sodium |
| 50062004 | Fuchsin basic stain |
| 50068000 | Phytochrome |
| 50073006 | Dimethylglycine dehydrogenase |
| 50095005 | Haemoglobin S |
| 50096006 | 3-Isopropylmalate dehydrogenase |
| 50100007 | Chrysotile |
| 50106001 | Formate dehydrogenase (cytochrome-c-553) |
| 50107005 | Immunoglobulin, GM>5< allotype |
| 50129009 | Haemoglobin St. Louis |
| 50139003 | Glycoprotein 6-alpha-L-fucosyltransferase |
| 50140001 | Choline acetyltransferase |
| 50142009 | NADPH-ferrihaemoprotein reductase |
| 50151001 | Flavoprotein |
| 50156006 | Blood group antigen Le^b^ |
| 50191003 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase |
| 50195007 | O-Acetylserine (thiol)-lyase |
| 50213009 | Chloride |
| 50218000 | Melarsonyl |
| 50221003 | Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase |
| 50233008 | gamma-Ketovaleric acid |
| 50254001 | Viral gene |
| 50272007 | Blood group antibody hr^s^ |
| 50298001 | ^235^Uranium |
| 50306007 | Borax |
| 50309000 | Sodium oxalate |
| 50352000 | Organic phosphorus compound |
| 50358001 | Heparin lyase |
| 50359009 | ^45^Calcium |
| 50371003 | Carnosine |
| 50374006 | ^120^Iodine |
| 50383001 | HLA-Bw76 antigen |
| 50418002 | Hexose oxidase |
| 50423002 | Formamidase |
| 50425009 | ^114^Indium |
| 50431007 | Cortisone alpha-reductase |
| 50456001 | Urine protein |
| 50470001 | Human genome |
| 50473004 | Female genital fluid |
| 50479000 | Soy protein-iron complex |
| 50480002 | Blood group antigen Ri^a^ |
| 50491009 | Yttrium isotope |
| 50502005 | ^194^Gold |
| 50507004 | N-phenylacetamide |
| 50512003 | Phospholipase A>1< |
| 50526007 | Blood group antibody S^D^ |
| 50533007 | Adenosine nucleosidase |
| 50550009 | 6-Phospho 2-dehydro-3-deoxygalactonate aldolase |
| 50580004 | Sulthiame |
| 50593009 | Casein |
| 50605001 | L-Amino-acid oxidase |
| 50622004 | Cholesterol esterase |
| 50627005 | Labetalol hydrochloride |
| 50641001 | Haemoglobin G-Taichung |
| 50656005 | Creatininase |
| 50661007 | Bismuth subgallate |
| 50665003 | Hydrocortisone butyrate |
| 50668001 | Oncogene protein TCRA |
| 50672002 | Hafnium |
| 50685004 | Adrenaline hydrochloride |
| 50700004 | Blood group antigen Heibel |
| 50706005 | Fibrinogen Malmoe |
| 50716002 | ^122^Antimony |
| 50735002 | Coagulation factor X Melbourne variant |
| 50750006 | Hexachlorobenzene |
| 50752003 | Blood group antibody Wiley |
| 50754002 | Trifluoperazine hydrochloride |
| 50762005 | Interleukin-1 |
| 50767004 | 5-Methylthioribose kinase |
| 50778007 | Haemoglobin J-Wenchang-Wuming |
| 50784005 | Intracisternal material, amorphous |
| 50791008 | Tetramethyl succinonitrile |
| 50825000 | Food colouring |
| 50848005 | Sulphamoxole |
| 50852005 | Seminal vesicle fluid |
| 50854006 | alpha-Amino-acid esterase |
| 50863008 | Plasma |
| 50864002 | Blood group antibody CE |
| 50898006 | UDPglucosamine 4-epimerase |
| 50899003 | Blood group antibody Je^a^ |
| 50912007 | Oncogene protein trk |
| 50914008 | Adamsite |
| 50925004 | Amidophosphoribosyltransferase |
| 50948009 | rRNA (guanine-N^1^)-methyltransferase |
| 50951002 | Neuropeptide Y |
| 50957003 | Leukopterin |
| 50969006 | Tetrahydrozoline hydrochloride |
| 50973009 | Metacycline hydrochloride |
| 50981005 | Haemoglobin Takamatsu |
| 50988004 | Lymphocyte antigen CD10 |
| 51034002 | Phosphoglycerate kinase |
| 51076005 | Fibrinogen Argenteuil |
| 51079003 | Pelargonic acid |
| 51090008 | NADH kinase |
| 51125005 | Diacetylaminoazotoluene |
| 51137007 | Sodium arsenate |
| 51139005 | Tetrabromo-o-cresol |
| 51148000 | Dicamba |
| 51161000 | Factor XIII |
| 51162007 | Holo-[acyl-carrier-protein] synthase |
| 51163002 | Lanosterol synthase |
| 51172005 | Cryofibrinogen |
| 51173000 | Muconolactone delta-isomerase |
| 51177004 | Citreoviridin |
| 51179001 | Alkyl dimethyl benzyl ammonium bromide |
| 51200005 | Strychnine |
| 51202002 | Sepiapterin deaminase |
| 51222003 | Blood group antigen IP>1< |
| 51224002 | Carmellose sodium |
| 51238009 | Lymphocyte antigen CD2R |
| 51242007 | Blood group antigen Riv |
| 51245009 | Barium propionate |
| 51248006 | Dihydroneopterin aldolase |
| 51250003 | Haemoglobin J-Buda |
| 51256009 | Cystathionine beta-synthase |
| 51260007 | Metabutoxycaine |
| 51262004 | Blood group antibody Donati |
| 51263009 | 3alpha-Hydroxy-5beta-androstane-17-one 3alpha-dehydrogenase |
| 51276003 | Blood group antibody Bothrops |
| 51280008 | Sebum |
| 51285003 | Haemoglobin J-Toronto |
| 51293003 | Blood group antigen rr-35 |
| 51303009 | (-)-Menthol dehydrogenase |
| 51304003 | Rubidium |
| 51305002 | Thymosin |
| 51311004 | Blood group antigen B 9208 |
| 51314007 | Hyponitrite reductase |
| 51321007 | Propylhexedrine |
| 51364000 | 2-Dehydro-3-deoxy-L-pentonate aldolase |
| 51366003 | Ammonium chloride |
| 51369005 | Phosmet |
| 51372003 | Blood group antibody An^a^ |
| 51379007 | Fibrinogen Alba/Geneva |
| 51386004 | Food preservative |
| 51389006 | Histidinol dehydrogenase |
| 51390002 | Haemoglobin F-Clarke |
| 51397004 | Haemoglobin Guizhou |
| 51405003 | Ammonia kinase |
| 51414008 | HLA-DR2 antigen |
| 51415009 | Blood group antibody Kn^a^ |
| 51419003 | Mucoprotein |
| 51420009 | Silicon |
| 51426003 | Vanadium radioisotope |
| 51437002 | 3-Deoxy-manno-octulosonate cytidylyltransferase |
| 51441003 | Reiterated gene |
| 51447004 | Blood group antibody Kam |
| 51462002 | Haematoporphyrin |
| 51466004 | Retinal isomerase |
| 51468003 | Blood group antibody Tajama |
| 51483008 | Naringenin-chalcone synthase |
| 51503008 | Rose oil |
| 51511003 | Blood group antigen Kosis |
| 51515007 | HLA-DRw antigen |
| 51542008 | Appendiceal contents |
| 51562000 | 2-Bromo-4-phenyl phenol |
| 51567006 | Sirius red F3B stain |
| 51569009 | Sulphaphenazole |
| 51598008 | Coproporphyrin |
| 51610006 | Quercetin O^3^methyltransferase |
| 51612003 | Hydrocortisone valerate |
| 51622009 | Adenine deaminase |
| 51644004 | Electrolytic agent |
| 51645003 | Blood group antibody Good |
| 51663003 | Plant mutagen |
| 51664009 | Metallic amalgam |
| 51674007 | ^241^Plutonium |
| 51704000 | Phospholipase C |
| 51708002 | Haemoglobin Rainier |
| 51718007 | HLA-Bw46 antigen |
| 51739000 | Ethyl biscoumacetate |
| 51765001 | Carbon monoxide |
| 51769007 | Pyrimidine-5'-nucleotide nucleosidase |
| 51770008 | Cyclic AMP receptor |
| 51774004 | ^123^Tin |
| 51775003 | Oestrone |
| 51776002 | Singlet oxygen |
| 51800004 | ^222^Radon |
| 51803002 | Fibrinogen Chapel Hill II |
| 51809003 | Blood group antibody Pantaysh |
| 51810008 | Proliferative inhibitory factor |
| 51824007 | NADH dehydrogenase |
| 51844001 | Amethocaine hydrochloride |
| 51856000 | Haemoglobin J-Sardegna |
| 51859007 | Organic thiocyanate insecticide |
| 51866008 | Protoporphyrin |
| 51873003 | Blood group antibody Lagay |
| 51874009 | Proline iminopeptidase |
| 51876006 | [Hydroxymethylglutaryl-CoA reductase (NADPH)] kinase |
| 51880001 | Isohexenylglutaconyl-CoA hydratase |
| 51888008 | Calcium salt |
| 51889000 | Oxaloglycolate reductase (decarboxylating) |
| 51905005 | Mustard |
| 51910009 | N-ethylmorpholine |
| 51913006 | Sorbose dehydrogenase (NADP^+^) |
| 51918002 | Haemoglobin Milledgeville |
| 51922007 | Magnetite |
| 51927001 | Dipropylene glycol methyl ether |
| 51931007 | Nail polish remover |
| 51934004 | Haemocyanin |
| 51941005 | Blood group antibody B |
| 51950007 | Antimitochondrial antibody |
| 51955002 | Asclepain |
| 51961004 | ^101^Palladium |
| 51963001 | Sulphite salt |
| 51964007 | Deoxydenylate kinase |
| 51965008 | Amsinckine |
| 51967000 | Sulphite reductase (NADPH) |
| 51974005 | Geranyl-diphosphate cyclase |
| 51990005 | Ganglioside galactosyltransferase |
| 52021000 | Tetrachlorobenzoquinone |
| 52024008 | Upper respiratory tract mucus |
| 52027001 | Crimidine |
| 52053009 | Epididymal fluid |
| 52062006 | Oxythioquinox |
| 52078008 | Epitope |
| 52081003 | Blood group antigen Griffith |
| 52086008 | Glycol |
| 52094001 | ^117m^Indium |
| 52104007 | Right upper lobe mucus |
| 52119008 | beta Endorphin preparation |
| 52126008 | Cortol |
| 52129001 | Protamine kinase |
| 52130006 | Quercetin |
| 52140009 | Oxybuprocaine |
| 52141008 | Coal dust |
| 52160001 | Lymphocyte antigen CD9 |
| 52162009 | 2-Oxobutyrate synthase |
| 52169000 | Platelet antibody HPA-2 |
| 52193005 | Blood group antibody Lindsay |
| 52209008 | Calcium citrate |
| 52210003 | Blood group antibody Manley |
| 52227006 | Platelet antibody HPA-3b |
| 52243004 | 1,3-Dichloro-2-propanol |
| 52258007 | Blood group antibody C^x^ |
| 52261008 | Haemoglobin Vanderbilt |
| 52264000 | Haemoglobin Yakima |
| 52269005 | Muramoyl-pentapeptide carboxypeptidase |
| 52275001 | Benactyzine |
| 52282002 | Histamine receptor |
| 52283007 | Peppermint oil |
| 52293000 | Abnormal haemoglobin, fusion defect |
| 52310000 | Blood group antibody Dp |
| 52313003 | Complement component C8 |
| 52315005 | o-Dichlorobenzene |
| 52326004 | Indoleacetaldoxime dehydratase |
| 52339000 | Nitrogen chloride |
| 52354006 | Zirconium compound |
| 52358009 | D-Serine dehydratase |
| 52360006 | Oestrone sulphotransferase |
| 52370008 | Psyllium |
| 52371007 | Haemoglobin Westmead |
| 52380007 | Glycine dehydrogenase |
| 52394008 | Potassium acetate |
| 52398006 | Phospho-2-dehydro-3-deoxyheptonate aldolase |
| 52401009 | Thrombin-antithrombin complex |
| 52408003 | Iodinated I^131^ gamma globulin |
| 52418008 | Chondroitin sulphotransferase |
| 52419000 | HLA-Bw72 antigen |
| 52422003 | 20-Hydroxyprogesterone |
| 52442007 | Betaine-homocysteine methyltransferase |
| 52454007 | Albumin |
| 52458005 | Haemoglobin J-Kaohslung |
| 52467005 | Blood group antigen Krog |
| 52470009 | Nickel salt |
| 52480008 | Alkenylglycerophosphoethanolamine hydrolase |
| 52493003 | ^129^Antimony |
| 52502000 | bis-(Trichlorohydroxy ethyl) urea |
| 52503005 | Argon |
| 52513002 | Haemoglobin Ferndown |
| 52518006 | Amino acid |
| 52525004 | Pyrimidine-nucleoside phosphorylase |
| 52541003 | Proline |
| 52546008 | Perilymph |
| 52555006 | Blood group antigen Shier |
| 52560005 | Norleucine |
| 52573009 | Blood group antibody Tj^a^ |
| 52574003 | Amiodarone hydrochloride |
| 52587009 | ^113^ Silver |
| 52596009 | Inosamine-phosphate amidinotransferase |
| 52601000 | Deproteinated pancreatic extract |
| 52609003 | Haemoglobin Pontoise |
| 52610008 | Glucuronolactone reductase |
| 52625008 | Arginine |
| 52642002 | Peptide |
| 52646004 | Actinium isotope |
| 52679004 | Submandibular proteinase A |
| 52680001 | Hepatitis B surface antigen subtype adr |
| 52690009 | ^133m^Xenon |
| 52701005 | ^210^Thallium |
| 52717004 | Iodate salt |
| 52720007 | Bismuth compound |
| 52722004 | Biotinidase |
| 52733001 | Overlapping gene |
| 52736009 | Threonine |
| 52740000 | meso-Tartrate dehydrogenase |
| 52745005 | ^51^Chromium |
| 52752007 | ^85m^Strontium |
| 52764004 | Blood group antibody Cad |
| 52770005 | Acetoacetic acid |
| 52786003 | Immunoglobulin, hinge region |
| 52793004 | Liquid nitrogen |
| 52797003 | Non structural gene |
| 52800001 | Marine toxin |
| 52803004 | Trimeprazine tartrate |
| 52804005 | o-Nitro-p-phenylenediamine |
| 52806007 | Chenopodium oil |
| 52830009 | Glyceryl-ether monooxygenase |
| 52834000 | Haemoglobin A>2< Canada |
| 52836003 | Paraformaldehyde |
| 52841006 | Methyl malonic acid |
| 52850008 | Profenamine |
| 52854004 | Stilbene dye |
| 52860004 | Manganese radioisotope |
| 52881004 | Glucosaminate ammonia-lyase |
| 52885008 | Alphaprodine |
| 52886009 | Minocycline hydrochloride |
| 52905007 | L-Arabinokinase |
| 52912003 | Blood group antibody Marks |
| 52935000 | HLA-Bw42 antigen |
| 52959005 | ^108m^Silver |
| 52973001 | 3-Methyleneoxindole reductase |
| 52978005 | Coagulation factor II Brussels variant |
| 52991006 | Blood group antibody Bryant |
| 53005004 | Cerebroside |
| 53008002 | Acetic anhydride |
| 53022002 | Chaulmoogra oil |
| 53023007 | Leukotriene D |
| 53027008 | Dinitrotoluene |
| 53034005 | Coal tar |
| 53041004 | Alcohol |
| 53047000 | HLA-DR3 antigen |
| 53048005 | Haematin |
| 53052005 | Methazolamide |
| 53072000 | Leukotriene E |
| 53082004 | Blood group antibody Le^c^ |
| 53090004 | Sulphacytidine |
| 53117004 | Hepatitis delta virus antibody |
| 53130003 | Venous blood |
| 53136009 | Chloroquine phosphate |
| 53149004 | Hydrophilic ointment |
| 53158006 | Luteolin methyltransferase |
| 53164004 | Perchloryl fluoride |
| 53166002 | trans-Cinnamate 2-monooxygenase |
| 53171009 | Unleaded petrol |
| 53172002 | Protein-glucosylgalactosylhydroxylysine glucosidase |
| 53175000 | Oil of celery |
| 53207004 | Diiodofluorescein I^131^ |
| 53211005 | Cyanogen chloride |
| 53235000 | Protamine zinc insulin |
| 53246002 | Ethylene |
| 53252001 | Mullerian regression factor |
| 53268007 | Ipomea |
| 53278005 | Haemoglobin Mississippi |
| 53287001 | HLA-A32 antigen |
| 53289003 | Oil of savin |
| 53302008 | Platelet antibody HPA-1a |
| 53306006 | Glutamate synthase (NADH) |
| 53307002 | Blood group antigen Hu |
| 53315004 | ^68^Germanium |
| 53323002 | Histidine acetyltransferase |
| 53327001 | Blood group antibody Caw |
| 53331007 | Platelet antibody HPA-1b |
| 53353009 | Stibophen |
| 53368005 | Phosphatidylserine decarboxylase |
| 53382005 | B-cell antigen receptor |
| 53393007 | Bromine radioisotope |
| 53398003 | Staphylococcus toxin |
| 53404008 | Thyroid aspartic proteinase |
| 53405009 | Tripelennamine hydrochloride |
| 53409003 | Blood group antigen Sieb |
| 53410008 | Beer |
| 53415003 | Plant anthraquinone glycoside |
| 53426009 | Phosphoribosylamine-glycine ligase |
| 53468009 | Acetylenedicarboxylate hydratase |
| 53473003 | Apolipoprotein C |
| 53475005 | beta-Glucoside kinase |
| 53491008 | Aspergillus saitoi aspartic proteinase |
| 53493006 | Dimethyl chlorthal |
| 53499005 | Riboflavin mononucleotide |
| 53511009 | Tropaeolin OO stain |
| 53513007 | Psilocybine |
| 53517008 | ^249^Californium |
| 53519006 | Dichlorotetrafluoromethane |
| 53527002 | Alcoholic beverage |
| 53532001 | Caesium isotope |
| 53545002 | Blood group antibody Cr1 |
| 53553005 | HLA-DPw5 antigen |
| 53557006 | Blood group antibody Starcher |
| 53560004 | Zinc isotope |
| 53563002 | Bismuth telluride |
| 53577004 | Phthalylsulphacetamide |
| 53588005 | Elaterin |
| 53594002 | Abnormal haemoglobin, delta-chain variant |
| 53598004 | Blood group antibody Ge3 |
| 53606004 | IMP cyclohydrolase |
| 53609006 | Thiaminase |
| 53646005 | Fructose-6-phosphate |
| 53673006 | Captan |
| 53681007 | Colony-stimulating factor, granulocyte-macrophage |
| 53682000 | Endorphin |
| 53689009 | tRNA (adenine-N^1^)-methyltransferase |
| 53692008 | ^150^Gadolinium |
| 53699004 | Haemoglobin Alberta |
| 53700003 | ^67^Copper |
| 53716001 | Blood group antibody Kursteiner |
| 53749005 | Glutathione thiolesterase |
| 53777001 | Ethoxyquin |
| 53784009 | Low incidence antibody |
| 53794004 | Immunoglobulin, heavy chain fragment |
| 53806002 | ^205^Bismuth |
| 53817001 | Alkyl trimethyl ammonium chloride |
| 53831001 | 3-Carboxy-cis,cis-muconate cycloisomerase |
| 53834009 | Hemicellulose |
| 53845007 | Bromisoval |
| 53856007 | Single chain urokinase-like plasminogen activator |
| 53859000 | Methyl lomustine |
| 53871006 | Blood group antigen Kp^b^ |
| 53875002 | Colostrum |
| 53876001 | Blood group antibody Suhany |
| 53878000 | Diacetone alcohol |
| 53882003 | Blood group antigen McC^a^ |
| 53902004 | UDP-N-acetylglucosamine 2-epimerase |
| 53914007 | Acetyl-CoA acetyltransferase |
| 53934008 | Haemoglobin St. Lukes |
| 53946007 | Butene |
| 53951001 | Technetium Tc^99m^ oxidronate |
| 53962001 | beta 1C/A globulin |
| 53971005 | Blood group antibody Kuhn |
| 53990002 | 4-alpha-Glucanotransferase |
| 54005009 | Yeast ribonuclease |
| 54024007 | Duodenal juice |
| 54028005 | tRNA (cytosine-5)-methyltransferase |
| 54041009 | Safflower oil |
| 54045000 | Glyceraldehyde |
| 54062005 | Cephalexin hydrochloride |
| 54083004 | Iodic acid |
| 54086007 | Hexylresorcinol |
| 54103000 | Immunoglobulin, GM>18< allotype |
| 54107004 | Sandalwood oil |
| 54108009 | Sodium silicate |
| 54112003 | Haemoglobin Gainesville |
| 54140008 | Haemoglobin F-Dickinson |
| 54141007 | Psyllium seed |
| 54144004 | Factor IX complex preparation |
| 54152001 | Nitrite reductase |
| 54158002 | Procollagen-proline,2-oxoglutarate 3-dioxygenase |
| 54159005 | Blood group antigen Es^a^ |
| 54163003 | Diaminopimelate dehydrogenase |
| 54167002 | Haemoglobin Sabine |
| 54168007 | Plant quinolizidine alkaloid |
| 54170003 | ^74^Arsenic |
| 54172006 | Metaproterenol sulfate |
| 54175008 | Haemoglobin St. Claude |
| 54179002 | Strontium radioisotope |
| 54180004 | S protein complement component |
| 54188006 | Human placental lactogen |
| 54195002 | Tissue factor antibody |
| 54197005 | Cyclomethycaine |
| 54202003 | Oil of ginger |
| 54221006 | Orange G stain |
| 54223009 | Glycerol-3-phosphate acyltransferase |
| 54228000 | Fibrinogen Montreal I |
| 54235008 | Histamine |
| 54237000 | Lymphocyte antigen CD8 |
| 54239002 | Aconitate hydratase |
| 54245005 | Lithocholic acid |
| 54248007 | Formate kinase |
| 54252007 | Minor histocompatibility loci |
| 54256005 | Aluminium isotope |
| 54313002 | ^184^Tantalum |
| 54323006 | Glycogen (starch) synthase |
| 54331001 | Isooctyl alcohol |
| 54338007 | Type 1 H substance |
| 54340002 | Antimony potassium tartrate |
| 54343000 | Blood group antibody Ryan |
| 54346008 | D-Arginase |
| 54351002 | Glutamine phenylacetyltransferase |
| 54352009 | Histoplasmin |
| 54353004 | Blood group antigen Hall J |
| 54370007 | Coagulation factor IX Long Beach variant |
| 54371006 | Alkyl mercuric chloride |
| 54375002 | Oncogene protein LYL |
| 54378000 | Factor IX |
| 54390003 | Exodeoxyribonuclease V |
| 54396009 | Leptodactylin |
| 54401008 | Adenosylmethionine-8-amino-7-oxononanoate aminotransferase |
| 54413003 | Blood group antibody Heibel |
| 54416006 | von Willebrand receptor |
| 54423007 | Testosterone 17beta-dehydrogenase (NADP^+^) |
| 54428003 | Peptide-tryptophan 2,3-dioxygenase |
| 54432009 | Alizarin blue S stain |
| 54434005 | Haemoglobin Russ |
| 54442006 | Right pleural fluid |
| 54446009 | Lysolecithin |
| 54456008 | Ribonuclease F |
| 54462003 | Direct reacting bilirubin |
| 54465001 | Lymphocyte antigen CD45RB |
| 54475003 | Blood group antibody Lu16 |
| 54481006 | HLA-B antigen |
| 54506001 | Galactitol dehydrogenase |
| 54508000 | Ferrocholinate |
| 54517000 | Hydrogen selenide |
| 54524004 | Blood group antigen Er^a^ |
| 54526002 | Acetate |
| 54534008 | 1-Chloro-1-nitropropane |
| 54543004 | Plant triterpene |
| 54546007 | Blood group antibody Jk^b^ |
| 54548008 | Dichlobenil |
| 54557002 | Blood group antigen Lagay |
| 54563006 | Dental cement |
| 54579007 | Deoxy adenosine diphosphate |
| 54588003 | Croton oil |
| 54592005 | Angiotensinogen |
| 54600003 | Haemoglobin F-Hull |
| 54628009 | D-Xylulose reductase |
| 54633008 | ^232^Uranium |
| 54643006 | Thiosulphate-thiol sulphurtransferase |
| 54651009 | Maneb |
| 54661002 | Alkyl sodium sulphonates |
| 54663004 | Active C3b |
| 54669000 | Dihydropteridine reductase |
| 54673002 | Perchloric acid |
| 54681001 | Blood group antigen Fy4 |
| 54708003 | Extended zinc insulin |
| 54717003 | Ethinamate |
| 54724002 | Bile acid AND/OR bile salt |
| 54729007 | Oxytetracycline hydrochloride |
| 54732005 | Persic oil |
| 54751004 | Chloroacetic acid |
| 54753001 | Secondary amyl acetate |
| 54760007 | Bryonin |
| 54769008 | Serine acetyltransferase |
| 54774000 | O-Succinyl homoserine (thiol)-lyase |
| 54788001 | Haemoglobin F-Texas-II |
| 54791001 | Metanil yellow stain |
| 54800000 | Guanidinoacetate kinase |
| 54804009 | ^181^Tungsten |
| 54808007 | Cobalt |
| 54813006 | Blood group antigen Jr^a^ |
| 54821000 | Tryptophan |
| 54832000 | Fructose-bisphosphatase |
| 54835003 | Lithium chloride |
| 54841005 | Hydrocyanic acid |
| 54843008 | Plant terpene |
| 54850007 | Blood group antibody Doughty |
| 54855002 | Blood group antigen Gomez |
| 54871002 | Acyl-lysine deacylase |
| 54894001 | ^228^Radium |
| 54901002 | Acetylesterase |
| 54911009 | GDPglucosidase |
| 54918003 | Dialkyl sodium sulphosuccinate |
| 54932001 | Thymol |
| 54939005 | Dimethylmalate dehydrogenase |
| 54941006 | Adenosine phosphate |
| 54965009 | Haemoglobin Porto Alegre |
| 54966005 | Phenyl ether-biphenyl vapour mixture |
| 54968006 | Tetraethyl dithiopyrophosphate |
| 54976008 | Phenyl ether |
| 54994002 | 1,3-beta-Oligoglucan phosphorylase |
| 55035009 | Blood group antibody Kopman |
| 55036005 | HLA-Aw66 antigen |
| 55049000 | Carbon trichloride |
| 55090002 | Chondro-4-sulphatase |
| 55092005 | Blood group antigen Sw^a^ |
| 55100009 | Blood group antigen M>1< |
| 55110000 | Pentasodium tripolyphosphate |
| 55117002 | ^137^Caesium |
| 55119004 | Immunoglobulin IgA1, H chain |
| 55122002 | Blood group antigen Tg^a^ |
| 55123007 | Diphtheria toxin |
| 55124001 | Molindone hydrochloride |
| 55128003 | Allethrins |
| 55138008 | Permanganate salt |
| 55159001 | Blood group antigen Binge |
| 55170008 | Uroporphyrin |
| 55201001 | Amine receptor |
| 55202008 | Methoxychlor |
| 55203003 | Loliine |
| 55224008 | Trichloropropane |
| 55261004 | Fumonisin |
| 55291009 | Pholcoline |
| 55302006 | Phosphoribosyl-ATP pyrophosphatase |
| 55316001 | Colestipol hydrochloride |
| 55324006 | Helium isotope |
| 55325007 | Homoisocitrate dehydrogenase |
| 55328009 | ^28^Magnesium |
| 55330006 | Subtilisin |
| 55354001 | Fructose-2,6-bisphosphatase |
| 55358003 | Thiouracil |
| 55368008 | Vanadium compound |
| 55386006 | Ricinine nitrilase |
| 55403000 | Sulphate adenylyltransferase |
| 55435000 | Nafcillin sodium |
| 55443005 | Hydroxycyclohexanecarboxylate dehydrogenase |
| 55450009 | Extracellular fluid |
| 55451008 | Blood group antigen Nou |
| 55452001 | Oxycodone |
| 55477000 | Glutathione |
| 55486005 | Phenazone |
| 55491006 | Strophanthin |
| 55494003 | Technetium Tc^99m^ albumin microspheres |
| 55495002 | Acidulated phosphate fluoride |
| 55500004 | Haemoglobin Perth |
| 55503002 | Sex steroid binding globulin |
| 55507001 | Iron oxide fumes |
| 55508006 | Bufogenin |
| 55515003 | Haemoglobin Köln |
| 55521004 | Phosphatidyl inositol |
| 55522006 | Fc receptor |
| 55527000 | Geraniol |
| 55535002 | ^113m^Cadmium |
| 55540005 | Ferrous carbonate |
| 55549006 | Blood group antigen Ridd |
| 55559007 | ^36^Chlorine |
| 55579004 | Coagulation factor II San Juan 2 variant |
| 55582009 | Arginase |
| 55583004 | Lathyrus poison |
| 55624000 | Inosine nucleosidase |
| 55633003 | Unstable haemoglobin |
| 55636006 | Octyl cresol |
| 55657003 | Oestradiol 17alpha-dehydrogenase |
| 55660005 | Blood group antigen f |
| 55667008 | UDP-N-acetylmuramoylalanyl-D-glutamyl-lysine-D-alamyl-D-alanine ligase |
| 55683008 | Haemoglobin Kokura |
| 55691004 | Dibenzocycloheptane derivative |
| 55695008 | Blood group antigen Kemma |
| 55700001 | Nylon |
| 55706007 | Fibrinogen Wiesbaden |
| 55723003 | Fibrin degradation product, intermediate derivative |
| 55724009 | Potassium salt |
| 55727002 | Barium dust |
| 55729004 | Blood group antibody At^a^ |
| 55741006 | Hexamine hippurate |
| 55753005 | Furfuraldehyde |
| 55755003 | Blood group antigen Pollio |
| 55762007 | Acrylic acid |
| 55763002 | Micrococcal nuclease |
| 55789002 | Porphobilinogen |
| 55792003 | Rotenone |
| 55793008 | Anileridine |
| 55795001 | HLA antigen abnormal |
| 55808004 | Malonate-semialdehyde dehydrogenase (acetylating) |
| 55813000 | 4-Enoyl-CoA reductase (NADPH) |
| 55814006 | Iodinated I^131^ aggregated albumin |
| 55816008 | Amino alcohol |
| 55831004 | Xylene cyanol FF stain |
| 55835008 | Blood group antibody Wu |
| 55840000 | CMP-N-acetylneuraminate-alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase |
| 55848007 | Blood group antibody Gon |
| 55877008 | Haemoglobin Fort Gordon |
| 55880009 | p-Toluenediamine |
| 55882001 | White wax |
| 55884000 | ^189m^Osmium |
| 55886003 | Cytosol aminopeptidase |
| 55895006 | Soft coal |
| 55900005 | Fatty-acid peroxidase |
| 55902002 | Benzyl alcohol |
| 55917003 | Glucosamine kinase |
| 55922003 | Blood group antigen Ge2 |
| 55939001 | Dihydrosphingosine |
| 55944008 | Niridazole |
| 55946005 | Pectin |
| 55951004 | ^38^Chlorine |
| 55972001 | Silicate salt |
| 56003000 | Glycerol-3-phosphate dehydrogenase (NAD(P)^+^) |
| 56006008 | Indium^113^ oxoquinoline platelet label |
| 56022009 | Right middle lobe mucus |
| 56024005 | Methylmalonyl-CoA mutase |
| 56025006 | D-Lactaldehyde dehydrogenase |
| 56065005 | Spermaceti |
| 56066006 | Turacin |
| 56071004 | Blood group antigen Thompson |
| 56085009 | Hyoscyamine sulfate |
| 56104009 | D-Lysine 5,6-aminomutase |
| 56114000 | HLA-Dw6 antigen |
| 56117007 | Air bubble |
| 56139009 | Glutaminyl-tRNA cyclotransferase |
| 56146000 | Androstenedione |
| 56147009 | Bufotenine |
| 56150007 | ^243^Plutonium |
| 56156001 | Desoxycorticosterone acetate |
| 56158000 | ^58m^Cobalt |
| 56163001 | Burr |
| 56167000 | Potassium radioisotope |
| 56181003 | Chlorinated hydrocarbon |
| 56227008 | Trolnitrate phosphate |
| 56232009 | HLA-Dw10 antigen |
| 56248005 | Blood group antigen Kp^c^ |
| 56261005 | Hydroxy phenylpyruvic acid, para |
| 56282004 | 2,3-Dihydroxybenzoate 2,3-dioxygenase |
| 56286001 | Blood group antibody Bouteille |
| 56297001 | Dextropropoxyphene hydrochloride |
| 56312005 | HLA-Cw10 antigen |
| 56314006 | Silver fluoride |
| 56325002 | Carbromal |
| 56328000 | Fibrinogen Homberg III |
| 56339002 | Saprol |
| 56352007 | Fibrinogen Giessen I |
| 56355009 | Clostridium histolyticum collagenase |
| 56362000 | L-Gulonolactone oxidase |
| 56363005 | Adenosine kinase |
| 56374001 | Plasminogen activator inhibitor-2 |
| 56382001 | Haemoglobin G-Galveston |
| 56383006 | Leucocyanidin |
| 56389005 | Etafedrine |
| 56410003 | Heterophil antibody |
| 56412006 | Arsine |
| 56414007 | Galactolipase |
| 56427006 | Metallic alloy |
| 56436005 | Sulphanilamide |
| 56448008 | Kallidin I |
| 56455005 | Anthranilate synthase |
| 56471005 | Colonic vomitus |
| 56473008 | Ethyl dipropylthiocarbamate |
| 56475001 | Disodium indium^111^ |
| 56489006 | Blood group substance |
| 56499001 | Blood group antigen Ul^a^ |
| 56516007 | Very low density lipoprotein |
| 56521005 | Lymphocyte antigen CDw49b |
| 56523008 | Sequoyitol dehydrogenase |
| 56534006 | Haemoglobin Chico |
| 56564003 | Fusion protein BCR-ABL |
| 56566001 | ^88^Krypton |
| 56567005 | Lymphocyte antigen CD39 |
| 56586002 | Skatole |
| 56590000 | Methylene biphenyl isocyanate |
| 56592008 | Haemoglobin C-Ziguinchor |
| 56594009 | di-trans,poly-cis-Decaprenylcistransferase |
| 56609000 | ^111^Indium |
| 56613007 | Bretylium tosylate |
| 56617008 | Blood group antibody Gerhany |
| 56634000 | Methyl formate |
| 56695001 | Guanosine-triphosphate guanylyltransferase |
| 56702000 | Pyruvate dehydrogenase (lipoamide) |
| 56714008 | Bombesin |
| 56715009 | Chlorcyclizine |
| 56723006 | Phenoxymethylpenicillin potassium |
| 56735005 | Blood group antibody Dropik |
| 56736006 | Methionine-tRNA ligase |
| 56740002 | Triiodotyrosine |
| 56747004 | Lymphocyte antigen CD40 |
| 56750001 | Blood group antibody In^a^ |
| 56755006 | Actinium compound |
| 56762002 | Stimulant laxative |
| 56773009 | Ichthyocrinotoxin |
| 56774003 | 4,5-Dihydroxyphthalate decarboxylase |
| 56781005 | Rhodotorula aspartic proteinase |
| 56796009 | Alloxan |
| 56822005 | Quaternary ammonium salt |
| 56838004 | NADH dehydrogenase (quinone) |
| 56846003 | N-Acetylglucosamine deacetylase |
| 56866007 | Blood group antibody Ri^a^ |
| 56867003 | Indium^113^ oxoquinoline RBC label |
| 56877001 | Kanamycin kinase |
| 56885005 | Blood group antibody Carson |
| 56886006 | Strontium compound |
| 56891007 | Independent high incidence blood group antigen |
| 56898001 | Protein S |
| 56899009 | ^125^Xenon |
| 56902007 | Methylitaconate delta-isomerase |
| 56904008 | Tungsten isotope |
| 56926009 | Haemoglobin J-Daloa |
| 56933009 | Blood group antibody Nijhuis |
| 56935002 | Alanine aminotransferase |
| 56942002 | Free fatty acid-albumin complex |
| 56945000 | Blood group antibody Fy3 |
| 56958004 | Barium compound |
| 56980001 | Haemoglobin Rahere |
| 57031001 | 1,1,-Dichloropropane |
| 57037002 | Fibrin degradation product, small peptide |
| 57040002 | Dibutyl adipate |
| 57051002 | Haemoglobin C-Harlem |
| 57056007 | Alkaline phosphatase |
| 57064001 | Fibrinogen Quebec I |
| 57076001 | Active C3bBb |
| 57078000 | H^+^-transporting ATP synthase |
| 57082003 | Arylesterase |
| 57090003 | Collagen type III |
| 57091004 | Methylisocitrate lyase |
| 57126000 | Glue |
| 57133000 | HLA antigen absent |
| 57150003 | Blood group antibody Eggenberger |
| 57155008 | Pyruvate dehydrogenase lipoamide-phosphatase |
| 57164003 | Dyclonine hydrochloride |
| 57178002 | Haemoglobin Henri Mondor |
| 57198007 | Lemon oil |
| 57199004 | Plasminogen activator inhibitor-1 |
| 57228007 | Blood group antibody Knoebnchild |
| 57244003 | 11-Ketoandrosterone |
| 57251007 | 2,6-beta-Fructan 6-levan biohydrolase |
| 57259009 | Gallbladder bile |
| 57268006 | Blood group antigen Oliver |
| 57272005 | Iodine compound |
| 57273000 | Zinc radioisotope |
| 57279001 | ^57^Nickel |
| 57281004 | Blood group antigen Re^a^ |
| 57294002 | Z line material |
| 57308006 | Acetylcholine |
| 57318001 | Blood group antibody Lu7 |
| 57362005 | 3-Oxoadipate enol-lactonase |
| 57377002 | Blood group antigen Lu9 |
| 57400003 | Phenol 2-monooxygenase |
| 57439007 | Blood group antigen JMH |
| 57440009 | Glycine hydroxymethyltransferase |
| 57442001 | Acylphosphatase |
| 57452002 | Homocitrate synthase |
| 57454001 | Metalloporphyrin |
| 57466007 | Phenyl cyclohexanol |
| 57471000 | Methyl flamprop |
| 57479003 | Air contaminant |
| 57519005 | Inorganic tin compound |
| 57528006 | Furylfuramide isomerase |
| 57529003 | Blood group antibody Marcus |
| 57533005 | Thioglucosidase |
| 57542003 | Glycerol dehydratase |
| 57562006 | dTDPdihydrostreptose-streptidine-6-phosphate dihydrostreptosyltransferase |
| 57573004 | Haemoglobin Beijing |
| 57574005 | Loperamide hydrochloride |
| 57575006 | Alkali-resistant haemoglobin |
| 57583000 | Naphazoline hydrochloride |
| 57595000 | Blood group antibody Kowanski |
| 57601008 | ^238^Plutonium |
| 57634005 | Iodophenol methyltransferase |
| 57635006 | N-butyl lactate |
| 57641004 | HLA-Dw2 antigen |
| 57649002 | Rhodopsin |
| 57678001 | Blood group antibody Jones |
| 57679009 | Ethanolamine-phosphate phospho-lyase |
| 57707004 | 2-Haloacid dehalogenase |
| 57720001 | Anise oil |
| 57743005 | Butyrate-CoA ligase |
| 57753006 | Brilliant yellow stain |
| 57763003 | Uridine |
| 57765005 | Aminopeptidase |
| 57795002 | Chemical element |
| 57808000 | beta-Thromboglobulin |
| 57813001 | Haeme |
| 57818005 | Scillaren B |
| 57827006 | Dihydroxyfumarate decarboxylase |
| 57830004 | Immunoglobulin, joining region |
| 57837001 | Blood group antibody Ridd |
| 57842009 | Coagulation factor X Friuli variant |
| 57843004 | Haemoglobin Okayama |
| 57851001 | Propyl nitrate |
| 57858007 | Guanosine diphosphate |
| 57859004 | Cyclohexamide |
| 57860009 | Haemoglobin Genova |
| 57868002 | Dichlorvos |
| 57880005 | Ascorbate 2,3-dioxygenase |
| 57894006 | Haemoglobin Lille |
| 57899001 | Zineb |
| 57911003 | Methotrimeprazine hydrochloride |
| 57912005 | Blood group antigen Enriquez |
| 57913000 | Anisotropine |
| 57915007 | Propylene oxide |
| 57916008 | Pyruvate oxidase |
| 57939002 | Benzene |
| 57959003 | ^205^Lead |
| 57960008 | Ferrochelatase |
| 57969009 | Deoxyadenosine kinase |
| 57979006 | Picrotoxin |
| 57986003 | Semisynthetic alkaloid |
| 58014006 | Diphosphomevalonate decarboxylase |
| 58017004 | Blood group antigen P1 |
| 58018009 | Cevadine |
| 58035008 | Blood group antibody Arun |
| 58043003 | NAD(P)^+^ arginine ADP-ribosyltransferase |
| 58046006 | gamma-Butyrobetaine, 2-oxoglutarate dioxygenase |
| 58049004 | Glutamate synthase (NADPH) |
| 58072002 | Monokine |
| 58089005 | mRNA (nucleoside-O^2^)'-methyltransferase |
| 58131001 | Alpha particle |
| 58132008 | Monodehydroascorbate reductase (NADH) |
| 58138007 | Thiamin pyrophosphokinase |
| 58139004 | Zirconium oxide |
| 58151002 | HLA-DPw4 antigen |
| 58152009 | Bacitracin C |
| 58163007 | Lactic dehydrogenase isoenzyme |
| 58165000 | Haemoglobin Gavello |
| 58173009 | Prostaglandin PGF2 alpha tromethamine |
| 58182003 | Blasticidin-S deaminase |
| 58186000 | Methyl phenyl ethyl hydantoin |
| 58187009 | Phosphoenolpyruvate carboxykinase (pyrophosphate) |
| 58195008 | Genetic code |
| 58202007 | Fructose |
| 58232004 | Blood group antibody Ven |
| 58233009 | Meclofenamate sodium |
| 58254002 | Blood group antigen Hg^a^ |
| 58257009 | D-Lactate dehydrogenase (cytochrome) |
| 58272008 | n-Acetyl muramic acid |
| 58279004 | Selenium hexafluoride |
| 58281002 | Gadolinium |
| 58292001 | Selenium sulfide |
| 58295004 | Inorganic chemical |
| 58305007 | Blood group antibody McC^a^ |
| 58313008 | Succinate-CoA ligase (GDP-forming) |
| 58319007 | Blood group antigen Kollogo |
| 58325006 | Mesuximide |
| 58339006 | Saccharopine dehydrogenase (NAD^+^,L-lysine-forming) |
| 58343005 | Cefonicid |
| 58345003 | Phosphoric acid |
| 58348001 | Sex chromatin |
| 58364009 | Blood group antibody HLA-A10 |
| 58368007 | Blood group antibody Englund |
| 58369004 | Pyrroline-5-carboxylate reductase |
| 58370003 | Coproporphyrinogen oxidase |
| 58376009 | Anisidine |
| 58397005 | Alkanal monooxygenase (FMN-Iinked) |
| 58402009 | HLA-A11 antigen |
| 58414001 | Haemoglobin Yusa |
| 58416004 | Kanamycin 6'-acetyltransferase |
| 58422008 | Methyl acrylate |
| 58441006 | Mannitol dehydrogenase |
| 58447005 | Tetrachlorodibenzofuran |
| 58449008 | Industrial smog |
| 58453005 | Blood group antigen Duvall |
| 58461000 | Metaraminol tartrate |
| 58466005 | Propionate CoA-transferase |
| 58505008 | Plant isoquinoline alkaloid |
| 58520002 | Collagen type I |
| 58529001 | Hydroxylamine reductase (NADH) |
| 58536000 | Antimony dimercaptosuccinate |
| 58541008 | ^24^Sodium |
| 58560001 | Blood group antigen Teremok |
| 58573002 | 2-Ethoxyethyl acetate |
| 58578006 | UDPgalacturonosyltransferase |
| 58591007 | Nucleoside-triphosphate-adenylate kinase |
| 58594004 | Blood group antigen Zwal |
| 58595003 | Carboxylic salt |
| 58597006 | DNA-deoxyinosine glycosidase |
| 58607005 | Neutron |
| 58613001 | Interleukin-3 |
| 58616009 | Githagenin |
| 58620008 | Sporidesmin |
| 58624004 | Fibrinogen Philadelphia |
| 58630004 | Protein-disulphide reductase (NAD(P)H) |
| 58631000 | Eriochrome blue black SE stain |
| 58644005 | Dolichol kinase |
| 58649000 | Cosmetic cream |
| 58652008 | Aspartylglucosylaminase |
| 58656006 | Ferredoxin-nitrite reductase |
| 58674002 | Naphthol |
| 58679007 | Blood group antibody Peacock |
| 58680005 | Glutamate acetyltransferase |
| 58687008 | p-tert-Butylphenol |
| 58693000 | Sodium bromide |
| 58721000 | Limonite |
| 58730008 | Factor VIII antibody |
| 58732000 | Red wine |
| 58739009 | Valine-pyruvate aminotransferase |
| 58745001 | ^195^Gold |
| 58753009 | Alanine |
| 58755002 | Water soluble anthracene brown stain |
| 58765008 | Uroporphyrin I |
| 58775006 | Phosphatidylinositol deacylase |
| 58782005 | ^85m^Yttrium |
| 58783000 | Amylase isoenzyme |
| 58787004 | Aspartate-tRNA ligase |
| 58789001 | Nicotinamidase |
| 58792002 | ^149^Gadolinium |
| 58793007 | Pinene hydrochloride |
| 58794001 | Monoterpenol acetyltransferase |
| 58796004 | ^211^Bismuth |
| 58799006 | Cucurbitacin |
| 58804001 | Fibrinogen Bern II |
| 58831003 | Haemoglobin Sawara |
| 58847001 | Thiamin-diphosphate kinase |
| 58876003 | ^186^Platinum |
| 58891001 | Salivary amylase |
| 58900009 | Properdin |
| 58907007 | Suxamethonium chloride |
| 58910000 | Fibrinogen Genova I |
| 58927008 | Beryllium fumes |
| 58955007 | Adenylate isopentenyltransferase |
| 58956008 | Trazodone hydrochloride |
| 58962003 | Chrysarobin |
| 58971007 | Petroleum sulphonate |
| 58975003 | Blood group antigen Dh^a^ |
| 58977006 | Magnesium salt |
| 58995009 | Pseudomonas aeruginosa neutral proteinase |
| 58996005 | Dieldrin |
| 59001002 | ^197m^Platinum |
| 59015000 | Guanosine 3',5'-bis(diphosphate) 3'-pyrophosphatase |
| 59025005 | Iridium compound |
| 59027002 | Peroxidase |
| 59031008 | Liquefied phenol |
| 59034000 | Trometamol |
| 59036003 | Silver radioisotope |
| 59040007 | Sarcina neutral proteinase |
| 59045002 | Haemoglobin Winnipeg |
| 59071003 | Vinyl ether |
| 59072005 | 3-Hydroxy-2-methylbutyryl-CoA dehydrogenase |
| 59074006 | Butyrate-acetoacetate CoA-transferase |
| 59075007 | Blood group antibody Paris |
| 59082006 | Urokinase |
| 59087000 | Coagulation factor XI variant type I |
| 59094002 | Melanin |
| 59111007 | Blood group antigen K22 |
| 59119009 | Ichthyosarcotoxin |
| 59134003 | Lymphogranuloma venereum antigen |
| 59147008 | Active C5b6 |
| 59149006 | Tetrodotoxin |
| 59161003 | Thymic erythropoietin suppression factor |
| 59162005 | Lysophosphatide |
| 59163000 | Fibrinogen Valencia |
| 59170000 | Dextrothyroxine |
| 59195004 | Site-specific methyltransferase (adenine-specific) |
| 59202000 | Actinium radioisotope |
| 59203005 | Thiol sulphotransferase |
| 59205003 | Blood group antibody Ge2 |
| 59208001 | Adrenergic receptor |
| 59224000 | Ethyl nitrophenyl thiobenzene |
| 59226003 | 4-2,4-Dichlorophenoxybutanoic acid |
| 59231001 | 5-Hydroxyfuranocoumarin O^5^-methyltransferase |
| 59241003 | 5-Oxoprolinase (ATP-hydrolysing) |
| 59243000 | Nucleotidase |
| 59259000 | ^191^Mercury |
| 59267008 | L-Fuconate dehydratase |
| 59268003 | Tubulin |
| 59271006 | C6 inactivator |
| 59287009 | ^180m^Hafnium |
| 59308003 | Dimethylsulphate |
| 59312009 | Blood group antigen Pr>a< |
| 59314005 | Pipradrol |
| 59318008 | Arsenic pentoxide |
| 59334006 | Cement, industrial |
| 59338009 | Methapyrilene |
| 59339001 | Haemoglobin Albany-Suma |
| 59347001 | Blood group antigen A 8306 |
| 59351004 | Citrate |
| 59353001 | ^187^Tungsten |
| 59365002 | Caraway oil |
| 59375004 | Lymphocyte antigen CD53 |
| 59386002 | Fetuin |
| 59406000 | Blood group antibody Krog |
| 59414006 | Stercobilin |
| 59431004 | Ketone |
| 59433001 | Human chorionic gonadotrophin |
| 59435008 | Creatine kinase isoenzyme |
| 59439002 | Conglutinogen |
| 59440000 | Diglycidyl ether |
| 59442008 | Nitric acid |
| 59485004 | Haemoglobin Koya Dora |
| 59488002 | Phenprocoumon |
| 59489005 | Calusterone |
| 59497003 | Choline sulphotransferase |
| 59501008 | Actinomycin lactonase |
| 59525000 | Haemoglobin J-Cape Town |
| 59526004 | Florantyrone |
| 59533004 | Food additive |
| 59541004 | ^175^Tantalum |
| 59542006 | Blood group antibody IB |
| 59545008 | Pesticide |
| 59549002 | Fibrinogen Milano II |
| 59560006 | Mepivacaine |
| 59570008 | Transferrin |
| 59584003 | Mercurous sulphate |
| 59595009 | Verdochromogen |
| 59605005 | Blood group antigen Whittaker |
| 59610009 | Left lower lobe mucus |
| 59718005 | N-Acylneuraminate-9-phosphate synthase |
| 59723005 | HLA-A31 antigen |
| 59732007 | Haemoglobin Perspolis |
| 59737001 | Blood group antibody Co^a^ |
| 59755005 | Muscarine |
| 59759004 | Bacitracin B |
| 59776000 | Calcium cyanide |
| 59779007 | Human chorionic gonadotropin, alpha subunit |
| 59787008 | Haemoglobin Creteil |
| 59801003 | Rhodium |
| 59804006 | Glycoprotein |
| 59808009 | Blood group antibody Man |
| 59815001 | Azoxybenzene |
| 59822009 | Histamine H2 receptor |
| 59835000 | Lymphocyte antigen CDw50 |
| 59840008 | Blood group antibody Zt^a^ |
| 59842000 | Nicotinate-nucleotide adenylyltransferase |
| 59844004 | ^42^Potassium |
| 59865005 | Complement component C1q |
| 59872006 | ^198^Thallium |
| 59880004 | Haemoglobin J-Calabria |
| 59882007 | Aminocaproic acid |
| 59888006 | Carnitine |
| 59895002 | Blood group antibody Tichmeyer |
| 59905008 | Isoantibody |
| 59906009 | Glucose dehydrogenase (pyrroloquinolinequinone) |
| 59924006 | Polynucleotide adenylyltransferase |
| 59937009 | Cephalothin sodium |
| 59938004 | ^208^Thallium |
| 59951009 | 4-Pyridoxolactonase |
| 59954001 | Oxaloacetate tautomerase |
| 59961002 | Eye liner |
| 59964005 | ^192^Gold |
| 59987002 | Polyoxyethelene 4 sorbitan monostearate |
| 60018006 | Amrinone lactate |
| 60047004 | Oncogene protein c-fms |
| 60052009 | Venom exonuclease |
| 60057003 | ^201^Thallium |
| 60061009 | Protein N-acetylglucosaminyltransferase |
| 60069006 | Plutonium compound |
| 60085001 | Chromatin |
| 60135007 | Homosalate |
| 60141000 | Ribonuclease P4 |
| 60153001 | gamma-Glutamyltransferase |
| 60175004 | Formate-tetrahydrofolate ligase |
| 60187006 | NADPH peroxidase |
| 60200001 | Glyoxylate reductase |
| 60208008 | Coagulation factor V |
| 60215000 | HLA-A2 antigen |
| 60244003 | 3-Dehydroretinol |
| 60245002 | ^240^Californium |
| 60253005 | Aminoacylase |
| 60260004 | Histidine |
| 60266005 | Chloroquine hydrochloride |
| 60273000 | ^220^Radon |
| 60289002 | Mepenzolate bromide |
| 60292003 | Blood group antigen I^D^ |
| 60300004 | Blood group antibody C^G^ |
| 60303002 | Dinitrobenzene |
| 60310008 | Mytilidase |
| 60323001 | Mercuric oxycyanide |
| 60343007 | D-Lyxose ketol-isomerase |
| 60344001 | Malonate-semialdehyde dehydrogenase |
| 60345000 | Cobalt hydrocarbonyl |
| 60349006 | Uridylic acid |
| 60351005 | Salicylate 1-monooxygenase |
| 60352003 | Anthocyanin |
| 60355001 | Haemoglobin Philly |
| 60364006 | Blood group antibody McC^b^ |
| 60373003 | Cathepsin H |
| 60376006 | Succinic acid |
| 60381002 | Nickel fluoride |
| 60403001 | beta-Amylase |
| 60407000 | Lymphocyte antigen CD46 |
| 60418000 | Serine dehydrogenase |
| 60424006 | Acetylserotonin methyltransferase |
| 60430006 | FSH receptor |
| 60441008 | Trypan blue stain |
| 60444000 | tRNA (guanosine-O^2'^)-methyltransferase |
| 60449005 | Putrescine oxidase |
| 60455000 | Racephedrine |
| 60457008 | Proprionic acid |
| 60459006 | Iron Fe^59^ labeled dextran |
| 60469000 | C>5b678< inhibitor |
| 60470004 | Blood group antigen Marcus |
| 60471000 | Sodium compound |
| 60489004 | Haemoglobin J-Habana |
| 60491007 | Blood group antigen Bothrops |
| 60500000 | Cysteine lyase |
| 60516003 | Blood group antibody McDermott |
| 60526005 | Acetyl salicylate |
| 60530008 | Aldehyde |
| 60543008 | ^78^Arsenic |
| 60544002 | Aminoamide |
| 60556001 | Glutamate-methylamine ligase |
| 60575006 | Blood group antibody Wiggins |
| 60577003 | Glucan 1,4-beta-glucosidase |
| 60596004 | Haemoglobin Providence |
| 60598003 | Operator gene |
| 60605004 | Hepatitis B e antigen |
| 60617002 | Nitrogenase (flavodoxin) |
| 60663008 | Phosphatidyl-N-methylethanolamine methyltransferase |
| 60702005 | Myelin protein |
| 60714002 | Fibrin degradation product, E fragment |
| 60717009 | Blood group antibody John Smith |
| 60722009 | Serine-sulphate ammonia-lyase |
| 60727003 | Miconazole nitrate |
| 60739006 | Waxoline blue stain |
| 60740008 | Dolichyl-phosphatase |
| 60760000 | Reverse T>3< |
| 60762008 | Cysteine-conjugate beta-lyase |
| 60764009 | Neovitamin A |
| 60769004 | Hard metal |
| 60772006 | Blood group antibody Rasmussen |
| 60792004 | HLA-Cw4 antigen |
| 60793009 | Smegma |
| 60803009 | Protocollagen |
| 60808000 | Fibrinogen Marburg |
| 60838006 | Blood group antigen Holmes |
| 60840001 | Blood group antigen Horw |
| 60842009 | Haemoglobin Agenogi |
| 60848008 | Blood group antibody Lu17 |
| 60860009 | Haemoglobin F-Caltech |
| 60868002 | Blood group antigen MZ 443 |
| 60872003 | Acetic naphthalene |
| 60874002 | Blood group antigen Au^a^ |
| 60884001 | Procollagen |
| 60885000 | Trisulphapyrimidines |
| 60886004 | Morphine sulfate |
| 60889006 | Haemoglobin Guangzhou-Hangzhou |
| 60904002 | HLA-Cw6 antigen |
| 60905001 | Salicylanilide |
| 60908004 | ^125^Tin |
| 60917004 | Cholinesulphatase |
| 60920007 | Fuchsin acid stain |
| 60924003 | Fibrinogen Paris II |
| 60925002 | Haemoglobin Tübingen |
| 60943003 | Glutamate-5-semialdehyde dehydrogenase |
| 60976004 | w-Hydroxydecanoate dehydrogenase |
| 60988002 | Tolmetin sodium |
| 61004005 | Blood group antigen Wiggins |
| 61010005 | Solvent |
| 61015000 | Blood group antibody Craig |
| 61024009 | Blood group antibody Bruno |
| 61025005 | Colloidal iodine |
| 61029004 | Haemoglobin Arlington Park |
| 61044003 | Acipenserin |
| 61045002 | Sedoheptulose |
| 61068006 | Thioflavine T stain |
| 61076008 | Haemoglobin Beth Israel |
| 61078009 | Progesterone receptor |
| 61088005 | Plastic |
| 61103002 | Choline-phosphate cytidylyltransferase |
| 61114004 | Chymase |
| 61116002 | Immunoglobulin, GM allotype |
| 61133009 | Cytochrome-c-lysine methyltransferase |
| 61149006 | 4-Acetamidobutyryl-CoA deacetylase |
| 61171001 | Maleylpyruvate isomerase |
| 61177002 | Arachidonate 15-lipoxygenase |
| 61178007 | Neamine |
| 61188008 | Extracellular fibril |
| 61190009 | Blood group antibody Payer |
| 61195004 | D-Glutaminase |
| 61201007 | Pheophytin |
| 61205003 | Molten metal |
| 61224000 | Deoxyribonuclease V |
| 61226003 | ^201^Lead |
| 61238007 | Creatine kinase isoenzyme, MM fraction |
| 61243000 | Orotidine-5'-phosphate decarboxylase |
| 61244006 | Monobasic potassium phosphate |
| 61245007 | Haemoglobin Cochin-Port Royal |
| 61268003 | Gastrointestinal contents |
| 61271006 | Blood group antibody s |
| 61275002 | Liothyronine |
| 61298005 | Acyl-CoA dehydrogenase (NADP^+^) |
| 61299002 | Enkephalin |
| 61306004 | Methylrosaniline |
| 61308003 | Putrescine carbamoyltransferase |
| 61321005 | Cancer-related substance |
| 61348006 | Lombricine kinase |
| 61357000 | Paramethadione |
| 61359002 | Thiosulfuric acid |
| 61360007 | Polymyxin B sulphate |
| 61384004 | Camphene |
| 61391001 | Temuline |
| 61398007 | Clofedanol |
| 61418009 | Nitroquinoline-N-oxide reductase |
| 61425002 | C reactive protein |
| 61429008 | Bismuth radioisotope |
| 61450004 | Dibromochloropropane |
| 61453002 | Glutarate-CoA ligase |
| 61454008 | Immune response gene |
| 61466002 | Uridine nucleosidase |
| 61467006 | Ribitol dehydrogenase |
| 61471009 | Chloride trifluoride |
| 61472002 | Collagen (substance) |
| 61479006 | Galactosylxylosylprotein 3-beta-galactosyltransferase |
| 61481008 | Amanitine |
| 61483006 | Azaribine |
| 61489005 | 1-Aminocyclopropane-1-carboxylate synthase |
| 61497003 | Latia-luciferin monooxygenase (demethylating) |
| 61505004 | Plant mitogen |
| 61527008 | Radium radioisotope |
| 61529006 | 4-Cresol dehydrogenase (hydroxylating) |
| 61540003 | Oil of hyssop |
| 61541004 | Dichlorophenoxy ethyl sulphate |
| 61566000 | Benzene 1,2-dioxygenase |
| 61573005 | Dehydro-L-gulonate decarboxylase |
| 61580007 | Red cell neutral endopeptidase |
| 61581006 | Carbendazim |
| 61588000 | Thymidine kinase |
| 61595009 | Octane |
| 61615004 | Aspergillus nuclease S>1< |
| 61617007 | 7alpha-Hydroxysteroid dehydrogenase |
| 61630008 | Chondroitin AC lyase |
| 61643008 | Isocitrate lyase |
| 61644002 | Solanain |
| 61655002 | Blood group antigen Kasamatsuo |
| 61664007 | Ribonuclease V |
| 61678008 | Fluphenazine hydrochloride (substance) |
| 61684006 | ^211^Radon |
| 61692002 | Chromoprotein |
| 61694001 | Ribonucleoside |
| 61709008 | Cinchophen |
| 61716009 | ^81m^Krypton |
| 61730004 | Ketotetrose-phosphate aldolase |
| 61731000 | Methyl isobutyl carbinol |
| 61736005 | Heavy metal compound |
| 61742009 | Biperiden lactate |
| 61765004 | Haemoglobin Altdorf |
| 61773008 | Lignocaine hydrochloride |
| 61789006 | Dye |
| 61795007 | Corticotropin-like intermediate lobe peptide |
| 61813008 | Fibrinogen Chapel Hill I |
| 61833007 | Blood group antibody Li^a^ |
| 61841007 | Complement activator |
| 61849009 | Disperse orange |
| 61863003 | Barium sulphide |
| 61864009 | Vinca alkaloid |
| 61871004 | Alanine-oxo-acid aminotransferase |
| 61872006 | Lactaldehyde reductase |
| 61899008 | Dextrothyroxine sodium |
| 61904007 | Phensuximide |
| 61905008 | Methylcyclohexanol |
| 61915002 | Blood group antigen Walin |
| 61925007 | Rubratoxin |
| 61936000 | Nicotinamide methyltransferase |
| 61944000 | Collagen type II |
| 61967003 | Haemoglobin C |
| 61971000 | Butyrate kinase |
| 61978006 | Blood group antibody Burrett |
| 61993005 | Allergoid |
| 61994004 | Haptoglobin 2-2 |
| 62003001 | Blood group antigen Boldog |
| 62004007 | Blood group antigen Lu8 |
| 62007000 | Blood group antigen Kowanski |
| 62027004 | Hexadecanol dehydrogenase |
| 62032003 | Dextransucrase |
| 62036000 | Titanium dioxide |
| 62038004 | HLA-DR antigen |
| 62039007 | Diclofenac sodium |
| 62044000 | Isopentenyl-diphosphate delta-isomerase |
| 62046003 | Pyrophosphate-protein phosphotransferase |
| 62053007 | Nylon 6 |
| 62059006 | Gastric contents |
| 62070004 | Dibromsalicylanilide |
| 62077001 | 2-Methoxyethanol acetate |
| 62097006 | Chlorate reductase |
| 62128007 | Kerosene |
| 62135004 | Protein xylosyltransferase |
| 62145002 | Fibrinogen Aarhus |
| 62150008 | Haemoglobin Sendagi |
| 62162007 | ^90m^Zirconium |
| 62167001 | Quinate dehydrogenase |
| 62168006 | Fibrinogen antibody |
| 62174006 | Fructose-1-6-phosphate |
| 62177004 | Tantalum compound |
| 62183001 | Collagen fibre |
| 62184007 | Haemoglobin Collingwood |
| 62194002 | Lung irritant chemical warfare agent |
| 62197009 | Nucleoside-diphosphate kinase |
| 62214005 | Phosphatidic acid |
| 62237004 | Mesoporphyrin |
| 62249003 | HLA-Cw5 antigen |
| 62252006 | Plasminogen |
| 62256009 | Bilirubin monoglucuronide |
| 62265002 | Acylagmatine amidase |
| 62267005 | Capsular-polysaccharide endo-1,3-alpha-galactosidase |
| 62298007 | Melanocyte hormone inhibiting factor |
| 62301006 | Thiamin oxidase |
| 62304003 | Mercuric sulphate |
| 62346007 | Phloretin hydrolase |
| 62352008 | 6-beta Hydroxycortisol |
| 62358007 | Blood group antibody Bio-5 |
| 62364000 | Monomethyl aniline |
| 62368002 | Eritrityl tetranitrate |
| 62384001 | Fibrinogen Oslo I |
| 62387008 | ^109m^Silver |
| 62412007 | Dipeptidyl peptidase IV |
| 62416005 | Formaldehyde transketolase |
| 62417001 | trans-Cinnamate 4-monooxygenase |
| 62421008 | Blood group antibody Henry |
| 62442005 | Chloriodised oil |
| 62443000 | Haemoglobin Christchurch |
| 62444006 | Cyclopentamine |
| 62451002 | Alcohol acetyltransferase |
| 62483008 | Hydroxycinnamate 4-beta-glucosyltransferase |
| 62486000 | ^10^Beryllium |
| 62492006 | Frangula |
| 62504002 | Antigen recognition site |
| 62506000 | Agavain |
| 62515007 | Heterophil antigen |
| 62517004 | Sodium chromate Cr^51^ |
| 62523009 | Blood group antibody e |
| 62543003 | Gallium |
| 62544009 | ^87^Krypton |
| 62545005 | Ammonium carbonate |
| 62547002 | ^251^Californium |
| 62563005 | Blood group antigen Anuszewska |
| 62569009 | Transferrin receptor |
| 62576004 | Carboxyhaemoglobin |
| 62600002 | Blood group antibody Bert |
| 62601003 | 3-Phosphoglycerate phosphatase |
| 62613008 | Blood group antigen Balkin |
| 62632002 | Blood group antibody Kx |
| 62649009 | Butyl fluazifop |
| 62652001 | beta-Aspartyldipeptidase |
| 62661001 | ^80m^Bromine |
| 62666006 | Histamine phosphate |
| 62673001 | Platelet antibody HPA-3a |
| 62680004 | Glycerophosphoinositol inositolphosphodiesterase |
| 62694003 | Aflatoxin |
| 62699008 | Complement component C5 |
| 62707007 | ^110^Silver |
| 62721009 | Fibrinopeptide A |
| 62741004 | Alkaline phosphatase isoenzyme, liver fraction |
| 62754006 | Sodium iodide |
| 62763008 | Teichoic acid |
| 62775003 | Fusion protein GAG-ONC |
| 62776002 | Fatty-acid synthase |
| 62797001 | Arginine kinase |
| 62800004 | Blood group antigen En^a^FS |
| 62812000 | Pharyngeal contents |
| 62817006 | Verruculogen |
| 62821004 | Hydroxybutyric acid |
| 62832004 | Blood group antigen Tollefsen-Oyen |
| 62841009 | Blood group antibody Stairwalt |
| 62848003 | Amphibian venom |
| 62854002 | Gastrin |
| 62873003 | Plant product |
| 62874009 | Bisalbumin |
| 62882009 | Haemoglobin A>2< Sphakia |
| 62885006 | Blood group antigen Ok^a^ |
| 62902008 | Oncogene protein L-MYC |
| 62915004 | Acrylonitrile |
| 62916003 | Polyvinylidene chloride |
| 62929003 | Blood group antibody Le^bL^ |
| 62934004 | Myxobacter AL-1 proteinase II |
| 62948004 | Haemoglobin J-Rajappen |
| 62957005 | ^237^Uranium |
| 62959008 | Immunoglobulin IgG1, H chain |
| 62963001 | Blood group antibody Rh41 |
| 62975006 | Methyl acetylene-propadiene mixture |
| 62998003 | Lymphocyte antigen CD74 |
| 63004003 | Phenylalanine |
| 63006001 | 3-Oxoacid CoA-transferase |
| 63026002 | Anti lymphocyte antibody |
| 63028001 | Indolelactate dehydrogenase (substance) |
| 63037001 | Phytotoxin |
| 63045006 | Berry |
| 63047003 | Blood group antigen K11 |
| 63083007 | Cyclobenzaprine hydrochloride |
| 63084001 | Clindamycin hydrochloride |
| 63089006 | Mannose |
| 63096008 | m^7^G(5')pppN pyrophosphatase |
| 63108002 | Dimethylallyltranstransferase |
| 63123007 | Oestrogen binding protein |
| 63133004 | Phenylhydrazine |
| 63134005 | 2,5-Dihydroxypyridine 5,6-dioxygenase |
| 63146009 | Blood group antigen Covas |
| 63155007 | Blood group antibody Rh33 |
| 63167009 | Warfarin sodium |
| 63169007 | Blood group antibody Fy^a^ |
| 63188000 | Carbenicillin indanyl sodium |
| 63203003 | Ethoxyzolamide |
| 63222007 | 2,4-Diaminopentanoate dehydrogenase |
| 63229003 | Blood group antigen Win |
| 63261004 | Chloroxuron |
| 63266009 | Blood group antibody Anton |
| 63271002 | Haemoglobin Lufkin |
| 63281003 | Enterobacter ribonuclease |
| 63282005 | Thiphenamyl |
| 63306009 | Immunoglobulin IgG2 |
| 63307000 | Lactoyl-CoA dehydratase |
| 63326008 | Inhibin hormone |
| 63330006 | Nonessential amino acid |
| 63341008 | Mevinphos |
| 63349005 | Zinc cyanide |
| 63350005 | Hepatitis B surface antigen subtype adw |
| 63360001 | ^89^Zirconium |
| 63366007 | Immune reactive locus |
| 63374008 | Haemoglobin Castilla |
| 63379003 | Coal tar pitch volatiles |
| 63383003 | Zinc stearate |
| 63399009 | Reduced glutathione |
| 63408009 | Cysteinyl-glycine dipeptidase |
| 63441007 | Isobutyl alcohol |
| 63447006 | Ribokinase |
| 63461001 | Cumene |
| 63478005 | Blood group antibody M^c^ |
| 63482007 | Gentamicin 3'-acetyltransferase |
| 63494003 | Inosine kinase |
| 63497005 | Dibutoline |
| 63522006 | Plant gene |
| 63527000 | Methionine decarboxylase |
| 63538000 | Blood group antigen Ny^a^ |
| 63545000 | Halazepam |
| 63559007 | Doxycycline calcium |
| 63591008 | Chromic sulphate |
| 63595004 | Blood group antigen Bultar |
| 63598002 | Blood group antigen Mi^a^ |
| 63606002 | Tin oxide |
| 63615009 | Bromdimethoxyamphetamine |
| 63621008 | Lymphocyte antigen CD47 |
| 63635005 | Blood group antigen Cross |
| 63652009 | Oncogene protein C-ABL |
| 63658008 | Methylenetetrahydrofolate-tRNA-(uracil-5)-methyltransferase (FADH>2<-oxidising) |
| 63664001 | Glycine methyltransferase |
| 63676001 | Arginine hydrochloride |
| 63679008 | 2-Amino-4-hydroxy-6-hydroxymethyl-dihydropteridine pyrophosphokinase |
| 63689007 | Jatropham |
| 63704005 | Thermophilic aminopeptidase |
| 63707003 | Haemoglobin F-Texas-I |
| 63718003 | Folic acid |
| 63730009 | Calcitonin |
| 63735004 | Immunoglobulin, KM>2< allotype |
| 63754004 | Yttrium |
| 63759009 | Trehalose-phosphatase |
| 63760004 | ^135^Caesium |
| 63766005 | Flour |
| 63768006 | Type II site-specific deoxyribonuclease |
| 63770002 | Haemoglobin Dunn |
| 63779001 | Difenidol |
| 63788005 | Blood group antibody Davis J |
| 63789002 | Carbamyl phosphate |
| 63793008 | Phosphorus compound |
| 63798004 | Haemoglobin Caribbean |
| 63809007 | Sphingosine beta-galactosyltransferase (substance) |
| 63813000 | Alkali |
| 63842008 | Dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase |
| 63852007 | Catkin |
| 63854008 | Isopropylmethylpyrimidyl diethyl thiophosphate |
| 63856005 | Coagulation factor IXa |
| 63857001 | Candida skin test antigen |
| 63862000 | 1, 2-Diacylglycerol |
| 63865003 | Blood group antigen Margaret |
| 63867006 | Blood group antigen Dav |
| 63868001 | ^193m^Mercury |
| 63869009 | Khellin |
| 63882001 | Aromatic solvent naphtha |
| 63889005 | Dichromate salt |
| 63896007 | Taurine salt of bile acid |
| 63920006 | Platelet antibody HPA-4 |
| 63927009 | Bromate salt |
| 63929007 | Alkali blue 6B stain |
| 63950003 | Immunoglobulin IgA2 |
| 63969008 | Regulator gene |
| 63984004 | Fibrinogen Awaji |
| 63999004 | Testolactone |
| 64011005 | Cyhalothrin |
| 64020001 | Blood group antibody A. Owens |
| 64026007 | Thiamin-phosphate kinase |
| 64029000 | Tienilic acid |
| 64032002 | Blood group antigen Tn |
| 64037008 | Blood group antibody Bregi |
| 64039006 | Cuprous oxide |
| 64053006 | Triokinase |
| 64055004 | 21-Hydroxysteroid dehydrogenase (NAD^+^) |
| 64070003 | Blood group antibody Schor |
| 64082007 | Plant toxalbumin |
| 64086005 | Formic acid |
| 64093009 | Blood group antigen Bx^a^ |
| 64095002 | Quinone oxime benzoyl hydrazine |
| 64096001 | Blood group antibody Giaigue |
| 64099008 | Oligo-1,6-glucosidase |
| 64105005 | Blood group antibody LW^a^ |
| 64112001 | Fast blue RR salt stain |
| 64128006 | Phosphoglycerate mutase |
| 64130008 | Troleandomycin |
| 64142003 | Spermine synthase |
| 64147009 | Nephrotoxic mycotoxin |
| 64170001 | Blood group antigen Whittle |
| 64179000 | Zinc chloride (substance) |
| 64182005 | Pituitary luteinising hormone |
| 64187004 | Cellulase |
| 64191009 | Naltrexone hydrochloride |
| 64197008 | Smoke |
| 64221009 | Tropinesterase |
| 64238008 | Blood group antigen Ce |
| 64242006 | Aerosol |
| 64244007 | Plant genome |
| 64257004 | D-Ribitol-5-phosphate cytidylyltransferase |
| 64259001 | Blood group antigen e |
| 64263008 | 3-Oxoadipate CoA-transferase |
| 64267009 | Haemoglobin Saki |
| 64273005 | HLA-A25 antigen |
| 64276002 | Calcium antacid |
| 64279009 | HLA-B13 antigen |
| 64288000 | Oncogene protein TCL1 |
| 64291000 | Blood group antibody Kamiya |
| 64365003 | Granulopoietin |
| 64385004 | Pyridoxal oxidase |
| 64416009 | Ganglioside GM>1< |
| 64426002 | Ribonuclease alpha |
| 64436005 | Fibrinogen Giessen III |
| 64437001 | Phycocyanin |
| 64447003 | Dihydroergocristine |
| 64449000 | Dhurrin |
| 64463006 | Ethotoin |
| 64471005 | Blood group antibody Lucy |
| 64472003 | Immunoreactive parathormone |
| 64488003 | Iodinated I^125^ human serum albumin |
| 64493000 | Immunoglobulin, GM>22< allotype |
| 64494006 | Dinoseb |
| 64499001 | Blood group antibody Lu8 |
| 64505000 | Uracil phosphoribosyltransferase |
| 64507008 | Amantadine hydrochloride |
| 64511002 | Cholestanetriol 26-monooxygenase |
| 64517003 | Yersinia pestis V antigen |
| 64520006 | Protamine sulfate |
| 64527009 | Orsellinate decarboxylase |
| 64530002 | Amyl acetate |
| 64535007 | Padimate A |
| 64538009 | Iodine heptafluoride |
| 64543002 | ^178^Tungsten |
| 64547001 | Naphthalene acetamide |
| 64563009 | Oncogene protein P190, BCR-ABL |
| 64566001 | HLA-Aw19 antigen |
| 64570009 | HLA-B44 antigen |
| 64601002 | Wood dust |
| 64602009 | Blood group antibody Kominarek |
| 64618003 | 2-Chloroethyl 2-(4-1,1-dimethylethyl) phenoxy-1 methylethyl ester |
| 64629004 | Antibody to hepatitis E virus |
| 64648000 | Herbicide oil |
| 64652000 | Horseradish peroxidase |
| 64659009 | Microbial metalloproteinases |
| 64669003 | Succinylsulphathiazole |
| 64686009 | Benzalkonium chloride |
| 64687000 | Halogenated hydrocarbon insecticide |
| 64699007 | Ferredoxin-NAD^+^ reductase |
| 64709009 | Dead space air |
| 64734009 | Starch (bacterial glycogen) synthase |
| 64763007 | 2-Dehydropantoyl-lactone reductase |
| 64769006 | Haemoglobin F-Marietta |
| 64778000 | Mammary fluid |
| 64780006 | Glycerophosphoinositol glycerophosphodiesterase |
| 64783008 | Chlormequat chloride |
| 64788004 | Blood group antigen Pr^a^ |
| 64790003 | Vertebrate collagenase |
| 64796009 | Malt soup extract |
| 64797000 | Blood group antibody Emma |
| 64806009 | Retinol dehydrogenase |
| 64813009 | Aminopentamide |
| 64821003 | Isobornyl thiocyanoacetate |
| 64823000 | Blood group antibody IP>1< |
| 64827004 | Quartz |
| 64843006 | Tungsten compound |
| 64845004 | Freund antigen |
| 64846003 | Blood group antigen i |
| 64856004 | Digestive system fluid |
| 64868008 | ^115m^Cadmium |
| 64869000 | Conotoxin |
| 64871000 | Insoluble immune complex |
| 64881001 | Phosphatidyl serine |
| 64888007 | Methicillin sodium |
| 64891007 | Urea cream |
| 64893005 | Immunoglobulin, L chain, kappa |
| 64895003 | Blood group antibody R.M. |
| 64896002 | Allergenic extract |
| 64901000 | Rubidium isotope |
| 64903002 | Methylguanidinase |
| 64918001 | HLA-Aw43 antigen |
| 64940005 | Ethoheptazine |
| 64974009 | Calcium isotope |
| 64991008 | Soluble berlin blue stain |
| 64993006 | Placental fluid |
| 65016007 | Tetrabromobenzoquinone |
| 65025001 | Pyridine |
| 65054007 | ^62^Zinc |
| 65070009 | L-Ascorbate peroxidase |
| 65081007 | Blood group antibody Tk |
| 65086002 | ^240^Americium |
| 65088001 | Propranolol hydrochloride |
| 65097002 | Immunoglobulin, GM>3< allotype |
| 65104003 | Furfuryl alcohol |
| 65114007 | Blood group antigen Boil |
| 65115008 | Sepia proteinase |
| 65123005 | Choline |
| 65125003 | Immunoglobulin, GM>20< allotype |
| 65134008 | Haemoglobin Athens-Ga |
| 65148008 | Xanthosine |
| 65149000 | Exhaled air |
| 65150000 | Autoantigen |
| 65151001 | Blood group antibody Bridgewater |
| 65156006 | Technetium Tc^99m^ pyrophosphate and polyphosphate |
| 65170006 | Arginine-tRNA ligase |
| 65183007 | Vitamin K |
| 65216001 | Cerebrospinal fluid |
| 65222005 | Calcium aminosalicylate |
| 65227004 | Blood group antigen Gilbraith |
| 65236000 | Blood group antigen Tx |
| 65246003 | Aldicarb |
| 65248002 | Blood group antigen HLA-A8 |
| 65249005 | Terphenyl |
| 65257008 | Phosphate butyryltransferase |
| 65269000 | Blood group antibody K20 |
| 65270004 | Hydroxyacylglutathione hydrolase |
| 65282008 | CMP-N-acetylneuraminate-galactosyldiacyl-glycerol alpha-2,3-sialyltransferase |
| 65283003 | Tryptophan 2-monooxygenase |
| 65285005 | Aflatoxin G |
| 65288007 | Haemoglobin Boyle Heights |
| 65302009 | Choline salicylate |
| 65311009 | ^196m^Thallium |
| 65345002 | Epoxy resin |
| 65386009 | Bocillus thermoproteolyticus neutral proteinase |
| 65395001 | Phosphoglucomutase |
| 65403003 | Novobiocin sodium |
| 65407002 | Androgen receptor |
| 65414000 | Haemoglobin Hamadan |
| 65418002 | Glucose-1-phosphate guanylyltransferase |
| 65423002 | Isosparteine |
| 65426005 | Benzaldehyde |
| 65428006 | Thyroid stimulating hormone |
| 65436002 | Light metal |
| 65445001 | Ethyl violet stain |
| 65449007 | Blood group antibody R>2<R>2<-202 |
| 65456001 | Blood group antibody Donavieski |
| 65458000 | Aminophenazone |
| 65459008 | Blood group antibody U^x^ |
| 65465008 | Fibrinogen Munich II |
| 65479000 | Inseparable antibody |
| 65480002 | Dihydroorotate dehydrogenase (substance) |
| 65485007 | Immunoglobulin, switch region |
| 65488009 | Citramalate CoA-transferase |
| 65495000 | Butopyronoxyl |
| 65509001 | Fibrinogen Stony Brook |
| 65512003 | Blood group antibody Thompson |
| 65527003 | ^190m>1<^Iridium |
| 65530005 | Oil of basil |
| 65543005 | Blood group antibody Haven |
| 65555004 | 11-beta Hydroxyandrostenedione |
| 65557007 | Graphite dust |
| 65580004 | Alizarin red S stain |
| 65586005 | Phosphorus oxychloride |
| 65589003 | Blood group antibody Fy^b^ |
| 65592004 | Nutmeg oil |
| 65601005 | Haemoglobin Kempsey |
| 65639002 | Uridine diphosphate |
| 65640000 | Sulphaemoglobin |
| 65644009 | Coke oven emission |
| 65665003 | Acylneuraminate cytidylyltransferase |
| 65669009 | Strong acid |
| 65674001 | ^190^Platinum |
| 65682001 | Proline dipeptidase |
| 65699000 | beta globulin |
| 65716002 | Blood group antigen Terry |
| 65730007 | Ponceau 3R stain |
| 65738000 | Coagulation factor VIIIa |
| 65741009 | Mepivacaine hydrochloride |
| 65746004 | Blood group antigen Lu5 |
| 65757009 | Non-protein nitrogen |
| 65773003 | Chloropicrin |
| 65777002 | Blood group antigen Joslin |
| 65799005 | Epiglottic mucus |
| 65802001 | Active complement enzyme |
| 65806003 | Blood group antibody Much (substance) |
| 65826004 | Oil of rue |
| 65863008 | Pigment |
| 65868004 | Propiomazine hydrochloride |
| 65874004 | Haemoglobin Le Lamentin |
| 65887005 | Blood group antigen Jk^a^ |
| 65889008 | Hypoxanthine phosphoribosyltransferase |
| 65898006 | Bothrops atrox serine proteinase |
| 65903005 | Haemoglobin Ohio |
| 65914008 | Glyceric acid |
| 65919003 | D-Ribulokinase |
| 65923006 | Pumice |
| 65925004 | Haemoglobin F-Bonaire-GA |
| 65932008 | Carbolineum |
| 65945007 | ^88^Zirconium |
| 65948009 | Aluminium ammonium sulphate |
| 65951002 | L-Ribulose-phosphate 4-epimerase |
| 65955006 | Dihydroxyphenylalanine |
| 65972004 | Daunorubicin hydrochloride |
| 65973009 | Haemoglobin Fort Worth |
| 65982003 | Triprolidine hydrochloride |
| 65988004 | [Acyl-carrier-protein] phosphodiesterase |
| 65992006 | Streptomycin 3''-kinase |
| 66004009 | Isoetarine |
| 66015004 | Transplantation antigen |
| 66037006 | Hydroxymethylglutaryl-CoA synthase |
| 66043008 | Pyruvate dehydrogenase (cytochrome) |
| 66044002 | Skin antiviral agent |
| 66086008 | Lepromin (substance) |
| 66103001 | Malyl-CoA lyase |
| 66124006 | Trypsin |
| 66128009 | Creatine kinase isoenzyme, BB fraction |
| 66143006 | alpha-Methyl styrene |
| 66147007 | Lymphocyte antigen CD14 |
| 66148002 | Sabadilla |
| 66153007 | 1-Alkylglycerophosphocholine acetyltransferase |
| 66178006 | ^117m^Cadmium |
| 66194004 | myo-Inositol oxygenase |
| 66196002 | Inositol 1-alpha-galactosyltransferase |
| 66202004 | Alkenylglycerophosphocholine hydrolase |
| 66203009 | Branched-chain-amino-acid aminotransferase |
| 66209008 | Haemoglobin Montgomery |
| 66228001 | Actinocongestin |
| 66234008 | Alanine-oxomalonate aminotransferase |
| 66235009 | Oncogene protein bcl-1 |
| 66240001 | Blood group antibody Parra |
| 66263006 | Lysine racemase |
| 66290002 | Benzthiazide |
| 66296008 | Haemoglobin J-Altgeld Gardens |
| 66322002 | Dextran 40 (substance) |
| 66365001 | N-m-tolyl phthalamic acid (substance) |
| 66384003 | Isophane insulin |
| 66389008 | Magnesium oxide |
| 66395009 | Blood group antigen Mitch |
| 66396005 | Fibrinogen Zürich II |
| 66404001 | Lochia rubra |
| 66428004 | Blood group antigen Wu |
| 66431003 | Alkyl dimethyl 3,4-dichlorobenzene ammonium chloride |
| 66440004 | HLA-DRw8 antigen |
| 66458005 | Thiol methyltransferase |
| 66460007 | Single stranded anti DNA antibody |
| 66461006 | Diamine aminotransferase |
| 66465002 | Silicon isotope |
| 66472001 | Fibrinogen Parma |
| 66481007 | Semisynthetic human insulin |
| 66497002 | Blood group antibody Weeks |
| 66506002 | Peptidoglycan endopeptidase |
| 66508001 | Quinine hydrochloride |
| 66509009 | Vancomycin hydrochloride |
| 66511000 | Blood group antigen Gf |
| 66524000 | Sphingomyelin |
| 66533003 | gamma-Glutamyl hydrolase |
| 66538007 | Glucan endo-1,2-beta-glucosidase |
| 66560005 | Rubredoxin-NAD^+^ reductase |
| 66562002 | Cigarette smoking tobacco |
| 66565000 | ^209^Bismuth |
| 66566004 | Gastrointestinal hormone receptor |
| 66573009 | Bordeaux mixture |
| 66586000 | Cadmium |
| 66587009 | Kallikrein |
| 66594007 | Phosphopentomutase |
| 66603002 | Glucagon |
| 66632004 | Lymphocyte antigen CD6 |
| 66639008 | Secobarbital sodium |
| 66644001 | Blood group antibody Sieb |
| 66653008 | Oxolinic acid |
| 66656000 | Phytomenadione |
| 66676006 | Vinyl carbazole |
| 66684005 | Sulphur dye |
| 66685006 | Pion |
| 66686007 | D-Arabinose dehydrogenase (NAD(P)^+^) |
| 66687003 | Tetrahydronaphthalene |
| 66716008 | ^234^Thorium |
| 66726001 | Acetaldehyde dehydrogenase (acetylating) |
| 66733001 | Hachimycin |
| 66734007 | Nicotinamide-nucleotide amidase |
| 66741001 | Fibrinogen Marseille |
| 66753002 | Heat labile bacterial toxin |
| 66756005 | ^115^Antimony |
| 66766002 | Dimethyl acetamide (substance) |
| 66770005 | Acid phosphatase isoenzyme, prostatic fraction |
| 66781008 | Cobalt dust |
| 66796007 | Oligoclonal protein |
| 66805006 | Haemoglobin J-Antakya |
| 66811009 | Plant aldehyde oil |
| 66815000 | Blood group antigen Baumler |
| 66817008 | Vasoprotectant |
| 66820000 | Haemoglobin J-Amiens |
| 66831008 | Blood group antibody Lu3 |
| 66832001 | Blood group antibody Vw |
| 66833006 | Coagulation factor II Clamart variant |
| 66843009 | Pentobarbital sodium |
| 66849008 | Cytotoxin venom |
| 66850008 | ^96^Technetium |
| 66875007 | Surface immunoglobulin |
| 66891005 | Cytotoxic antibody |
| 66901003 | Chloroacetaldehyde |
| 66906008 | Blood group antigen VS |
| 66925006 | Copper |
| 66945003 | Phosphite salt |
| 66956003 | ^122^Iodine |
| 67007009 | Blood group antigen McCall |
| 67008004 | Roridin |
| 67011003 | Cyanohydrin beta-glucosyltransferase |
| 67014006 | Glycerol kinase |
| 67025002 | Methionyl dipeptidase |
| 67029008 | Acetophenazine maleate |
| 67036009 | Plant growth regulator |
| 67054008 | Zinc phosphide |
| 67060008 | Vitamin D>3<, phosphate ester |
| 67064004 | HLA-Dw4 antigen |
| 67065003 | Serratia marcescens extracellular proteinase |
| 67079006 | Glucose |
| 67080009 | Glucuronate reductase |
| 67098008 | ^226^Actinium |
| 67100008 | GDP-4-dehydro-D-rhamnose reductase |
| 67127007 | Methyl benzene |
| 67131001 | Amino-acid racemase (substance) |
| 67152009 | Haemoglobin Torino |
| 67154005 | ^66^Nickel |
| 67164001 | Lymphocyte antigen CD54 |
| 67174003 | Bronchial mucus |
| 67194007 | Syngraft |
| 67200004 | Pyrophosphate-glycerol phosphotransferase |
| 67215003 | Isoflavone O^4'^-methyltransferase |
| 67216002 | Pipazetate |
| 67218001 | Complement component C4b |
| 67221004 | Azathioprine sodium |
| 67246004 | Carcinoembryonic antigen |
| 67250006 | Blood group antibody Inaba |
| 67265007 | Fumigant |
| 67266008 | Chromium isotope |
| 67271001 | Gene |
| 67273003 | Blood group antigen HLA-A7 |
| 67296003 | Pork insulin |
| 67324005 | Rice |
| 67339006 | Levansucrase |
| 67340008 | Haemoglobin Hiroshima |
| 67342000 | Blood group antibody Jo^a^ |
| 67345003 | Blood group antibody He |
| 67347006 | Levorphanol tartrate |
| 67355004 | Haemoglobin M-Saskatoon |
| 67366006 | Hair spray |
| 67368007 | Glycine carboxypeptidase |
| 67377000 | Pangamic acid |
| 67379002 | 2-Hexadecenal reductase |
| 67384008 | UTP-xylose-1-phosphate uridylyltransferase |
| 67386005 | Blood group antibody Rx |
| 67404005 | 1,2-beta-fructan 1^F^-fructosyltransferase |
| 67412002 | Phosphoenolpyruvate carboxykinase (GTP) |
| 67428007 | Benzfetamine |
| 67436003 | Blood group antibody Lu^b^ |
| 67449008 | Pyruvate synthase |
| 67451007 | Haemoglobin J-Rovigo |
| 67471003 | Jasmolin |
| 67473000 | Lithium hydroxide |
| 67485008 | Isoamylase (substance) |
| 67517005 | 25-Hydroxy ergocalciferol |
| 67518000 | ^195^Mercury |
| 67535001 | Thiamine monophosphate |
| 67538004 | Citrinin |
| 67552002 | Inorganic polysulphide compound |
| 67560001 | Polypyrrole |
| 67568008 | D-Lactate dehydrogenase |
| 67575009 | ^125m^Tellurium |
| 67584009 | Glutamate dehydrogenase (NADP+) |
| 67586006 | Nonylphenoxy P.H. ethanol |
| 67594004 | 4-Hydroxy-4-methyl-2-oxoglutarate aldolase |
| 67609008 | 8,11,14-Eicosatrienoic acid |
| 67610003 | Leukoagglutinin |
| 67618005 | Isopropyl ether |
| 67620008 | Quinoline |
| 67634008 | Hydrogenated terphenyls |
| 67636005 | Guaiacol |
| 67639003 | Sulphonmethane |
| 67650000 | Xenograft |
| 67652008 | 1-Alkyl-2-acetylglycerol cholinephospho-transferase |
| 67658007 | tRNA sulfurtransferase |
| 67659004 | Sequestered antigen |
| 67675001 | Eosinophilic chemotactic factor-anaphylaxis |
| 67686004 | Tripalmitin |
| 67687008 | 16-Hydroxysteroid epimerase |
| 67690002 | Sodium iodide I^123^ |
| 67695007 | Cytidylate kinase |
| 67713006 | Blood group antibody Le^x^ |
| 67719005 | Iodine isotope |
| 67771002 | Deoxyribonuclease II |
| 67774005 | Blood group antibody Le^a^ |
| 67785007 | tRNA (guanine-N^7^)-methyltransferase |
| 67803007 | Thiamin pyridinylase |
| 67812009 | [Pyruvate kinase] phosphatase |
| 67831003 | Haemoglobin J-Singapore |
| 67836008 | Chelidonine |
| 67844008 | 1-Methyladenosine nucleosidase |
| 67846005 | Scopoletin glucosyltransferase |
| 67866001 | Insulin |
| 67899004 | Complement component, classic pathway |
| 67903006 | D-Iditol dehydrogenase |
| 67906003 | Etiocholanolone |
| 67910000 | Hydroxylamine reductase |
| 67921009 | ^203^Bismuth |
| 67922002 | Serum |
| 67927008 | HLA-A29 antigen |
| 67928003 | Suramin sodium |
| 67938008 | Amnesic shellfish poison |
| 67956008 | Neutral red stain |
| 67957004 | Vinyl toluene |
| 67958009 | Blood group antibody Towey |
| 67980007 | Amcinonide |
| 67990004 | White wine |
| 67994008 | Kynurenate-7,8-dihydrodiol dehydrogenase |
| 68005004 | Chlorflurecol |
| 68020005 | dCTP pyrophosphatase |
| 68024001 | Cellulose acetate |
| 68039000 | beta-Naphthol |
| 68051003 | Dichloropropene |
| 68077006 | Rutin |
| 68101005 | Oxidoreductase |
| 68105001 | Decahydronaphthalene |
| 68110002 | Sphinganine kinase |
| 68117004 | Yttrium radioisotope |
| 68120007 | AMP nucleosidase |
| 68132006 | N-b-bis (2-chloroethyl)-2-naphthylamine |
| 68134007 | CDPdiacylglycerol pyrophosphatase |
| 68144009 | Formyltetrahydrofolate dehydrogenase (substance) |
| 68149004 | Blood group antigen Tofts |
| 68153002 | ^123^Xenon |
| 68174001 | Pyrroline-2-carboxylate reductase |
| 68175000 | Complement component C3a |
| 68185004 | Haemoglobin Abruzzo |
| 68198008 | Extracellular metabolic agent (substance) |
| 68224005 | Ammonium sulphamate |
| 68238003 | ^186^Iridium |
| 68249009 | Blood group antigen Kn^a^ |
| 68263003 | Janus green B stain |
| 68277000 | Phorate |
| 68283002 | beta-Fructofuranosidase |
| 68293009 | Methenamine mandelate |
| 68296001 | 1,6-Dihydroxycyclohexa-2,4-diene-1-carboxylate dehydrogenase |
| 68310009 | Lucanthone |
| 68321000 | Perthane |
| 68326005 | Central myelin |
| 68329003 | Fuller's earth |
| 68332000 | Digoxin immune fab |
| 68334004 | Pyrophosphate salt |
| 68356001 | Chlorine compound |
| 68357005 | Sodium hexafluorosilicate |
| 68374005 | Blood group antibody Rg^a^ |
| 68379000 | Cinnamon oil |
| 68396004 | Ethyl butyl propanediol |
| 68399006 | Fibrinogen Bondy |
| 68420003 | HLA-Dw13 antigen |
| 68429002 | Alanine-tRNA ligase |
| 68430007 | 21-Hydroxysteroid dehydrogenase (NADP^+^) |
| 68459007 | Crystal ponceau stain |
| 68475005 | Intermediate-acting insulin |
| 68484005 | Glyceraldehyde-3-phosphate dehydrogenase |
| 68498002 | Antibody |
| 68522008 | Blood group antigen Lucy |
| 68524009 | Tragacanth |
| 68527002 | Blood group antibody S1^b^ |
| 68537007 | Anti DNA histone antibody |
| 68540007 | Nicotine |
| 68561000 | Haemoglobin Hirose |
| 68580003 | ^59^Iron |
| 68593008 | CDPabequose epimerase |
| 68615006 | Bicarbonate |
| 68617003 | N-Acetyllactosamine 3-alpha-galactosyltransferase (substance) |
| 68620006 | Phosphorylase kinase |
| 68630002 | ^125^Iodine |
| 68639001 | Blood group antibody Wade |
| 68657000 | CDPglucose 4,6-dehydratase |
| 68669008 | Cyclobarbital |
| 68674000 | Folpet |
| 68680008 | Dexchlorpheniramine maleate |
| 68691001 | Sabadine |
| 68692008 | Complement component C3g |
| 68699004 | Phenylephrine bitartrate |
| 68715002 | Hexaethyl tetraphosphate |
| 68725007 | NAD^+^ nucleosidase |
| 68753007 | Amosite |
| 68762009 | Blood group antigen In^a^ |
| 68767003 | Blood group antibody Kp^b^ (substance) |
| 68783003 | HLA-DRw13 antigen |
| 68794004 | Uracil |
| 68803005 | 1-Pyrroline-5-carboxylate dehydrogenase |
| 68810004 | Methane monooxygenase |
| 68826003 | Allyl-alcohol dehydrogenase |
| 68831001 | Carbathiin |
| 68836006 | Phosphoadenylylsulphatase |
| 68837002 | Cadaverine |
| 68839004 | 2',3'-Cyclic-nucleotide 2'-phosphodiesterase |
| 68851002 | Lymphocyte antigen CD7 |
| 68868003 | Clostripain |
| 68871006 | Technetium isotope |
| 68909008 | Haemoglobin Nagasaki |
| 68929009 | Cadmium radioisotope |
| 68941002 | Blood group antigen Vil |
| 68945006 | Interleukin-2 |
| 68967007 | Iodocholesterol I^131^ |
| 68970006 | Glycerol-3-phosphate oxidase |
| 68971005 | Coproantibody |
| 68975001 | Blood group antibody Hey |
| 68990002 | Blood group antibody Taylor |
| 68991003 | Chromous salt |
| 68992005 | Cellulose |
| 69038000 | Biliverdin |
| 69042002 | Immunoconglutinin |
| 69049006 | Blood group antibody Meteja |
| 69050006 | Physostigmine salicylate |
| 69055001 | Acetate kinase (pyrophosphate) |
| 69059007 | Cone |
| 69076006 | Strontium chloride Sr^85^ |
| 69084005 | Butilate |
| 69088008 | Haemoglobin S-Antilles |
| 69089000 | ^52^Iron |
| 69091008 | Haemoglobin Rush |
| 69095004 | Cinnamyl-alcohol dehydrogenase |
| 69108009 | Haemoglobin Parchman |
| 69118004 | Blood group antibody Greenlee |
| 69122009 | Methyl dichlorfop |
| 69133007 | Sudan IV stain |
| 69136004 | Prostaglandin PGE3 alpha |
| 69149009 | Blood group antigen Be^a^ |
| 69151008 | Glutamate formiminotransferase |
| 69169004 | Vitamin K>3< |
| 69172006 | Cyclonite |
| 69180004 | Threonine dehydratase |
| 69184008 | Blood group antigen M^e^ |
| 69187001 | Pseudouridine kinase |
| 69211003 | Blood group antibody BOA 3150 |
| 69225002 | Nail polish |
| 69241001 | Butorphanol tartrate |
| 69268001 | ^131m^Tellurium |
| 69296007 | Octocrylene |
| 69298008 | Phospholipase A>2< |
| 69306002 | 6-Phytase |
| 69307006 | Heterochromatin |
| 69308001 | Vinylacetyl-CoA delta-isomerase |
| 69311000 | Immunoglobulin, Fc fragment |
| 69313002 | Fibronectin |
| 69314008 | Benzophenone |
| 69324000 | Phosphorus pentasulphide |
| 69340002 | Napropamide (substance) |
| 69342005 | Lymphocyte antigen CD27 |
| 69351002 | Methoxyphenamine |
| 69373009 | Blood group antigen Alda |
| 69411001 | Lymphocyte antigen CD11a |
| 69418007 | Platelet antigen HPA-5b (substance) |
| 69419004 | 3-Oxoacyl-acyl-carrier-protein synthase |
| 69433004 | Blood group antigen Lu7 |
| 69435006 | Blood group antibody Go^a^ |
| 69440003 | Cardiotonic drug |
| 69451003 | beta-D-Fucosidase |
| 69453000 | Haemoglobin Burke |
| 69457004 | Candida albicans aspartic proteinase |
| 69459001 | Thiamin-phosphate pyrophosphorylase |
| 69467009 | Formylaspartate deformylase |
| 69469007 | Lymphocyte antigen CD77 |
| 69473005 | Kveim-Silzbach antigen |
| 69504003 | beta-(9-Cytokinin)-alanine synthase |
| 69506001 | Oxyphenonium (substance) |
| 69507005 | Phthalic acid ester |
| 69513001 | 5-Dehydro-4-deoxyglucarate dehydratase |
| 69519002 | Ethylenediamine tetra-acetate |
| 69522000 | Pine tar |
| 69526002 | Noxious fumes |
| 69542009 | Blood group antigen Gibson |
| 69544005 | Haemoglobin Tours |
| 69553003 | Geraniol dehydrogenase |
| 69557002 | sn-Glycerol-3-phosphate 2-alpha-galactosyltransferase |
| 69563006 | Heat labile alpha>1< glycoprotein |
| 69583007 | Plant goitrogen |
| 69594006 | Dinitro-o-cyclohexyl phenol |
| 69606009 | Trimethyllysine,2-oxoglutarate dioxygenase |
| 69612004 | Fetal antigen |
| 69613009 | ^244^Plutonium |
| 69637009 | Waxes |
| 69644000 | Calcium arsenite |
| 69654001 | 3-Hydroxyaspartate aldolase |
| 69662009 | alpha Actinin |
| 69674008 | Agmatinase |
| 69680000 | Blood group antigen Co^a^ |
| 69700005 | tRNA (adenine-N^6^)-methyltransferase |
| 69703007 | Caesium radioisotope |
| 69705000 | Fibrinogen Bicêtre |
| 69719000 | Blood group antibody Le^b^ |
| 69750003 | ^63^Nickel |
| 69751004 | Galactinol-raffinose galactosyltransferase |
| 69755008 | Blood group antigen Mathison |
| 69756009 | Haemoglobin Vancouver |
| 69760007 | Imidazo pyruvic acid |
| 69764003 | (R)-3-Amino-2-methylpropionate aminotransferase |
| 69770009 | Iron radioisotope |
| 69780008 | Polynucleotide 5'-hydroxyl-kinase |
| 69783005 | Meglumine iodipamide |
| 69813006 | N-Acylglucosamine-6-phosphate 2-epimerase |
| 69814000 | Methylenetetrahydrofolate dehydrogenase (NADP^+^) |
| 69832000 | Lymphocyte antigen CD38 |
| 69839009 | Iodinated I^125^ povidone |
| 69844002 | 1-Chloro-1-nitroethane |
| 69870001 | Thallium isotope |
| 69871002 | Methylchlormethyl ether |
| 69893007 | Cyanazine |
| 69899006 | Oxymorphone hydrochloride |
| 69900001 | Blood group antigen Haase |
| 69901002 | Platelet-specific antibody |
| 69904005 | 2,6-Dihydroxypyridine 3-monooxygenase |
| 69908008 | Messenger RNA |
| 69932001 | Potassium chromate |
| 69936003 | Haemoglobin Tunis |
| 69940007 | Blood group antigen Mit |
| 69941006 | Blood group antibody Enriquez |
| 69958001 | Sodium sulfate |
| 69979001 | Blood group antibody Simon |
| 69992003 | Blood group antigen T |
| 69993008 | Mevaldate reductase |
| 69995001 | 3-Hydroxyoctanoyl-[acyl-carrier-protein]-dehydratase |
| 70001008 | Piperacetazine |
| 70012008 | L-Lactate dehydrogenase |
| 70016006 | Complementary DNA |
| 70032009 | Phosphoribosylaminoimidazole carboxylase |
| 70050002 | Haemoglobin H |
| 70059001 | Blood group antigen At^a^ |
| 70069007 | Patulin |
| 70077006 | Colony-stimulating factor, granulocyte-monocyte |
| 70078001 | Aromatic-hydroxylamine acetyltransferase |
| 70084003 | Methyl (n-amyl) ketone |
| 70086001 | Cholyl-carbon^14^ glycine |
| 70088000 | Tyrosine 2,3-aminomutase |
| 70095009 | Immunoglobulin isotype |
| 70106000 | Lipid |
| 70113000 | Branched-chain amino acid |
| 70150004 | Bile |
| 70154008 | Iodinated I^125^ sodium iodine |
| 70155009 | Immunoglobulin dimer |
| 70161007 | 3-Hydroxybutyryl-CoA dehydratase |
| 70168001 | Cupric sulfate |
| 70169009 | Ciclopirox olamine |
| 70170005 | Acetylornithine deacetylase |
| 70184000 | Deoxycytidine monophosphate deaminase |
| 70198008 | Mannitol-1-phosphate dehydrogenase |
| 70203000 | Adenine |
| 70213008 | Tryptophan synthase |
| 70214002 | Haemoglobin Moskva |
| 70221002 | Phosgene |
| 70237008 | Glucosamine |
| 70251008 | Ethyl di-(p-chlorophenyl) glycolate |
| 70265005 | Lathosterol oxidase |
| 70269004 | beta-Lysine 5,6-aminomutase |
| 70271004 | Coagulation factor X Stuart variant |
| 70276009 | Dimethylpropiothetin dethiomethylase |
| 70282007 | Acetylspermidine deacetylase |
| 70288006 | Methionine |
| 70290007 | Indium compound |
| 70304009 | Blood group antigen Crawford |
| 70309004 | Calcidiol 1-monooxygenase |
| 70319005 | Cobalt fumes |
| 70335003 | Blood group antigen Bi |
| 70338001 | Nepenthes aspartic proteinase |
| 70352004 | Blood group antibody Gill |
| 70354003 | Polypeptide |
| 70365008 | ^239^Uranium |
| 70367000 | Valine decarboxylase |
| 70368005 | Guanidinoacetate methyltransferase |
| 70391009 | Uridine diphosphate glucose |
| 70392002 | Prolactin inhibiting factor |
| 70400004 | Immunoglobulin, GM>4< allotype |
| 70403002 | Ribonucleotide |
| 70430007 | Blood group antigen Black |
| 70434003 | Complement factor Ba |
| 70438000 | ^88^Rubidium |
| 70440005 | Coagulation factor XII |
| 70444001 | Recessive gene |
| 70454002 | Prolactin |
| 70469001 | Blood group antigen L Harris |
| 70487003 | Hexosamine |
| 70489000 | Algal toxin |
| 70496003 | Lipoic acid |
| 70508008 | beta-Aspartyl-N-acetylglucosaminidase |
| 70519006 | Haemoglobin G-Philadelphia |
| 70520000 | Ponceau xylidine stain |
| 70524009 | Chloroallyl diethyldithiocarbamate |
| 70535004 | Arylamine glucosyltransferase |
| 70544003 | ^199^Gold |
| 70561000 | 2-Pivalyl-1,3- indandione |
| 70562007 | Leuprorelin acetate |
| 70563002 | Blood group antibody Walin |
| 70564008 | Allantoate deiminase |
| 70565009 | Sulphur dioxygenase |
| 70566005 | Glycine-oxaloacetate aminotransferase |
| 70570002 | Sulfadoxine |
| 70584007 | Blood group antigen Cr^a^ |
| 70587000 | beta Alanine |
| 70588005 | Acetoin dehydrogenase |
| 70592003 | 2-Nitropropane dioxygenase |
| 70597009 | Boron |
| 70608003 | UDPglucuronate decarboxylase |
| 70613004 | Zirconyl hydroxychloride |
| 70620006 | Plant glycoside |
| 70623008 | Fusion protein GAG-POL |
| 70643002 | Lead tetroxide |
| 70672001 | Glycerophosphocholine cholinephosphodiesterase |
| 70675004 | Lipopolysaccharide glucosyltransferase II |
| 70684004 | Oxybenzone and dioxybenzone |
| 70695005 | Dihydropyrimidinase |
| 70699004 | ^185^Tungsten |
| 70706009 | Troxerutin |
| 70724006 | Streptomycin 6-kinase |
| 70725007 | Paecilomyces varioti aspartic proteinase |
| 70726008 | Selenium compound |
| 70732003 | Trimethadione |
| 70734002 | alpha-L-Fucosidase |
| 70741008 | Blood group antigen K16 |
| 70744000 | Haemoglobin F-Jamaica |
| 70748002 | Haemosiderin |
| 70750005 | 3-Cyanoalanine hydratase |
| 70773002 | Dimethylallylcistransferase |
| 70785005 | Tryptophan-phenylpyruvate aminotransferase |
| 70787002 | Alcohol dehydrogenase (NADP+) |
| 70799009 | Pumiliotoxin B |
| 70800008 | Ecdysone oxidase |
| 70807006 | 1,2-Diacylglycerol 3-beta-galactosyltransferase |
| 70813002 | Milk |
| 70825004 | Somatomedin |
| 70828002 | Major histocompatibility complex |
| 70832008 | Immunoglobulin, GM>6< allotype |
| 70844006 | Haemoglobin Necker Enfants-Malades |
| 70846008 | Sarin |
| 70863007 | Alkylamidase |
| 70869006 | Blood group antigen Milne |
| 70886000 | Dicloxacillin sodium |
| 70888004 | Diethyl ketone |
| 70906001 | bis-(Diethylthiocarbamyl) disulphide |
| 70941002 | Chrome green |
| 70961008 | Neomycin sulfate |
| 70963006 | Antigen receptor |
| 70972003 | Active C5b6789 (substance) |
| 70990002 | Quinone |
| 71006008 | Blood group antigen Sia-b1 |
| 71012003 | UDParabinose 4-epimerase |
| 71017009 | Blood group antigen Todd |
| 71024005 | Blood group antigen Rh41 |
| 71027003 | Xylose isomerase |
| 71032002 | UDP-N-acetylmuramate dehydrogenase |
| 71043005 | Dicycloverine hydrochloride |
| 71058002 | Myxobacter AL-l proteinase I |
| 71076009 | Strontium iodide |
| 71079002 | Blood group antigen IA |
| 71082007 | Haemoglobin O-Indonesia |
| 71108007 | Cycrimine |
| 71128006 | Molybdenum |
| 71138001 | Sulfacitine |
| 71146000 | Blood group antibody Pr>2< |
| 71152004 | ^20^Neon |
| 71159008 | Pregnanetriol |
| 71165008 | Cicloheximide |
| 71168005 | alpha,alpha-Trehalose phosphorylase |
| 71183000 | Indomethacin sodium trihydrate |
| 71185007 | Nucleoprotein |
| 71211001 | Nucleotide |
| 71227008 | Siderite |
| 71230001 | Haemoglobin Mequon |
| 71242006 | Prephenate dehydrogenase (NADP^+^) |
| 71250002 | Butethamine |
| 71251003 | ^192^Platinum |
| 71263008 | Thioethanolamine acetyltransferase |
| 71281006 | Coagulation factor X Padua 1 variant |
| 71283009 | NADPH dehydrogenase (quinone) |
| 71288000 | Oncogene protein GP120, V-FMS |
| 71291000 | Superbine |
| 71334007 | Ethyl mercaptan |
| 71342008 | Mannan endo-1,6-beta-mannosidase |
| 71348007 | Deblocking antibody |
| 71365003 | beta Endorphin |
| 71368001 | Complement component C3d |
| 71370005 | HLA-DP antigen |
| 71374001 | Sodium hypochlorite |
| 71380009 | Benzarone |
| 71391002 | Ethanolamine ammonia-lyase |
| 71396007 | HLA-B17 antigen |
| 71411004 | Blood group antibody Dahl |
| 71415008 | Blood group antigen Wallin |
| 71417000 | Doxycycline hydrochloride |
| 71422000 | Clostridium perfringens toxin |
| 71423005 | Haemoglobin Queens |
| 71425003 | ^61^Copper |
| 71428001 | Oil of copaiba |
| 71430004 | Oil of pepper |
| 71437001 | Histone-lysine methyltransferase |
| 71454009 | Dimethylformamide |
| 71459004 | Fibrinogen Bern I |
| 71463006 | Polyethylene |
| 71470006 | N-Methyl-L-amino-acid oxidase |
| 71474002 | Immunoglobulin IgG3, H chain |
| 71482002 | Iron compound |
| 71494006 | Aspartate acetyltransferase |
| 71499001 | Dioscin |
| 71500005 | Haemoglobin S-Travis |
| 71522003 | ^192^Mercury (substance) |
| 71532005 | Indoleacetic acid (substance) |
| 71533000 | Pentazocine lactate |
| 71544008 | Polysaccharide |
| 71549003 | Interchromatin granule |
| 71560007 | ^129^Tellurium |
| 71561006 | Chelonitoxin |
| 71562004 | Mexicanain |
| 71563009 | Diphenoxylate hydrochloride |
| 71589009 | Benzidine |
| 71611009 | Lactate 2-monooxygenase |
| 71630009 | Coagulation factor IX Leyden variant |
| 71633006 | ^22^Sodium |
| 71636003 | Fibrinogen I^123^ |
| 71640007 | Acid phosphatase isoenzyme |
| 71647005 | ^14^Carbon |
| 71656002 | Haemoglobin Iwata |
| 71668006 | Chloroprocaine |
| 71669003 | Alkyl aryl polyether sulphonate |
| 71681004 | Blood group antigen Dugstad |
| 71686009 | Matrix of fibrocartilage |
| 71700008 | Haemoglobin J-Singa |
| 71714008 | Calcium gluceptate |
| 71726003 | Aflatoxin M |
| 71730000 | 5alpha-Hydroxysteroid dehydratase |
| 71756007 | Veratridine |
| 71763007 | Thallium |
| 71774003 | Gibberellin |
| 71789007 | Technetium |
| 71797000 | Lymphocyte antigen CD22 |
| 71805008 | Isocitrate epimerase |
| 71813009 | Methaqualone |
| 71818000 | Herbicide |
| 71823000 | Monomethyl hydrazine |
| 71845004 | Epithelial antibody |
| 71862009 | Antitoxin |
| 71916002 | Hydrastine |
| 71921004 | Haemoglobin G-Szuhu |
| 71935002 | Haemoglobin A>2< |
| 71957009 | Phloxin B stain |
| 71971001 | Corticotropin releasing factor |
| 71972008 | Blood group antibody Jc^a^ |
| 71975005 | Pyruvate kinase |
| 71976006 | Blood group antibody Lu14 |
| 71992001 | Amine ethoxylate |
| 72003002 | Xenysalate |
| 72015003 | Iodinated I^125^ albumin |
| 72024007 | Tetrahydrocannabinol |
| 72025008 | Crotamine venom |
| 72034003 | DNA beta-glucosyltransferase |
| 72036001 | Blood group antigen Bell |
| 72069001 | Cytosine |
| 72081002 | Divinyl benzene |
| 72084005 | GMP synthase |
| 72088008 | HLA-Bw41 antigen |
| 72113008 | Transcobalamin I |
| 72131009 | Silver iodide |
| 72134001 | Ankyrin |
| 72138003 | Lysine acetyltransferase |
| 72156003 | Protein-D-aspartate methyltransferase |
| 72159005 | Cyanocobalamin Co^60^ |
| 72164009 | Inositol |
| 72165005 | Antibody to hepatitis C virus |
| 72170003 | Blood group antigen Starcher |
| 72179002 | Oxybenzone |
| 72186005 | FAD pyrophosphatase |
| 72192004 | (Deoxy)nucleoside phosphate kinase |
| 72233001 | Galacturonokinase |
| 72251000 | Arsenic trioxide |
| 72271009 | Blood group antigen Fuller |
| 72305003 | ^107^Cadmium |
| 72309009 | Bioflavonoid |
| 72322001 | Para-aminobenzoic acid esters in alcohol |
| 72340002 | Plotolysin toxin |
| 72341003 | Blood urea nitrogen |
| 72344006 | Sodium psylliate |
| 72358008 | Agglutinogen |
| 72359000 | Gonyautoxin |
| 72361009 | Blood group antigen Wimberly |
| 72368003 | Citrullinase |
| 72371006 | Fast violet B salt stain |
| 72380006 | Blood group antigen Vel |
| 72384002 | Alkylglycerone-phosphate synthase |
| 72387009 | Aciclovir sodium |
| 72393001 | Butyl acrylate |
| 72400009 | Blood group antibody Swietlik |
| 72433004 | 3beta-Hydroxy-4alpha-methylcholestenecarboxylate dehydrogenase (decarboxylating) |
| 72444007 | Iron-cytochrome-c reductase |
| 72453000 | Trimethylamine-N-oxide reductase |
| 72454006 | ^99m^Technetium |
| 72455007 | ^83^Rubidium |
| 72460006 | 7,8-Dihydroxykynurenate 8,8a-dioxygenase |
| 72464002 | Pantothenase |
| 72469007 | Acetazolamide sodium |
| 72499003 | Rubidium chloride |
| 72507005 | 2-Ethylmalate synthase |
| 72511004 | Fruit |
| 72520008 | p-Aminophenol (substance) |
| 72522000 | Mephenesin |
| 72526002 | Blood group antibody Hil |
| 72546007 | Haemoglobin G-Audhali |
| 72551001 | Metal fumes |
| 72559004 | Streptomyces alkalophilic keratinase (substance) |
| 72563006 | Gastrin I |
| 72571005 | Platelet antibody HPA-3 |
| 72572003 | Diamond black stain |
| 72578004 | Osmium |
| 72582002 | Haemoglobin Sassari |
| 72584001 | HLA-Dw5 antigen |
| 72586004 | beta-Alanine-pyruvate aminotransferase |
| 72590002 | Cerebronic acid |
| 72602006 | Blood group antigen ENKT |
| 72625007 | 3,4-Dihydroxyphenylacetate 2,3-dioxygenase |
| 72636000 | Pinene |
| 72675009 | Simple physiological organic compound |
| 72685005 | Blood group antigen Maliff |
| 72717003 | Magnesium |
| 72737004 | (S)-Tricyclamol |
| 72745009 | Flavodoxin |
| 72748006 | Blood group antibody Mansfield |
| 72750003 | Nucleoside-phosphate kinase |
| 72752006 | Atracurium besylate |
| 72763009 | Hydriodic acid |
| 72766001 | 2',3'-Cyclic-nucleotide 3'-phosphodiesterase |
| 72770009 | Metoprolol tartrate |
| 72772001 | Blood group antigen Boston |
| 72773006 | Linuron |
| 72774000 | Potassium p-aminosalicylate |
| 72778002 | Tyrosine-tRNA ligase |
| 72784004 | Lactated potassic saline |
| 72802008 | Acetal |
| 72805005 | Chymopapain |
| 72808007 | Trolamine salicylate |
| 72812001 | Aspartate 4-decarboxylase |
| 72822007 | Homogentisate 1,2-dioxygenase |
| 72833005 | HLA-A30 antigen |
| 72835003 | ^119m^Tin |
| 72840006 | Valine |
| 72843008 | 2-Hydroxy-2,2-bis-(4-chlorophenyl) ethyl acetate |
| 72844002 | ^187^Platinum |
| 72857005 | Methitural |
| 72869002 | Upper respiratory fluids |
| 72873004 | Blood group antigen I^T^P>1< |
| 72886008 | Blood group antigen B 9724 |
| 72887004 | Pirimicarb |
| 72890005 | NAD(P)H dehydrogenase (quinone) |
| 72891009 | Cytotropic antibody (substance) |
| 72909000 | Tumour-associated antigen |
| 72926006 | HLA-Bw48 antigen |
| 72927002 | Radon |
| 72929004 | Phosphate acetyltransferase |
| 72949008 | Pepsin C |
| 72955003 | Acetate-coenzyme A ligase (substance) |
| 72984007 | Muscarinic receptor |
| 72989002 | Blood group antibody Th^a^ |
| 72990006 | Alveolar air |
| 72993008 | Lipase |
| 73010004 | Methyl silicate |
| 73029005 | Fibrinogen Baltimore IV |
| 73031001 | alpha Ketoglutarate |
| 73040002 | Vanadium pentoxide fumes |
| 73065000 | Gallium^67^ citrate |
| 73076001 | Emylcamate |
| 73084002 | Ethylene glycol ester |
| 73085001 | Chlordane |
| 73106004 | Cycle-phase nonspecific agent |
| 73126000 | Digalloyl trioleate |
| 73127009 | Haemoglobin Bougardirey-Mali |
| 73129007 | ^131m^Xenon |
| 73131003 | Carotene |
| 73135007 | Soluble antigen |
| 73187006 | Thyroxine |
| 73195005 | Blood group antibody HLA-B15 |
| 73196006 | Manganese compound |
| 73204005 | Myosin ATPase |
| 73213007 | Chlorphenesin carbamate |
| 73236003 | Haemoglobin Detroit |
| 73246001 | Streptomycin sulphate |
| 73251007 | Auramine G stain |
| 73254004 | CMP-N-acetylneuraminate-beta-galactoside alpha-2,6-sialyltransferase |
| 73267001 | 1-1-bis-(p-chlorophenyl)-2-Nitrobutane |
| 73268006 | Para-aminobenzoic acid and ethyl alcohol |
| 73276008 | Staphylococcus aureus antibody test kit |
| 73279001 | 2-Dehydropantoate reductase |
| 73300004 | Haemoglobin F-Tokyo |
| 73314004 | Blood group antibody Wolfe |
| 73334003 | Scillaren A |
| 73347008 | Blood group antibody JMH |
| 73353008 | ^54^Manganese |
| 73360002 | Haemoglobin M-Hyde Park |
| 73362005 | Blood group antigen Rh37 |
| 73377002 | Propyl diethyl succinamate |
| 73386007 | Carbofuran |
| 73388008 | 1,3-beta-Glucan phosphorylase |
| 73389000 | Blood group antigen Groslouis |
| 73393006 | Oil of balm |
| 73404007 | Cyanamide compound |
| 73407000 | Yohimbine |
| 73417005 | Zetekitoxin |
| 73421003 | Fusel oil |
| 73427004 | Cholesterol ester |
| 73434002 | Fonofos |
| 73436000 | Lergotrile mesylate |
| 73440009 | Methyl chloro methyl ether |
| 73444000 | Procaine hydrochloride |
| 73461002 | Fibrinogen London II |
| 73469000 | Radium |
| 73476005 | Mipafox |
| 73520004 | Blood group antigen Bregi |
| 73522007 | ^105^Ruthenium |
| 73537006 | Purinergic receptor |
| 73553009 | Rosemary oil |
| 73559008 | Dialkyl dimethyl ammonium chloride |
| 73563001 | Hexose-1-phosphate guanylyltransferase |
| 73567000 | HLA-DQw antigen |
| 73579000 | Carbidopa |
| 73586008 | L-3-Cyanoalanine synthase (substance) |
| 73591009 | Cytochalasin |
| 73596004 | 2-Amino-5-nitrothiazole |
| 73606003 | Gallate 1-beta-glucosyltransferase |
| 73613003 | Orotate reductase (NADH) |
| 73628003 | Progesterone 11alpha-monooxygenase |
| 73637003 | Blood group antigen B 7358 |
| 73640003 | ^188^Iridium |
| 73656008 | Blood group antibody Langer |
| 73661005 | Hepatitis B surface antigen subtype ayw |
| 73667009 | N^6^-Acetyl-beta-lysine aminotransferase |
| 73680007 | Oil of levant wormseed |
| 73685002 | Thallous chloride Tl^201^ |
| 73694008 | Blood group antibody A |
| 73708009 | Diphenylchloroarsine |
| 73709001 | Blood group antibody hr^B^ |
| 73710006 | Blood group antibody K22 |
| 73717009 | Muconate cycloisomerase |
| 73722009 | Dibasic potassium phosphate |
| 73723004 | Oestriol |
| 73734001 | ^8^Helium |
| 73741007 | Zearalenone |
| 73743005 | Oil of chamomile, German |
| 73745003 | Iodinated I^125^ oleic acid and triolein |
| 73748001 | alpha Ketobutyric acid |
| 73755004 | Blood group antigen Neut |
| 73758002 | ^117^Indium |
| 73778005 | Haemoglobin M-Boston |
| 73794003 | Folylpolyglutamate synthase |
| 73801006 | Coagulation factor VIIa |
| 73803009 | Glaucarubin |
| 73827006 | Econazole nitrate |
| 73828001 | Bilirubin-albumin complex |
| 73838006 | Phosphatidyl myo-inositol alpha-mannosyltransferase |
| 73842009 | Thymic ectopic endocrine substance |
| 73846007 | Blood group antigen RASM |
| 73858007 | Mandelate racemase |
| 73875001 | UDPglucuronate 5'-epimerase |
| 73880005 | Ribonuclease III |
| 73892005 | Carmine stain |
| 73909007 | Trifluoromonobromomethane |
| 73916008 | 5-Hydroxy tryptophan |
| 73923009 | Trinitrophenylmethylnitramine |
| 73925002 | ^152^Gadolinium |
| 73941001 | Chelated calcium (substance) |
| 73946006 | Phenylephrine hydrochloride |
| 73971009 | Dihydroorotate oxidase (substance) |
| 73980009 | Blood group antigen Rh29 |
| 73987007 | Oncogene |
| 73991002 | Connective tissue protein |
| 73992009 | 1-Alkylglycerophosphocholine acyltransferase |
| 74000003 | Lead chromate |
| 74002006 | Gliadin antibody |
| 74014003 | Phenylalanine ammonia-lyase |
| 74027004 | Protocatechuate 4,5-dioxygenase |
| 74032003 | Steroid 17-alpha-monooxygenase |
| 74054001 | Sodium 2,4-dichlorophenoxyethyl sulphate |
| 74055000 | Plant ketone oil |
| 74064005 | Blood group antibody JAL |
| 74075009 | Americium radioisotope |
| 74085005 | L-Fuculose-phosphate aldolase |
| 74090008 | Dimozide |
| 74124009 | alpha-1,4-Glucan-protein synthase (ADP-forming) |
| 74130009 | ^71^Germanium |
| 74131008 | 4-Deoxy-L-threo-5-hexosulose-uronate ketol-isomerase |
| 74138002 | Interleukin-11 |
| 74143009 | Lysine 2-monooxygenase |
| 74144003 | Blood group antigen Sj |
| 74145002 | Carnitine decarboxylase |
| 74149008 | Blood group antibody Boldog |
| 74171003 | 1,1-Dimethylhydrazine |
| 74199007 | Galactosylceramide sulphotransferase |
| 74209006 | Haemoglobin Aichi |
| 74210001 | I-J region, MHC |
| 74237004 | Atropine sulfate |
| 74242007 | Food starch |
| 74243002 | Prostaglandin-D>2< 11-ketoreductase |
| 74271008 | Formaldehyde dehydrogenase (glutathione) |
| 74273006 | Cocaine hydrochloride |
| 74292008 | Blood group antibody Bullock |
| 74306001 | Aspartate racemase |
| 74330004 | Betaine-aldehyde dehydrogenase |
| 74374002 | Blood group antibody Th |
| 74405003 | Haemoglobin G-Waimanalo |
| 74407006 | Haemoglobin Bethesda |
| 74412007 | Blood group antibody Gero |
| 74420009 | Galactosylgalactosylglucosylceramide beta-D-acetyl-galactosaminyltransferase |
| 74426003 | Haemoglobin I |
| 74452009 | ^248^Californium |
| 74482003 | Lymphocyte antigen CD73 |
| 74483008 | Urethral secretion |
| 74484002 | Blood group antibody McKenney |
| 74505001 | Haemoglobin Savannah |
| 74510002 | Blood group antigen Xg^a^ |
| 74515007 | Haemoglobin Port Phillip |
| 74521006 | DNA-directed RNA polymerase |
| 74523009 | Sulfadiazine |
| 74526001 | D-Octopine dehydrogenase |
| 74554008 | Iodophthalein |
| 74564004 | Argininosuccinate lyase |
| 74567006 | Blood group antibody Bg^a^ |
| 74586003 | Streptococcus toxin |
| 74589005 | Chlormerodrin |
| 74600002 | Bisacodyl tannex |
| 74605007 | Triphosphatase |
| 74616000 | Sweat |
| 74623004 | Haemoglobin Icaria |
| 74628008 | Hydrolase |
| 74634001 | Pituitary pars intermedia colloid |
| 74639006 | D-Alanine-poly(phosphoribitol) ligase |
| 74640008 | Mevalonate kinase |
| 74643005 | Malate oxidase |
| 74646002 | ^129^Barium |
| 74652001 | Blood group antigen K |
| 74656003 | ^177^Tantalum |
| 74661001 | Blood group antibody c-like |
| 74665005 | Aluminium welding fumes |
| 74678005 | (R)-2-Methylmalate dehydratase |
| 74684008 | ^182^Osmium |
| 74690007 | Diiodophenylpyruvate reductase |
| 74700009 | Fibrinogen Homberg II |
| 74713003 | Thiopropazate |
| 74718007 | Zinc arsenate |
| 74719004 | ^99m^Rhodium |
| 74722002 | Rectal contents |
| 74727008 | Hydroxyproline |
| 74750002 | Tetrachloronaphthalene |
| 74755007 | Immunoglobulin IgG2, H chain |
| 74794008 | Exodeoxyribonuclease (Lambda-induced) |
| 74801000 | Sugar |
| 74804008 | 3-Hydroxybenzoate 4-monooxygenase |
| 74826009 | Haemoglobin Randwick |
| 74835002 | Phosphoserine phosphatase |
| 74849006 | Aspartoacylase |
| 74860002 | Citrate CoA-transferase |
| 74866008 | Deoxycytidylic acid |
| 74868009 | Dihydrouracil dehydrogenase (NADP^+^) |
| 74880001 | Yellow ointment |
| 74889000 | Immunoglobulin M |
| 74897007 | Bromine trifluoride |
| 74905005 | Ethyl morphine |
| 74913006 | Pelletierine |
| 74916003 | Inorganic arsenic |
| 74941005 | Lactaldehyde reductase (DADPH) |
| 74947009 | Gaseous substance |
| 74950007 | Apomorphine hydrochloride |
| 74959008 | Protein disulphide-isomerase |
| 74979000 | Anthranilate 3-monooxygenase |
| 74981003 | Lewisite |
| 74985007 | Glucokinase |
| 74993007 | Low molecular weight kininogen |
| 74994001 | Blood group antigen Jk3 |
| 74997008 | Glucose dehydrogenase |
| 75025002 | Adrenal medullary hormone (substance) |
| 75026001 | Fluorine monoxide |
| 75034007 | Blood group antigen BR 726750 |
| 75044009 | Sisal fibre |
| 75055009 | Nucleoside-triphosphate-hexose-1-phosphate nucleotidyltransferase |
| 75062000 | 2-Oxoaldehyde dehydrogenase |
| 75064004 | Plasmin inhibitor |
| 75081008 | Candida lipolytica serine proteinase |
| 75092009 | Histamine H1 receptor |
| 75097003 | beta-Glucuronidase |
| 75115009 | Fluoxetine hydrochloride |
| 75139004 | Auxin B |
| 75153004 | Blood group antigen Gerhany |
| 75163007 | 2-Methylcitrate synthase |
| 75175002 | Oil of cascarilla |
| 75197000 | Ytterbium isotope |
| 75214004 | Platelet antibody HPA-2b |
| 75215003 | Blood group antigen AnWj |
| 75225008 | Phosphoglucomutase (glucose-cofactor) |
| 75228005 | Blood group antibody Vienna |
| 75239008 | 3-Hydroxyacyl-CoA dehydrogenase |
| 75247008 | Benzathine benzylpenicillin |
| 75265007 | Cytidine |
| 75268009 | Mesoridazine besylate |
| 75272008 | Aldehyde dehydrogenase [NAD(P)+] |
| 75274009 | Fumarate reductase (NADH) |
| 75277002 | Oncogene protein H-RAS |
| 75284005 | Glutamate dehydrogenase |
| 75285006 | D-Arabinokinase |
| 75288008 | Cuprous salt |
| 75289000 | Fusarinine-C ornithinesterase |
| 75298002 | Proline-tRNA ligase |
| 75322009 | Blood group antigen Arun |
| 75327003 | Xylometazoline hydrochloride |
| 75341007 | Ethacrynate sodium |
| 75348001 | 4-Androstene-3,17-dione monooxygenase |
| 75359005 | Timolol maleate |
| 75362008 | Tetrachloroethylene |
| 75363003 | Verrucarin |
| 75368007 | 4-Hydroxyphenylpyruvate dioxygenase |
| 75371004 | Theobromine |
| 75384008 | Haemoglobin Volga |
| 75399008 | Citric acid |
| 75405006 | 5-Aminopentanamidase |
| 75417008 | Cyclopiazonic acid |
| 75421001 | Triose-phosphate isomerase |
| 75466005 | Alkyl naphthyl methyl pyridinium chloride |
| 75476008 | Bovine growth hormone |
| 75495001 | Dimethylbenzene |
| 75512004 | Haemoglobin City of Hope |
| 75520002 | Haemoglobin Brigham |
| 75536000 | Metaldehyde |
| 75550005 | Chitin deacetylase |
| 75553007 | Protease inhibitor venom |
| 75560001 | 1-Nitropropane |
| 75561002 | Dihydro-beta-ergocryptine |
| 75563004 | alpha-1,3-Mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase |
| 75574008 | 42-kDa Protein |
| 75590008 | Liquefied petroleum gas |
| 75604003 | ^105m^Rhodium |
| 75619002 | Somatotropin binding globulin |
| 75624004 | Aluminium-based antacid |
| 75627006 | Insect repellent |
| 75635009 | Urobilin |
| 75645006 | Butaperazine |
| 75665004 | Monosodium glutamate |
| 75666003 | Blood group antibody M>2< |
| 75678004 | ^206^Bismuth |
| 75696008 | ^45^Titanium |
| 75698009 | Haemoglobin F-Urumqi |
| 75701001 | Deoxynucleotide 3'-phosphatase |
| 75725009 | Hydroxyglutamate decarboxylase |
| 75735003 | Blood group antigen M1^a^ |
| 75750007 | Escherichia coli antigen test kit |
| 75777003 | Cytokine |
| 75799006 | Lysine |
| 75808003 | Complement component C3b |
| 75811002 | HLA-A26 antigen |
| 75812009 | Blood group antibody Wr^a^ |
| 75815006 | Zinc undecylenate |
| 75816007 | Blood group antibody f |
| 75819000 | Blood group antigen P^k^ |
| 75820006 | Blood group antibody C^w^ |
| 75828004 | Creatine kinase |
| 75839001 | ^77^Arsenic |
| 75840004 | Coagulation factor XIIa |
| 75842007 | Azobenzene |
| 75849003 | 3-Hydroxy-2-methylpyridine-4,5-dicarboxylate 4-decarboxylase |
| 75850003 | L-Idonate dehydrogenase |
| 75861006 | Haemoglobin Okazaki |
| 75871008 | Argininosuccinic acid |
| 75874000 | Krypton radioisotope |
| 75876003 | Sodium alginate |
| 75925000 | Vimentin |
| 75951003 | Iodine monobromide |
| 75956008 | Haematein stain |
| 75966000 | Steroid-lactonase |
| 75967009 | ^92^Strontium |
| 75982004 | N-Acetyl-beta-glucosaminidase |
| 75989008 | Pepsin B |
| 75999003 | Diiodotyrosine aminotransferase |
| 76001002 | Pyronine B stain |
| 76002009 | Fibrinogen Vancouver |
| 76003004 | Triiodobenzoic acid |
| 76004005 | Dioxybenzone |
| 76008008 | Blood group antibody Or^a^ |
| 76044003 | Nasal mucus |
| 76048000 | Azocarmine G (GX) stain |
| 76071003 | Blood group antigen Kuhn |
| 76088005 | alpha-L-Rhamnosidase |
| 76128005 | Antibody to hepatitis B core antigen, IgG type |
| 76134003 | Neurotensin |
| 76136001 | Antibody to antigen in LW blood group system |
| 76150006 | Bacteriorhodopsin |
| 76159007 | ^193^Mercury |
| 76176006 | Acrolein phenylhydrazine |
| 76178007 | Mercuric cyanide |
| 76190009 | Talbutal |
| 76198002 | Ammonium hydroxide |
| 76213002 | Exhaust fumes |
| 76239004 | Haemoglobin San Diego |
| 76250001 | Beta lysin |
| 76252009 | Blood group antibody Lan |
| 76269006 | Ferroxidase |
| 76283008 | Cytisine |
| 76297000 | Ethanolamine-phosphate cytidylyltransferase |
| 76300005 | GTP pyrophosphokinase |
| 76320006 | Fibrinogen London IV |
| 76325001 | Phosphoribosylaminoimidazolecarboxamide formyltransferase |
| 76370009 | Nomadic nitrogen |
| 76389009 | Phosphomethylpyrimidine kinase |
| 76411003 | Platelet antigen HPA-5a |
| 76421006 | Nabam |
| 76439002 | Fat red 7B stain |
| 76442008 | Hydroxylamine hydrochloride |
| 76448007 | Phosphoglycerate phosphatase |
| 76470005 | Flavonoid 3'-monooxygenase |
| 76488002 | Haemoglobin Camperdown |
| 76501008 | Pyrogallol |
| 76506003 | Fibrinogen Munich I |
| 76525000 | Ephedrine sulfate |
| 76526004 | ^194^Mercury |
| 76527008 | Sodium radioisotope |
| 76533004 | Mustard gas |
| 76557004 | Haemoglobin C-Georgetown |
| 76560006 | Ribulose-bisphosphate carboxylase |
| 76575003 | Podophyllotoxin |
| 76587005 | Ganciclovir sodium |
| 76592007 | Monoterpenyl-pyrophosphatase |
| 76595009 | Geranyltranstransferase |
| 76596005 | N-Acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase |
| 76600000 | ^102^Rhodium |
| 76605005 | Biebrich scarlet stain |
| 76607002 | Blood group antibody Bx^a^ |
| 76613006 | Glycidol |
| 76617007 | Ferrous chloride |
| 76622007 | Alternansucrase |
| 76633005 | Fast red TR salt stain |
| 76638001 | N-Acylglucosamine 2-epimerase |
| 76639009 | Chorionic fluid |
| 76643008 | Isopentenyladenosine |
| 76645001 | Prodigiosin |
| 76655002 | Methylene chloride |
| 76669002 | Cellobiose epimerase |
| 76672009 | Cardiac lipoprotein |
| 76674005 | Oil of fleabane |
| 76688009 | Blood group antibody K19 |
| 76698003 | Conjugate |
| 76701006 | Pseudogene |
| 76711004 | Adenosine triphosphate |
| 76716009 | Membrane-bound antibody |
| 76721007 | Blood group antigen Yh^a^ |
| 76728001 | GDPmannose dehydrogenase |
| 76731000 | Double stranded anti-deoxyribonucleic acid antibody (substance) |
| 76734008 | Blood group antigen Dalman |
| 76736005 | Perinucleolar chromatin |
| 76743004 | ^99^Technetium |
| 76767007 | Peyote preparation |
| 76770006 | N-Acetylgalactosamine-6-sulphatase |
| 76781009 | Ketone body |
| 76787008 | Tridihexethyl chloride |
| 76829000 | Plant pyrrolizidine alkaloid |
| 76861001 | Laminaribiose phosphorylase |
| 76874007 | Blood group antibody Berrio |
| 76881000 | Borate decahydrate |
| 76885009 | Bleach |
| 76897005 | Blood group antibody Tc^c^ |
| 76898000 | Phenobarbital sodium |
| 76904007 | ^75^Germanium |
| 76907000 | Dodecenoyl -CoA delta-isomerase |
| 76918000 | HLA-Bw53 antigen |
| 76925007 | Alkali blue 5B (4B) stain |
| 76958003 | Blood group antibody Le^d^ |
| 76964005 | Blood group antigen Welsh |
| 76965006 | Blood group antigen Inaba |
| 76977001 | Aminopeptidase (human liver) |
| 76979003 | Sugar-1-phosphate nucleotidyltransferase |
| 77001006 | Protein-disulphide reductase (glutathione) |
| 77004003 | ^18^Fluorine |
| 77010003 | Blood group antigen BLe^d^ |
| 77012006 | Amniotic fluid |
| 77014007 | Fixed oil |
| 77023005 | Cardiac muscle antibody |
| 77025003 | Pentachlorophenol |
| 77033002 | Diaminohydroxyphosphoribosylaminopyrimidine deaminase |
| 77036005 | 2,4,5-Trimethoxyamphetamine (substance) |
| 77037001 | Decylcitrate synthase |
| 77042009 | Methyl mercaptan |
| 77043004 | Ethyl nitrite |
| 77073008 | Nile blue stain |
| 77079007 | Haemoglobin G-Honolulu |
| 77089006 | Rheumatoid factor (substance) |
| 77101008 | Blood group antibody Mi^a^ |
| 77118007 | Methyl ethyl ketone |
| 77124001 | Haemoglobin Lyon |
| 77132009 | Rocket fuel |
| 77136007 | alpha-Melanocyte stimulating hormone |
| 77148005 | Blood group antigen Cooper |
| 77160006 | Private blood group antigen |
| 77168004 | Phosphoribosylformylglycinamidine synthase |
| 77190004 | Haemoglobin F-Victoria Jubilee |
| 77192007 | Abrin |
| 77200000 | Endo-1,4-beta-xylanase |
| 77210009 | GMP reductase |
| 77222007 | Spiperone |
| 77242003 | 4-Hydroxyphenylacetate 3-monooxygenase (substance) |
| 77245001 | 8-Hydroxyquinoline |
| 77247009 | 3-Phytase |
| 77249007 | Phthalic anhydride |
| 77275006 | Blood group antibody Big |
| 77313009 | Technetium Tc^99m^ exametazime |
| 77314003 | Serine carboxypeptidase |
| 77315002 | Antigen in LW blood group system |
| 77321003 | Haemoglobin F-Meinohama |
| 77322005 | 2-Oxoisovalerate dehydrogenase (lipoamide) |
| 77328009 | Microbial serine proteinases |
| 77339007 | Haemoglobin Ube-2 |
| 77347007 | alpha-1,6-Mannosyl-glycoprotein beta-1,2-N-acetylglucosaminyltransferase |
| 77353007 | Fenoprofen calcium |
| 77370004 | Lactic acid |
| 77387002 | 2-Acylglycerophosphocholine acyltransferase |
| 77394004 | Cyclobutane |
| 77400002 | Territrem |
| 77404006 | Homoserine |
| 77409001 | Intramitochondrial ferritin |
| 77431009 | Potassium nitrate |
| 77433007 | Fullerene |
| 77438003 | C1q complement receptor |
| 77454000 | Mannoheptulose |
| 77473001 | Haemoglobin Contaldo |
| 77481000 | Pentamidine diisothionate |
| 77487001 | Blood group antibody VA |
| 77496001 | gamma Benzene hexachloride |
| 77499008 | VHDL |
| 77504008 | Fatty-acyl-CoA synthase |
| 77510008 | Indium^113^ oxoquinoline WBC label |
| 77512000 | Blood group antibody HLA-B12 |
| 77515003 | Curare |
| 77523001 | Microbody matrix (substance) |
| 77525008 | B cell antibody |
| 77530007 | (S)-2-Methylmalate dehydratase |
| 77536001 | Dinocap |
| 77537005 | Blood group antigen Truax |
| 77544001 | Nicotine polacrilex |
| 77557009 | Lymphocyte antigen CD41b |
| 77582009 | Fibrinogen Nijmegen |
| 77586007 | D-Arabinose dehydrogenase |
| 77594000 | 2-N-dibutylamino-ethanol |
| 77597007 | 1,4-beta-D-Xylan synthase |
| 77610004 | 1,4-Lactonase |
| 77611000 | Inorganic dust |
| 77617001 | Haemoglobin Olomouc |
| 77625004 | Glycerol 2-phosphatase |
| 77632008 | Quinidine gluconate |
| 77662002 | Immunoprecipitate |
| 77671006 | Antidiuretic hormone |
| 77673009 | Noradrenaline acid tartrate |
| 77683008 | Amygdalin |
| 77703004 | Amphotericin B |
| 77710005 | Plasmalogen |
| 77722008 | Poultry bone |
| 77729004 | Tetrasodium pyrophosphate |
| 77752000 | Haemoglobin K-Cameroon |
| 77756002 | L-Ascorbate-cytochrome-b>5< reductase |
| 77760004 | Neotran |
| 77762007 | Desulphoheparin sulphotransferase |
| 77764008 | Guanabenz acetate |
| 77767001 | Anti viral antibody |
| 77774006 | Blood group antibody Stowe |
| 77793008 | Isoamyl acetate |
| 77799007 | Aluminium phenolsulphonate |
| 77812005 | C3a complement receptor |
| 77824003 | Coprostanol |
| 77828000 | myo-Inositol-1-phosphate synthase |
| 77829008 | Hypotaurine dehydrogenase |
| 77832006 | Acetyl-CoA carboxylase |
| 77847002 | Ceramide glucosyltransferase |
| 77849004 | Potassium bicarbonate |
| 77850004 | Organic arsenic |
| 77864004 | Antioncogene |
| 77901009 | Cycloartenol synthase |
| 77907008 | Blood group antibody To^a^ |
| 77923008 | Phosphorus radioisotope |
| 77927009 | ^128^Barium |
| 77929007 | Haemoglobin Chicago |
| 77932005 | O-Acetylhomoserine (thiol)-lyase |
| 77934006 | Sulphurated lime solution |
| 77942007 | Integrin leucocyte adhesive protein |
| 77951004 | Aspartate carboxypeptidase |
| 77963009 | Central myelin protein |
| 77983005 | Lighter fluid |
| 77998007 | Deoxythymidine diphosphate |
| 78003007 | Fibrinogen New Orleans II |
| 78014005 | Urine |
| 78020006 | Blood group antigen Westerlund |
| 78023008 | ^87m^Strontium |
| 78032005 | Resorcinol |
| 78036008 | Complement component fragment |
| 78047001 | 1-1-bis-(p-chlorophenyl)-2-Nitropropane |
| 78059002 | Bisulphite salt |
| 78073006 | Acetyldiaminopimelate deacetylase |
| 78075004 | 12alpha-Hydroxysteroid dehydrogenase |
| 78116009 | Ceramide cholinephosphotransferase |
| 78130004 | Dihydrostreptomycin-6-phosphate 3'alpha-kinase |
| 78134008 | Piminodine |
| 78137001 | Pumiliotoxin C |
| 78151001 | Trichloroacetic acid |
| 78173008 | T cell antibody |
| 78175001 | Glutarate-semialdehyde dehydrogenase |
| 78178004 | Anti rickettsial antibody |
| 78215002 | Blood group antigen Rh35 |
| 78219008 | Gelsemine |
| 78221003 | Cobra venom |
| 78228009 | ^129m^Tellurium |
| 78231005 | Blood group antibody Js^a^ |
| 78232003 | Acylglycerol kinase |
| 78242001 | Oncogene protein KS3 |
| 78249005 | Haemoglobin North Chicago |
| 78252002 | Blood group antibody Finlay |
| 78255000 | Coagulation factor II San Juan 1 variant |
| 78257008 | Sternutator |
| 78258003 | Deoxycholic acid |
| 78263004 | Immunoglobulin, constant region |
| 78286006 | Lantadene A |
| 78316004 | Dehydroepiandrosterone |
| 78327002 | Hypotaurocyamine kinase |
| 78334000 | CMP-N-acylneuraminate phosphodiesterase |
| 78339005 | HLA-B14 antigen |
| 78343009 | Isopropylamine |
| 78346001 | Spermidine dehydrogenase |
| 78350008 | Triethylamine |
| 78369003 | Alizarin 2-beta-glucosyltransferase |
| 78386009 | Blood group antigen I^S^ |
| 78388005 | Histidine-tRNA ligase |
| 78400000 | Crotonoyl-[acyl-carrier-protein] hydratase |
| 78404009 | Ethanolamine oxidase |
| 78414000 | Rubber compound |
| 78433005 | Methylaminoheptane |
| 78445001 | Haemoglobin Jackson |
| 78446000 | ^194^Osmium |
| 78447009 | Phospholipids |
| 78452004 | Xanthosine-5-phosphate |
| 78454003 | Immunoglobulin, GM>11< allotype |
| 78460003 | Antistreptolysin O |
| 78462006 | ^134^Caesium |
| 78467000 | Lymphocyte antigen CDw60 |
| 78481003 | Iofetamine I^123^ hydrochloride |
| 78491009 | Trinitrobenzene |
| 78505007 | Glutamate-cysteine ligase |
| 78520001 | Dazomet |
| 78527003 | Fucose |
| 78529000 | ^130^Iodine |
| 78552001 | Cloral betaine |
| 78556003 | Dihydroorotase |
| 78570003 | Indium^111^ transferrin |
| 78573001 | Lignoceric acid |
| 78588006 | Fibrinolysin, human |
| 78589003 | Diphenylcyanoarsine |
| 78594003 | Blood group antigen Bonde |
| 78597005 | Intracisternal material of known identity |
| 78602003 | Shikimate kinase |
| 78604002 | Sphingosine cholinephosphotransferase |
| 78605001 | HLA-Dw15 antigen |
| 78617004 | Barium hydroxide |
| 78636009 | Aminopyridine |
| 78637000 | 3-Ethylmalate synthase |
| 78650004 | Adenosylhomocysteine nucleosidase |
| 78655009 | Benzoyl chloride |
| 78661007 | Blood group antibody Rb^a^ |
| 78665003 | Haemoglobin Daneshgah-Tehran |
| 78671009 | Zinc arsenite |
| 78686003 | Copper^64^ acetate |
| 78688002 | Blood group antigen Henry |
| 78702007 | Thalidomide |
| 78707001 | Blood group antibody Fl |
| 78708006 | Sodium arsanilate |
| 78709003 | HLA-Bw67 antigen |
| 78713005 | Caproic acid |
| 78720003 | N-Acyl mannosamine kinase |
| 78721004 | Nervonic acid |
| 78730007 | ^189^Iridium |
| 78736001 | alpha>2< HS glycoprotein |
| 78744001 | Hydrogen dehydrogenase |
| 78749006 | HLA-DQ antigen |
| 78750006 | Blood group antibody Sc2 |
| 78751005 | Kynurenine-oxoglutarate aminotransferase |
| 78758004 | 2,3-Dimethylmalate lyase |
| 78759007 | Pyridoxamine-phosphate aminotransferase |
| 78760002 | Angiotensinase |
| 78772008 | Phenanthrene |
| 78774009 | FMN adenylyltransferase |
| 78782009 | Silver chloride |
| 78787003 | Hydroxyphenyl mercurichloride |
| 78796003 | 7-Dehydrocholesterol reductase |
| 78802001 | Blood group antigen Norlander |
| 78825000 | Fibrinogen Leuven |
| 78833004 | ^246^Californium |
| 78834005 | Fucosylglycoprotein 3-alpha-galactosyltransferase |
| 78837003 | Glycine benzoyltransferase |
| 78851003 | Lipoprotein-X |
| 78859001 | Morrhuate sodium |
| 78866000 | HLA-Aw68 antigen |
| 78869007 | Nuclear fast red stain |
| 78870008 | Cobalt radioisotope |
| 78903005 | Pancreatic elastase |
| 78910004 | Solid substance |
| 78924000 | Haemoglobin J-Cubujuqui |
| 78936006 | Propoxycaine hydrochloride |
| 78955006 | Blood group antibody Hollister |
| 78959000 | Sulphathiourea |
| 78966004 | Metham sodium |
| 78971006 | Toluenediamine |
| 79005005 | Immunoglobulin gene GM allotype |
| 79006006 | Methylglutaconyl-CoA hydratase |
| 79007002 | Industrial product |
| 79008007 | Blood group antibody Dh^a^ |
| 79018002 | Amylosucrase |
| 79027001 | Haemoglobin J-Cairo |
| 79029003 | Blood group antibody Mitch |
| 79039009 | Methacrylic acid |
| 79055002 | Hydroxylamine oxidase |
| 79061004 | Germanium |
| 79066009 | Haemoglobin Cranston |
| 79080002 | Blood group antibody Rh39 |
| 79084006 | Clostridial toxin |
| 79098003 | Haemoglobin Beograd |
| 79124006 | Blood group antigen To^a^ (substance) |
| 79127004 | Fibrin monomer |
| 79135001 | Promazine hydrochloride |
| 79136000 | ^146^Gadolinium |
| 79141008 | Crotalus adamanteus serine proteinase |
| 79146003 | Citrated calcium carbimide |
| 79166007 | Acyl-phosphate-hexose phosphotransferase |
| 79176005 | Blood group antigen Rh40 |
| 79193005 | Fibrinogen Homberg I |
| 79197006 | ^82^Rubidium |
| 79198001 | Alloalbumin |
| 79209008 | Dicoumarol |
| 79211004 | Alcohol dehydrogenase [NAD(P)+] |
| 79212006 | Proinsulin |
| 79219002 | Haemoglobin Sunnybrook |
| 79226002 | Blood group antigen Stairwalt |
| 79242009 | [Acyl carrier-protein] acetyltransferase |
| 79245006 | Glutamate synthase (ferredoxin) |
| 79249000 | Lochia flava |
| 79251001 | Glyceraldehyde-3-phosphate dehydrogenase (NADP^+^) (phosphorylating) |
| 79271005 | Tremetol |
| 79288003 | Cross reacting antigen |
| 79293000 | Nucleoside-triphosphatase |
| 79316006 | Alkyl aryl polyether sulphate |
| 79326004 | Lymphocyte antigen CD23 |
| 79328003 | Lysine decarboxylase |
| 79329006 | Serum protein |
| 79330001 | Zinc trichlorophenate |
| 79331002 | Blood group antibody Hr |
| 79338008 | ^97m^Technetium |
| 79341004 | Lymphocyte antigen CD71 |
| 79343001 | Oil of parsley |
| 79370008 | Thiocyanate compound |
| 79375003 | Proteoglycan |
| 79380007 | Hydrocortisone acetate |
| 79388000 | Aryl acylamidase |
| 79391000 | ATP phosphoribosyltransferase |
| 79396005 | Purine-nucleoside phosphorylase |
| 79415006 | Procollagen-proline,2-oxoglutarate 4-dioxygenase |
| 79422003 | Gadolinium radioisotope |
| 79428004 | Dihydroxyaluminium aminoacetate |
| 79446005 | Imidazole acetyltransferase |
| 79448006 | ^91m^Yttrium |
| 79477007 | ^66^Gallium |
| 79482000 | ^174^Hafnium |
| 79496006 | Blood group antigen Y. Bern |
| 79498007 | Zeta-chain haemoglobin |
| 79506002 | ^196m^Iridium |
| 79514008 | Methylenetetrahydrofolate reductase (NADPH) |
| 79522001 | Carbamate pesticide |
| 79523006 | ^76^Bromine |
| 79531001 | Aminopeptidase P |
| 79545007 | trans-L-3-Hydroxyproline dehydratase |
| 79549001 | Cyanoacrylate |
| 79550001 | ^197^Gold |
| 79568003 | Acetylornithine aminotransferase |
| 79576001 | Titanium sulphate |
| 79580006 | Adrenal hormone |
| 79581005 | Hydrated sodium borate |
| 79610008 | Technetium Tc^99m^ serum albumin |
| 79612000 | Myelin |
| 79625008 | Methylenetetrahydrofolate dehydrogenase (NAD^+^) |
| 79630007 | Extracellular secretion material following exocytosis, luminal, exocrine |
| 79638000 | Blood group antibody Hr^B^ |
| 79640005 | Deoxythymidylic acid |
| 79651005 | Naphthyl acetic acid |
| 79657009 | Type III site-specific deoxyribonuclease |
| 79680001 | Sporotrichum proteinase I |
| 79685006 | 5-Aminolaevulinate synthase |
| 79689000 | Amprotropine |
| 79691008 | Oximinotransferase |
| 79697007 | Leucocyte-adhesion receptor |
| 79706000 | Bilirubin |
| 79721006 | Flavone apiosyltransferase |
| 79744009 | beta-Lactamase |
| 79761007 | Di-2-ethylhexyl phthalate |
| 79769009 | Anti parasitic antibody |
| 79773007 | Active C4b2a |
| 79775000 | Terebene |
| 79778003 | Acetylene |
| 79784000 | Lead acetate |
| 79796007 | Blood group antibody Pt^a^ |
| 79798008 | Spleen exonuclease |
| 79803004 | Chloroacetophenone |
| 79813007 | Blood group antibody H |
| 79846001 | Coagulation factor IX Cambridge variant |
| 79850008 | Augusticeps-type venom |
| 79862007 | Alanopine dehydrogenase |
| 79900002 | Methionine S-methyltransferase |
| 79907004 | Aminobenzoic acid derivative |
| 79912003 | Squalene monooxygenase |
| 79937008 | Sodium cacodylate |
| 79943005 | Nucleoside-diphosphatase |
| 79973001 | Complement component C9 |
| 79976009 | 2-Isopropoxyethanol |
| 80044001 | Polysaccharide methyltransferase |
| 80048003 | Blood group antibody Walls |
| 80086007 | Haemoglobin Toyoake |
| 80105007 | Blood group antibody iP>1< |
| 80120001 | Tryptophan 2,3-dioxygenase |
| 80122009 | HLA-B40 antigen |
| 80133007 | Blood group antibody Westerlund |
| 80143005 | GMP synthase (glutamine-hydrolysing) |
| 80164009 | Cinnabar |
| 80188006 | HLA-C antigen |
| 80189003 | Plant steroid alkaloid |
| 80191006 | Protocatechuate 3,4-dioxygenase |
| 80214006 | Micrococcus caseolyticus neutral proteinase |
| 80222004 | 5'-Nucleotidase |
| 80230003 | 2,6-Dichloro-4-nitrobenzenamine |
| 80234007 | Matrix of cartilage |
| 80237000 | Cocoa butter |
| 80238005 | Prodipidine |
| 80253002 | Aminometradine |
| 80259003 | Food flavoring agent |
| 80260008 | Iodinated I^125^ laevothyroxine |
| 80263005 | Aminotriazole |
| 80269009 | Keratan-sulphate endo-1,4-beta-galactosidase |
| 80276004 | Blood group antigen Savior |
| 80283006 | UDPgalactopyranose mutase |
| 80305003 | Pontamine sky blue 6BX stain |
| 80312007 | Platinum isotope |
| 80322001 | Synthetic alkaloid |
| 80324000 | Stone dust |
| 80343000 | Anti bacterial antibody |
| 80344006 | ^85m^Krypton |
| 80373009 | Sedoheptulokinase |
| 80382003 | Hydrocarbon |
| 80393001 | Diiodotyrosine |
| 80403006 | Blood group antibody Clements |
| 80413003 | Blood group antigen Stowe |
| 80424001 | Blood group antigen McKenney |
| 80429006 | UDP-N-acetylglucosamine pyrophosphorylase |
| 80453000 | Proline racemase |
| 80458009 | Aminoacyl-lysine dipeptidase |
| 80464002 | Anthranilate 1,2-dioxygenase (deaminating, decarboxylating) |
| 80465001 | Blood group antigen Lan |
| 80472000 | Haemoglobin Strasbourg |
| 80482004 | Blood group antigen Rh32 |
| 80485002 | Sulphur monochloride |
| 80492007 | Alkyl dimethyl ethylbenzyl ammonium chloride |
| 80494008 | Reticulin |
| 80506001 | Aldose dehydrogenase |
| 80516009 | Blood group antigen Davis J |
| 80517000 | Heparosan-N-sulphate-glucuronate 5-epimerase |
| 80521007 | ^200^Platinum |
| 80532007 | Aprobarbital |
| 80537001 | Peptide YY |
| 80539003 | Cobalt salt |
| 80540001 | Succinyl-CoA hydrolase |
| 80553003 | Tetrachloroquinone |
| 80558007 | Blood group antibody HLA-A8 |
| 80562001 | Deoxy guanosine triphosphate |
| 80572003 | Colony-stimulating factor, granulocytic |
| 80575001 | Blood group antigen Kaj |
| 80582002 | Glycerol |
| 80590002 | Lymphocyte antigen CDw12 |
| 80591003 | N-Acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase |
| 80605008 | Acokantherin |
| 80613009 | Mannitol dehydrogenase (NADP^+^) |
| 80616001 | Haemoglobin Radcliffe |
| 80620002 | HLA-B35 antigen |
| 80630006 | Sodium arsenite |
| 80652002 | Phenyl mercuric salts |
| 80688007 | Pro-opiomelanocortin |
| 80705000 | Blood group antigen Knoebnchild |
| 80706004 | Alkyl dimethyl ethyl ammonium chloride |
| 80741000 | Plasma kinin |
| 80743002 | Mustard black |
| 80745009 | Barium thioglycolate |
| 80751004 | ^133^Xenon |
| 80754007 | Blood group antigen Hut |
| 80760007 | Blood group antigen Nijhuis |
| 80789009 | Diosgenin |
| 80819005 | Proline carboxypeptidase |
| 80832000 | Ketopantoaldolase |
| 80837006 | Sialidase |
| 80839009 | D-Amino-acid dehydrogenase |
| 80854003 | ^211^Lead |
| 80861004 | Nucleolus organiser region |
| 80869002 | Immunoglobulin, GM>19< allotype |
| 80873004 | Oxyhaemoglobin |
| 80876007 | Phosphomannan mannosephosphotransferase |
| 80892002 | Blood group antibody Zd |
| 80903004 | Haplotoxin (substance) |
| 80911009 | Exodeoxyribonuclease III |
| 80916004 | Potassium phosphate |
| 80917008 | Toxin |
| 80918003 | Protoporphyrin IX |
| 80920000 | ^176^Tungsten |
| 80929004 | Blood group antigen Cs^a^ |
| 80946001 | Thromboxane |
| 80959009 | Methylprednisolone acetate |
| 80972005 | Cephazolin sodium |
| 80987000 | Animal genome |
| 80992003 | erythro-3-Hydroxyaspartate dehydratase |
| 80994002 | Fampridine |
| 81017004 | Encainide hydrochloride |
| 81044009 | 2-Ethoxyacetate |
| 81053002 | Blood group antibody Welsh |
| 81080009 | Blood group antigen En^a^FR |
| 81100008 | Pentose (substance) |
| 81111000 | Glycogen-synthase-D phosphatase |
| 81114008 | Phosphatidylcholine-dolichol acyltransferase |
| 81118006 | Gonadal hormone |
| 81123006 | Interleukin-5 |
| 81172004 | Creatinase |
| 81176001 | Batrachotoxin |
| 81181005 | Chitobiosyldiphosphodolichol alpha-mannosyltransferase |
| 81195008 | Pentane |
| 81205009 | Blood group antigen Do^a^ |
| 81213005 | Blood group antigen Snyder |
| 81222006 | Sutilains |
| 81243007 | Isocitrate dehydrogenase (NADP^+^) |
| 81255001 | Acetyl-CoA acyltransferase |
| 81262005 | Blood group antibody Gy^a^ |
| 81273003 | Fibrinogen Louisville |
| 81286007 | Growth factor |
| 81290009 | Tyrosine decarboxylase |
| 81297007 | Blood group antibody Boil |
| 81312003 | 5-Aminovalerate aminotransferase |
| 81322009 | Phosphoamidase |
| 81324005 | Zirconium radioisotope |
| 81329000 | Blood group antibody PeCo |
| 81332002 | Blood group antibody N>2< |
| 81357007 | Aspartate ammonia-lyase |
| 81362008 | Hexobarbital |
| 81365005 | Levamisole hydrochloride |
| 81384008 | Blood group antibody Dautriche |
| 81394003 | Bence Jones protein |
| 81395002 | Arachidonate 12-lipoxygenase |
| 81397005 | Auramine O stain |
| 81419006 | Chemical fumes |
| 81426006 | Blood group antigen HLA-B8 (substance) |
| 81430009 | Titanium oxide |
| 81432001 | HLA-Dw18 antigen |
| 81444003 | Factor X |
| 81458001 | Eucatropine |
| 81461000 | Fetal fibrinogen |
| 81473000 | Sulphite reductase |
| 81481004 | 4-Aminobutyrate aminotransferase |
| 81494002 | Cholinephosphotransferase |
| 81508005 | Doxycycline monohydrate |
| 81522005 | Deoxythymidine triphosphate |
| 81537009 | Tartronate-semialdehyde synthase |
| 81578006 | Lymphocyte antigen CD25 |
| 81582008 | Haemoglobin Santa Ana |
| 81584009 | Brombenzyl cyanide |
| 81589004 | Moniliformin |
| 81599009 | Paraoxon |
| 81600007 | Blood group antigen Gy^a^ |
| 81602004 | Naled |
| 81605002 | gamma Fetoprotein |
| 81610003 | Blood group antigen Frando |
| 81615008 | Hypercalcaemic steroid preparation |
| 81620008 | HLA-A23 antigen |
| 81621007 | Indium^111^ red cell label |
| 81625003 | 3beta-Hydroxy-delta 5-steroid dehydrogenase |
| 81641002 | Blood group antigen Chase |
| 81651001 | Diagnostic antiserum |
| 81655005 | Protoporphyrinogen oxidase |
| 81663006 | Glucuronokinase |
| 81679007 | Blood group antibody Chase |
| 81689006 | Prostatic secretions |
| 81692005 | ATP deaminase |
| 81702008 | Active C5b67 |
| 81719005 | Tremorgenic mycotoxin |
| 81732000 | Indolepyruvate methyltransferase |
| 81761004 | Technetium Tc^99m^ microaggregated albumin |
| 81778008 | Mercurophylline injection |
| 81784006 | Blood group antibody Rod |
| 81801009 | Alcohol oxidase |
| 81809006 | Fumarylacetoacetase |
| 81810001 | Vanillylmandelic acid |
| 81816007 | Candicidin |
| 81821005 | ^243^Americium |
| 81837004 | Uridine kinase |
| 81847001 | Haemoglobin Setif |
| 81859002 | Dichlorophenarsine hydrochloride |
| 81860007 | Isoetarine mesilate |
| 81863009 | Watasemia-luciferin 2-monooxogenase |
| 81867005 | Tantalum isotope |
| 81868000 | Linolenic acid |
| 81880008 | beta-Alanyl-CoA ammonia-lyase |
| 81886002 | Ethylene glycol |
| 81901008 | Haemoglobin Deer Lodge |
| 81905004 | Globulin |
| 81911001 | Chewing tobacco |
| 81926004 | T-cell antigen receptor |
| 81929006 | Haemoglobin Raleigh |
| 81945008 | Chloromuconate cycloisomerase |
| 81946009 | Dantrolene sodium |
| 81948005 | Iron silicate |
| 81963008 | Blood group antigen BOA 3150 |
| 81969007 | Phosphoenolpyruvate carboxylase |
| 81989008 | Nucleoside phosphoacylhydrolase |
| 82004000 | Methyl acetate |
| 82017002 | 5-Carboxymethyl-2-hydroxymuconate delta-isomerase |
| 82021009 | Lotus aspartic proteinase |
| 82026004 | Butyl methyl ketone |
| 82055007 | Spermidine synthase |
| 82061005 | Triphenylamine |
| 82064002 | Coproporphyrinogen I |
| 82075003 | Bismuth subsalicylate |
| 82083009 | Phosphoprotein phosphatase |
| 82100006 | IMP dehydrogenase |
| 82122004 | Bacillus thuringiensis preparation |
| 82131004 | Heptabarb |
| 82134007 | Apyrase |
| 82149004 | Haemoglobin Hofu |
| 82150004 | Diisopropyl-fluorophosphatase |
| 82154008 | Rubber cis-polyprenylcistransferase |
| 82160008 | Cathepsin L |
| 82171009 | Blood group antibody Hoalzel |
| 82175000 | tRNA (guanine-N^1^)-methyltransferase |
| 82176004 | Blood group antigen Koopman |
| 82183006 | Cytoadhesin receptor |
| 82205007 | Tetrachloro-1,4- benzoquinone |
| 82216000 | Metazocine |
| 82220001 | Staphylococcal serine proteinase |
| 82222009 | Acetoacetate-coenzyme A ligase (substance) |
| 82224005 | Ethyl mercury phosphate |
| 82227003 | D-Lysopine dehydrogenase |
| 82230005 | Quinidine sulphate |
| 82239006 | Blood group antigen Naz |
| 82246002 | Exoribonuclease H |
| 82256003 | Human gene |
| 82270003 | Blood group antibody Bi |
| 82279002 | Blood group antibody Rh32 |
| 82282007 | Apigenin O^4'^-methyltransferase |
| 82299008 | Blood group antibody M^A^ |
| 82322007 | Oil of dill |
| 82332000 | Chlorodimethyl phenoxy ethanol |
| 82335003 | Gluconolactonase |
| 82337006 | Isopentyl alcohol |
| 82359008 | Prulaurasin |
| 82391009 | Haemoglobin F-Poole |
| 82394001 | Glucose-1-phosphate adenylyltransferase |
| 82395000 | CMP-N-acetylneuraminate-beta-galactoside alpha-2,3-sialyltransferase |
| 82398003 | Chlorinated biphenyl oxide |
| 82409003 | Antibody to hepatitis B core antigen |
| 82411007 | Rose bengal stain |
| 82412000 | Adenosylmethionine hydrolase |
| 82444001 | 3-Hydroxybutyryl-CoA dehydrogenase |
| 82450006 | Cottonseed oil |
| 82469001 | Glutathione dehydrogenase (ascorbate) |
| 82481002 | White phosphorus |
| 82485006 | Pentamethonium bromide |
| 82489000 | Blood group antibody IAB |
| 82490009 | Chenodeoxycholic acid |
| 82503004 | ^164^Ytterbium |
| 82544003 | Haemoglobin Bibba |
| 82549008 | Haemoglobin J-Broussais |
| 82565009 | Mucopolysaccharide |
| 82566005 | Animal feed |
| 82570002 | Glucose-1-phosphatase |
| 82571003 | Blood group antigen Zim |
| 82572005 | Sulphenone |
| 82592003 | Complement factor Bb |
| 82594002 | Blood group antibody Riv |
| 82604001 | Echis carnatus prothrombin-activating proteinase |
| 82609006 | Haptoglobin 1-1 |
| 82620006 | Blood group antigen M^g^ |
| 82622003 | Vitamin A (substance) |
| 82623008 | Dihydrodipicolinate synthase |
| 82645009 | Antibody to hepatitis B surface antigen |
| 82671008 | Alkylmercury lyase |
| 82682000 | Victoria blue 4R stain |
| 82693003 | Myoglobin |
| 82720002 | Blood group antigen Lu16 |
| 82753007 | Lymphocyte antigen CD20 |
| 82759006 | Dihydrofolate synthase |
| 82772007 | Formiminoaspartate deiminase |
| 82778006 | Uroporphyrin III |
| 82786006 | Citrate (re)-synthase |
| 82787002 | Chloridazon-catechol dioxygenase |
| 82792000 | Biotin-[methylmalonyl-CoA-carboxyltransferase] ligase |
| 82798001 | Coagulation factor X Prower variant |
| 82803005 | Blood group antibody Juneau |
| 82846008 | L-Arabinitol dehydrogenase |
| 82850001 | Fibrinogen Charlottsville |
| 82855006 | ^115^Indium |
| 82861009 | Blood group antigen Kelly |
| 82863007 | Incomplete antibody |
| 82873009 | Abnormal haemoglobin, extended chain |
| 82885001 | Colistimethate |
| 82890003 | Haemoglobin Tashikuergan |
| 82906001 | Aldose-6-phosphate reductase (NADPH) |
| 82912006 | Non-ionised calcium |
| 82922000 | Coagulation factor II Poissy variant |
| 82927006 | High molecular weight kininogen |
| 82931000 | Sodium succinate |
| 82937001 | Factor VII antibody |
| 82963006 | Polygalacturonase |
| 82981009 | Decaborane |
| 82983007 | Euchromatin |
| 82989006 | Decylhomocitrate synthase |
| 83003003 | Lymphocyte antigen CD37 |
| 83024008 | Oil of patchouli |
| 83026005 | RNA uridylyltransferase |
| 83034004 | Monocrotaline |
| 83036002 | Lactate |
| 83042003 | Erythropoietin |
| 83051006 | Cimetidine hydrochloride |
| 83054003 | Undecaprenol kinase |
| 83055002 | Escin |
| 83064007 | Haemoglobin J-Guantanamo |
| 83066009 | Haemoglobin Harbin |
| 83068005 | Factor XI antibody |
| 83078008 | Blood group antibody Os^a^ |
| 83087004 | 6-Phospho-beta-galactosidase |
| 83098003 | Intracellular fibril |
| 83102006 | Sorbitol-6-phosphatase |
| 83108005 | Blood group antigen Vg^a^ |
| 83109002 | Blood group antibody Baugh |
| 83115002 | Dichlorophenazone |
| 83131005 | Blood group antigen Perry |
| 83143006 | Glutethimide |
| 83149005 | Transaldolase |
| 83177001 | Thallium compound |
| 83180000 | Phenylpyruvate tautomerase |
| 83182008 | 2-Dehydro-3-deoxy-L-arabinonate dehydratase |
| 83184009 | Asparagine-transfer ribonucleic acid ligase (substance) |
| 83188007 | Adenylylsulphate-ammonia adenylyltransferase |
| 83191007 | Organic sulphone compound |
| 83205002 | ^76^Krypton |
| 83235009 | Bovine growth hormone recombinant |
| 83237001 | Titanium isotope |
| 83261008 | myo-Inositol 1-kinase |
| 83267007 | Phenacetin |
| 83280005 | Fibrinogen Lille |
| 83283007 | Chloramphenicol acetyltransferase |
| 83298009 | Ethyl acetate |
| 83309005 | Profenamine hydrochloride |
| 83310000 | Cupric salt |
| 83334005 | Adenine phosphoribosyltransferase |
| 83342006 | Cyanate hydrolase |
| 83348005 | Phosphatidylinositol-bisphosphatase |
| 83349002 | Viomycin kinase |
| 83357004 | Red veterinary petrolatum |
| 83388000 | UDP-N-acetylglucosamine-dolichyl-phosphate-N-acetylglucosaminephosphotransferase |
| 83391000 | HLA-Bw antigen |
| 83399003 | Glycerone kinase |
| 83400005 | Phosphoglycerate kinase (GTP) |
| 83404001 | Blood group antibody K |
| 83407008 | Protoveratrine A |
| 83423008 | Sodium diprotrizoate |
| 83432005 | Blood group antigen 1123K |
| 83438009 | Dobesilate calcium |
| 83446005 | Riboflavin synthase |
| 83475004 | Desmin |
| 83496006 | HLA class I antigen |
| 83499004 | Blood group antibody Maliff |
| 83515009 | HLA-DRw17 antigen |
| 83534009 | Cyclopentolate hydrochloride |
| 83539004 | Dihydrofolate reductase |
| 83545007 | Fumitremorgen |
| 83552009 | Pharyngeal mucus |
| 83581005 | Silicon dioxide |
| 83595008 | Goat's milk |
| 83596009 | Iron oxide |
| 83598005 | Xenon |
| 83600004 | Spirit soluble eosin stain |
| 83601000 | ^38^Sulphur |
| 83614004 | ^229^Thorium |
| 83615003 | Haemoglobin A>2< Fitzroy |
| 83616002 | Thrombomodulin-thrombin complex |
| 83619009 | Polyvinyl alcohol |
| 83621004 | Complement receptor 5 |
| 83625008 | Antimony thioglycolate |
| 83640005 | Uridine diphosphate-N-acetylmuramoylalanyl-D-glutamate-2,6 diaminopimelate ligase (substance) |
| 83667004 | Enterogastrone |
| 83671001 | Hydroxylysine kinase |
| 83672008 | Pentachloronitrobenzene |
| 83682009 | Methylaspartate mutase (substance) |
| 83688008 | Flumethrin |
| 83695004 | Haemoglobin Spanish Town |
| 83696003 | Oncogene protein LYL1 |
| 83700006 | Glyceraldehyde-3-phosphate dehydrogenase (NADP^+^) |
| 83701005 | Erythrulose reductase |
| 83702003 | Bialamicol |
| 83704002 | Pipethanate |
| 83705001 | Nitrogenase |
| 83717004 | Big big gastrin |
| 83732006 | Hb 114(G16), Leu |
| 83734007 | Blood group antigen Eggenberger |
| 83737000 | Tedion |
| 83749004 | Acid radical |
| 83769009 | Phosphoglycolate phosphatase |
| 83770005 | Phospho-2-dehydro-3-deoxygluconate aldolase |
| 83792009 | Succinate-CoA ligase (ADP-forming) |
| 83797003 | Leucine |
| 83814001 | Sorghum aspartic proteinase |
| 83815000 | Haemoglobin E |
| 83847005 | Palladium radioisotope |
| 83849008 | 1,1-Dichloroethylene |
| 83863002 | Deoxyguanosine kinase |
| 83869003 | Blood group antibody Co3 |
| 83871003 | Haemoglobin Sogn |
| 83872005 | Fenyramidol |
| 83873000 | Sodium monofluorophosphate |
| 83881004 | Aluminium oxide |
| 83882006 | Juniper oil |
| 83884007 | Blood group antigen Lu4 |
| 83897009 | Paralytic shellfish toxin |
| 83912003 | ^129^Iodine |
| 83933007 | Hydroxyzine pamoate |
| 83945003 | Hydroxyzine hydrochloride |
| 83963003 | Uranium nitrate |
| 83968007 | Clemastine fumarate |
| 83972006 | ^233^Uranium |
| 83981000 | Erythromycin gluceptate |
| 83989003 | Blood group antigen Messenger |
| 84006004 | Dihydrodipicolinate reductase |
| 84019000 | DNA alpha-glucosyltransferase |
| 84024002 | Dolichyl-phosphate beta-glucosyltransferase |
| 84035007 | Cystathionine |
| 84055008 | ^204^Bismuth |
| 84059002 | Pinguinain |
| 84079005 | Blood group antigen Clements |
| 84083005 | Haemoglobin Khartoum |
| 84103009 | Phenoxyethanol |
| 84123005 | Nitrofurfuryl methylether |
| 84131000 | Urate oxidase |
| 84136005 | Haemoglobin Stanleyville-II |
| 84144005 | Sodium cyanide |
| 84145006 | Cryptenamine |
| 84147003 | Thymidine,2-oxoglutarate dioxygenase |
| 84163006 | Blood group antigen Je^a^ |
| 84164000 | Chloramben |
| 84165004 | Cefoxitin sodium |
| 84169005 | Collidine |
| 84171005 | Blood group antibody Tc^b^ |
| 84181009 | Styrene |
| 84191003 | ^193^Platinum |
| 84212004 | Ethylenimine |
| 84213009 | Midazolam hydrochloride |
| 84217005 | Titan yellow stain |
| 84230006 | Plant sesquiterpene |
| 84242001 | ^245^Plutonium |
| 84250005 | Fumitoxin |
| 84259006 | Blood group antigen Wb |
| 84270004 | Cade oil |
| 84274008 | Hydrobromic acid |
| 84276005 | Lymphocyte antigen CD43 |
| 84317008 | Phosphonacetic acid |
| 84323003 | Mercocresols |
| 84341006 | ^254^Californium |
| 84342004 | Rubidium radioisotope |
| 84345002 | Haemoglobin Saverne |
| 84348000 | Fructose 5-dehydrogenase (NADP^+^) |
| 84361000 | Fibrinogen Los Angeles |
| 84363002 | Hydroxyketone dye |
| 84372005 | Blood group antibody Hartley |
| 84373000 | Hyaluronoglucuronidase |
| 84375007 | Haemoglobin J-Sicilia |
| 84377004 | Staphylococcal cysteine proteinase |
| 84381004 | Menthyl anthranilate and titanium oxide |
| 84386009 | Tribromoethanol |
| 84406006 | HLA-DPw antigen |
| 84424008 | Potassium cyanide |
| 84429003 | Rubredoxin-NAD(P)^+^ reductase |
| 84430008 | Cross reacting antibody |
| 84433005 | HLA-Bw56 antigen |
| 84443008 | ^225^Radium |
| 84464007 | Lymphocyte antigen CD42b |
| 84486008 | Mannose-1-phosphate guanylyltransferase |
| 84488009 | Compound blood group antigen iH |
| 84498003 | Pipe smoking tobacco |
| 84509001 | Haemoglobin Siriraj |
| 84520001 | Viral structural gene |
| 84524005 | Idursulfase |
| 84536004 | Fibrinogen Metz |
| 84538003 | Blood group antigen C |
| 84547006 | L-Ascorbate oxidase |
| 84553006 | ^93m^Molybdenum |
| 84560000 | Leucine aminotransferase |
| 84583002 | Active C5b |
| 84601005 | Immunoglobulin, GM>24< allotype |
| 84609007 | Blood group antibody Xg^a^ |
| 84616008 | Dolichyl-xylosyl-phosphate-protein xylosyltransferase |
| 84629008 | Androgen |
| 84650004 | Intestinal contents |
| 84653002 | Blood group antibody Swarts |
| 84656005 | Atebrin FS stain |
| 84658006 | Blood group antibody Elder |
| 84671009 | Acyl-[acyl-carrier-protein] desaturase |
| 84698008 | Cholesterol |
| 84704008 | Pyridoxamine-oxaloacetate aminotransferase |
| 84708006 | Blood group antigen Gill (substance) |
| 84717006 | Diacylglycerol-sterol acyltransferase |
| 84718001 | Alkyl dimethyl ethyl ammonium bromide |
| 84720003 | Complement component C4a |
| 84746004 | Pituitary hormone |
| 84748003 | Doxapram hydrochloride |
| 84761003 | Phosphodiesterase I |
| 84770000 | Polyphosphate kinase |
| 84771001 | D-Xylose dehydrogenase |
| 84786007 | Dehydrogluconokinase |
| 84791008 | Sodium metabisulphite |
| 84802001 | Equinatoxin |
| 84818007 | 17,21-Dihydroxypregnenolone |
| 84822002 | Methyl methacrylate |
| 84823007 | Transfer ribonucleic acid isopentenyltransferase (substance) |
| 84835006 | Cyclic adenosine monophosphate |
| 84847000 | Platinum |
| 84865001 | Active C1r/C1s |
| 84870008 | Blood group antibody Horn |
| 84874004 | Iodohippurate I^123^ sodium |
| 84896005 | Oncogene protein TCL3 |
| 84905003 | Beta interferon |
| 84922001 | Blood group antibody McAuley |
| 84926003 | Homovanillic acid |
| 84927007 | Fungal gene |
| 84933003 | Germanium tetrahydride |
| 84934009 | Haemoglobin Cowtown |
| 84935005 | Tumour-angiogenesis factor |
| 84960005 | Auxin A |
| 84963007 | ^3^Helium |
| 84973009 | Glucan 1,6-alpha-isomaltosidase |
| 84987009 | Ethyl phosphate |
| 84990003 | ^80^Bromine |
| 85012003 | Protein-glutamate methyltransferase |
| 85024005 | Plant oestrogenic glycoside |
| 85035000 | Griseofulvin microsize |
| 85037008 | Doxepin hydrochloride |
| 85043005 | D-Alanine aminotransferase |
| 85060000 | Blood group antibody Duvall |
| 85066006 | Azo black stain |
| 85074007 | ^103m^Rhodium |
| 85105005 | Haemoglobin Inkster |
| 85112001 | Cellodextrin phosphorylase |
| 85115004 | Methylmalonate-semialdehyde dehydrogenase (acylating) (substance) |
| 85122007 | Globoside alpha-N-acetylgalactosaminyltransferase |
| 85129003 | Blood group antigen Wr^a^ |
| 85134004 | Phospholipase D |
| 85137006 | Tetrachlorophenol |
| 85142003 | Germanium isotope |
| 85146000 | Thorium radioisotope |
| 85155002 | Anti RANA antibody |
| 85172009 | Bromine pentafluoride |
| 85174005 | Phthalocyanine dye |
| 85181003 | Fibrous protein |
| 85185007 | p-Nitrobiphenyl |
| 85190005 | Bismark brown Y stain |
| 85197008 | Coagulation factor IX Vancouver variant |
| 85205004 | beta-Adrenergic receptor |
| 85214009 | Glutamic acid |
| 85236007 | D region, MHC |
| 85242006 | Levamfetamine |
| 85246009 | Barbiturase |
| 85252005 | Cuscohygrine |
| 85253000 | Blood group antigen Bp^a^ |
| 85254006 | Opheline kinase |
| 85258009 | Chromic acid |
| 85267009 | Angiotensin II |
| 85268004 | 5-Dehydro-2-deoxygluconokinase |
| 85270008 | Wood splinter |
| 85283009 | Glutamine-phenylpyruvate aminotransferase |
| 85287005 | Hypoxanthine |
| 85294008 | Haptoglobin |
| 85297001 | Maltose synthase |
| 85310002 | Bis(5'-adenosyl)-triphosphatase |
| 85335008 | beta Pyridyl carbinol |
| 85347002 | Cardiotoxin venom |
| 85351000 | Aldehyde oxidase |
| 85364004 | Coagulation factor II Madrid variant |
| 85369009 | Tin radioisotope |
| 85374001 | Blood group antigen Donavieski |
| 85378003 | Bromine |
| 85391002 | Meralluride |
| 85393004 | Blood group antigen ILe^bH^ |
| 85404003 | ^131^Tellurium |
| 85410003 | Haemoglobin Linkoping |
| 85427006 | Haemoglobin Owari |
| 85433002 | Butoconazole nitrate |
| 85451001 | Nitrite reductase (cytochrome) |
| 85459004 | Exophthalmos producing substance |
| 85460009 | Oncogene protein K-RAS |
| 85462001 | Pentanone |
| 85475001 | Cypermethrin |
| 85482002 | Sorbitol-6-phosphate dehydrogenase |
| 85491003 | Catalase (substance) |
| 85494006 | Gold sodium thiosulphate |
| 85504001 | Complement component C5a |
| 85508003 | 5-Pyridoxate dioxygenase |
| 85565002 | Blood group antigen Fy5 |
| 85574000 | Zinc oxide fumes |
| 85577007 | Diaminobutyrate-pyruvate aminotransferase |
| 85580008 | Capreomycin sulfate |
| 85584004 | Achromobacter iophogus collagenase |
| 85594009 | Blood group antigen Sc1 |
| 85596006 | Fluorescein |
| 85600001 | Triglyceride |
| 85603004 | Triphenamyl |
| 85608008 | Methacrylonitrile |
| 85609000 | Methionine gamma-lyase |
| 85612002 | Atrazine |
| 85633006 | Nitrosulfathiazole |
| 85643009 | Filicin |
| 85661000 | 5-Methyltetrahydropteroyltriglutamate-homo-cysteine methyltransferase |
| 85668006 | Starch powder |
| 85673000 | Intracisternal material |
| 85689002 | Coproporphyrinogen III |
| 85693008 | Technetium Tc^99m^ aggregated albumin |
| 85701007 | Ganglioside GM>2< |
| 85717001 | Carbonate dehydratase |
| 85724000 | Oxacillin sodium |
| 85727007 | Xanthine phosphoribosyltransferase |
| 85731001 | Immunoglobulin, secretory piece |
| 85737002 | Chlorpheniramine maleate |
| 85751002 | 17-Hydroxyprogesterone |
| 85760005 | Hyperosmotic laxative |
| 85766004 | myo-Inositol 3-methyltransferase |
| 85773009 | Haemoglobin D-Ouled Rabah |
| 85784002 | Cytosine deaminase |
| 85788004 | Thioglycolic acid |
| 85794007 | Blood group antibody Snyder |
| 85822005 | Zeatin |
| 85829001 | Left bronchial mucus |
| 85834002 | Blood group antibody Cooper |
| 85839007 | Glutamine-scyllo-inosose aminotransferase |
| 85854001 | Alkane 1-monooxygenase |
| 85860001 | Nervous system hormone-like substance |
| 85877001 | Ethanolamine kinase |
| 85886006 | Blood group antigen Peretz |
| 85889004 | ^191^Platinum |
| 85894004 | Ketol-acid reductoisomerase |
| 85899009 | Lithium |
| 85906005 | Bulbogastrone |
| 85923001 | Oil of marjoram |
| 85937005 | Acrolein |
| 85943007 | Ca^2+^-transporting ATPase |
| 85954002 | Blood group antigen Berrio |
| 85955001 | Haemoglobin A>2< Zagreb |
| 85958004 | ^72^Selenium |
| 85969001 | Haemoglobin Rampa |
| 85977002 | Crag herbicide |
| 85981002 | Chromotrope 2R stain |
| 85984005 | Haemoglobin Memphis |
| 85988008 | Blood group antibody Jk^a^ |
| 85997007 | Oncogene protein mas |
| 85998002 | Blood group antibody Ull |
| 86001006 | HLA-DPw2 antigen |
| 86026002 | Haemoglobin Stanmore |
| 86027006 | Argon isotope |
| 86054009 | Riboflavinase |
| 86076000 | Lymphocyte antigen CD45RO |
| 86083007 | Blood group antigen Pantaysh |
| 86108002 | mRNA (O^2^'-methyladenosine-N^6^)-methyltransferase |
| 86120005 | Phosphoribulokinase |
| 86132009 | Haemoglobin A>2< Honai |
| 86141004 | UTP-glucose-1-phosphate uridylyltransferase |
| 86155007 | Lanosterol |
| 86180007 | Serpentine asbestos |
| 86186001 | ^37^Argon |
| 86202008 | NAD^+^ pyrophosphatase |
| 86205005 | Carbon oxysulphide |
| 86211008 | Free thyroxin |
| 86218002 | Cantharidin |
| 86223002 | Carboxypeptidase B |
| 86227001 | Ytterbium |
| 86233005 | Sulphur dioxide |
| 86239009 | Galactoside 3(4)-L-fucosyltransferase |
| 86241005 | ^66^Germanium |
| 86243008 | ^109^Cadmium |
| 86254003 | Blood group antigen Tichmeyer |
| 86257005 | Ritodrine hydrochloride |
| 86261004 | Decay accelerating factor |
| 86272009 | HLA-Dw8 antigen |
| 86281003 | 2-Nitropropane |
| 86301004 | Posterior pituitary hormone |
| 86315002 | Dibutyl succinate |
| 86320002 | Fibrinogen Milano I |
| 86332003 | Blood group antigen Yt^b^ |
| 86336000 | Haemoglobin Chiapas |
| 86340009 | Glucose 1-phosphate thymidylyltransferase |
| 86355000 | Electrolyte |
| 86383003 | Coccidioidin |
| 86388007 | Mercuric oxide |
| 86399009 | Nickel isotope |
| 86416000 | Potassium arsenite |
| 86420001 | Biotin-[propionyl-CoA-carboxylase,(ATP-hydrolysing)] ligase |
| 86430005 | L-Iduronidase |
| 86431009 | Pantothenic acid |
| 86436004 | Ethyl nitrophenyl benzene thiophosphonate |
| 86447006 | Glycerophosphoric acid |
| 86460000 | D-Methionine-pyruvate aminotransferase |
| 86461001 | Plant diterpene |
| 86471004 | Tribasic copper sulphate |
| 86478005 | Diisopropylamine |
| 86506005 | Mercury (II) reductase |
| 86518001 | Steroid sulphotransferase |
| 86520003 | Haemoglobin J-Chicago |
| 86521004 | ^77^Bromine |
| 86526009 | Deoxyguanylic acid |
| 86529002 | N-Sulphoglucosamine-3-sulphatase |
| 86530007 | Blood group antibody Hu |
| 86532004 | Blood group antibody Sj |
| 86537005 | Penicillium roqueforti neutral proteinase |
| 86541009 | Brilliant crocein stain |
| 86549006 | Hypothalamic or pituitary hormone |
| 86551005 | Haemoglobin Chad |
| 86575005 | Nitrogen isotope |
| 86579004 | Nitrogen gas |
| 86584005 | Pheniodol sodium |
| 86600008 | Fish toxin |
| 86609009 | Wood preservative |
| 86613002 | Sarcosine oxidase |
| 86621008 | Hamamelose kinase |
| 86622001 | Blood group antibody Taur |
| 86627007 | Haemoglobin F-Ube |
| 86633003 | Cadmium salt |
| 86637002 | ^81^Rubidium |
| 86640002 | 3-Demethylubiquinone-9 3-methyltransferase |
| 86659000 | Thiethylperazine malate |
| 86668003 | Blood group antigen Barrett |
| 86692006 | ^206^Thallium |
| 86697000 | HLA-Aw36 antigen |
| 86701002 | Nucleoside-triphosphate pyrophosphatase |
| 86710005 | Nitrogen radioisotope |
| 86712002 | (S)-2-Hydroxy-fatty-acid dehydrogenase |
| 86739005 | Zinc |
| 86742004 | Deoxycytidylate hydroxymethyltransferase |
| 86750008 | Nitrazine yellow stain |
| 86754004 | ^197^Platinum |
| 86756002 | Tincture of green soap |
| 86759009 | Blood group antibody Gallner |
| 86778009 | Polyribonucleotide synthase (ATP) |
| 86783001 | L-Galactonolactone oxidase |
| 86790006 | Blood group antibody JL |
| 86813000 | Oxalomalate lyase |
| 86822004 | Neurine |
| 86836009 | Haemoglobin J-Baltimore |
| 86848007 | Penicillin amidase |
| 86852007 | ^196m>2<^Gold |
| 86865003 | ^65^Nickel |
| 86878003 | Retinal dehydrogenase |
| 86884000 | 2,4,5-Trichlorophenoxyacetic acid |
| 86887007 | Haemoglobin I-Interlaken |
| 86904001 | Cholestenone 5alpha-reductase |
| 86913004 | Blood group antibody Milne |
| 86922003 | Plant cardiac glycoside |
| 86928004 | Sulphur tetrafluoride |
| 86935007 | Blood group antigen An^a^ |
| 86946005 | Trichlorophenoxy ethyl sulphate |
| 86951004 | Blood group antibody Hands |
| 86953001 | Zinc salt |
| 86955008 | Glycobiarsol |
| 86960007 | Epidermal growth factor-urogastrone receptor |
| 86963009 | Lower respiratory tract mucus |
| 86973006 | ^133m^Barium |
| 86988001 | Ergotoxine |
| 86990000 | Deoxycytidine kinase |
| 86994009 | HLA-B38 antigen |
| 87028007 | Hemp fibre |
| 87032001 | Dipeptidyl peptidase II |
| 87033006 | Itaconyl-CoA hydratase |
| 87036003 | Blood group antibody R1^a^ |
| 87039005 | Carbamoyl-serine ammonia-lyase |
| 87044003 | Palmitic acid |
| 87067001 | Sublimed sulphur |
| 87090006 | Flavoxate hydrochloride |
| 87097009 | Nitrofurazone |
| 87112000 | Blood group antigen Zaw |
| 87116002 | 5,25-Dihydroxy cholecalciferol |
| 87122006 | Blood group antibody Covas |
| 87136001 | Asparagine |
| 87148003 | Amphetamine sulphate |
| 87151005 | Neostigmine methylsulfate |
| 87154002 | Cystine reductase (reduced nicotinamide adenine dinucleotide) (substance) |
| 87167004 | Oncogene protein int-2 |
| 87171001 | ^127m^Tellurium |
| 87174009 | Guaifenesin |
| 87200008 | Lower respiratory fluids |
| 87205003 | Maldison |
| 87212007 | Lysine-tRNA ligase |
| 87222001 | Citrate(si)-synthase |
| 87236006 | Dihydroxyphenylalanine ammonia-lyase |
| 87251002 | 4-Methoxyamphetamine |
| 87283008 | Clidinium bromide |
| 87300005 | 2,4-Dichlorophenol 6-monooxygenase |
| 87303007 | Cefapirin |
| 87304001 | Acetylglutamate kinase |
| 87312009 | Colony-stimulating factor, multiple |
| 87316007 | Immunoglobulin, light chain |
| 87332005 | Homogentisic acid |
| 87336008 | Alcohol dehydrogenase |
| 87337004 | Sulphur iodide |
| 87344008 | Pantothenate kinase |
| 87347001 | Urocanic acid |
| 87368000 | Blood group antibody En^a^FR |
| 87371008 | Phosphoribosyl pyrophosphate |
| 87399004 | Apolipoprotein A |
| 87401005 | ^212^Lead |
| 87403008 | Heptane |
| 87410002 | Technetium Tc^99^ N-substituted iminodiacetate |
| 87437000 | ^73^Selenium |
| 87440000 | Tryptophan 5-monooxygenase |
| 87444009 | Immunoglobulin, GM>12< allotype |
| 87445005 | Ipodate |
| 87452007 | Light metal compound |
| 87453002 | Carbon |
| 87468001 | Magnesium bromide |
| 87472002 | Vecuronium bromide |
| 87477008 | Phytanic acid |
| 87478003 | ^239^Plutonium |
| 87485004 | Strontium bromide |
| 87499000 | Blood group antigen Mckeever |
| 87504000 | Enoyl-CoA hydratase |
| 87524001 | Immunoglobulin, hypervariable region |
| 87526004 | Bilirubin oxidase |
| 87542006 | Blood group antigen Rh33 |
| 87549002 | Blood group antigen Gd |
| 87568004 | Hormone |
| 87574004 | o-Aminophenol oxidase |
| 87585002 | ^41^Calcium |
| 87593002 | Blood group antibody Er^a^ |
| 87599003 | Metaxalone |
| 87609004 | Hexokinase |
| 87610009 | Aflatoxin B |
| 87612001 | Blood |
| 87624008 | L-Iditol dehydrogenase |
| 87625009 | 4-Hydroxy-2-oxoglutarate aldolase |
| 87629003 | Coagulation factor X variant |
| 87645001 | Hexylene glycol |
| 87657005 | Blood group antibody E. Amos |
| 87661004 | Lymphocyte antigen CD59 |
| 87664007 | Haemoglobin A>2< NYU |
| 87672009 | Blood group antigen Mateen |
| 87692002 | Wax-ester hydrolase |
| 87708000 | Vitamin |
| 87714007 | ^185^Iridium |
| 87718005 | Acetyl-CoA carboxylase-phosphatase |
| 87723005 | Cholestenone 5beta-reductase |
| 87729009 | Sulphite oxidase |
| 87738006 | Isopropyl cresol |
| 87741002 | Haemoglobin D-Bushman |
| 87744005 | Calcium arsenate |
| 87802005 | ^33^Phosphorus |
| 87805007 | Deoxycytidine deaminase |
| 87811005 | Injectable fibrinolysin |
| 87817009 | Glycerol-3-phosphate dehydrogenase (NAD^+^) |
| 87831009 | Trimipramine maleate |
| 87835000 | Blood group antibody Dantu |
| 87847006 | Promoxolane |
| 87853006 | Technetium Tc^99m^ iron ascorbate |
| 87869004 | Manganese |
| 87873001 | Ribonuclease U>2< |
| 87882007 | 3-Isopropylmalate dehydratase |
| 87889003 | Haemoglobin Chapel Hill |
| 87896001 | Creosote |
| 87897005 | Human antihaemophilic plasma |
| 87901004 | Catechol l,2 dioxygenase |
| 87918000 | Mineral |
| 87924006 | N-Acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase |
| 87925007 | Biotin-CoA ligase |
| 87926008 | Deoxythymidine diphosphate-4-amino-4,6-dideoxy-D-glucose aminotransferase (substance) |
| 87929001 | Ribose dehydrogenase (NADP^+^) |
| 87930006 | Fibrinogen Baltimore I |
| 87931005 | Mimosine |
| 87940009 | ^179^Tantalum |
| 87946003 | Blood group antigen U^x^ |
| 87954001 | Guanosine deaminase |
| 87957008 | Calotropin |
| 87958003 | Ferrous citrate Fe^59^ |
| 87972007 | Blood group antibody Sadler |
| 87981001 | o-Pyrocatechuate decarboxylase |
| 87983003 | Rhodium salt |
| 87990008 | Phospho-N-acetylmuramoyl-pentapeptide-transferase |
| 88001004 | Chlorpropham |
| 88005008 | Haemoglobin Helsinki |
| 88007000 | Sodium tetrahydride |
| 88014003 | Beryllium |
| 88020002 | Ketoacid |
| 88023000 | LYT antigen |
| 88025007 | Silvex |
| 88038004 | Fructuronate reductase |
| 88043006 | Allose kinase |
| 88064005 | Haemoglobin F-Forest Park |
| 88074008 | Cytokinins |
| 88087002 | Dodecylguanidine monoacetate |
| 88090008 | Tellurium isotope |
| 88097006 | Tin compound |
| 88122008 | Passiflorine |
| 88131008 | HLA-DRw12 antigen |
| 88166005 | Copper^64^ versenate |
| 88171003 | Cytidine deaminase |
| 88179001 | Robin |
| 88184007 | Acetyl chloride |
| 88194002 | Clofenotane |
| 88204001 | Antigen in Kidd (JK) blood group system |
| 88222003 | Phosphatidylcholine 12-monooxygenase |
| 88236008 | Phosphine |
| 88237004 | ^82m^Rubidium |
| 88245009 | Bacillus subtilis ribonuclease |
| 88262004 | Phenylphosphine |
| 88287006 | Sulphur radioisotope |
| 88292008 | Blood group antigen Zt^a^ |
| 88304003 | Lymphocyte antigen CD48 |
| 88319002 | Prompt zinc insulin |
| 88325003 | Calcium undecylenate |
| 88330004 | Cevine |
| 88337001 | Maleylacetoacetate isomerase |
| 88341002 | Blood group antibody k |
| 88342009 | HLA-D antigen |
| 88352008 | Bromindione |
| 88368002 | Angiotensin I |
| 88375001 | Blood group antibody Van Buggenhout |
| 88376000 | Carcinogen |
| 88381009 | Methyl chloride |
| 88383007 | Phosphoglucokinase |
| 88404004 | alpha>2< Neuramino glycoprotein |
| 88406002 | Chymotrypsin C |
| 88408001 | D-Amino-acid oxidase |
| 88426003 | Oncogene protein N-MYC |
| 88427007 | Methyl acetylene |
| 88432008 | Arabinose isomerase |
| 88452009 | Steroid delta-isomerase |
| 88453004 | Platelet antigen HPA-1a |
| 88457003 | ^198^Lead |
| 88462002 | HLA-Aw33 antigen |
| 88468003 | Magnesium silicate |
| 88473009 | Selenomethionine Se^75^ |
| 88476001 | Urate |
| 88480006 | Potassium |
| 88485001 | Etidocaine |
| 88486000 | Poly (ribitol-phosphate) beta-glucosyltransferase |
| 88488004 | Lead |
| 88502003 | Behenic acid |
| 88525002 | 2-Coumarate O-beta-glucosyltransferase |
| 88543003 | Oxyfenamate |
| 88546006 | Sarcosine |
| 88551000 | 5-Azacytidine |
| 88555009 | Aminodeoxygluconate dehydratase |
| 88557001 | Phosphatidylcholine-sterol acyltransferase |
| 88574001 | Otic sulphonamide preparation |
| 88583006 | Creatinine deiminase |
| 88585004 | Chlorprothixene hydrochloride |
| 88589005 | Cyclocumarol |
| 88602005 | Glucagon-like peptide 2 |
| 88605007 | ^224^Radium |
| 88617009 | Magnesium isotope |
| 88625006 | Water soluble aniline blue stain |
| 88631009 | beta Sitosterol |
| 88637008 | Haemoglobin A>2< Babinga |
| 88640008 | Deoxyribodipyrimidine endonucleosidase |
| 88660000 | Fast sulphon black F stain |
| 88661001 | Platelet antibody HPA-4a |
| 88662008 | Pyridoxine 5-dehydrogenase |
| 88683002 | Active C4b2a3b |
| 88689003 | Long-chain-alcohol dehydrogenase |
| 88704000 | Bacterial insecticide |
| 88709005 | Deoxythymidine monophosphate kinase (substance) |
| 88710000 | alpha-1,3-Mannosyl-glycoprotein beta-1,2-N-acetylglucosaminyltransferase |
| 88724001 | Ptomatropine |
| 88730001 | Fibrinogen Paris IV |
| 88736007 | Betamethasone dipropionate |
| 88754006 | alpha-Naphthyl thiourea |
| 88757004 | Sulfafurazole acetyl |
| 88770008 | Indole-3-acetaldehyde reductase (NADH) |
| 88781006 | Americium |
| 88785002 | Nitroso dye |
| 88792007 | Peptidoglycan glycosyltransferase |
| 88802007 | Chlorazanil |
| 88811007 | Witch hazel |
| 88832004 | 3alpha-Hydroxycholanate dehydrogenase |
| 88863000 | tert-Butyl alcohol |
| 88864006 | ^250^Californium |
| 88878007 | Protein |
| 88881002 | Blood group antigen H |
| 88896003 | Threonine racemase |
| 88913006 | Blood group antigen Milano |
| 88919005 | Fibroblast growth factor |
| 88921000 | Fibril |
| 88941005 | Haemoglobin Thailand |
| 88949007 | 2-Alkyn-1-ol dehydrogenase |
| 88954003 | ^55^Iron |
| 88958000 | Blood group antibody Mo^a^ |
| 88970001 | Eudermol |
| 88983000 | Lymphocyte antigen CD61 |
| 89006002 | Vipera russelli proteinase |
| 89009009 | Methylphosphothioglycerate phosphatase |
| 89015009 | Choleretic agent |
| 89025004 | MCPA sodium salt |
| 89028002 | Curcumin stain |
| 89033003 | Blood-group-substance endo-1,4-beta-galactosidase |
| 89041003 | Blood group antigen Sk^a^ |
| 89043000 | Blood group antibody Geslin |
| 89048009 | Collagen type IV |
| 89055006 | Benzylpenicillin sodium |
| 89064001 | Oncogene protein met |
| 89067008 | Cinchonidine |
| 89071006 | Phenylpyruvic acid |
| 89074003 | Blood group antigen Wolfe |
| 89086000 | Fibrin degradation product |
| 89094007 | Thrombospondin |
| 89095008 | Takabrucem salicylanilide |
| 89119000 | Nitrate salt |
| 89128004 | Xanthates |
| 89139001 | Light green SF stain |
| 89148006 | Fast garnet GBC salt stain |
| 89152006 | Dynein ATPase |
| 89177007 | Proton |
| 89184004 | Vinbarbital |
| 89189009 | Neurohumoural receptor |
| 89191001 | 15-Hydroperoxy-5,8,11,13-eicosatetraenoic acid |
| 89195005 | Octamethyl pyrophosphoramide |
| 89197002 | Germanium compound |
| 89201002 | Carbonyl reductase (NADPH) |
| 89203004 | Acetolactate decarboxylase |
| 89214001 | Chlorotoloxyacetic acid |
| 89219006 | Potassium gluconate |
| 89224009 | Glucan 1,6-alpha-glucosidase |
| 89227002 | Paracrine substance |
| 89249008 | Dipyrrole |
| 89256002 | Formate dehydrogenase |
| 89263002 | Glucose-1-phosphate cytidylyltransferase |
| 89264008 | rRNA (adenine-N^6^)-methyltransferase |
| 89272005 | ^58^Cobalt |
| 89284007 | N^6^-Methyl-lysine oxidase |
| 89289002 | [Hydroxymethylglutaryl-CoA reductase (NADPH)]-phosphatase |
| 89301000 | 2-Oxoadipate reductase |
| 89306005 | Imidazoleacetate-phosphoribosyldiphosphate ligase |
| 89307001 | 15-Hydroxyprostaglandin dehydrogenase (NAD^+^) |
| 89309003 | Organic sulphur compound |
| 89326009 | Glucosulphone sodium |
| 89335002 | Copper undecylenate |
| 89336001 | Caffeate 3,4-dioxygenase |
| 89349006 | Hexachloroacetone |
| 89350006 | Blood group antibody O'Connor |
| 89351005 | Potassium iodide |
| 89364006 | Leucine dehydrogenase |
| 89371001 | 5-Oxoprolyl-peptidase |
| 89401004 | Potassium guaiacolsulphonate |
| 89422005 | Allobarbital |
| 89436000 | Blood group antigen Rich |
| 89453007 | Citryl-CoA lyase |
| 89457008 | Radioactive isotope |
| 89468008 | Coagulation factor IX Seattle variant |
| 89482008 | Histidinol-phosphate aminotransferase |
| 89506006 | Oxalic acid |
| 89515004 | Hypochlorite salt |
| 89518002 | N-octylbicycloheptene dicarboximide |
| 89526005 | HLA-B18 antigen |
| 89543008 | Blood group antibody V |
| 89553009 | Sulphite reductase (ferredoxin) |
| 89564007 | Blood group antigen Cameron |
| 89577003 | Pontamine sky blue 5BX stain |
| 89588009 | Aryl-aldehyde dehydrogenase (NADP^+^) |
| 89592002 | Blood group antibody Be^a^ |
| 89595000 | Iodised oil |
| 89612008 | Petrichloral |
| 89619004 | Ubiquinol-cytochrome-c reductase |
| 89632009 | ^227^Thorium |
| 89668004 | Blood group antigen Terschurr |
| 89669007 | Carboxypeptidase S |
| 89678001 | Cefuroxime axetil |
| 89701003 | Dithiazanine iodide |
| 89702005 | Selenium salt |
| 89707004 | Sesame oil |
| 89717009 | Bilirubin Z transport protein |
| 89735000 | Blood group antibody Kenneddy |
| 89745003 | Somatotropin receptor |
| 89750009 | Adonidin (substance) |
| 89767002 | Blood group antibody Mateen |
| 89771004 | Lymphocyte antigen CD34 |
| 89772006 | Tranylcypromine sulfate |
| 89775008 | Pipamazine |
| 89781000 | Hydroxymandelonitrile lyase |
| 89803009 | Blood group antigen Mackin |
| 89811004 | Gluten |
| 89818005 | Technetium Tc^99^ tagged red cells |
| 89822000 | 4-Nitroso dimethylamine |
| 89829009 | Etioporphyrin |
| 89838006 | Coagulation factor IX Hilo variant |
| 89841002 | Blood group antibody AY |
| 89848008 | (S)-Norlaudanosoline synthase |
| 89851001 | Thebaine |
| 89853003 | Cortilymph |
| 89856006 | Ponceau S stain |
| 89864000 | Entomophthora collagenolytic proteinase |
| 89866003 | Plotospasmin toxin |
| 89867007 | Triorthocresyl phosphate |
| 89875001 | Serogically-defined antigen |
| 89889006 | Cotton fibre |
| 89920007 | Blood group antibody Pr>1d< |
| 89926001 | ^236^Uranium |
| 89952007 | Blood group antigen s^D^ |
| 89981008 | Nucleoside ribosyltransferase |
| 90011005 | CDPglycerol pyrophosphatase |
| 90018004 | 6-Phospho-beta-glucosidase |
| 90019007 | (N-Acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase |
| 90025006 | ^95^Zirconium |
| 90026007 | Ajacine |
| 90029000 | Tyrosine carboxypeptidase |
| 90047006 | Aminobenzoate decarboxylase |
| 90058002 | Bauxite fumes |
| 90059005 | ^79^Krypton |
| 90066006 | Oxalyl-CoA decarboxylase |
| 90077000 | Progesterone monooxygenase |
| 90086005 | Sphingosine |
| 90088006 | HLA-B39 antigen |
| 90095002 | Oil of angelica |
| 90100000 | Isopropanol dehydrogenase (NADP^+^) |
| 90106006 | Blood group antibody En^a^FS |
| 90107002 | Alkylglycerone kinase |
| 90118002 | Dobutamine hydrochloride |
| 90136002 | Pink wine |
| 90142003 | Calcium caseinate |
| 90148004 | Succinate-hydroxymethylglutarate CoA-transferase |
| 90150007 | ^117m^Tin |
| 90156001 | Blood group antigen Becker |
| 90160003 | Blood group antibody Bell |
| 90170001 | Propargyl alcohol |
| 90192002 | Aspergillus oryzae neutral proteinase |
| 90193007 | Agmatine 4-coumaroyltransferase |
| 90209005 | ^100^Rhodium |
| 90220005 | Novobiocin |
| 90234005 | Candicin toxin |
| 90247000 | Blood group antibody Gould |
| 90260006 | Allergen |
| 90266000 | Haemoglobin D |
| 90296005 | Blood group antibody Fy4 |
| 90299003 | Blood group antigen U^z^ |
| 90304002 | Blood group antibody Wetz |
| 90311003 | Lymphocyte chemotactic factor |
| 90317004 | Helium |
| 90339002 | Germicide |
| 90342008 | Carbazochrome salicylate |
| 90344009 | Etazocine |
| 90350004 | 1-Pyrroline-4-hydroxy-2-carboxylate deaminase |
| 90355009 | Carbon radioisotope |
| 90404003 | Fibrinogen Barcelona I |
| 90495007 | Plant alcoholic oil |
| 90529007 | ^77^Germanium |
| 90534006 | (R)-Dehydropantoate dehydrogenase |
| 90537004 | ^232^Plutonium |
| 90544008 | Iodine monochloride |
| 90567005 | Iron isotope |
| 90581007 | Carbamide peroxide |
| 90582000 | Cytidine triphosphate |
| 90595005 | Silver bromide |
| 90615000 | Human leukocyte antigen Bw61 (substance) |
| 90617008 | Indium^113^ bleomycin |
| 90618003 | Gold compound |
| 90624009 | Blood group antigen Mo^a^ |
| 90633006 | Azobilirubin pigment |
| 90644003 | L-Gulonate dehydrogenase |
| 90656002 | Blood group antigen LW^a^ |
| 90664008 | ^127^Tin |
| 90666005 | Glyoxylate reductase (NADP^+^) |
| 90667001 | Lymphocyte antigen CD72 |
| 90668006 | Enzyme |
| 90670002 | Deltamethrin |
| 90671003 | Potassium thiocyanate |
| 90677004 | Mustard white |
| 90694002 | Asparagine synthase (glutamine-hydrolysing) |
| 90696000 | Neosaxitonin |
| 90698004 | Chondro-6-sulphatase |
| 90714008 | HLA-Aw74 antigen |
| 90720009 | Cytoplasmic antibody |
| 90724000 | 3-Hydroxymethylcephem carbamoyltransferase |
| 90733003 | Metrizamide |
| 90737002 | Leaves |
| 90743000 | Deoxycytidine triphosphate deaminase |
| 90745007 | Bunamiodyl |
| 90758008 | Coparaffinate |
| 90762002 | Blood group antibody Jk3 (substance) |
| 90812004 | Hot liquid |
| 90836000 | Blood group antigen Reiter |
| 90841008 | Thallium radioisotope |
| 90847007 | Guanine tRNA-ribosyltransferase |
| 90851009 | Coagulation factor Va |
| 90865006 | Haemoglobin J-Cambridge |
| 90867003 | Cytochrome-b>5< reductase |
| 90872007 | Ephedrine dehydrogenase |
| 90873002 | Malate dehydrogenase (acceptor) |
| 90875009 | Doxorubicin hydrochloride |
| 90879003 | Thorium compound |
| 90902007 | (S)-2-Hydroxy-acid oxidase |
| 90922006 | Protopine |
| 90936001 | Haemoglobin Crete |
| 90943007 | Carnitine dehydrogenase |
| 90944001 | Coumarinic anhydride |
| 90945000 | beta 2 microglobulin |
| 90953008 | Gallium compound |
| 90957009 | Thiosulphate sulphurtransferase |
| 90960002 | Tartrate dehydrogenase |
| 90971001 | beta-2 Adrenergic receptor |
| 90977002 | Blood group antibody Driver |
| 91004000 | Organic dust |
| 91007007 | Sodium selenate |
| 91013003 | Pentazocine hydrochloride |
| 91016006 | Polydeoxyribonucleotide synthase (ATP) |
| 91018007 | Cresylic acid |
| 91023007 | Alverine citrate |
| 91026004 | Sodium isopropyl xanthate |
| 91067009 | Prostaglandin-E>2< 9-ketoreductase |
| 91100006 | Allantoin racemase |
| 91103008 | Blood group antigen IP |
| 91132006 | Curcin |
| 91137000 | Deuterium |
| 91163005 | ^242^Californium |
| 91166002 | Monoiodotyrosine |
| 91171009 | Pesticide adjuvant |
| 91185004 | Active C1q |
| 91190001 | Dextran 1,6-alpha-isomaltotriosidase |
| 91194005 | Cellulose synthase (GDP-forming) |
| 91205007 | dTDPgalactose dehydrogenase |
| 91215001 | Acetylene tetrabromite |
| 91239006 | ^111m^Silver |
| 91245003 | Oncogene protein C-MYC |
| 91254000 | gamma-Glutamylcyclotransferase |
| 91255004 | Copper fumes |
| 91262008 | Guanosine triphosphate |
| 91263003 | Blood group antigen Th^a^ |
| 91266006 | Sulphoxone |
| 91279002 | ^77^Krypton |
| 91283002 | Glutathione peroxidase |
| 91295002 | Fast blue BB salt stain |
| 91306006 | Unclassified vasodilating agent |
| 91309004 | Acute phase reactant |
| 91312001 | Haemoglobin St. Etienne |
| 91314000 | Furazolidone |
| 91319005 | Levanase |
| 91351006 | Haemoglobin Kenitra |
| 91353009 | Cephalotoxin |
| 91370001 | Peroxyacetic acid |
| 91384006 | Dibenzoxepin derivative |
| 91403002 | Lobeline |
| 91410008 | Silicon compound |
| 91423001 | Coagulation factor II Quick variant |
| 91424007 | Nitrogen dioxide |
| 91426009 | Antigen in Duffy (FY) blood group system |
| 91455001 | Wood tar |
| 91464006 | Lymphocyte antigen CD36 |
| 91495004 | Palladium isotope |
| 91518003 | Polybrominated biphenyl (substance) |
| 91521001 | Corticosterone |
| 91542004 | Blood group antibody Peretz |
| 91543009 | Serine palmitoyltransferase |
| 91548000 | Mandelate 4-monooxygenase |
| 91560004 | Isopropyl benzene |
| 91572005 | Blood group antibody rr-35 |
| 91574006 | Haemoglobin British Columbia |
| 91577004 | Fibrinogen Chapel Hill III |
| 91594002 | Methohexital sodium |
| 91598004 | Benzoyl peroxide |
| 91606004 | Cochineal stain |
| 91611002 | Iodide peroxidase |
| 91616007 | Arsenic trisulphide |
| 91619000 | Andirine |
| 91626000 | Blood group antigen Sharp |
| 91638009 | Haemoglobin Miyashiro |
| 91639001 | Cold cream |
| 91645009 | Thymine |
| 91665002 | ^26^Aluminium |
| 91668000 | Orcinol 2-monooxygenase |
| 91677007 | Aplysiatoxin |
| 91680008 | Formiminoglutamase |
| 91720002 | Body substance |
| 95969004 | Organic acid |
| 95970003 | Trace element |
| 95971004 | Urea nitrogen |
| 95972006 | Ammonia nitrogen |
| 95973001 | Protein nitrogen |
| 95974007 | alpha-Amino acid nitrogen |
| 95975008 | Inorganic sulphate |
| 95976009 | Aluminium stearate |
| 95977000 | Chelated iron |
| 95978005 | Spot remover |
| 95979002 | Trichloroethyl alcohol |
| 95980004 | Creosol |
| 95981000 | Paradimethylaminobenzaldehyde |
| 95982007 | Methoxyacetate |
| 95983002 | Adipic acid |
| 95984008 | alpha-Aminoadipic acid |
| 95985009 | 2,4 Toluenediamine |
| 95986005 | 2,6 Toluenediamine |
| 95987001 | Chloramine B |
| 95988006 | Poloxalene |
| 95989003 | Organic chloride compound |
| 95990007 | Grubicide |
| 95991006 | Famphur |
| 95992004 | Cythioate |
| 95993009 | Bromadiolone |
| 95994003 | Camptothecin |
| 95995002 | Capsaicin |
| 95996001 | Kapok |
| 95997005 | Capsanthin |
| 95999008 | Bacterial enterotoxin |
| 96001009 | Clostridium difficile toxin B |
| 96002002 | Verotoxin 1 |
| 96003007 | Verotoxin 2 |
| 96004001 | Escherichia coli toxin |
| 96007008 | Tazobactam |
| 96008003 | Sulbactam |
| 96009006 | Bacitracin methylene disalicylate |
| 96010001 | Sulphomyxin |
| 96012009 | Carbomycin A |
| 96013004 | Carbomycin B |
| 96016007 | Carbadox |
| 96017003 | Thiostrepton |
| 96019000 | Tiamulin fumarate |
| 96021005 | Tylosin phosphate |
| 96022003 | Tylosin tartrate |
| 96024002 | Tilmicosin phosphate |
| 96025001 | Butirosin |
| 96026000 | Neomycin palmitate |
| 96027009 | Neomycin undecenoate |
| 96028004 | Dihydrostreptomycin sulphate |
| 96030002 | Apramycin sulphate |
| 96031003 | Sisomicin |
| 96032005 | Erythromycin phosphate |
| 96033000 | Erythromycin thiocyanate |
| 96035007 | Dirithromycin |
| 96036008 | Miokamycin |
| 96037004 | Roxithromycin |
| 96039001 | Mercaptobenzothiazole |
| 96040004 | Mercaptobenzothiazole zinc |
| 96041000 | Mercaptobenzothiazole sodium |
| 96042007 | Cephalonium |
| 96043002 | Cefapirin benzathine |
| 96045009 | Ceftiofur sodium |
| 96046005 | Ceftiofur hydrochloride |
| 96048006 | Cefepime |
| 96050003 | Cefpodoxime proxetil |
| 96056009 | Cefatrizine |
| 96058005 | Cilastatin |
| 96059002 | Cefmetazole |
| 96061006 | Loracarbef |
| 96066001 | Cloxacillin benzathine |
| 96068000 | Amoxycillin trihydrate |
| 96070009 | Ampicillin sodium |
| 96071008 | Ampicillin trihydrate |
| 96075004 | Tetracycline phosphate complex |
| 96076003 | Rolitetracycline |
| 96078002 | Ormetoprin |
| 96079005 | Pipemidic acid |
| 96080008 | Enrofloxacin |
| 96082000 | Sarafloxacin |
| 96083005 | Clinafloxacin |
| 96085003 | Fleroxacin |
| 96089009 | Pefloxacin |
| 96092008 | Trovafloxacin |
| 96094009 | Sulphabromomethazine sodium |
| 96095005 | Sulphaethoxypyridazine |
| 96096006 | Sulphaquinoxaline |
| 96098007 | Valaciclovir |
| 96100007 | Foscarnet sodium |
| 96101006 | Pirlimycin hydrochloride |
| 96102004 | Carnidazole |
Terminology
. Page versions: R5 R4B R4 R3 R2
|
Propose a change