This page is part of the FHIR Specification (v5.0.0: R5 - STU). This is the current published version in it's permanent home (it will always be available at this URL). For a full list of available versions, see the Directory of published versions . Page versions: R5 R4
Biomedical Research and Regulation Work Group | Maturity Level: N/A | Standards Status: Informative | Compartments: No defined compartments |
Raw Turtle (+ also see Turtle/RDF Format Specification)
Example of substancesourcematerial
@prefix fhir: <http://hl7.org/fhir/> . @prefix owl: <http://www.w3.org/2002/07/owl#> . @prefix rdfs: <http://www.w3.org/2000/01/rdf-schema#> . @prefix xsd: <http://www.w3.org/2001/XMLSchema#> . # - resource ------------------------------------------------------------------- [a fhir:SubstanceSourceMaterial ; fhir:nodeRole fhir:treeRoot ; fhir:id [ fhir:v "example"] ; # fhir:text [ fhir:status [ fhir:v "generated" ] ; fhir:div "<div xmlns=\"http://www.w3.org/1999/xhtml\"><p><b>Generated Narrative: SubstanceSourceMaterial</b><a name=\"example\"> </a></p><div style=\"display: inline-block; background-color: #d9e0e7; padding: 6px; margin: 4px; border: 1px solid #8da1b4; border-radius: 5px; line-height: 60%\"><p style=\"margin-bottom: 0px\">Resource SubstanceSourceMaterial "example" </p></div></div>" ]] . # numberOfMoieties value="2"/> # <identifier> # <system value="http://substanceidOID"/> # <value value="POYFG4531Y (Artificial ID)"/> # </identifier> # <substanceType> # <coding> # <system value="http://substancetypeOID"/> # <code value="Chemical"/> # </coding> # </substanceType> # <moiety> # <moietyRole> # <coding> # <system value="http://moietyroleOID"/> # <code value="SaltMolecule"/> # </coding> # </moietyRole> # <moietyId> # <system value="http://moietyidOID"/> # <value value="HJFGTE8954 (Artificial ID); [QTT17582CB (UNII)]"/> # </moietyId> # <moietyName value="Hydrochloric acid"/> # <stereochemistry> # <coding> # <system value="http://stereochemistryOID"/> # <code value="Achiral"/> # </coding> # </stereochemistry> # <opticalActivity> # <coding> # <system value="http://opticalactivityOID"/> # <code value="N/A"/> # </coding> # </opticalActivity> # <molecularFormula value="HCl"/> # <amount> # <amountType> # <coding> # <system value="http://amounttypeOID"/> # <code value="MoleRatiotoParent"/> # </coding> # </amountType> # <average> # <value value="1"/> # <unit value="1"/> # </average> # <nonNumericValue value="Mole Ratio to Ponatinib"/> # </amount> # </moiety> # <moiety> # <moietyRole> # <coding> # <system value="http://moietyroleOID"/> # <code value="Parentsubstance"/> # </coding> # </moietyRole> # <moietyId> # <system value="http://moietyidOID"/> # <value value="PONG785632B (Artificial ID); [QTT17582CB (UNII)]"/> # </moietyId> # <moietyName value="Ponatinib"/> # <stereochemistry> # <coding> # <system value="http://stereochemistryOID"/> # <code value="Achiral"/> # </coding> # </stereochemistry> # <opticalActivity> # <coding> # <system value="http://opticalactivityOID"/> # <code value="N/A"/> # </coding> # </opticalActivity> # <molecularFormula value="C29H27F3N6O"/> # <amount> # <amountType> # <coding> # <system value="http://amounttypeOID"/> # <code value="MoleRatiotoAcid"/> # </coding> # </amountType> # <average> # <value value="1"/> # <unit value="1"/> # </average> # <nonNumericValue value="Mol Ratio Ponatinib/ Ponatinib hydrochloride (1:1)"/> # </amount> # </moiety> # <referenceInformation> # <substanceClassification> # <domain> # <coding> # <system value="http://domainOID"/> # <code value="HumanPharmaceutical"/> # </coding> # </domain> # <substanceClassificationCode value="L01XE24"/> # <substanceClassificationType value="Ponatinib"/> # <referenceSource> # <publicDomain value="true"/> # <referenceSourceType> # <coding> # <system value="http://referencesourcetypeOID"/> # <code value="WHOCollaboratingCentreforDrugStatisticsmethodology(WHOCC)"/> # </coding> # </referenceSourceType> # <referenceSourceClass> # <coding> # <system value="http://referencesourceclassOID"/> # <code value="Web"/> # </coding> # </referenceSourceClass> # <referenceSourceCitation value="http://www.whocc.no/atc_ddd_index/?code=L01XE24 "/> # </referenceSource> # </substanceClassification> # <substanceRelationship> # <relatedSubstanceId> # <system value="http://relatedsubstanceidOID"/> # <value value="GHF26754YQ (Artificial ID), [4340891KFS (UNII)]"/> # </relatedSubstanceId> # <relatedSubstanceName value="Ponatinib"/> # <relationship> # <coding> # <system value="http://relationshipOID"/> # <code value="Parentsubstancetosalt"/> # </coding> # </relationship> # <relationshipType> # <coding> # <system value="http://relationshiptypeOID"/> # <code value="Ionic"/> # </coding> # </relationshipType> # <isDefining value="true"/> # <amount> # <amountType> # <coding> # <system value="http://amounttypeOID"/> # <code value="Weightpercenttosalt"/> # </coding> # </amountType> # <average> # <value value="93.6"/> # <unit value="1"/> # </average> # <unit> # <coding> # <system value="http://unitOID"/> # <code value="Weightpercent"/> # </coding> # </unit> # <nonNumericValue value="Equivalent factor: 0.936"/> # </amount> # </substanceRelationship> # </referenceInformation> # <referenceSource> # <publicDomain value="false"/> # <referenceSourceType> # <coding> # <system value="http://referencesourcetypeOID"/> # <code value="MarketingAuthorizationApplication"/> # </coding> # </referenceSourceType> # <referenceSourceClass> # <coding> # <system value="http://referencesourceclassOID"/> # <code value="Regulatorysubmission"/> # </coding> # </referenceSourceClass> # <referenceSourceId value="33333 (Artificial ID)"/> # <referenceSourceDocument> # <document> # <contentType value="text/plain"/> # <data value="U3lteXggICAwNjA5MTQyMjExMkQgMSAgIDEuMDAwMDAgICAgIDAuMDAwMDAgICAgIDAgXG4gNDAgNDMgIDAgICAgIDAgIDAgICAgICAgICAgICA5OTkgVjIwMDBcbiAgIC0yLjIzNDAgICAtMC4xNjYxICAgIDAuMDAwMCBOICAgMCAgMCAgMCAgMCAgMCAgMCAgICAgICAgICAgMCAgMCAgMA=="/> # </document> # <referenceSourceDocumentType> # <coding> # <system value="http://referencesourcedocumenttypeOID"/> # <code value="Textfile"/> # </coding> # </referenceSourceDocumentType> # </referenceSourceDocument> # </referenceSource> # <structure> # <stereochemistry> # <coding> # <system value="http://stereochemistryOID"/> # <code value="Achiral"/> # </coding> # </stereochemistry> # <opticalActivity> # <coding> # <system value="http://opticalactivityOID"/> # <code value="N/A"/> # </coding> # </opticalActivity> # <molecularFormula value="C29H28F3ClN6O"/> # <molecularFormulaByMoiety value="C29H27F3N6O.HCl"/> # <molecularWeight> # <molecularWeightMethod> # <coding> # <system value="http://molecularweightmethodOID"/> # <code value="Calculated"/> # </coding> # </molecularWeightMethod> # <molecularWeightType> # <coding> # <system value="http://molecularweighttypeOID"/> # <code value="Numberaverage"/> # </coding> # </molecularWeightType> # <amount> # <amountType> # <coding> # <system value="http://amounttypeOID"/> # <code value="Exact"/> # </coding> # </amountType> # <average> # <value value="569.02"/> # <unit value="1"/> # </average> # <unit> # <coding> # <system value="http://unitOID"/> # <code value="g/mol"/> # </coding> # </unit> # </amount> # </molecularWeight> # <referenceSource> # <publicDomain value="true"/> # <referenceSourceType> # <coding> # <system value="http://referencesourcetypeOID"/> # <code value="ChemIDplus"/> # </coding> # </referenceSourceType> # <referenceSourceClass> # <coding> # <system value="http://referencesourceclassOID"/> # <code value="PublicDatabase"/> # </coding> # </referenceSourceClass> # <referenceSourceCitation value="http://chem.sis.nlm.nih.gov/chemidplus/unii/96R6PU3D8J "/> # </referenceSource> # <structuralRepresentation> # <type> # <coding> # <system value="http://structuralrepresentationtypeOID"/> # <code value="Full"/> # </coding> # </type> # <representation value="Figure B.40"/> # </structuralRepresentation> # <structuralRepresentation> # <type> # <coding> # <system value="http://structuralrepresentationtypeOID"/> # <code value="InChI"/> # </coding> # </type> # <representation value="InChI=1S/C29H27F3N6O.ClH/c1-20-5-6-22(16-21(20)8-10-25-18-33-27-4-3-11-34-38(25)27)28(39)35-24-9-7-23(26(17-24)29(30,31)32)19-37-14-12-36(2)13-15-37;/h3-7,9,11,16-18H,12-15,19H2,1-2H3,(H,35,39);1H"/> # </structuralRepresentation> # <structuralRepresentation> # <type> # <coding> # <system value="http://structuralrepresentationtypeOID"/> # <code value="SMILES"/> # </coding> # </type> # <representation value="Cc1ccc(cc1C#Cc2cnc3n2nccc3)C(=O)Nc4ccc(c(c4)C(F)(F)F)CN5CCN(CC5)C.Cl"/> # </structuralRepresentation> # <structuralRepresentation> # <type> # <coding> # <system value="http://structuralrepresentationtypeOID"/> # <code value="MOL"/> # </coding> # </type> # <attachment> # <contentType value="text/plain"/> # <data value="U3lteXggICAwNjA5MTQyMjExMkQgMSAgIDEuMDAwMDAgICAgIDAuMDAwMDAgICAgIDAgXG4gNDAgNDMgIDAgICAgIDAgIDAgICAgICAgICAgICA5OTkgVjIwMDBcbiAgIC0yLjIzNDAgICAtMC4xNjYxICAgIDAuMDAwMCBOICAgMCAgMCAgMCAgMCAgMCAgMCAgICAgICAgICAgMCAgMCAgMA=="/> # </attachment> # </structuralRepresentation> # </structure> # <substanceCode> # <code value="1114544-31-8"/> # <codeSystemStatus> # <coding> # <system value="http://1.1.149"/> # <code value="Active"/> # </coding> # </codeSystemStatus> # </substanceCode> # <substanceCode> # <code value="96R6PU3D8J"/> # <codeSystemStatus> # <coding> # <system value="http://1.1.150"/> # <code value="Active"/> # </coding> # </codeSystemStatus> # </substanceCode> # <substanceName> # <substanceName value="Ponatinib hydrochloride"/> # <substanceNameType> # <coding> # <system value="http://substancenametypeOID"/> # <code value="Official"/> # </coding> # </substanceNameType> # <language> # <coding> # <system value="http://languageOID"/> # <code value="en"/> # </coding> # </language> # <substanceNameDomain> # <coding> # <system value="http://substancenamedomainOID"/> # <code value="Drug"/> # </coding> # </substanceNameDomain> # <jurisdiction> # <coding> # <system value="http://jurisdictionOID"/> # <code value="EU,US"/> # </coding> # </jurisdiction> # <officialName> # <officialNameType> # <coding> # <system value="http://officialnametypeOID"/> # <code value="USAN"/> # </coding> # </officialNameType> # <officialNameStatus> # <coding> # <system value="http://officialnamestatusOID"/> # <code value="Current"/> # </coding> # </officialNameStatus> # </officialName> # <referenceSource> # <publicDomain value="true"/> # <referenceSourceType> # <coding> # <system value="http://referencesourcetypeOID"/> # <code value="Martindale"/> # </coding> # </referenceSourceType> # <referenceSourceClass> # <coding> # <system value="http://referencesourceclassOID"/> # <code value="Officialnamesource"/> # </coding> # </referenceSourceClass> # <referenceSourceCitation value="Martindale The complete drug reference"/> # <referenceSourceUrl value="https://www.medicinescomplete.com/mc/martindale/current/ms-28485-s.htm?q=Ponatinib%20hydrochloride&t=search&ss=text&tot=12&p=1#_hit"/> # <referenceSourceDocument> # <publicDomain value="true"/> # <referenceSourceDocumentType> # <coding> # <system value="http://referencesourcedocumenttypeOID"/> # <code value="Journalarticle"/> # </coding> # </referenceSourceDocumentType> # </referenceSourceDocument> # </referenceSource> # </substanceName> # <substanceName> # <substanceName value="3-(2-(Imidazo(1,2-b)pyridazin-3-yl)ethynyl)-4-methyl-N-(4-((4-methylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)benzamide monohydrochloride"/> # <substanceNameType> # <coding> # <system value="http://substancenametypeOID"/> # <code value="Systematic"/> # </coding> # </substanceNameType> # <language> # <coding> # <system value="http://languageOID"/> # <code value="en"/> # </coding> # </language> # <referenceSource> # <publicDomain value="true"/> # <referenceSourceType> # <coding> # <system value="http://referencesourcetypeOID"/> # <code value="ChemIDplus"/> # </coding> # </referenceSourceType> # <referenceSourceClass> # <coding> # <system value="http://referencesourceclassOID"/> # <code value="PublicDatabase"/> # </coding> # </referenceSourceClass> # <referenceSourceCitation value="http://chem.sis.nlm.nih.gov/chemidplus/unii/96R6PU3D8J "/> # </referenceSource> # </substanceName> # <substanceName> # <substanceName value="Benzamide, 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[(4-methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)phenyl]-,hydrochloride (1:1)"/> # <substanceNameType> # <coding> # <system value="http://substancenametypeOID"/> # <code value="OtherName"/> # </coding> # </substanceNameType> # <language> # <coding> # <system value="http://languageOID"/> # <code value="en"/> # </coding> # </language> # <referenceSource> # <publicDomain value="true"/> # <referenceSourceType> # <coding> # <system value="http://referencesourcetypeOID"/> # <code value="CAS"/> # </coding> # </referenceSourceType> # <referenceSourceClass> # <coding> # <system value="http://referencesourceclassOID"/> # <code value="Othernamesource"/> # </coding> # </referenceSourceClass> # <referenceSourceCitation value="CAS Registry Name"/> # </referenceSource> # </substanceName> # <substanceName> # <substanceName value="XYWZ123"/> # <substanceNameType> # <coding> # <system value="http://substancenametypeOID"/> # <code value="CompanyCode"/> # </coding> # </substanceNameType> # <language> # <coding> # <system value="http://languageOID"/> # <code value="en"/> # </coding> # </language> # <referenceSource> # <publicDomain value="false"/> # <referenceSourceType> # <coding> # <system value="http://referencesourcetypeOID"/> # <code value="MarketingAuthorizationApplication"/> # </coding> # </referenceSourceType> # <referenceSourceClass> # <coding> # <system value="http://referencesourceclassOID"/> # <code value="Regulatorysubmission"/> # </coding> # </referenceSourceClass> # <referenceSourceId value="CBG345267C (Artificial ID)"/> # </referenceSource> # </substanceName # -------------------------------------------------------------------------------------
Usage note: every effort has been made to ensure that the examples are correct and useful, but they are not a normative part of the specification.
FHIR ®© HL7.org 2011+. FHIR R5 hl7.fhir.core#5.0.0 generated on Sun, Mar 26, 2023 15:26+1100.
Links: Search |
Version History |
Contents |
Glossary |
QA |
Compare to R4 |
Compare to R4B |
|
Propose a change