This page is part of the FHIR Specification (v5.0.0-draft-final: Final QA Preview for R5 - see ballot notes). The current version which supercedes this version is 5.0.0. For a full list of available versions, see the Directory of published versions
. Page versions: R5 R4
| Biomedical Research and Regulation Work Group | Maturity Level: N/A | Standards Status: Informative | Compartments: Not linked to any defined compartments |
Raw Turtle (+ also see Turtle/RDF Format Specification)
Example of substancepolymer
@prefix fhir: <http://hl7.org/fhir/> .
@prefix owl: <http://www.w3.org/2002/07/owl#> .
@prefix rdfs: <http://www.w3.org/2000/01/rdf-schema#> .
@prefix xsd: <http://www.w3.org/2001/XMLSchema#> .
# - resource -------------------------------------------------------------------
[a fhir:SubstancePolymer ;
fhir:nodeRole fhir:treeRoot ;
fhir:id [ fhir:v "example"] ; #
fhir:text [
fhir:status [ fhir:v "generated" ] ;
fhir:div "<div xmlns=\"http://www.w3.org/1999/xhtml\"><p><b>Generated Narrative: SubstancePolymer</b><a name=\"example\"> </a></p><div style=\"display: inline-block; background-color: #d9e0e7; padding: 6px; margin: 4px; border: 1px solid #8da1b4; border-radius: 5px; line-height: 60%\"><p style=\"margin-bottom: 0px\">Resource SubstancePolymer "example" </p></div></div>"
]] . # numberOfMoieties value="2"/>
# <identifier>
# <system value="http://substanceidOID"/>
# <value value="POYFG4531Y (Artificial ID)"/>
# </identifier>
# <substanceType>
# <coding>
# <system value="http://substancetypeOID"/>
# <code value="Chemical"/>
# </coding>
# </substanceType>
# <moiety>
# <moietyRole>
# <coding>
# <system value="http://moietyroleOID"/>
# <code value="SaltMolecule"/>
# </coding>
# </moietyRole>
# <moietyId>
# <system value="http://moietyidOID"/>
# <value value="HJFGTE8954 (Artificial ID); [QTT17582CB (UNII)]"/>
# </moietyId>
# <moietyName value="Hydrochloric acid"/>
# <stereochemistry>
# <coding>
# <system value="http://stereochemistryOID"/>
# <code value="Achiral"/>
# </coding>
# </stereochemistry>
# <opticalActivity>
# <coding>
# <system value="http://opticalactivityOID"/>
# <code value="N/A"/>
# </coding>
# </opticalActivity>
# <molecularFormula value="HCl"/>
# <amount>
# <amountType>
# <coding>
# <system value="http://amounttypeOID"/>
# <code value="MoleRatiotoParent"/>
# </coding>
# </amountType>
# <average>
# <value value="1"/>
# <unit value="1"/>
# </average>
# <nonNumericValue value="Mole Ratio to Ponatinib"/>
# </amount>
# </moiety>
# <moiety>
# <moietyRole>
# <coding>
# <system value="http://moietyroleOID"/>
# <code value="Parentsubstance"/>
# </coding>
# </moietyRole>
# <moietyId>
# <system value="http://moietyidOID"/>
# <value value="PONG785632B (Artificial ID); [QTT17582CB (UNII)]"/>
# </moietyId>
# <moietyName value="Ponatinib"/>
# <stereochemistry>
# <coding>
# <system value="http://stereochemistryOID"/>
# <code value="Achiral"/>
# </coding>
# </stereochemistry>
# <opticalActivity>
# <coding>
# <system value="http://opticalactivityOID"/>
# <code value="N/A"/>
# </coding>
# </opticalActivity>
# <molecularFormula value="C29H27F3N6O"/>
# <amount>
# <amountType>
# <coding>
# <system value="http://amounttypeOID"/>
# <code value="MoleRatiotoAcid"/>
# </coding>
# </amountType>
# <average>
# <value value="1"/>
# <unit value="1"/>
# </average>
# <nonNumericValue value="Mol Ratio Ponatinib/ Ponatinib hydrochloride (1:1)"/>
# </amount>
# </moiety>
# <referenceInformation>
# <substanceClassification>
# <domain>
# <coding>
# <system value="http://domainOID"/>
# <code value="HumanPharmaceutical"/>
# </coding>
# </domain>
# <substanceClassificationCode value="L01XE24"/>
# <substanceClassificationType value="Ponatinib"/>
# <referenceSource>
# <publicDomain value="true"/>
# <referenceSourceType>
# <coding>
# <system value="http://referencesourcetypeOID"/>
# <code value="WHOCollaboratingCentreforDrugStatisticsmethodology(WHOCC)"/>
# </coding>
# </referenceSourceType>
# <referenceSourceClass>
# <coding>
# <system value="http://referencesourceclassOID"/>
# <code value="Web"/>
# </coding>
# </referenceSourceClass>
# <referenceSourceCitation value="http://www.whocc.no/atc_ddd_index/?code=L01XE24 "/>
# </referenceSource>
# </substanceClassification>
# <substanceRelationship>
# <relatedSubstanceId>
# <system value="http://relatedsubstanceidOID"/>
# <value value="GHF26754YQ (Artificial ID), [4340891KFS (UNII)]"/>
# </relatedSubstanceId>
# <relatedSubstanceName value="Ponatinib"/>
# <relationship>
# <coding>
# <system value="http://relationshipOID"/>
# <code value="Parentsubstancetosalt"/>
# </coding>
# </relationship>
# <relationshipType>
# <coding>
# <system value="http://relationshiptypeOID"/>
# <code value="Ionic"/>
# </coding>
# </relationshipType>
# <isDefining value="true"/>
# <amount>
# <amountType>
# <coding>
# <system value="http://amounttypeOID"/>
# <code value="Weightpercenttosalt"/>
# </coding>
# </amountType>
# <average>
# <value value="93.6"/>
# <unit value="1"/>
# </average>
# <unit>
# <coding>
# <system value="http://unitOID"/>
# <code value="Weightpercent"/>
# </coding>
# </unit>
# <nonNumericValue value="Equivalent factor: 0.936"/>
# </amount>
# </substanceRelationship>
# </referenceInformation>
# <referenceSource>
# <publicDomain value="false"/>
# <referenceSourceType>
# <coding>
# <system value="http://referencesourcetypeOID"/>
# <code value="MarketingAuthorizationApplication"/>
# </coding>
# </referenceSourceType>
# <referenceSourceClass>
# <coding>
# <system value="http://referencesourceclassOID"/>
# <code value="Regulatorysubmission"/>
# </coding>
# </referenceSourceClass>
# <referenceSourceId value="33333 (Artificial ID)"/>
# <referenceSourceDocument>
# <document>
# <contentType value="text/plain"/>
# <data value="U3lteXggICAwNjA5MTQyMjExMkQgMSAgIDEuMDAwMDAgICAgIDAuMDAwMDAgICAgIDAgXG4gNDAgNDMgIDAgICAgIDAgIDAgICAgICAgICAgICA5OTkgVjIwMDBcbiAgIC0yLjIzNDAgICAtMC4xNjYxICAgIDAuMDAwMCBOICAgMCAgMCAgMCAgMCAgMCAgMCAgICAgICAgICAgMCAgMCAgMA=="/>
# </document>
# <referenceSourceDocumentType>
# <coding>
# <system value="http://referencesourcedocumenttypeOID"/>
# <code value="Textfile"/>
# </coding>
# </referenceSourceDocumentType>
# </referenceSourceDocument>
# </referenceSource>
# <structure>
# <stereochemistry>
# <coding>
# <system value="http://stereochemistryOID"/>
# <code value="Achiral"/>
# </coding>
# </stereochemistry>
# <opticalActivity>
# <coding>
# <system value="http://opticalactivityOID"/>
# <code value="N/A"/>
# </coding>
# </opticalActivity>
# <molecularFormula value="C29H28F3ClN6O"/>
# <molecularFormulaByMoiety value="C29H27F3N6O.HCl"/>
# <molecularWeight>
# <molecularWeightMethod>
# <coding>
# <system value="http://molecularweightmethodOID"/>
# <code value="Calculated"/>
# </coding>
# </molecularWeightMethod>
# <molecularWeightType>
# <coding>
# <system value="http://molecularweighttypeOID"/>
# <code value="Numberaverage"/>
# </coding>
# </molecularWeightType>
# <amount>
# <amountType>
# <coding>
# <system value="http://amounttypeOID"/>
# <code value="Exact"/>
# </coding>
# </amountType>
# <average>
# <value value="569.02"/>
# <unit value="1"/>
# </average>
# <unit>
# <coding>
# <system value="http://unitOID"/>
# <code value="g/mol"/>
# </coding>
# </unit>
# </amount>
# </molecularWeight>
# <referenceSource>
# <publicDomain value="true"/>
# <referenceSourceType>
# <coding>
# <system value="http://referencesourcetypeOID"/>
# <code value="ChemIDplus"/>
# </coding>
# </referenceSourceType>
# <referenceSourceClass>
# <coding>
# <system value="http://referencesourceclassOID"/>
# <code value="PublicDatabase"/>
# </coding>
# </referenceSourceClass>
# <referenceSourceCitation value="http://chem.sis.nlm.nih.gov/chemidplus/unii/96R6PU3D8J "/>
# </referenceSource>
# <structuralRepresentation>
# <type>
# <coding>
# <system value="http://structuralrepresentationtypeOID"/>
# <code value="Full"/>
# </coding>
# </type>
# <representation value="Figure B.40"/>
# </structuralRepresentation>
# <structuralRepresentation>
# <type>
# <coding>
# <system value="http://structuralrepresentationtypeOID"/>
# <code value="InChI"/>
# </coding>
# </type>
# <representation value="InChI=1S/C29H27F3N6O.ClH/c1-20-5-6-22(16-21(20)8-10-25-18-33-27-4-3-11-34-38(25)27)28(39)35-24-9-7-23(26(17-24)29(30,31)32)19-37-14-12-36(2)13-15-37;/h3-7,9,11,16-18H,12-15,19H2,1-2H3,(H,35,39);1H"/>
# </structuralRepresentation>
# <structuralRepresentation>
# <type>
# <coding>
# <system value="http://structuralrepresentationtypeOID"/>
# <code value="SMILES"/>
# </coding>
# </type>
# <representation value="Cc1ccc(cc1C#Cc2cnc3n2nccc3)C(=O)Nc4ccc(c(c4)C(F)(F)F)CN5CCN(CC5)C.Cl"/>
# </structuralRepresentation>
# <structuralRepresentation>
# <type>
# <coding>
# <system value="http://structuralrepresentationtypeOID"/>
# <code value="MOL"/>
# </coding>
# </type>
# <attachment>
# <contentType value="text/plain"/>
# <data value="U3lteXggICAwNjA5MTQyMjExMkQgMSAgIDEuMDAwMDAgICAgIDAuMDAwMDAgICAgIDAgXG4gNDAgNDMgIDAgICAgIDAgIDAgICAgICAgICAgICA5OTkgVjIwMDBcbiAgIC0yLjIzNDAgICAtMC4xNjYxICAgIDAuMDAwMCBOICAgMCAgMCAgMCAgMCAgMCAgMCAgICAgICAgICAgMCAgMCAgMA=="/>
# </attachment>
# </structuralRepresentation>
# </structure>
# <substanceCode>
# <code value="1114544-31-8"/>
# <codeSystemStatus>
# <coding>
# <system value="http://1.1.149"/>
# <code value="Active"/>
# </coding>
# </codeSystemStatus>
# </substanceCode>
# <substanceCode>
# <code value="96R6PU3D8J"/>
# <codeSystemStatus>
# <coding>
# <system value="http://1.1.150"/>
# <code value="Active"/>
# </coding>
# </codeSystemStatus>
# </substanceCode>
# <substanceName>
# <substanceName value="Ponatinib hydrochloride"/>
# <substanceNameType>
# <coding>
# <system value="http://substancenametypeOID"/>
# <code value="Official"/>
# </coding>
# </substanceNameType>
# <language>
# <coding>
# <system value="http://languageOID"/>
# <code value="en"/>
# </coding>
# </language>
# <substanceNameDomain>
# <coding>
# <system value="http://substancenamedomainOID"/>
# <code value="Drug"/>
# </coding>
# </substanceNameDomain>
# <jurisdiction>
# <coding>
# <system value="http://jurisdictionOID"/>
# <code value="EU,US"/>
# </coding>
# </jurisdiction>
# <officialName>
# <officialNameType>
# <coding>
# <system value="http://officialnametypeOID"/>
# <code value="USAN"/>
# </coding>
# </officialNameType>
# <officialNameStatus>
# <coding>
# <system value="http://officialnamestatusOID"/>
# <code value="Current"/>
# </coding>
# </officialNameStatus>
# </officialName>
# <referenceSource>
# <publicDomain value="true"/>
# <referenceSourceType>
# <coding>
# <system value="http://referencesourcetypeOID"/>
# <code value="Martindale"/>
# </coding>
# </referenceSourceType>
# <referenceSourceClass>
# <coding>
# <system value="http://referencesourceclassOID"/>
# <code value="Officialnamesource"/>
# </coding>
# </referenceSourceClass>
# <referenceSourceCitation value="Martindale The complete drug reference"/>
# <referenceSourceUrl value="https://www.medicinescomplete.com/mc/martindale/current/ms-28485-s.htm?q=Ponatinib%20hydrochloride&t=search&ss=text&tot=12&p=1#_hit"/>
# <referenceSourceDocument>
# <publicDomain value="true"/>
# <referenceSourceDocumentType>
# <coding>
# <system value="http://referencesourcedocumenttypeOID"/>
# <code value="Journalarticle"/>
# </coding>
# </referenceSourceDocumentType>
# </referenceSourceDocument>
# </referenceSource>
# </substanceName>
# <substanceName>
# <substanceName value="3-(2-(Imidazo(1,2-b)pyridazin-3-yl)ethynyl)-4-methyl-N-(4-((4-methylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)benzamide monohydrochloride"/>
# <substanceNameType>
# <coding>
# <system value="http://substancenametypeOID"/>
# <code value="Systematic"/>
# </coding>
# </substanceNameType>
# <language>
# <coding>
# <system value="http://languageOID"/>
# <code value="en"/>
# </coding>
# </language>
# <referenceSource>
# <publicDomain value="true"/>
# <referenceSourceType>
# <coding>
# <system value="http://referencesourcetypeOID"/>
# <code value="ChemIDplus"/>
# </coding>
# </referenceSourceType>
# <referenceSourceClass>
# <coding>
# <system value="http://referencesourceclassOID"/>
# <code value="PublicDatabase"/>
# </coding>
# </referenceSourceClass>
# <referenceSourceCitation value="http://chem.sis.nlm.nih.gov/chemidplus/unii/96R6PU3D8J "/>
# </referenceSource>
# </substanceName>
# <substanceName>
# <substanceName value="Benzamide, 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[(4-methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)phenyl]-,hydrochloride (1:1)"/>
# <substanceNameType>
# <coding>
# <system value="http://substancenametypeOID"/>
# <code value="OtherName"/>
# </coding>
# </substanceNameType>
# <language>
# <coding>
# <system value="http://languageOID"/>
# <code value="en"/>
# </coding>
# </language>
# <referenceSource>
# <publicDomain value="true"/>
# <referenceSourceType>
# <coding>
# <system value="http://referencesourcetypeOID"/>
# <code value="CAS"/>
# </coding>
# </referenceSourceType>
# <referenceSourceClass>
# <coding>
# <system value="http://referencesourceclassOID"/>
# <code value="Othernamesource"/>
# </coding>
# </referenceSourceClass>
# <referenceSourceCitation value="CAS Registry Name"/>
# </referenceSource>
# </substanceName>
# <substanceName>
# <substanceName value="XYWZ123"/>
# <substanceNameType>
# <coding>
# <system value="http://substancenametypeOID"/>
# <code value="CompanyCode"/>
# </coding>
# </substanceNameType>
# <language>
# <coding>
# <system value="http://languageOID"/>
# <code value="en"/>
# </coding>
# </language>
# <referenceSource>
# <publicDomain value="false"/>
# <referenceSourceType>
# <coding>
# <system value="http://referencesourcetypeOID"/>
# <code value="MarketingAuthorizationApplication"/>
# </coding>
# </referenceSourceType>
# <referenceSourceClass>
# <coding>
# <system value="http://referencesourceclassOID"/>
# <code value="Regulatorysubmission"/>
# </coding>
# </referenceSourceClass>
# <referenceSourceId value="CBG345267C (Artificial ID)"/>
# </referenceSource>
# </substanceName
# -------------------------------------------------------------------------------------
Usage note: every effort has been made to ensure that the examples are correct and useful, but they are not a normative part of the specification.
FHIR ®© HL7.org 2011+. FHIR R5 hl7.fhir.core#5.0.0-draft-final generated on Wed, Mar 1, 2023 23:07+1100.
Links: Search |
Version History |
Contents |
Glossary |
QA |
Compare to R4B |
Compare to R5 Draft |
|
Propose a change