This page is part of the FHIR Specification (v1.8.0: STU 3 Draft). The current version which supercedes this version is 5.0.0. For a full list of available versions, see the Directory of published versions
. Page versions: R5 R4B R4 R3
This is a value set defined by the FHIR project.
Summary
| Defining URL: | http://hl7.org/fhir/ValueSet/supply-item |
| Name: | SNOMED CT Supply Item |
| Definition: | This value set includes all substance and physical object codes from SNOMED CT and provided as an example value set. |
| Committee: | Orders and Observations Work Group |
| OID: | 2.16.840.1.113883.4.642.2.896 (for OID based terminology systems) |
| Copyright: | This value set includes content from SNOMED CT, which is copyright © 2002+ International Health Terminology Standards Development Organisation (IHTSDO), and distributed by agreement between IHTSDO and HL7. Implementer use of SNOMED CT is not covered by this agreement. |
| Source Resource | XML / JSON |
This value set is used in the following places:
This value set includes codes from the following code systems:
This expansion generated 06 Dec 2016
This value set has >1000 codes in it. In order to keep the publication size manageable, only a selection (1000 codes) of the whole set of codes is shown
All codes from system http://snomed.info/sct
| Code | Display | Definition |
| 102002 | Hemoglobin Okaloosa | |
| 120006 | Ornithine racemase | |
| 125001 | Ferrous sulfate Fe^59^ | |
| 126000 | Galactosyl-N-acetylglucosaminylgalactosylglucosylceramide alpha-galactosyltransferase | |
| 130002 | Hemoglobin Hopkins-II | |
| 131003 | Dolichyl-phosphate mannosyltransferase | |
| 159002 | Ferrocyanide salt | |
| 164003 | Phosphoenolpyruvate-protein phosphotransferase | |
| 178002 | Uridine diphosphate galactose | |
| 186002 | HLA-Cw9 antigen | |
| 187006 | Cyanocobalamin Co^57^ | |
| 200001 | Berberine | |
| 217008 | Blood group antigen IH | |
| 231008 | 3-Hydroxyisobutyrate dehydrogenase | |
| 238002 | Heptachlor | |
| 261000 | Codeine phosphate | |
| 296000 | Coumachlor | |
| 322006 | Octylphenoxy P.H. ethanol | |
| 327000 | ^76^Arsenic | |
| 329002 | ^127^Antimony | |
| 336001 | Fibrinogen Tokyo II | |
| 340005 | Enzyme variant | |
| 363000 | Fibrinogen San Juan | |
| 370000 | beta>2S< Glycoprotein | |
| 371001 | Acylcarnitine hydrolase | |
| 377002 | Sparteine | |
| 392001 | ^151^Gadolinium | |
| 395004 | Immunoglobulin pentamer | |
| 412004 | Ribose-5-phosphate isomerase | |
| 424006 | Citramalyl-CoA lyase | |
| 425007 | Hemoglobin Nagoya | |
| 432003 | Carminic acid stain (substance) | |
| 438004 | 2-Hydroxyglutarate dehydrogenase | |
| 462009 | Urease (ATP-hydrolysing) | |
| 472007 | Vegetable textile fiber | |
| 476005 | Lymphocyte antigen CD1b | |
| 498001 | Nitrilase | |
| 501001 | Blood group antibody Sf^a^ | |
| 505005 | Blood group antibody M' | |
| 506006 | 3-Oxosteroid delta^1^-dehydrogenase | |
| 515004 | Blood group antigen Giaigue | |
| 519005 | Free protein S | |
| 521000 | ^197^Mercury | |
| 529003 | Guanosine | |
| 538001 | 2,3-Dihydroxybenzoate 3,4-dioxygenase | |
| 566009 | Acrosin | |
| 576007 | Blood group antibody Duck | |
| 578008 | Hemoglobin Jianghua | |
| 584006 | Blood group antibody Wr^b^ | |
| 585007 | Substance P | |
| 591009 | 2-Oxoisovalerate dehydrogenase (acylating) | |
| 593007 | Blood group antibody Holmes | |
| 594001 | 2-Oxoglutarate synthase | |
| 597008 | ^247^Californium | |
| 604000 | Plant sapogenin glycoside | |
| 611001 | Hippurate hydrolase | |
| 620005 | Trichlorophenol | |
| 648005 | Oil of calamus | |
| 662003 | Aeromonas proteolytica aminopeptidase | |
| 668004 | ^185^Osmium | |
| 683009 | Mercuric acetate | |
| 686001 | Plastoquinol-plastocyanin reductase | |
| 693002 | Trichothecenes | |
| 698006 | Erythromycin lactobionate | |
| 699003 | Coal tar extract | |
| 704006 | Blood group antigen Rx | |
| 732002 | N-valeraldehyde | |
| 735000 | Blood group antigen Jobbins | |
| 747006 | Oxamniquine | |
| 773001 | Hemoglobin M-Iwate | |
| 785009 | Dextranase | |
| 804003 | Creosotic acid | |
| 819002 | Lytic antibody | |
| 850000 | Stizolobate synthase | |
| 859004 | Peptide-N^4^-(N-acetyl-b-glucosaminyl) asparagine amidase | |
| 860009 | Immunoglobulin, aggregated | |
| 873008 | Urethan | |
| 876000 | Blood group antigen D | |
| 877009 | Carboxypeptidase A | |
| 889006 | (Acetyl-CoA carboxylase) kinase | |
| 896008 | Ice | |
| 905001 | o-Dihydroxycoumarin O^7^-glucosyltransferase | |
| 923009 | Complement component C2 | |
| 925002 | Sodium iodipamide | |
| 963005 | Pyridoxine 4-dehydrogenase | |
| 974001 | Adenosylmethionine decarboxylase | |
| 979006 | Carbamate kinase (substance) | |
| 993004 | Palladium compound | |
| 1002007 | Mannotetraose 2-alpha-N-acetylglucosaminyltransferase | |
| 1010008 | N-Acetylneuraminate monooxygenase | |
| 1018001 | Nornicotine | |
| 1025008 | ^93^Molybdenum | |
| 1047008 | Guanine deaminase | |
| 1050006 | Melilotate 3-monooxygenase | |
| 1057009 | Phosphate salt | |
| 1065007 | E. coli periplasmic proteinase | |
| 1080001 | ^202^Thallium | |
| 1091008 | Coagulation factor inhibitor | |
| 1097007 | Blood group antigen M^A^ | |
| 1105007 | Isochorismate synthase | |
| 1113008 | Pancreatic ribonuclease | |
| 1137008 | ^240^Uranium | |
| 1149009 | Hemoglobin Barcelona | |
| 1160000 | Antibody to antigen in Lutheran blood group system | |
| 1166006 | Titanium | |
| 1169004 | Hemoglobin Gower-2 | |
| 1171004 | Fibrinogen Kawaguchi | |
| 1185009 | Hemoglobin Roseau-Pointe à Pitre | |
| 1189003 | Hemoglobin F-M-Osaka | |
| 1190007 | Mephenoxalone | |
| 1219001 | Diethyl xanthogen disulfide | |
| 1223009 | Blood group antigen Marks | |
| 1244009 | Fibrinogen Madrid I | |
| 1248007 | Leucostoma neutral proteinase | |
| 1269009 | Amikacin sulfate | |
| 1272002 | Pteridine oxidase | |
| 1273007 | Blood group antibody Evelyn | |
| 1313002 | Nitrate reductase (cytochrome) | |
| 1319003 | Blood group antibody K18 | |
| 1320009 | Hemoglobin Manitoba | |
| 1325004 | Metocurine iodide | |
| 1331001 | Methamidophos | |
| 1334009 | Estradiol receptor | |
| 1336006 | 11-Deoxycorticosterone | |
| 1341003 | Hemoglobin Ta-li | |
| 1346008 | Blue shade eosin stain (substance) | |
| 1355006 | Coagulation factor IX Oxford 3 variant | |
| 1368003 | ^131^Iodine | |
| 1371006 | Blood group antigen Big | |
| 1373009 | ^93^Zirconium | |
| 1381005 | ^126^Iodine | |
| 1394007 | Iron pentacarbonyl | |
| 1396009 | Actinium | |
| 1405004 | Blood group antibody M^e^ | |
| 1408002 | Blood group antibody 1123K | |
| 1416006 | Radium compound | |
| 1450002 | Methylparafynol (substance) | |
| 1466000 | Cyclomaltodextrinase | |
| 1471007 | Elastin | |
| 1472000 | Adenosine-phosphate deaminase | |
| 1476002 | Codeine sulfate | |
| 1477006 | Hemoglobin Yatsushiro | |
| 1496005 | Proto-oncogene | |
| 1506001 | Blood group antigen Ch1 (substance) | |
| 1517000 | HLA-B21 antigen | |
| 1530004 | 6-Carboxyhexanoate-CoA ligase | |
| 1535009 | Nitrogen fluoride | |
| 1536005 | Pargyline hydrochloride | |
| 1540001 | Tellurium radioisotope | |
| 1545006 | Uridine phosphorylase | |
| 1557002 | Talc | |
| 1565004 | Blood group antibody Buckalew | |
| 1575001 | Maltose tetrapalmitate | |
| 1603001 | Cobalt isotope | |
| 1607000 | Homoserine kinase | |
| 1609002 | N-octyl isosafrole sulfoxide | |
| 1634002 | Blood group antigen Ven | |
| 1649005 | Blood group antigen Sul | |
| 1656004 | Hemoglobin Shaare Zedek | |
| 1660001 | Plant seeds | |
| 1668008 | Ceforanide | |
| 1672007 | Ligase | |
| 1673002 | Xylenol | |
| 1675009 | ^86^Rubidium | |
| 1676005 | Blood group antibody LW^ab^ | |
| 1681001 | Blood group antibody BLe^b^ | |
| 1696002 | 12-Hydroperoxy eicosatetraenoic acid | |
| 1701009 | ^191^Gold | |
| 1710001 | Uric acid | |
| 1726000 | Diamond | |
| 1727009 | Deoxylimonate A-ring-lactonase | |
| 1740004 | Deoxy cytidine triphosphate | |
| 1764003 | Saccharopine dehydrogenase (NADP^+^,L-glutamate-forming) | |
| 1768000 | Sucrose phosphorylase | |
| 1786002 | Leucine-tRNA ligase | |
| 1793003 | Sodium trichloroacetate | |
| 1795005 | Glyodin | |
| 1798007 | Hemoglobin Hammersmith | |
| 1799004 | L-Lysine oxidase | |
| 1823002 | Hemoglobin Tochigi | |
| 1827001 | Ribonuclease T>1< | |
| 1886008 | Verdohemoglobin | |
| 1904005 | Galactoside 3-fucosyltransferase | |
| 1914001 | von Willebrand factor antibody (substance) | |
| 1916004 | Boroglycerin | |
| 1940007 | Immunoglobulin, GM>21< allotype | |
| 1944003 | Coagulation factor X Patient variant | |
| 1956002 | Buclizine hydrochloride | |
| 1971003 | Loxapine hydrochloride | |
| 1975007 | Blood group antibody Niemetz | |
| 1978009 | Site-specific methyltransferase (cytosine-specific) | |
| 1985008 | Vomitus | |
| 1991005 | Lignins | |
| 2000001 | Heavy nitrogen | |
| 2006007 | Inosine diphosphate | |
| 2008008 | ^67^Gallium | |
| 2009000 | Cobalt carbonyl | |
| 2017008 | DNA topoisomerase | |
| 2027002 | Alternaria serine proteinase | |
| 2029004 | Fibrinogen Oslo II | |
| 2038002 | Blood group antibody Bg^b^ | |
| 2039005 | sym-Norspermidine synthase | |
| 2050008 | Choloylglycine hydrolase | |
| 2064008 | L-Xylulokinase | |
| 2082006 | Lymphocyte antigen CD51 | |
| 2085008 | Oncogene protein TCL | |
| 2088005 | Page blue G-90 stain (substance) | |
| 2096000 | NAD^+^ ADP-ribosyltransferase | |
| 2100004 | Sulfonethylmethane | |
| 2101000 | Yeast proteinase B | |
| 2125008 | Betazole | |
| 2130007 | Cyclohexane-1,2-diol dehydrogenase | |
| 2141009 | Hydrogen | |
| 2147008 | Blood group antigen Paular | |
| 2151005 | Pyridoxamine-pyruvate aminotransferase | |
| 2154002 | Tagaturonate reductase | |
| 2159007 | Azorubin S stain (substance) | |
| 2163000 | Dicofol | |
| 2168009 | Bisphosphoglycerate mutase | |
| 2179004 | Malonate-semialdehyde dehydratase | |
| 2189000 | Hemoglobin F-Dammam | |
| 2194000 | ^101^Rhodium | |
| 2195004 | Tocainide hydrochloride | |
| 2197007 | Boric acid topical preparation | |
| 2201007 | Bacteriopurpurin | |
| 2208001 | Phenylserine aldolase | |
| 2212007 | Fibrinogen Bethesda II | |
| 2215009 | Azuresin | |
| 2240002 | Guanidinobutyrase | |
| 2249001 | Gentamicin sulfate | |
| 2254005 | Orotic acid | |
| 2260005 | HLA-DRw18 antigen | |
| 2262002 | Cellulose polysulfatase | |
| 2264001 | Selenium isotope | |
| 2309006 | Gold | |
| 2311002 | Prostacyclin synthase | |
| 2329007 | Blood group antibody Vel | |
| 2331003 | Carbohydrate | |
| 2338009 | Plant roots | |
| 2343002 | Guthion | |
| 2346005 | Vascormone | |
| 2354007 | 3'-Nucleotidase | |
| 2358005 | Glass fragment | |
| 2369008 | Indole-3-acetate beta-glucosyltransferase | |
| 2370009 | UDP-N-acetylmuramate-alanine ligase | |
| 2376003 | Mercury compound | |
| 2384004 | ^230^Uranium | |
| 2404002 | Blood group antibody St^a^ | |
| 2405001 | b- Propiolactone | |
| 2414006 | Prolactin receptor | |
| 2430003 | Silicon radioisotope | |
| 2431004 | Blood group antibody Friedberg | |
| 2441001 | Mercury radioisotope | |
| 2444009 | HLA-Dw25 antigen | |
| 2450004 | Mannosamine | |
| 2462000 | Glucose dehydrogenase (NADP^+^) | |
| 2466002 | Chloride peroxidase | |
| 2500009 | Lymphocyte antigen CDw41b | |
| 2509005 | D-Glutamate oxidase | |
| 2516006 | Metallic sulfide compound | |
| 2522002 | Extravascular blood | |
| 2529006 | Hemoglobin Wood | |
| 2537003 | Antituberculosis agent | |
| 2568004 | Blood group antigen McAuley | |
| 2573005 | Immunoglobulin, GM>13< allotype | |
| 2575003 | Zinc alpha>2< glycoprotein | |
| 2595009 | ^119m^Tellurium | |
| 2597001 | alpha 1 globulin | |
| 2611008 | Blood group antibody La Fave | |
| 2637006 | Indium isotope | |
| 2648004 | Bile vomitus | |
| 2649007 | Azo dye | |
| 2660003 | Sodium dehydrocholate | |
| 2671002 | 3-Methyl-2-oxobutanoate hydroxy-methyltransferase | |
| 2674005 | ^128^Cesium | |
| 2676007 | C3(H20) | |
| 2678008 | Hemoglobin New Mexico | |
| 2680002 | Factor XIII antibody | |
| 2698003 | Natural gas | |
| 2705002 | ^72^Arsenic | |
| 2706001 | Blood group antigen Vennera | |
| 2719002 | Tartrate dehydratase | |
| 2721007 | Blood group antigen McC^f^ | |
| 2728001 | Antigen in Lewis (Le) blood group system | |
| 2753003 | Blood group antibody M>1< | |
| 2754009 | Hemoglobin F-Kennestone | |
| 2765004 | Blood group antigen Sc3 | |
| 2778004 | Pleural fluid | |
| 2796008 | Methantheline (substance) | |
| 2799001 | Methylbenzethonium chloride | |
| 2823004 | Hemoglobin Bristol | |
| 2832002 | Molybdenum compound | |
| 2846002 | Hemoglobin Saitama | |
| 2869004 | Acetic acid | |
| 2878005 | Meperidine hydrochloride (substance) | |
| 2880004 | Calcium sulfate | |
| 2883002 | Exopolygalacturonate lyase | |
| 2913009 | Immunoglobulin E, H chain | |
| 2916001 | ^22^Neon | |
| 2925007 | Fluorometholone | |
| 2927004 | Rescinnamine | |
| 2938004 | Pyrazole | |
| 2942001 | Carbon^14^ D-xylose | |
| 2950005 | Hemoglobin L-Persian Gulf | |
| 2958003 | Zinc caprylate | |
| 2964005 | Dimethoxyamphetamine | |
| 2974008 | Trichophyton schoenleinii collagenase | |
| 2988007 | HLA-Aw antigen | |
| 2991007 | Mecamylamine hydrochloride | |
| 2995003 | Arecoline | |
| 3027009 | ^133^Barium | |
| 3031003 | Dihydroxyaluminum sodium carbonate | |
| 3040004 | Technetium Tc^99m^ disofenin | |
| 3045009 | Nitrochlorobenzene | |
| 3052006 | Ornithine-oxo-acid aminotransferase | |
| 3066001 | Triiodothyroacetic acid | |
| 3070009 | Aspartate-ammonia ligase | |
| 3087006 | Oil of male fern | |
| 3107005 | Hemoglobin Shuangfeng | |
| 3108000 | Aspergillus deoxyribonuclease K>1< | |
| 3131000 | Blood group antigen Middel | |
| 3136005 | Cefoperazone sodium | |
| 3142009 | Azacyclonol | |
| 3145006 | Penicillic acid | |
| 3150000 | Sialate O-acetylesterase | |
| 3151001 | Left upper lobe mucus | |
| 3155005 | 3-Phosphoglyceroyl-phosphate-polyphosphate phosphotransferase | |
| 3161008 | 3-Methyl histidine | |
| 3167007 | Hard coal | |
| 3187008 | Blood group antigen Nielsen | |
| 3193000 | alpha-1,4-Glucan-protein synthase (UDP-forming) | |
| 3197004 | Inosine monophosphate | |
| 3209002 | Pancuronium sodium | |
| 3212004 | Manganese sulfate | |
| 3225007 | Fibrinogen Seattle I | |
| 3232003 | o-Benzyl-parachlorophenol | |
| 3271000 | Hemoglobin Southampton | |
| 3273002 | Tyrosine-ester sulfotransferase | |
| 3300001 | Euphorbain | |
| 3318003 | Vaginal secretions | |
| 3325005 | Lipopolysaccharide | |
| 3339005 | (R)-20-Hydroxysteroid dehydrogenase | |
| 3340007 | alpha-Amylase | |
| 3342004 | Copper isotope (substance) | |
| 3346001 | Hemoglobin Brest | |
| 3378009 | Imipramine hydrochloride | |
| 3379001 | Thimerosal | |
| 3392003 | Aldehyde dehydrogenase (acceptor) | |
| 3405005 | 2-Hydroxy-3-oxoadipate synthase | |
| 3411008 | bis-(Dimethylthiocarbamyl) disulfide | |
| 3437006 | Hydroxymethylglutaryl-CoA hydrolase | |
| 3440006 | Biotin carboxylase | |
| 3455002 | Discontinued pesticide | |
| 3463001 | L-Amino-acid dehydrogenase | |
| 3465008 | DNA topoisomerase (ATP-hydrolysing) | |
| 3466009 | Dimethylamine | |
| 3492002 | Galactinol-sucrose galactosyltransferase | |
| 3493007 | Smegma clitoridis | |
| 3495000 | Cystyl-aminopeptidase | |
| 3501003 | Isoxsuprine hydrochloride | |
| 3523004 | Hemoglobin Q-India | |
| 3532002 | Laryngeal mucus | |
| 3555004 | Blood group antigen Morrison | |
| 3579002 | ^129^Cesium | |
| 3581000 | Glucose-6-phosphatase | |
| 3587001 | Malate dehydrogenase (decarboxylating) | |
| 3588006 | Complement enzyme | |
| 3592004 | Short-acting thyroid stimulator | |
| 3597005 | Acebutolol hydrochloride | |
| 3601005 | Ether | |
| 3602003 | Warm antibody | |
| 3610002 | Epoxide hydrolase | |
| 3617004 | ^79^Selenium | |
| 3648007 | Glucocorticoid receptor | |
| 3655009 | Hemoglobin Constant Springs | |
| 3672002 | Fibrinogen Caracas | |
| 3684000 | Phenylacetic acid | |
| 3689005 | Hemoglobin Mizushi | |
| 3692009 | Sodium sulfite | |
| 3693004 | Fibrinogen Dusard | |
| 3702007 | CDPglycerol glycerophosphotransferase | |
| 3710008 | Prostaglandin synthase | |
| 3718001 | Cow's milk | |
| 3726009 | Valine-tRNA ligase | |
| 3727000 | Hemoglobin F-Port Royal | |
| 3730007 | Blood group antigen Tr^a^ | |
| 3737005 | Nitrate reductase (NADH) | |
| 3742002 | Extracellular crystal | |
| 3757009 | Gossypol | |
| 3771001 | Neuromelanin | |
| 3775005 | Choline dehydrogenase | |
| 3776006 | Xanthine dehydrogenase | |
| 3792001 | Arachidonic acid | |
| 3793006 | Soluble barium compound | |
| 3800009 | Acetate kinase | |
| 3807007 | Blood group antigen c | |
| 3811001 | Magnesium-protoporphyrin methyltransferase | |
| 3812008 | Beryllium isotope | |
| 3816006 | Vanadium isotope | |
| 3823007 | Prochlorperazine edisylate | |
| 3829006 | Iron | |
| 3834005 | CMP-N-acetylneuraminate-(alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetyl-galactosaminide alpha-2,6-sialyltransferase | |
| 3836007 | Glutaminase | |
| 3844007 | Protoaphin-aglucone dehydratase (cyclizing) | |
| 3848005 | Nitrotoluene | |
| 3849002 | Carbon black | |
| 3854006 | bis-Chloro methyl ether | |
| 3874004 | Hydrocodone bitartrate | |
| 3892007 | Thymidine | |
| 3896005 | p-Hydroxybenzoate ester | |
| 3897001 | Blood group antigen 'N' | |
| 3906002 | Rectified birch tar oil (substance) | |
| 3920009 | Hemoglobin Atago | |
| 3930000 | Manufactured gas | |
| 3932008 | ^64^Copper | |
| 3941003 | Metronidazole hydrochloride | |
| 3945007 | Tin isotope | |
| 3958008 | ^245^Californium | |
| 3961009 | Blood group antigen Ritherford | |
| 3976001 | Blood group antigen HEMPAS | |
| 3982003 | Oxaloacetate decarboxylase | |
| 3983008 | N,-N-dimethyltryptamine | |
| 3990003 | Alkaline phosphatase isoenzyme, bone fraction | |
| 3994007 | Hemoglobin Tampa | |
| 4014000 | Sulfisomidine | |
| 4024008 | Soft metal | |
| 4025009 | Captodiame | |
| 4043008 | Etidocaine hydrochloride | |
| 4047009 | cis-1,2-Dihydrobenzene-1,2-diol dehydrogenase | |
| 4048004 | 1,1,2,2-Tetrachloro-1,2- difluoroethane | |
| 4067000 | Chorismate mutase | |
| 4076007 | Parathyroid hormone | |
| 4077003 | Dihydrolipoamide succinyltransferase | |
| 4080002 | Hemoglobin Grady, Dakar | |
| 4091009 | Enteropeptidase | |
| 4097008 | Apo-SAA complex | |
| 4104007 | Chondroitin sulfate | |
| 4105008 | Adenylate cyclase | |
| 4115002 | Blood group antibody Norlander | |
| 4137009 | sec-Butyl acetate | |
| 4153007 | Long-chain-enoyl-CoA hydratase | |
| 4167003 | Lymphocyte antigen CD31 | |
| 4169000 | Blood group antibody Le^bH^ | |
| 4177001 | Hemoglobin Long Island-Marseille | |
| 4182008 | CDPdiacylglycerol-serine O-phosphatidyl-transferase | |
| 4188007 | Fibrinogen Sydney II | |
| 4200007 | Neriifolin | |
| 4201006 | 6-Aminohexanoate-dimer hydrolase | |
| 4203009 | Imipramine pamoate | |
| 4207005 | Cortisone beta-reductase | |
| 4217000 | Fluorosilicate salt | |
| 4218005 | Immunoglobulin, GM>23< allotype | |
| 4231000 | Gallium isotope | |
| 4239003 | Glycerol dehydrogenase | |
| 4255005 | ^241^Americium | |
| 4289006 | Keyhole-limpet hemocyanin | |
| 4290002 | Linamarin synthase | |
| 4314009 | Blood group antibody Allchurch | |
| 4334005 | Tar oil | |
| 4342006 | 2-Aminopyridine | |
| 4353000 | Dibutyl phthalate | |
| 4355007 | Coagulation factor IX San Dimas variant | |
| 4362003 | 4-Coumarate-CoA ligase | |
| 4370008 | Acetone | |
| 4393002 | Blood group antigen Fedor | |
| 4401009 | Blood group antibody H>T< | |
| 4413004 | Benzypyrinium (substance) | |
| 4422003 | Blood group antigen | |
| 4423008 | Fibrinogen New York II | |
| 4425001 | Blood group antibody Binge | |
| 4435007 | Sulfuryl fluoride | |
| 4437004 | ^127^Cesium | |
| 4471008 | ^244^Californium | |
| 4479005 | Hemoglobin Brockton | |
| 4480008 | Sulfaethidole | |
| 4509009 | Plant phenanthrene toxin | |
| 4518006 | Buthenal | |
| 4534009 | ^208^Bismuth | |
| 4540002 | ADP deaminase | |
| 4546008 | Myristic acid | |
| 4555006 | Blood group antibody Rils | |
| 4560005 | Hemoglobin Mizuho | |
| 4561009 | Arginine decarboxylase | |
| 4564001 | Blood group antibody Sisson | |
| 4567008 | Galactose-1-phosphate thymidylyltransferase | |
| 4582003 | Blood group antigen N^A^ | |
| 4591004 | Blood group antigen Far | |
| 4610008 | Senile cardiac protein | |
| 4616002 | Triclobisonium chloride | |
| 4629002 | Hypoglycin B | |
| 4635002 | Arterial blood | |
| 4643007 | Calf thymus ribonuclease H | |
| 4656000 | Alcian blue 8GX stain (substance) | |
| 4674009 | 2,3-Dihydroxybenzoate serine ligase | |
| 4681002 | Potassium permanganate | |
| 4693006 | Chromium^51^ albumin | |
| 4700006 | Beef insulin | |
| 4706000 | Chlorine monoxide | |
| 4714006 | ^183m^Osmium | |
| 4728000 | Scopulariopsis proteinase | |
| 4731004 | Aluminum pyro powder | |
| 4732006 | Oncogene protein P55, V-MYC | |
| 4746006 | Hemoglobin Mito | |
| 4761007 | Lymphocyte antigen CD30 | |
| 4762000 | Platelet antigen HPA-3b | |
| 4777008 | Fluroxene | |
| 4780009 | Butabarbital sodium (substance) | |
| 4786003 | beta-1,4-Mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase | |
| 4789005 | Blood group antibody Bultar | |
| 4793004 | Azobenzene reductase | |
| 4814001 | Valethamate | |
| 4824009 | Amine oxidase (flavin-containing) | |
| 4825005 | Peptidyl-glycinamidase | |
| 4831008 | Arabinose-5-phosphate isomerase | |
| 4832001 | Technetium Tc^99m^ mebrofenin | |
| 4833006 | Glucan endo-1,3-alpha-glucosidase | |
| 4844003 | 3,3' Diiodothyronine | |
| 4864008 | Adenylic acid | |
| 4872005 | Glucosulfone | |
| 4878009 | HLA-Dw3 antigen | |
| 4882006 | Ichthyoallyeinotoxin | |
| 4889002 | Xylulokinase | |
| 4901003 | Pyruvate oxidase (CoA-acetylating) | |
| 4925006 | Oncogene protein V-ABC | |
| 4933007 | Lymphocyte antigen CD15 | |
| 4940008 | Tattoo dye | |
| 4955004 | Neoplastic structural gene | |
| 4962008 | Tree bark | |
| 4963003 | Neutral amino acid | |
| 4965005 | Glutathione reductase (NAD(P)H) | |
| 4968007 | Acumentin | |
| 4986005 | Magnesium borate | |
| 5003005 | Hemoglobin Swan River | |
| 5004004 | Blood group antibody Panzar | |
| 5007006 | Papain | |
| 5024000 | Fresh water | |
| 5031001 | 3-3'Dichlorobenzidine | |
| 5040002 | Cesium | |
| 5043000 | Erythrosin Y stain (substance) | |
| 5045007 | Oncogene protein TCL4 | |
| 5059000 | ^97^Technetium | |
| 5060005 | ^132^Cesium | |
| 5061009 | Protein-methionine-S-oxide reductase | |
| 5064001 | Blood group antibody D 1276 | |
| 5081005 | Blood group antigen hr^B^ | |
| 5086000 | Gelsolin | |
| 5094007 | Blood group antigen Rios | |
| 5098005 | Fennel oil | |
| 5109006 | Methylated-DNA-protein-cysteine methyltransferase | |
| 5142007 | Coagulation factor II Houston variant | |
| 5160007 | Metallic compound | |
| 5163009 | Scombrotoxin | |
| 5167005 | Zinc chloride fumes | |
| 5172001 | Coagulation factor Xa | |
| 5179005 | Connective tissue fiber | |
| 5200001 | trans-Epoxysuccinate hydrolase | |
| 5206007 | Cyanate compound | |
| 5220000 | Bacitracin | |
| 5226006 | Flavone O^7^-beta-glucosyltransferase | |
| 5250008 | Thymus-independent antigen | |
| 5252000 | Hafnium radioisotope | |
| 5253005 | Hemoglobin Woodville | |
| 5259009 | Blood group antigen Braden | |
| 5289002 | Scilliroside | |
| 5303002 | Hemoglobin Hoshida | |
| 5305009 | Polynucleotide | |
| 5307001 | Blood group antigen Hamet | |
| 5312000 | ^65^Zinc (substance) | |
| 5323001 | Uridine diphosphate glucuronic acid | |
| 5330007 | Actin-binding protein | |
| 5339008 | L-Glycol dehydrogenase | |
| 5340005 | Blood group antigen Swietlik | |
| 5392001 | Propylene glycol monomethyl ether | |
| 5395004 | Pyridoxamine-phosphate oxidase | |
| 5404007 | Lymphocyte antigen CD45RA | |
| 5405008 | ^60^Cobalt (substance) | |
| 5406009 | beta-L-Arabinosidase | |
| 5420002 | Accessory sinus mucus | |
| 5439007 | Blood group antibody Do^a^ | |
| 5442001 | Page blue 83 stain (substance) | |
| 5453007 | Iridium isotope | |
| 5471000 | Hemoglobin G-Coushatta | |
| 5474008 | Propionate-CoA ligase | |
| 5477001 | Ferric subsulfate | |
| 5483003 | Oxalate CoA-transferase | |
| 5504009 | Blood group antigen Fuerhart | |
| 5511008 | Inosinate nucleosidase | |
| 5513006 | Immunoglobulin A, H chain | |
| 5515004 | Rhodium fumes | |
| 5533005 | Blood group antibody Kp^a^ | |
| 5537006 | Immunoglobulin D, H chain (substance) | |
| 5540006 | Calcium | |
| 5547009 | ^233^Plutonium | |
| 5548004 | 2-Dehydro-3-deoxy-D-pentonate aldolase | |
| 5568005 | Hemoglobin Hijiyama | |
| 5573004 | Blood group antigen Oca | |
| 5589001 | Licodione O^2'^-methyltransferase | |
| 5590005 | Beryllium radioisotope | |
| 5628003 | Hemoglobin I-High Wycombe | |
| 5629006 | Cytidylic acid | |
| 5637003 | HLA-DQw6 antigen | |
| 5641004 | Divalproex sodium (substance) | |
| 5647000 | Griseofulvin ultramicrosize | |
| 5656008 | ^116m^Antimony | |
| 5657004 | Coal tar topical solution | |
| 5659001 | Hemoglobin J-Tongariki | |
| 5670008 | Gold isotope | |
| 5681006 | Ceftizoxime sodium | |
| 5691000 | Absorbable gelatin sponge | |
| 5692007 | Cyanocobalamin Co^58^ | |
| 5699003 | Somatomedin C | |
| 5700002 | Blood group antibody Gomez | |
| 5702005 | ^106m^Silver | |
| 5704006 | Galactokinase | |
| 5705007 | 1,3-Propanediol dehydrogenase | |
| 5739006 | Stramonium | |
| 5746002 | ^118m^Antimony | |
| 5757007 | HLA-Cw8 antigen | |
| 5762008 | Heterogeneous nuclear ribonucleic acid (substance) | |
| 5764009 | ^242^Plutonium | |
| 5767002 | Sulfamerazine | |
| 5774007 | White petrolatum | |
| 5800007 | tRNA (5-methylaminomethyl-2-thiouridylate)-methyltransferase | |
| 5813001 | Malate dehydrogenase | |
| 5826002 | Ethyl-4-bis-(hydroxypropyl)-1-aminobenzoate | |
| 5827006 | Crotonaldehyde | |
| 5829009 | Hemoglobin Vaasa | |
| 5830004 | Hemoglobin Bart | |
| 5840001 | Blood group antibody Wj | |
| 5858007 | ^110m^Indium | |
| 5863006 | Vitexin beta-glucosyltransferase | |
| 5896008 | Hellebrin | |
| 5899001 | Bacterial structural gene | |
| 5907009 | Quinidine polygalacturonate | |
| 5910002 | Oncogene protein PP60, V-SRC | |
| 5915007 | Blood group antigen Gladding | |
| 5927005 | Lactaldehyde dehydrogenase | |
| 5931004 | Technetium Tc^99m^ sulfur colloid | |
| 5932006 | Cysteine | |
| 5950004 | 3',5'-Cyclic-nucleotide phosphodiesterase | |
| 5955009 | Diethylene glycol | |
| 5977008 | Blood group antigen Bullock | |
| 5989005 | Immunoglobulin, GM>17< allotype | |
| 5991002 | D-Fuconate dehydratase | |
| 6021003 | ^88^Yttrium | |
| 6038004 | Oxygen radioisotope | |
| 6043006 | Bone cement | |
| 6044000 | Carbon disulfide | |
| 6054001 | Doxylamine succinate | |
| 6056004 | Blood group antibody Wk^a^ | |
| 6068008 | Blood group antigen Mil | |
| 6083003 | Hydroxylysine | |
| 6085005 | Synovial fluid | |
| 6088007 | Benzphetamine hydrochloride (substance) | |
| 6089004 | Lochia alba | |
| 6091007 | Blood group antibody L Harris | |
| 6107003 | Asparagusate reductase (NADH) | |
| 6109000 | Aromatic-amino-acid aminotransferase | |
| 6115000 | Blood group antibody Anuszewska | |
| 6135004 | Blood group antigen Duck | |
| 6138002 | Blood group antigen Le Provost | |
| 6162007 | Meclocycline | |
| 6170002 | Heat labile antibody | |
| 6172005 | Fatty-acid methyltransferase | |
| 6178009 | Lymphocyte antigen CD63 | |
| 6179001 | o-Methy-bufotenine | |
| 6182006 | Chloroacetone | |
| 6197009 | Blood group antigen Zd | |
| 6237004 | Bemegride | |
| 6249003 | Potassium metabisulfite | |
| 6256009 | Ribose isomerase | |
| 6257000 | Sodium chloride Na^22^ | |
| 6260007 | Protokylol | |
| 6261006 | Flurothyl (substance) | |
| 6263009 | Plant residue | |
| 6264003 | Diazinon | |
| 6287006 | Methidathion | |
| 6291001 | N-Acetylglucosamine-1-phosphodiester N-acetylglucosaminidase | |
| 6301006 | ^178^Tantalum | |
| 6310003 | Particulate antigen | |
| 6314007 | Phenol beta-glucosyltransferase | |
| 6333002 | Squill extract | |
| 6338006 | Imidazolonepropionase | |
| 6356006 | Chlorodiallylacetamide | |
| 6360009 | Kallidin II | |
| 6367007 | ^95m^Technetium | |
| 6386004 | N-Acetylneuraminate O^4^-acetyltransferase | |
| 6394006 | Phentermine hydrochloride | |
| 6401007 | Lichenase | |
| 6409009 | Morpholine | |
| 6411000 | Interleukin-12 | |
| 6422001 | HLA-DRw14 antigen | |
| 6451002 | Chlorobenzilate | |
| 6455006 | Chloroprene | |
| 6469006 | delta^1^-Piperideine-2-carboxylate reductase | |
| 6478000 | 6-Phosphofructokinase | |
| 6495008 | Fibrinogen Montreal II | |
| 6507009 | Blood group antigen Lu12 | |
| 6513000 | Flumethiazide | |
| 6516008 | Indium^111^-Fe(OH)>3< | |
| 6524003 | Distilled spirits | |
| 6529008 | Blood group antigen Cl^a^ | |
| 6532006 | Macrophage activating factor | |
| 6590001 | Galactosylceramidase | |
| 6592009 | HLA-Dw12 antigen | |
| 6602005 | Aminoacridine | |
| 6611005 | Diethylaminoethanol | |
| 6612003 | Chloramphenicol sodium succinate | |
| 6619007 | Bilirubin Y transport protein | |
| 6642000 | Opsonin | |
| 6644004 | Homoserine dehydrogenase | |
| 6671004 | Blood group antigen Caw | |
| 6672006 | Phosphoadenylate 3'-nucleotidase | |
| 6699008 | Titanium radioisotope | |
| 6701008 | Lissamine fast red B stain (substance) | |
| 6702001 | Ethyl mercaptoethyl diethyl thiophosphate | |
| 6709005 | Gentamicin 2''-nucleotidyltransferase | |
| 6710000 | Nitric oxide | |
| 6713003 | ^91^Yttrium | |
| 6717002 | Nifuroxime | |
| 6725000 | Methylthioninium chloride | |
| 6730001 | ^234^Uranium | |
| 6741004 | Anti DNA antibody | |
| 6755007 | Thymus leukemia antigen (substance) | |
| 6786001 | Silver difluoride | |
| 6790004 | Aminopterin | |
| 6792007 | Veratrine | |
| 6808006 | Ferrous iron compound | |
| 6809003 | Phomopsin | |
| 6814004 | Discadenine synthase | |
| 6817006 | Oxidized glutathione | |
| 6826009 | Sterol hormone | |
| 6837005 | Propoxyphene napsylate (substance) | |
| 6854002 | ^188^Platinum | |
| 6865007 | Theophylline calcium salicylate | |
| 6873003 | Cephapirin sodium (substance) | |
| 6879004 | 5,8,11-Eicosatrienoic acid | |
| 6881002 | Magnesium fumes | |
| 6884005 | (S)-3-Amino-2-methylpropionate aminotransferase | |
| 6890009 | 3-Deoxy-manno-octulosonate-8-phosphatase | |
| 6896003 | Thiopurine methyltransferase | |
| 6910009 | Sodium fluoride | |
| 6911008 | Deoxycytidylate methyltransferase | |
| 6916003 | Bowieine | |
| 6924008 | Exopolyphosphatase | |
| 6925009 | Leucine acetyltransferase | |
| 6927001 | ^121^Tin | |
| 6937006 | Thymidylate synthase | |
| 6945001 | Blood group antigen Le^bH^ | |
| 6952004 | ^121m^Tin | |
| 6958000 | Blood group antibody Frando | |
| 6961004 | Lysolecithin acylmutase | |
| 6970001 | 4-Hydroxyproline epimerase | |
| 6973004 | Chromium^51^ chloride | |
| 6983000 | Acrylamide | |
| 6992002 | Triflupromazine hydrochloride | |
| 6993007 | Seminal fluid | |
| 6999006 | Ammonium compound | |
| 7008002 | beta-Carotene 15,15'-dioxygenase | |
| 7018007 | Malate-CoA ligase | |
| 7029006 | Blood group antigen Greenlee | |
| 7030001 | Globoside | |
| 7034005 | Diclofenac | |
| 7045008 | Lycorine | |
| 7047000 | Asphyxiant atmosphere | |
| 7049002 | Pyruvate carboxylase | |
| 7054006 | Hemoglobin Poissy | |
| 7056008 | 3-Propylmalate synthase | |
| 7059001 | N-Acylneuraminate-9-phosphatase | |
| 7061005 | Anthocyanidin O^3^-glucosyltransferase | |
| 7070008 | Convallamarin | |
| 7084003 | Fibrinogen Buenos Aires II | |
| 7110002 | ^69^Germanium | |
| 7120007 | Antigen | |
| 7132006 | ^73^Gallium (substance) | |
| 7139002 | Acid-CoA ligase (GDP-forming) | |
| 7146006 | Cyclohexene oxide | |
| 7152007 | Chlorthion | |
| 7156005 | Phosphorus isotope | |
| 7158006 | HLA-Dw19 antigen | |
| 7161007 | Complement component C2a | |
| 7179006 | Prekallikrein | |
| 7191002 | Methenyltetrahydrofolate cyclohydrolase | |
| 7208009 | Thiol oxidase | |
| 7211005 | Blood group antibody Haakestad (substance) | |
| 7237008 | Galactonate dehydratase | |
| 7243005 | Methyl isocyanate | |
| 7269004 | Thorium | |
| 7271004 | Mixed dust | |
| 7280004 | dTDP4-dehydrorhamnose reductase | |
| 7281000 | Technetium Tc^99m^ lidofenin | |
| 7284008 | Mercaptan compound | |
| 7294003 | tert-Butyl acetate | |
| 7302008 | Ambuphylline | |
| 7318002 | Bacteriochlorophyll | |
| 7321000 | Pyrimidine | |
| 7325009 | Calcium hydroxide (substance) | |
| 7327001 | Sulfurous acid | |
| 7328006 | Red petrolatum | |
| 7330008 | Shellac | |
| 7337006 | Blood group antibody Tr^a^ | |
| 7348004 | Coagulation factor II | |
| 7382005 | Aminoalcohol ester (substance) | |
| 7401000 | Heme-hemopexin complex | |
| 7411007 | Blood group antibody HLA-B8 | |
| 7427000 | Sepiapterin reductase | |
| 7434003 | Erythrosin B stain (substance) | |
| 7446004 | Ruthenium | |
| 7451005 | Tobramycin ophthalmic preparation | |
| 7460002 | ^127^Tellurium | |
| 7470000 | p-tert-Butyltoluene | |
| 7489000 | Homocytotropic antibody | |
| 7503004 | ^72^Gallium | |
| 7509000 | Mannitol hexanitrate | |
| 7515000 | Hepatotoxic mycotoxin | |
| 7537007 | Stizolobinate synthase | |
| 7547005 | Hemoglobin Lincoln Park | |
| 7549008 | Fibrinogen Bethesda I | |
| 7588005 | Blood group antibody Sk^a^ | |
| 7608003 | Triethylene glycol | |
| 7616007 | Blood group antibody Pruitt | |
| 7648006 | HLA-Bw70 antigen | |
| 7661006 | Fish bone | |
| 7670009 | Aminobutyraldehyde dehydrogenase | |
| 7675004 | Blood group antigen Towey | |
| 7679005 | Strong oxidizing compound | |
| 7685003 | Blood group antibody Bg^c^ | |
| 7696006 | Ferrovanadium dust | |
| 7716001 | Isovaleryl-CoA dehydrogenase | |
| 7737009 | Chlortetracycline hydrochloride (substance) | |
| 7738004 | HLA-B49 antigen | |
| 7761002 | ^111^Silver | |
| 7770004 | ^89^Strontium | |
| 7774008 | Neo-b-vitamin A>1< | |
| 7779003 | ^103^Ruthenium | |
| 7785005 | Sphingomyelin phosphodiesterase D | |
| 7790008 | 1-Monoacylglycerol | |
| 7791007 | Soy protein | |
| 7795003 | Oxalate oxidase | |
| 7801007 | Tetrahydroxypteridine cycloisomerase | |
| 7816005 | Antazoline hydrochloride | |
| 7834009 | Acetyldigitoxin | |
| 7846008 | Sphingomyelin phosphodiesterase | |
| 7848009 | 1-Phosphatidylinositol phosphodiesterase | |
| 7868003 | beta-Cyclopiazonate dehydrogenase | |
| 7879008 | ^218^Radon | |
| 7900007 | Hemoglobin Presbyterian | |
| 7904003 | Deanol | |
| 7909008 | Arginine carboxypeptidase | |
| 7924004 | Diflorasone | |
| 7938006 | D-Arabinitol dehydrogenase | |
| 7945006 | Orsellinate-depside hydrolase | |
| 7948008 | Reed-Sternberg antibody | |
| 7953003 | Thioneb | |
| 7957002 | Phosphatidate cytidylyltransferase | |
| 7961008 | Hemoglobin F-Shanghai | |
| 7970006 | Allograft | |
| 7974002 | Blood group antibody Dalman | |
| 7975001 | Amiphenazole | |
| 7979007 | 3'-Phosphoadenylylsulfate 3'-phosphatase | |
| 7983007 | Sodium rhodanide | |
| 7985000 | Sulfur isotope | |
| 7997004 | Butyl mercaptan | |
| 8000007 | Cucurbitacin delta^23^-reductase | |
| 8002004 | Blood group antibody Fleming | |
| 8025003 | Blood group antibody Gibson | |
| 8029009 | Allyl glycidyl ether | |
| 8030004 | Polyethylene glycol | |
| 8035009 | Cholestenol delta-isomerase | |
| 8048008 | Blood group antigen Th | |
| 8054009 | Orotate reductase (NADPH) | |
| 8055005 | Galactoside acetyltransferase | |
| 8105004 | Hemoglobin Leiden | |
| 8108002 | Undecaprenyl-diphosphatase | |
| 8123007 | Blood group antibody Schuppenhauer | |
| 8132009 | Magnesium acetylsalicylate | |
| 8143001 | Diosmin | |
| 8153000 | Pipecolic acid | |
| 8156008 | Immunoglobulin, Fd fragment | |
| 8164002 | Lymphocyte antigen CD67 | |
| 8168004 | Uracil-5-carboxylate decarboxylase | |
| 8179009 | Cevadilline | |
| 8184003 | Convallamarogenin | |
| 8190004 | Diaminopimelate epimerase | |
| 8202008 | ^43^Potassium | |
| 8203003 | Human menopausal gonadotropin | |
| 8204009 | Polyester | |
| 8222007 | Coagulation factor II Padua variant | |
| 8227001 | ^106^Ruthenium | |
| 8230008 | Streptococcal cysteine proteinase | |
| 8237006 | Strobane | |
| 8252004 | Chlorothiazide sodium | |
| 8257005 | Abnormal hemoglobin | |
| 8261004 | Potassium thiosulfate | |
| 8268005 | Blood group antibody Hildebrandt | |
| 8270001 | tRNA adenylyltransferase | |
| 8275006 | Methionine-S-oxide reductase | |
| 8295000 | Uromucoid protein | |
| 8300003 | Cyclohexanol | |
| 8310007 | Hemoglobin Madrid | |
| 8313009 | RNA-directed DNA polymerase | |
| 8340009 | Procollagen-lysine,2-oxoglutarate 5-dioxygenase | |
| 8342001 | Brilliant cresyl blue stain (substance) | |
| 8343006 | Blood group antibody Re^a^ | |
| 8354001 | Manganese ethylene bis-dithiocarbamate | |
| 8355000 | Hafnium isotope | |
| 8362009 | Blood group antibody c | |
| 8365006 | Oil of pennyroyal-European | |
| 8368008 | Xylan 1,44-beta-xylosidase | |
| 8376005 | Antibody to antigen in Duffy blood group system | |
| 8385005 | Glucan 1,4-alpha-glucosidase | |
| 8397006 | Nicotine resin complex | |
| 8406008 | Nitroethane oxidase | |
| 8429000 | Brilliant orange stain (substance) | |
| 8450009 | Oil of lemon grass | |
| 8452001 | Blood group antigen Sisson | |
| 8456003 | Methyl ethyl ketone peroxide | |
| 8460000 | Blood group antibody Vg^a^ | |
| 8473001 | Homocysteine methyltransferase | |
| 8474007 | Lead oleate | |
| 8484008 | Blood group antigen Mur | |
| 8485009 | Oncogene protein P210, BCR-ABL | |
| 8486005 | HLA-DRw15 antigen | |
| 8487001 | ^48^Vanadium | |
| 8491006 | Complement inhibitor | |
| 8492004 | Allantoicase | |
| 8498000 | Short neurotoxin venom | |
| 8507001 | Cyclohexane | |
| 8514004 | Ornithine | |
| 8520003 | Hemoglobin Machida | |
| 8525008 | ^183^Osmium | |
| 8529002 | Urinary protein of low molecular weight | |
| 8534003 | ^110^Tin | |
| 8537005 | Solution | |
| 8578007 | Potassium cyanate | |
| 8591008 | Dichlorodifluoromethane | |
| 8612007 | Tumor necrosis factor | |
| 8620009 | Oncogene protein TCL6 | |
| 8631001 | Potassium chloride | |
| 8653004 | Rubijervine | |
| 8660005 | Complement component C3c | |
| 8687009 | Gum arabic | |
| 8689007 | Kanamycin sulfate | |
| 8701002 | Sulfachlorpyridazine | |
| 8705006 | 4-Hydroxybenzoate decarboxylase | |
| 8731008 | Blood group antibody Austin | |
| 8740007 | C3(H20)Bb | |
| 8761000 | Adenylylsulfate kinase | |
| 8767001 | Santonin | |
| 8785008 | Chlorine dioxide | |
| 8786009 | Blood group antigen Wd^a^ | |
| 8795001 | Hemoglobin F | |
| 8817004 | LH receptor site | |
| 8818009 | Blood group antibody Tri W | |
| 8822004 | Linoleic acid | |
| 8830003 | Nitrate reductase [NAD(P)H] (substance) | |
| 8836009 | Gallocyanine stain (substance) | |
| 8844009 | Hydroxybutyrate-dimer hydrolase | |
| 8858006 | Strontium nitrate Sr^85^ | |
| 8865003 | Natural graphite | |
| 8878003 | Blood group antigen Evelyn | |
| 8882001 | 3-Hydroxybenzoate 6-monooxygenase | |
| 8886003 | Flecainide acetate | |
| 8908003 | Blood group antibody I^T^ | |
| 8914005 | Endolymph | |
| 8919000 | Biotin | |
| 8926000 | Azure B stain (substance) | |
| 8945009 | Phosphopantothenate-cysteine ligase | |
| 8953001 | 2,3-Dihydroxyindole 2,3-dioxygenase | |
| 8963009 | N-Acetylmuramoyl-L-alanine amidase | |
| 8969008 | Bulbourethral secretions | |
| 8977007 | Blood group antibody Tarplee | |
| 8982000 | Oleate hydratase | |
| 8987006 | Cycle-phase specific agent | |
| 8991001 | Ribulokinase | |
| 9010006 | Methyl blue stain (substance) | |
| 9013008 | Dephospho-CoA kinase | |
| 9021002 | Carbaryl | |
| 9024005 | Glucose-6-phosphate dehydrogenase | |
| 9045003 | Radon radioisotope | |
| 9052001 | Allspice oil | |
| 9054000 | Blood group antigen HLA-B15 | |
| 9103003 | Retinol fatty-acyltransferase | |
| 9110009 | Mercuric compound | |
| 9125009 | Sempervirine | |
| 9159008 | Triacetate-lactonase | |
| 9172009 | Blood group antibody Alda | |
| 9174005 | Fibrinogen Poitiers | |
| 9183000 | beta-N-Acetylgalactosaminidase | |
| 9189001 | CMP-N-acetylneuraminate-lactosylceramide alpha-2,3-sialyltransferase | |
| 9195000 | Immunoglobulin gene INV allotype | |
| 9197008 | Apiose reductase | |
| 9205004 | Hemoglobin Tarrant | |
| 9220005 | Plant phenol oil | |
| 9223007 | Borneol dehydrogenase | |
| 9234005 | Chlorobutanol | |
| 9246009 | ^118^Tellurium | |
| 9253000 | HLA-DRw16 antigen | |
| 9270008 | Catecholamine receptor | |
| 9271007 | Fibrinogen Pontoise | |
| 9296005 | Gamma interferon | |
| 9301005 | Lens neutral proteinase | |
| 9302003 | Gentisate decarboxylase | |
| 9315007 | Spearmint oil | |
| 9319001 | Blood group antibody Vennera | |
| 9334007 | Isopropyl glycidyl ether | |
| 9349004 | Nitrobenzene | |
| 9351000 | ^103^Palladium | |
| 9355009 | Hemoglobin F-Alexandra | |
| 9392009 | Blood group antibody Pollio | |
| 9396007 | ^60^Iron | |
| 9398008 | Blood group antigen Pillsbury | |
| 9410003 | Bromoform | |
| 9422000 | High density lipoprotein | |
| 9457002 | Fibrinogen Almeria | |
| 9471005 | Polypropylene glycol | |
| 9472003 | Blood group antigen Schneider | |
| 9477009 | ATP pyrophosphatase | |
| 9485000 | Glucuronosyl-disulfoglucosamine glucuronidase | |
| 9493000 | Homologous antigen | |
| 9507008 | ^238^Uranium | |
| 9508003 | Hemoglobin F-Kotobuki | |
| 9530002 | Amine hormone | |
| 9532005 | Coagulation factor XIIIa | |
| 9539001 | Chlorprothixene lactate | |
| 9549003 | Hemoglobin F-Albaicin | |
| 9556009 | Cholesterol acyltransferase | |
| 9582000 | Alanine racemase | |
| 9588001 | beta-Phosphoglucomutase | |
| 9608008 | Blood group antigen Noble | |
| 9623003 | 6-Phosphofructo-2-kinase | |
| 9630009 | Poly(ribitol-phosphate) N-acetylglucosaminyltransferase | |
| 9639005 | Bromine compound | |
| 9643009 | Chlorphentermine | |
| 9663002 | Mepazine (substance) | |
| 9664008 | Di-sec-octyl phthalate | |
| 9672005 | Blood group antigen S | |
| 9675007 | Coniferyl-alcohol glucosyltransferase | |
| 9676008 | Fibrinogen New York III | |
| 9680003 | Central depressant | |
| 9695001 | Hemoglobin J-Camaguey | |
| 9701007 | Blood group antibody Pr>3< | |
| 9716005 | Blood group antibody Luke | |
| 9721008 | Phencyclidine | |
| 9765000 | Lithium salt | |
| 9797000 | Phosphorus trichloride | |
| 9817005 | Mycoplasma pulmonis antibody test kit | |
| 9821003 | Methylthioadenosine nucleosidase | |
| 9830006 | ^200^Thallium | |
| 9865006 | Deoxyhemoglobin | |
| 9871000 | D-Amino-acid acetyltransferase | |
| 9885005 | Mannitol-1-phosphatase | |
| 9890008 | Unspecific monooxygenase | |
| 9900004 | Phenylalanine (histidine) aminotransferase | |
| 9910008 | Oxymetazoline hydrochloride | |
| 9913005 | Arachidic acid | |
| 9921004 | Blood group antibody 'N' | |
| 9923001 | Phenylalanine 4-monooxygenase | |
| 9928005 | alpha-Dextrin endo-1,6-alpha-glucosidase | |
| 9930007 | Blood group antigen Hartley | |
| 9955001 | Oil of juniper wood (substance) | |
| 9969001 | alpha-Glutamyl-glutamate dipeptidase | |
| 9974009 | Angiotensin | |
| 9975005 | Arabinan endo-1,5-alpha-L-arabinosidase | |
| 9980001 | Lymphocyte antigen CDw75 | |
| 9981002 | Lactate-malate transhydrogenase | |
| 9985006 | Desarginisated complement enzyme | |
| 9986007 | Tryptophanase | |
| 9992001 | Molybdenum radioisotope | |
| 10016008 | Bithionol | |
| 10020007 | Biperiden hydrochloride | |
| 10031004 | Vulvar secretions | |
| 10034007 | Formyltetrahydrofolate deformylase | |
| 10039002 | ^210m^Bismuth | |
| 10043003 | D-Alanine-alanyl-poly(glycerolphosphate) ligase | |
| 10063005 | Inorganic pyrophosphatase | |
| 10067006 | Phosphatidylethanolamine methyltransferase | |
| 10097003 | Ribose-5-phosphate-ammonia ligase | |
| 10102000 | Plant enzyme | |
| 10105003 | Active C3bBbC3b | |
| 10109009 | Fibrinogen London III | |
| 10126003 | Awn | |
| 10133003 | Cyclizine lactate | |
| 10150001 | Uraninite | |
| 10158008 | Blood group antigen K13 | |
| 10160005 | Formiminotetrahydrofolate cyclodeaminase | |
| 10162002 | 3beta-Hydroxysteroid dehydrogenase | |
| 10168003 | Immunoglobulin kappa light chain gene | |
| 10174003 | Procarbazine hydrochloride | |
| 10189007 | Conglutinin | |
| 10192006 | Prostaglandin PGF2 (substance) | |
| 10202007 | Prostaglandin PGE3 | |
| 10228005 | Blood group antibody Mil | |
| 10229002 | Hemoglobin Kenya | |
| 10240005 | Lethanes | |
| 10247008 | Chrysoidine R stain (substance) | |
| 10249006 | Agar | |
| 10265007 | Blood group antibody Jobbins | |
| 10270000 | Erythromycin estolate | |
| 10282009 | Betahistidine | |
| 10308009 | ^42^Argon | |
| 10313008 | Phenylmercuric nitrate | |
| 10324005 | Demeclocycline hydrochloride | |
| 10329000 | Zinc insulin | |
| 10333007 | Clobenoside | |
| 10336004 | Ribosylnicotinamide kinase | |
| 10342000 | Heparin cofactor II | |
| 10354000 | Somantin | |
| 10357007 | Arsenite compound | |
| 10373001 | beta-1,3-Galactosyl-o-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase | |
| 10377000 | Sodium nitrite | |
| 10393009 | HLA-Dw20 antigen | |
| 10397005 | Protein-lysine 6-oxidase | |
| 10398000 | Blood group antibody iH | |
| 10407003 | Hemoglobin F-Xin-Su | |
| 10419006 | Thorium isotope | |
| 10424009 | Maprotiline hydrochloride | |
| 10430009 | Benzpyrene | |
| 10436003 | Blood group antibody Ad | |
| 10440007 | HLA class II antigen | |
| 10450008 | Glucose-1-phosphate phosphodismutase | |
| 10466005 | Phosphide compound | |
| 10471003 | Fibrinogen Vienna | |
| 10473000 | Complement component C3 | |
| 10488005 | Hemoglobin F-Cobb | |
| 10490006 | Thymidine-triphosphatase | |
| 10500003 | Xanthinol | |
| 10508005 | Tetramine toxin | |
| 10511006 | Monuron | |
| 10534002 | Thyrotropin releasing factor | |
| 10550005 | Dipotassium salt of endothall | |
| 10560001 | Blood group antibody By | |
| 10570004 | Blood group antigen Sf^a^ | |
| 10581001 | Hemoglobin Grange-Blanche | |
| 10595003 | Pseudoephedrine sulfate | |
| 10622000 | Blood group antibody Gilbraith | |
| 10627006 | Gliocladium proteinase | |
| 10641002 | 3-Phosphoshikimate 1-carboxyvinyltransferase | |
| 10644005 | Black phosphorus | |
| 10645006 | ^207m^Lead | |
| 10660009 | Luteoskyrin | |
| 10669005 | Lectin | |
| 10682002 | Fibrinogen Grand Rapids | |
| 10685000 | Type I site-specific deoxyribonuclease | |
| 10691003 | Biliverdin reductase | |
| 10710009 | Anilazine | |
| 10730008 | Azlocillin sodium | |
| 10738001 | ^86^Yttrium | |
| 10740006 | Sudan blue stain (substance) | |
| 10750007 | Neurotoxic mycotoxin | |
| 10751006 | Netilmicin sulfate | |
| 10767000 | Calcium phosphate dibasic | |
| 10781003 | Sodium phosphate P^32^ | |
| 10782005 | Pentagastrin | |
| 10790005 | ^53^Manganese | |
| 10796004 | Glucose-6-phosphate | |
| 10827009 | Milk protein | |
| 10838009 | ADPphosphoglycerate phosphatase | |
| 10843002 | Anterior pituitary hormone | |
| 10862004 | Oncogene protein neu | |
| 10889009 | Blood group antigen Tc^a^ | |
| 10912008 | Blood group antigen Le^a^ | |
| 10914009 | Cyanamide hydratase | |
| 10931002 | Tryptophan 2'-dioxygenase | |
| 10938008 | Sulfurous oxychloride | |
| 10944007 | Taurine | |
| 10949002 | alpha-Mannosidase | |
| 10952005 | Antimony compound | |
| 10955007 | Factor X antibody (substance) | |
| 10976002 | Dinitrobenzene isomer | |
| 10987005 | Platelet-derived growth factor | |
| 11004008 | Blood group antigen Ge3 | |
| 11022006 | Blood group antibody Cr2 (substance) | |
| 11036001 | Alum | |
| 11038000 | Limonene | |
| 11041009 | Blood group antibody Dr^a^ | |
| 11058004 | ^111^Palladium | |
| 11064006 | Blood group antigen Lu^b^ | |
| 11066008 | Sodium ethyl xanthate | |
| 11069001 | Azure C stain (substance) | |
| 11085006 | D-Alanine hydroxymethyltransferase | |
| 11091008 | Blood group antibody Madden | |
| 11111005 | Fructan beta-fructosidase | |
| 11115001 | Thromboxane A>2< | |
| 11121002 | ^135^Iodine | |
| 11123004 | Blood group antigen Simpson | |
| 11136004 | Methoxyflurane | |
| 11137008 | Chymotrypsin | |
| 11151008 | Immunoglobulin D | |
| 11170003 | Vanillin | |
| 11199008 | Phosphatidyl glycerol | |
| 11201005 | Solochrome black 6B stain (substance) | |
| 11202003 | Manganese salt | |
| 11203008 | Methane | |
| 11206000 | Hemoglobin Hikari | |
| 11220007 | Ileal juice | |
| 11222004 | Blood group antigen Ge1 | |
| 11233001 | Public blood group antigen | |
| 11238005 | Caprolactam | |
| 11239002 | Urate-ribonucleotide phosphorylase | |
| 11252007 | Blood group antigen Sa | |
| 11253002 | Boron trioxide | |
| 11257001 | Nitrogen compound | |
| 11259003 | Cassaine | |
| 11264004 | Sulfated fatty alcohol | |
| 11267006 | Interleukin-10 | |
| 11289005 | CMP-N-acetylneuraminate-monosialoganglioside sialyltransferase | |
| 11298008 | Hemoglobin Riyadh | |
| 11307006 | 2-Acetyl amino fluorine | |
| 11311000 | Pus | |
| 11312007 | Malate dehydrogenase (oxaloacetate-decarboxylating) | |
| 11320009 | Sucrose | |
| 11323006 | Methyl mercuric dicyanodiamine (substance) | |
| 11330000 | Platelet antibody HPA-4b | |
| 11331001 | ^56^Cobalt | |
| 11345007 | Tribromsalan | |
| 11353004 | Glomerular basement membrane antibody | |
| 11355006 | Hemoglobin Alabama | |
| 11370007 | Carbarsone | |
| 11392006 | Aminoglycoside N^6'^-acetyltransferase | |
| 11416006 | Cypridina-luciferin 2-monooxygenase | |
| 11420005 | Rhubarb preparation | |
| 11425000 | Glycopeptide alpha-N-acetylgalactosaminidase | |
| 11427008 | 2-Hydroxy-4-carboxymuconate-6-semialdehyde dehydrogenase | |
| 11439000 | Vas deferens secretions | |
| 11447000 | Antibody to hepatitis B core antigen, IgM type | |
| 11453000 | Cerebroventricular fluid | |
| 11462003 | Ostomy appliance adhesive | |
| 11473005 | Trichlormethiazide | |
| 11474004 | Blood group antibody French | |
| 11479009 | Blood group antibody Ok^a^ | |
| 11489008 | Blood group antigen Nickolai | |
| 11490004 | Hemoglobin Bari | |
| 11496005 | Mercuric chloride | |
| 11504003 | Edrophonium chloride | |
| 11525003 | Silver citrate | |
| 11526002 | Aspartame | |
| 11555005 | Boron compound | |
| 11566003 | Blood group antibody Braden | |
| 11576000 | Cyclohexylamine | |
| 11587008 | dTDP4-amino-4,6-dideoxygalactose aminotransferase | |
| 11589006 | Copper acetoarsenite | |
| 11594006 | Blood group antigen hr^s^ | |
| 11600003 | Blood group antibody Terrell | |
| 11605008 | UDPglucose 4-epimerase | |
| 11621003 | Organic metallic compound | |
| 11622005 | Cyclopamine | |
| 11633008 | Flurbiprofen sodium | |
| 11643006 | Phosphoenolpyruvate carboxykinase (ATP) | |
| 11644000 | Piperacillin sodium | |
| 11645004 | Spirit soluble aniline blue stain (substance) | |
| 11652002 | Vasoactive intestinal peptide | |
| 11684009 | Blood group antigen Kennedy | |
| 11699009 | Petroleum | |
| 11702002 | bis-(p-Chlorophenyl) ethanol | |
| 11713004 | Water | |
| 11714005 | Strong silver protein | |
| 11715006 | ^4^Helium | |
| 11725001 | Blood group antigen Gould | |
| 11727009 | Indophenol from naphthol stain (substance) | |
| 11734006 | Bis (5'-guanosyl) tetraphosphatase | |
| 11735007 | T>2<-induced deoxynucleotide kinase | |
| 11741000 | 2-Nitro-1,1-bis (p-chlorophenyl) propane | |
| 11742007 | Samarandin toxin | |
| 11744008 | Blood group antigen Knudsen | |
| 11761006 | Hemoglobin Duarte | |
| 11770009 | Blood group antigen Fy^a^ | |
| 11780008 | Durazol red stain (substance) | |
| 11799004 | Blood group antibody Donaldson | |
| 11825009 | Endomysial antibody | |
| 11831007 | Dichloroethyl ether | |
| 11863001 | Blood group antigen Ls^a^ | |
| 11869002 | 2,4-Diaminophenol hydrochloride | |
| 11873004 | Carbon monoxide dehydrogenase | |
| 11877003 | HLA-DRw10 antigen | |
| 11880002 | Hemoglobin Andrew-Minneapolis | |
| 11886008 | Blood group antibody Mckeever | |
| 11891009 | Breath | |
| 11894001 | Clostridium botulinum toxin | |
| 11907003 | Ethylamine | |
| 11943009 | Hydroxydione | |
| 11965009 | Difluorodibromomethane | |
| 11966005 | Dimethylaniline | |
| 11968006 | Formate dehydrogenase (cytochrome) | |
| 11984007 | 1, Hydroxy cholecalciferol | |
| 11986009 | Penicillin G potassium | |
| 11989002 | Plant azoxy glycoside | |
| 11996000 | Platinum compound | |
| 12001002 | Thionine stain (substance) | |
| 12009000 | Coagulation factor IX Chapel Hill variant (substance) | |
| 12015000 | Magnesium carbonate hydroxide | |
| 12016004 | Creatine kinase isoenzyme, MB fraction | |
| 12018003 | Trichophyton extract skin test | |
| 12030009 | Sudan II stain (substance) | |
| 12034000 | Coagulation factor II Salatka variant | |
| 12079001 | Hemoglobin J-Meerut | |
| 12085008 | 1,3-beta-Glucan synthase | |
| 12086009 | Hemoglobin G-Hsi-Tsou | |
| 12103002 | HLA-B45 antigen | |
| 12112000 | Neon | |
| 12117006 | 5-Methyltetrahydrofolate-homocysteine methyltransferase | |
| 12119009 | Water soluble nigrosine stain (substance) | |
| 12147008 | Serratia marcescans nuclease | |
| 12148003 | Hemoglobin Avicenna | |
| 12160002 | Loganate methyltransferase | |
| 12171001 | Cutting oil | |
| 12177002 | Pseudoephedrine hydrochloride | |
| 12186007 | Radioactive gas | |
| 12190009 | Blood group antibody Lazicki | |
| 12194000 | Leukotriene | |
| 12203005 | Prenyl-pyrophosphatase | |
| 12206002 | Glutamine-fructose-6-phosphate aminotransferase (isomerizing) | |
| 12208001 | Syrosingopine | |
| 12216005 | Hemoglobin F-Malta I | |
| 12218006 | Diltiazem hydrochloride | |
| 12233003 | Diphenylamine | |
| 12235005 | Hemoglobin Zambia | |
| 12290003 | Emetine hydrochloride | |
| 12292006 | Californium | |
| 12315006 | Halazone | |
| 12353001 | AMP deaminase | |
| 12358005 | Citronella oil | |
| 12366001 | Hemoglobin Hope | |
| 12374000 | Hemoglobin Pasadena | |
| 12375004 | Krypton | |
| 12379005 | Blood group antibody Do^b^ | |
| 12391001 | Dextran 70 | |
| 12414006 | Osmium isotope | |
| 12426001 | Methylglutamate dehydrogenase | |
| 12433001 | p-Chlorophenyl-p-chlorobenzyl sulfide | |
| 12438005 | Dilan | |
| 12439002 | Carnosine N-methyltransferase | |
| 12448007 | Whelk poison | |
| 12457001 | Hemoglobin Evanston | |
| 12465003 | Hemoglobin Suan-Dok | |
| 12474001 | Long neurotoxin venom (substance) | |
| 12485004 | Glycerol-1,2-cyclic-phosphate 2-phosphodiesterase | |
| 12487007 | Printing ink | |
| 12490001 | Potassium hypochlorite | |
| 12498008 | Blood group antibody Kn^b^ | |
| 12499000 | Cord blood | |
| 12502001 | Cedar oil | |
| 12503006 | Aluminum | |
| 12509005 | Galactoside 2-L-fucosyltransferase | |
| 12510000 | Eucalyptus oil | |
| 12525000 | Tybamate | |
| 12542006 | Ethyl butyl ketone | |
| 12564002 | HLA class III antigen | |
| 12567009 | Fire retardant | |
| 12568004 | Belladonnine | |
| 12577006 | Blood group antibody Ch^a^ | |
| 12578001 | Erythromycin ethylsuccinate | |
| 12597001 | Tin | |
| 12598006 | Arachidonate 5-lipoxygenase | |
| 12614000 | Serine-tRNA ligase | |
| 12627001 | Macrophage chemotactic factor | |
| 12641005 | Boron tribromide (substance) | |
| 12642003 | Artificial antigen | |
| 12648004 | LFA-1 leukocyte adhesive protein | |
| 12671002 | Clostridium difficile toxin | |
| 12684006 | Glutamate-ammonia ligase | |
| 12685007 | Blood group antigen Wiley | |
| 12689001 | Magnesium radioisotope | |
| 12710003 | Hematoxylin stain (substance) | |
| 12714007 | Cysteine dioxygenase | |
| 12716009 | Aluminum carbonate | |
| 12743004 | Thorium oxide | |
| 12750000 | ^182^Hafnium | |
| 12752008 | Blood group antibody HLA-A7 | |
| 12753003 | Blood group antibody Fr^a^ | |
| 12754009 | L-Lactate dehydrogenase (cytochrome) | |
| 12788003 | Hemoglobin Sunshine Seth | |
| 12790002 | (S)-6-Hydroxynicotine oxidase | |
| 12798009 | Cicutoxin | |
| 12801003 | Iodamide meglumine | |
| 12821002 | Clemizole | |
| 12823004 | Altronate dehydratase | |
| 12860000 | Hemoglobin Shepherds Bush | |
| 12870003 | Coagulation factor IX Durham variant | |
| 12878005 | Thiophene | |
| 12899008 | Blood group antibody Lu^a^ | |
| 12915002 | Nerve growth factor | |
| 12917005 | Steryl-sulfatase | |
| 12930006 | Calcium phosphate dibasic dihydrate | |
| 12934002 | HLA-Cw7 antigen | |
| 12937009 | Glucoside 3-dehydrogenase | |
| 12940009 | ^7^Beryllium | |
| 12950005 | Putrescine methyltransferase | |
| 12970004 | Inositol hexanitrate | |
| 12977001 | Deuterium oxide | |
| 12984009 | Inulin fructotransferase (depolymerizing) | |
| 12995003 | Bagasse | |
| 12998001 | Blood group antibody Mineo | |
| 13005000 | Hemoglobin New York | |
| 13006004 | Oil of cajuput | |
| 13012009 | Nucleoside phosphotransferase | |
| 13016007 | Blood group antigen Li^a^ | |
| 13030002 | Piperocaine | |
| 13032005 | Pentanamidase | |
| 13074000 | Acetoin racemase | |
| 13083005 | Eosinophilic chemotactic factor (substance) | |
| 13105002 | Hepatitis B surface antigen subtype ayr | |
| 13121007 | gamma-Linolenic acid | |
| 13134008 | trans-1,2-Dihydrobenzene-1,2-diol dehydrogenase | |
| 13143004 | Glycosaminoglycan galactosyltransferase | |
| 13150000 | Animal fat | |
| 13185000 | Pyrogallol 1,2-oxygenase | |
| 13188003 | Tobramycin sulfate | |
| 13195007 | Immunoglobulin IgA2, H chain | |
| 13198009 | UDP-N-acetylmuramoylpentapeptide-lysine N^6^-alanyltransferase | |
| 13230006 | Farnesyl-diphosphate farnesyltransferase | |
| 13232003 | Achromobacter proteinase I | |
| 13235001 | Riboflavin (substance) | |
| 13237009 | ^131^Cesium | |
| 13240009 | Hemoglobin Warwickshire | |
| 13241008 | ^106m^Rhodium | |
| 13245004 | Aspartate kinase | |
| 13287002 | Bromoxynil | |
| 13293005 | Galactarate dehydratase | |
| 13294004 | ^242^Americium | |
| 13295003 | Urocanate hydratase | |
| 13304005 | Ribose-phosphate pyrophosphokinase | |
| 13305006 | Perillyl-alcohol dehydrogenase | |
| 13342004 | Diethyl 2-chlorovinyl phosphate | |
| 13373000 | Serine-phosphoethanolamine synthase | |
| 13377004 | Blood group antigen Vw | |
| 13393008 | Antimony trichloride | |
| 13400000 | HLA-Bw65 antigen | |
| 13422007 | ^117^Tellurium | |
| 13435003 | Blood group antibody Cs^a^ | |
| 13477003 | Lysozyme | |
| 13484006 | Blood group antibody NOR | |
| 13489001 | Methoxyethyl mercuriacetate | |
| 13492002 | Blood group antibody Di^b^ | |
| 13494001 | Kynurenine-glyoxylate aminotransferase | |
| 13501003 | Erythritol kinase | |
| 13502005 | Hydroxychloroquine sulfate | |
| 13523004 | Protium | |
| 13524005 | Grease | |
| 13531009 | Butyl alcohol | |
| 13539006 | Blood group antibody Sharp | |
| 13541007 | N-Acetylneuraminate lyase | |
| 13571004 | Blood group antibody Stevenson | |
| 13577000 | Nut | |
| 13579002 | 1-Naththylamine | |
| 13585009 | Cefotetan | |
| 13590007 | Blood group antibody Kosis | |
| 13597005 | Dihydroxy-acid dehydratase | |
| 13598000 | CMP-N-acetylneuraminate-N-acetyllactosaminide alpha-2,3-sialyltransferase | |
| 13602003 | ^209^Thallium | |
| 13618009 | Hemoglobin Twin Peaks | |
| 13625002 | HLA-A24 antigen | |
| 13626001 | Selenium^75^ HCAT | |
| 13634007 | Fructose-6-phosphate phosphoketolase | |
| 13652007 | Silicone | |
| 13659003 | Benzquinamide | |
| 13668001 | Propylene glycol | |
| 13676004 | Creolin | |
| 13696007 | Immunoglobulin lambda light chain gene | |
| 13701000 | Blood group antigen E. Amos | |
| 13708006 | Rectified pine tar oil | |
| 13717006 | Blood group antibody McCall | |
| 13718001 | Immunoglobulin, variable region | |
| 13722006 | Cymarin | |
| 13723001 | Blood group antigen Man | |
| 13727000 | Human immunodeficiency virus receptor (substance) | |
| 13739008 | Gallate decarboxylase | |
| 13744001 | Methyl red stain (substance) | |
| 13772008 | Blood group antibody Middel | |
| 13774009 | Ribosomal RNA | |
| 13780001 | Sphinganine-1-phosphate aldolase | |
| 13781002 | alpha Amino isobutyric acid | |
| 13784005 | Pyruvic acid | |
| 13786007 | Pyrophosphate-fructose-6-phosphate 1-phosphotransferase | |
| 13787003 | Protein secretory trypsin inhibitor | |
| 13788008 | Dinitrobutyl phenol | |
| 13789000 | Coal tar creosote | |
| 13799005 | Plasmanylethanolamine desaturase | |
| 13804000 | Amidinoaspartase | |
| 13818007 | Cork | |
| 13827008 | Boron trifluoride | |
| 13833004 | Daminozide | |
| 13835006 | Bile-salt sulfotransferase | |
| 13841004 | Leukotriene C | |
| 13858009 | alpha>1x< Glycoprotein | |
| 13863008 | Arabinose | |
| 13864002 | Hemoglobin A>2< Roosevelt | |
| 13872000 | Blood group antibody Fuller | |
| 13884003 | Phenyl mercuric acetate | |
| 13887005 | ^190m^Osmium | |
| 13903005 | Pectinesterase (substance) | |
| 13919003 | Indole 2,3-dioxygenase | |
| 13925004 | Deoxyribonucleic acid, double stranded | |
| 13931001 | Osmium tetroxide | |
| 13932008 | Undecaprenyl-phosphate mannosyltransferase | |
| 13952009 | Oil of hops | |
| 13961009 | Hemoglobin Wayne | |
| 13967008 | Methylcholanthrene | |
| 13979008 | Bromic acid | |
| 13999002 | Thetin-homocysteine methyltransferase | |
| 14006006 | Ethylene oxide | |
| 14013006 | Guanadrel sulfate | |
| 14057005 | Ficin | |
| 14060003 | Catechol | |
| 14071002 | ^90^Strontium | |
| 14090005 | Blood group antigen N | |
| 14092002 | Tyramine | |
| 14097008 | Halogen compound | |
| 14101004 | Indoleacetylglucose-inositol acyltransferase | |
| 14104007 | Blood group antigen O'Connor | |
| 14120002 | Rodenticide | |
| 14125007 | Serine | |
| 14132003 | Silicon carbide | |
| 14139007 | Arginine glutamate | |
| 14146003 | Potassium isotope | |
| 14148002 | L-Pipecolate dehydrogenase | |
| 14172007 | Intrinsic factor concentrate preparation | |
| 14190008 | Blood group antibody T | |
| 14193005 | Sulfobromophthalein | |
| 14195003 | Mercury isotope | |
| 14213001 | ^47^Calcium | |
| 14226002 | Blood group antigen Friedberg | |
| 14228001 | Dolichyl-phosphate-mannose-protein mannosyltransferase | |
| 14231000 | Aliphatic unsaturated hydrocarbon | |
| 14263006 | Prepared fish | |
| 14271005 | Blood group antigen Gon | |
| 14279007 | Blood group antibody Epi | |
| 14285000 | Coagulation factor XI variant type III | |
| 14306003 | 1L-myo-Inositol-1-phosphatase | |
| 14312008 | Vitamin L>2< | |
| 14321009 | Captafol | |
| 14330001 | Gold radioisotope | |
| 14334005 | tRNA (uracil-5)-methyltransferase | |
| 14338008 | Peptidoglycan beta-N-acetylmuramidase | |
| 14340003 | Verapamil hydrochloride | |
| 14349002 | Fibrinogen Seattle II | |
| 14360006 | Trinitroaniline | |
| 14376002 | Adenylylsulfatase | |
| 14388000 | Cyanide hydratase | |
| 14396005 | Blood group antibody Ls^a^ | |
| 14399003 | Iodine radioisotope | |
| 14401009 | Indium | |
| 14402002 | Wood | |
| 14409006 | Neocinchophen | |
| 14436008 | Peripheral myelin | |
| 14438009 | Carbenicillin disodium | |
| 14439001 | Pyrazolylalanine synthase | |
| 14443002 | Aminoglycoside -class of antibiotic- | |
| 14444008 | Blood group antibody Todd | |
| 14458005 | Ketohexokinase | |
| 14461006 | Aluminum phosphate | |
| 14464003 | HLA-Cw3 antigen | |
| 14472001 | Dehydroacetic acid | |
| 14503005 | Sucrose 1^F^-fructosyltransferase | |
| 14507006 | Arsthinol | |
| 14517001 | Blood group antibody Jordan | |
| 14529005 | ^153^Gadolinium | |
| 14539004 | Dimethylaniline-N-oxide aldolase | |
| 14543000 | Glycosulfatase | |
| 14544006 | Methyl violet 6B stain (substance) | |
| 14550001 | ^131^Barium | |
| 14558008 | Malate dehydrogenase oxaloacetate-decarboxylating (NADP^+^) | |
| 14564001 | Amylopectin | |
| 14574003 | Blood group antibody Bovet | |
| 14583008 | Oxyuranus scutellotus prothrombin-activating proteinase | |
| 14585001 | Benzquinamide hydrochloride | |
| 14586000 | Phospho-5-dehydro-2-deoxygluconate aldolase | |
| 14602007 | Chlorophyll | |
| 14604008 | Blood group antibody Hg^a^ | |
| 14611007 | Hemoglobin Yoshizuka | |
| 14616002 | Heteroglycan alpha-mannosyltransferase | |
| 14620003 | Blood group antibody B 9724 | |
| 14638000 | Thiobarbiturate | |
| 14645000 | Zinc phenolsulfonate | |
| 14655001 | Histidinol-phosphatase | |
| 14660002 | Actinidin | |
| 14665007 | Blood group antigen Parra | |
| 14668009 | Hemoglobin Tak | |
| 14674009 | Azinphos-methyl | |
| 14691008 | ^90^Yttrium | |
| 14699005 | Dichloronaphthoquinone | |
| 14702003 | Threonine-tRNA ligase | |
| 14708004 | Hemoglobin Noko | |
| 14711003 | Blood group antigen A | |
| 14715007 | Dextran 75 | |
| 14726001 | Antibody to antigen in Lewis blood group system | |
| 14733001 | 2-Enoate reductase | |
| 14743003 | Cinchonine | |
| 14767006 | alpha>1< Anti-trypsin | |
| 14796007 | Amfecloral (substance) | |
| 14802009 | Acetoacetyl-CoA reductase | |
| 14804005 | Creatine | |
| 14805006 | Cucumisin | |
| 14809000 | Dihydroxyacetone | |
| 14813007 | ^177^Tungsten | |
| 14815000 | Phosphorylase | |
| 14819006 | Aspidium | |
| 14827002 | Blood group antigen Di^a^ | |
| 14839005 | Hafnium dust | |
| 14843009 | Adenosine-tetraphosphatase | |
| 14846001 | Glycerol-3-phosphate 1-dehydrogenase (NADP^+^) | |
| 14849008 | HLA-Bw77 antigen | |
| 14860004 | ADPsugar pyrophosphatase | |
| 14863002 | Arsenic radioisotope | |
| 14873000 | Structural gene | |
| 14898004 | Nicotinate phosphoribosyltransferase | |
| 14903000 | Antimony sodium thioglycolate | |
| 14905007 | Promethazine hydrochloride | |
| 14931009 | Glycine-transfer ribonucleic acid ligase (substance) | |
| 14958002 | Naphthol green B stain (substance) | |
| 14971004 | Isoleucine | |
| 14976009 | Succinate-semialdehyde dehydrogenase | |
| 14986005 | Blood group antigen Wilson | |
| 14996001 | Glucose dehydrogenase (acceptor) | |
| 15009009 | Meprylcaine | |
| 15011000 | Blood group antibody Ts | |
| 15017001 | Beeswax | |
| 15021008 | Neoantigen | |
| 15047004 | ^93^Yttrium | |
| 15052009 | Diphenoxylate | |
| 15061009 | Formate dehydrogenase (NADP^+^) | |
| 15072004 | Diethylene glycol monobutyl ether | |
| 15073009 | Antigen excess immune complex | |
| 15085001 | (S)-Usnate reductase | |
| 15092006 | Malonyl-CoA decarboxylase | |
| 15093001 | Glutathione-homocystine transhydrogenase | |
| 15098005 | Alseroxylon | |
| 15116007 | Mycodextranase | |
| 15126000 | Ruthenium isotope | |
| 15129007 | Zinc propionate | |
| 15145009 | N-Acetylglucosamine-6-sulfatase | |
| 15150003 | Thallium salt | |
| 15158005 | Air | |
| 15186002 | Hemoglobin A,b | |
| 15217008 | 6-Aminohexanoate-cyclic-dimer hydrolase | |
| 15234000 | Dihydrouracil dehydrogenase (NAD^+^) | |
| 15245002 | n-Acetyl galactosamine | |
| 15248000 | Fluoropolymer | |
| 15249008 | Ethylidene diacetate | |
| 15254004 | Thiamin kinase | |
| 15272005 | ^197^Thallium | |
| 15275007 | Blood group antibody FR | |
| 15286009 | HLA-Cw2 antigen | |
| 15287000 | trans-Hexaprenyltranstransferase | |
| 15294002 | Hemoglobin Bushwick | |
| 15297009 | ATP citrate (pro-3S)-lyase | |
| 15298004 | 1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase | |
| 15308006 | Dibasic copper sulfate | |
| 15313005 | Blood group antibody Gf | |
| 15322006 | Benzoquinonium | |
| 15327000 | 7beta-Hydroxysteroid dehydrogenase (NADP^+^) | |
| 15331006 | Glycine | |
| 15352003 | Cyproheptadine hydrochloride | |
| 15369001 | Disodium salt of endothall | |
| 15373003 | Creatinine | |
| 15379004 | Aryl-aldehyde dehydrogenase | |
| 15392001 | Blood group antigen Jo^a^ | |
| 15399005 | 2-Methyleneglutarate mutase | |
| 15416001 | Blood group antigen Pruitt | |
| 15424006 | ^243^Californium | |
| 15450005 | ^244m^Americium | |
| 15451009 | Hemoglobin Geelong | |
| 15455000 | Hemoglobin Lepore-Washington-Boston | |
| 15458003 | Boron isotope | |
| 15469000 | Blood group antibody p | |
| 15472007 | Disaccharide | |
| 15495003 | CDPdiacylglycerol-glycerol-3-phosphate 3-phosphatidyltransferase | |
| 15505005 | Preprodynorphin | |
| 15529003 | Rosolic acid sodium salt stain (substance) | |
| 15551006 | Complement component, alternate pathway | |
| 15563001 | Cyclopentanone monooxygenase | |
| 15571002 | Mezlocillin sodium | |
| 15595000 | Amorphous or granular extracellular material | |
| 15612008 | Porphobilinogen synthase | |
| 15620005 | Blood group antigen Yk^a^ | |
| 15623007 | Oil of cumin | |
| 15653000 | Lymphocyte antigen CD76 | |
| 15658009 | Cytidine diphosphate | |
| 15660006 | Bleomycin sulfate | |
| 15666000 | Chlorine isotope | |
| 15668004 | 3,4,5-Trihydroxybenzoic acid | |
| 15683009 | Blood group antigen Robert | |
| 15698006 | Lysergic acid diethylamide | |
| 15730005 | Porphyrin | |
| 15735000 | Solanine | |
| 15752001 | Immunoglobulin M, H chain | |
| 15754000 | Interleukin-7 | |
| 15764009 | Cyclohexanone | |
| 15769004 | Aspartate 1-decarboxylase | |
| 15781000 | Blood group antigen K20 | |
| 15785009 | Phenazopyridine | |
| 15790007 | NAD^+^ synthase (glutamine-hydrolysing) | |
| 15797005 | Blood group antigen A. Owens | |
| 15798000 | Blood group antibody Bp^a^ | |
| 15800007 | Hemoglobin Mobile | |
| 15810003 | Tuaminoheptane | |
| 15817000 | Phosphomevalonate kinase | |
| 15821007 | Brackish water | |
| 15826002 | Dihydrorotenone | |
| 15833002 | 4-Aminobiphenyl | |
| 15835009 | Hemoglobin Moabit | |
| 15879007 | Autograft | |
| 15882002 | n-Butyric acid | |
| 15895007 | Fibrinogen London I | |
| 15896008 | Methyl violet 2B stain (substance) | |
| 15901005 | Fibrinogen Paris III | |
| 15909007 | Blood group antibody Yk^a^ | |
| 15917004 | 4-Methyloxaloacetate esterase | |
| 15928000 | Donovan's solution | |
| 15942008 | Blood group antibody Lanthois | |
| 15943003 | Guanylic acid | |
| 15951000 | 2-Methylcitrate dehydratase | |
| 16011006 | Technetium Tc^99m^ albumin colloid (substance) | |
| 16017005 | Hemoglobin Syracuse | |
| 16019008 | Blood group antibody Fy^x^ (substance) | |
| 16022005 | Abnormal hemoglobin, multiple point mutation | |
| 16024006 | ^204^Thallium | |
| 16025007 | HLA-DQw8 antigen | |
| 16045004 | Catechol 2,3-dioxygenase | |
| 16073002 | Mercurous compound | |
| 16074008 | Immune complex at equivalence | |
| 16082008 | Tritium | |
| 16085005 | 2-Furoyl-CoA dehydrogenase | |
| 16103004 | L-Arabinose dehydrogenase | |
| 16106007 | Sulfameter (substance) | |
| 16122008 | Blood group antibody hr^H^ | |
| 16125005 | Styramate | |
| 16128007 | Anionic detergent | |
| 16130009 | Deoxyribonuclease IV (Phage T>4<-induced) | |
| 16133006 | Blood group antigen Kamiya | |
| 16136003 | Sterol | |
| 16138002 | Blood group antigen M' | |
| 16159009 | Tracheal mucus | |
| 16164008 | 4-Oxoproline reductase | |
| 16165009 | Saccharopine dehydrogenase (NAD^+^,L-glutamate-forming) | |
| 16179001 | Diethanolamine-p-methoxycinnamate | |
| 16202002 | Ribitol-5-phosphate dehydrogenase | |
| 16213004 | Glycine acetyltransferase | |
| 16214005 | Deslanoside | |
| 16229007 | 5-Amino-6-(5-phosphoribosylamino) uracil reductase | |
| 16230002 | Blood group antigen Madden (substance) | |
| 16236008 | Fetoprotein | |
| 16243002 | ^166^Ytterbium | |
| 16257000 | Dopamine hydrochloride | |
| 16265002 | ^172^Hafnium | |
| 16267005 | Carrier protein | |
| 16270009 | Prephenate dehydrogenase | |
| 16272001 | Succinate-semialdehyde dehydrogenase (NAD(P)^+^) | |
| 16274000 | Tantalum radioisotope | |
| 16276003 | Coagulation factor IX Eagle Rock variant | |
| 16285003 | Isoamyl salicylate | |
| 16290000 | ^184^Iridium | |
| 16296006 | Prostaglandin receptor | |
| 16303009 | D-Proline reductase (dithiol) | |
| 16309008 | Carboxy-cis,cis-muconate cyclase | |
| 16313001 | Tea | |
| 16318005 | Dibenzothiepin | |
| 16321007 | Ovex | |
| 16355005 | Tetracycline hydrochloride | |
| 16359004 | Phthalylsulfathiazole | |
| 16368002 | Cadmium fumes | |
| 16369005 | Asbestos | |
| 16392005 | Hexylcaine | |
| 16395007 | Pituitary gonadotropin | |
| 16405003 | Chlorophenol | |
| 16441003 | N-Acetyllactosamine synthase | |
| 16456007 | Hemoglobin P-Galveston | |
| 16458008 | 2-Isopropylmalate synthase | |
| 16462002 | Alpha neoendorphin | |
| 16469006 | Hemoglobin Edmonton | |
| 16472004 | Guanylate kinase | |
| 16477005 | Diagnostic vaccine | |
| 16480006 | Aminoacyl-histidine dipeptidase | |
| 16482003 | Monobutyl biphenyl sodium monosulfonate | |
| 16492006 | Cloxacillin sodium | |
| 16502003 | Molecular oxygen | |
| 16503008 | Glycine formiminotransferase | |
| 16509007 | Hemoglobin Ankara | |
| 16515007 | ^188^Tungsten | |
| 16519001 | Blood group antibody Ny^a^ | |
| 16520007 | Pyridoxine 4-oxidase | |
| 16522004 | Flurandrenolide (substance) | |
| 16526001 | ^173^Tantalum | |
| 16546006 | Palmitoleic acid | |
| 16586003 | ^86^Zirconium | |
| 16605007 | n-Butyl acetate | |
| 16610006 | Cyclohexanone monooxygenase | |
| 16613008 | Prostaglandin PGD2 (substance) | |
| 16624005 | Bromide salt | |
| 16628008 | Somatotropin releasing factor | |
| 16633007 | Methyl mercuric cyanoguanidine | |
| 16641007 | Bonellinin | |
| 16642000 | Glutamate-ethylamine ligase | |
| 16660000 | Cholesterol monooxygenase (side-chain cleaving) | |
| 16670003 | Fibrinopeptide B-beta 1-42 | |
| 16683002 | Progesterone | |
| 16693009 | Cesium compound | |
| 16696001 | Plant pigment | |
| 16705004 | HLA-Bw47 antigen | |
| 16712008 | Saccharopine dehydrogenase (NADP^+^,L-lysine-forming) | |
| 16716006 | Glutamate 5-kinase | |
| 16717002 | Dehydrocorticosterone | |
| 16719004 | Flowers | |
| 16729006 | Phosphogluconate dehydrogenase (decarboxylating) | |
| 16734005 | Blood group antibody S>2< | |
| 16739000 | Ethane | |
| 16744007 | Lactobacillus acidophilus agent (substance) | |
| 16745008 | Xenon isotope | |
| 16748005 | Zolamine | |
| 16752005 | Blood group antigen Pearl | |
| 16774004 | Dry cleaning agent | |
| 16778001 | Octachlorocyclohexenone | |
| 16783009 | alpha-Glucosidase | |
| 16788000 | Naphthalene black 12B stain (substance) | |
| 16803002 | Thyrotropin receptor | |
| 16808006 | Trichloroethylene | |
| 16826009 | Pentamidine isethionate | |
| 16836001 | Azure A stain (substance) | |
| 16840005 | Hemoglobin Hekinan | |
| 16842002 | Acyl-[acyl-carrier-protein]-phospholipid acyltransferase | |
| 16847008 | o-Demethylpuromycin methyltransferase | |
| 16848003 | Hemoglobin Vicksburg | |
| 16850006 | Ribose | |
| 16878007 | Blood group antibody E | |
| 16885006 | Trimellitic acid | |
| 16906006 | Clostridium histolyticum aminopeptidase | |
| 16915004 | Streptozocin | |
| 16923002 | Lupus anticoagulant | |
| 16927001 | Sodium-n-methyl dithiocarbamate | |
| 16943008 | Chrysoidine Y stain (substance) | |
| 16946000 | Triacetin | |
| 16951006 | Antigen in Rh blood group system (substance) | |
| 16968005 | Diethyltoluamide | |
| 16969002 | (R)-2-Hydroxy-fatty-acid dehydrogenase | |
| 16984006 | Phosphocreatine | |
| 16989001 | Polygalacturonate 4-alpha-galacturonosyltransferase | |
| 16995000 | Hemoglobin Osu Christiansborg | |
| 16996004 | Blood group antibody Gd | |
| 17003006 | alpha-1- Acid glycoprotein | |
| 17008002 | Levallorphan | |
| 17023007 | Soluble metallo-endopeptidase | |
| 17032009 | Xylosylprotein 4-beta-galactosyltransferase | |
| 17033004 | Lysine 2,3-aminomutase | |
| 17047000 | Aniline | |
| 17053000 | Pterin deaminase | |
| 17058009 | Argemone oil | |
| 17062003 | Nafoxidine hydrochloride | |
| 17069007 | Chromic phosphate P^32^ | |
| 17072000 | Cathepsin D | |
| 17074004 | Blood group antigen Pelletier | |
| 17108004 | Blood group antibody En^a^TS | |
| 17117004 | Androsterone | |
| 17119001 | Blood group antibody Yh^a^ | |
| 17147002 | Cholic acid | |
| 17152007 | Blood group antibody I^D^ | |
| 17165003 | Blood group antigen 754 | |
| 17171009 | Chlorine monofluoride | |
| 17172002 | Dibromofluorescein stain (substance) | |
| 17174001 | (R)-3-Amino-2-methylpropionate-pyruvate aminotransferase | |
| 17178003 | Dolichyl-phosphate xylosyltransferase | |
| 17199000 | ^195^Iridium | |
| 17212003 | Bismuth subcarbonate | |
| 17223004 | Insulin receptor | |
| 17224005 | ^177^Ytterbium | |
| 17229000 | Acetonitrile | |
| 17240008 | Oil in water agent | |
| 17243005 | Uracil mustard (substance) | |
| 17244004 | Apraclonidine hydrochloride | |
| 17253006 | Hypoderma collagenase | |
| 17255004 | D-threo-Aldose dehydrogenase | |
| 17257007 | Idoxuridine ophthalmic preparation | |
| 17265005 | ^191^Osmium | |
| 17270003 | Amino-acid acetyltransferase | |
| 17334004 | Acetate CoA-transferase | |
| 17356001 | Pralidoxime chloride | |
| 17371002 | Hemoglobin Cordele | |
| 17377003 | Glucan 1,3-beta-glucosidase | |
| 17387004 | Pancreatic fluid | |
| 17400004 | ^202m^Lead | |
| 17430007 | Blood group antigen Hey | |
| 17445000 | Trichloronaphthalene | |
| 17455001 | Lipopolysaccharide galactosyltransferase | |
| 17462005 | Blood group antigen K12 | |
| 17483004 | Trichlorobenzene | |
| 17485006 | Methoxypsoralen solution | |
| 17486007 | Methyl 2-cyanoacrylate (substance) | |
| 17497007 | Pseudomonas cytochrome oxidase | |
| 17503004 | Clocortolone pivalate | |
| 17524009 | Phosphoacetylglucosamine mutase | |
| 17534000 | Chylomicrons | |
| 17546001 | L-Aspartate oxidase | |
| 17574006 | Hemoglobin A>2< Melbourne | |
| 17577004 | Exo-poly-alpha-galacturonosidase | |
| 17595001 | Lymphocyte antigen CD32 | |
| 17597009 | Protein-N-pi-phosphohistidine-sugar phosphotransferase | |
| 17598004 | L-Arabinonate dehydratase | |
| 17603007 | Cob(I)alamin adenosyltransferase | |
| 17614005 | Fibrinogen Buenos Aires I | |
| 17626000 | L-Serine dehydratase | |
| 17627009 | Antibody to hepatitis Be antigen | |
| 17628004 | Indole-3-glycerol-phosphate synthase | |
| 17635007 | ^111m^Palladium | |
| 17637004 | Dimethylhistidine methyltransferase | |
| 17640004 | Blood group antibody Savery | |
| 17643002 | Hafnium compound | |
| 17644008 | Enoyl-[acyl-carrier-protein] reductase (NADH) | |
| 17646005 | ^107m^Silver | |
| 17659002 | Blood group antigen R.M. | |
| 17666001 | Calcium thioglycolate | |
| 17676003 | Lactoylglutathione lyase | |
| 17677007 | Hemoglobin F-Columbus-Ga | |
| 17678002 | Zirconium | |
| 17685003 | Urushiol | |
| 17693003 | Acriflavine stain (substance) | |
| 17694009 | Anthraquinone dye | |
| 17701004 | Brucella protein nucleate | |
| 17707000 | Blood group antibody Ritter | |
| 17708005 | Nitrate reductase | |
| 17728009 | Tellurium dioxide | |
| 17730006 | Mannuronate reductase | |
| 17731005 | Coagulation factor IX London variant | |
| 17733008 | Carnitine palmitoyltransferase | |
| 17740009 | Blood group antigen Epi | |
| 17750005 | Naphthalene | |
| 17761002 | ^120^Antimony | |
| 17764005 | Platinum salt | |
| 17768008 | Oxamate carbamoyltransferase | |
| 17773002 | 8-Hydroxyfuranocoumarin O^8^-methyltransferase | |
| 17777001 | Blastomycin | |
| 17784009 | Petroleum distillate | |
| 17798001 | Coagulation factor II Cardeza variant | |
| 17830000 | Hydroxyethylthiazole kinase (substance) | |
| 17836006 | Aromatic ammonia spirit | |
| 17838007 | Hemoglobin South Florida | |
| 17848009 | Thioperazine | |
| 17853004 | Antibody excess immune complex | |
| 17870007 | Xylidine | |
| 17874003 | Bergamot oil | |
| 17895008 | Hemoglobin A>2< Manzanares | |
| 17898005 | Succinchlorimide | |
| 17900007 | 4-Carboxymuconolactone decarboxylase | |
| 17903009 | Abnormal hemoglobin, gamma-chain variant | |
| 17906001 | ^92^Yttrium | |
| 17908000 | Betamethasone benzoate | |
| 17909008 | Glucuronate-1-phosphate uridylyltransferase | |
| 17910003 | ^75^Bromine | |
| 17913001 | Allantoic fluid | |
| 17916009 | Propylene glycol dinitrate | |
| 17917000 | Activated attapulgite | |
| 17927006 | Hemoglobin Dallas | |
| 17932007 | Fibrinogen Vicenza | |
| 17936005 | Alkyl phenol polyglycol ether | |
| 17942009 | Fibrinogen Houston | |
| 17948008 | Hematopoietic factor | |
| 17965004 | Dihydroxyphenylalanine aminotransferase | |
| 17990002 | Melarsoprol | |
| 17991003 | Fibrinogen Adelaide | |
| 17997004 | L-Xylose dehydrogenase | |
| 18004003 | Cholinesterase | |
| 18015008 | ^128^Antimony | |
| 18017000 | Phenyl glycidyl ether | |
| 18025003 | Binary chemical warfare agent | |
| 18030004 | Blood group antibody Balkin | |
| 18039003 | Alkyl mercuric phosphate | |
| 18082002 | Blood group antigen V | |
| 18093000 | Halogenated hydrocarbon-organic oxygen insecticide | |
| 18094006 | Hemoglobin J-Norfolk | |
| 18124001 | Histamine methyltransferase | |
| 18127008 | Bacterial endotoxin | |
| 18128003 | Keratan sulfate | |
| 18143001 | Fibrinogen Quebec II | |
| 18150002 | Blood group antibody A,B | |
| 18164002 | Gentisate 1,2-dioxygenase | |
| 18180007 | Hemoglobin J-Auckland | |
| 18195009 | HLA-DR9 antigen | |
| 18202008 | beta-Mannosidase | |
| 18211008 | Hydroxymethylglutaryl-CoA reductase | |
| 18220004 | Thyroid hormone | |
| 18230008 | Deoxy adenosine triphosphate | |
| 18247009 | Technetium radioisotope | |
| 18287004 | Plastic polymer | |
| 18288009 | von Willebrand factor | |
| 18290005 | 3-Dehydroquinate synthase | |
| 18298003 | Thromboxane B>2< | |
| 18300003 | Thiodimeton | |
| 18303001 | Amidase | |
| 18321003 | Thiethylperazine maleate | |
| 18324006 | D-Arabinonolactonase | |
| 18328009 | Mannose isomerase | |
| 18344000 | 2,4-Dichlorophenoxyacetic acid | |
| 18350005 | Ribonuclease IV | |
| 18359006 | Blood group antibody Fedor | |
| 18368008 | Chyle | |
| 18380000 | Blood group antibody K^w^ | |
| 18394004 | Collagenase preparation | |
| 18395003 | Hydroxypyruvate decarboxylase | |
| 18397006 | Sulfatide | |
| 18406008 | Hemoglobin Summer Hill | |
| 18414002 | Vitamin D>3< (substance) | |
| 18421002 | 3-Hydroxydecanoyl-[acyl-carrier-protein]-dehydratase | |
| 18426007 | Blood group antibody MZ 443 | |
| 18436004 | Lymphocyte antigen CD58 | |
| 18449009 | Lincomycin hydrochloride | |
| 18454000 | 3-Oxo-5beta-steroid delta^4^-dehydrogenase | |
| 18462008 | Methdilazine | |
| 18468007 | Blood group antibody M^g^ | |
| 18470003 | Genome | |
| 18486005 | Blood group antigen BLe^b^ | |
| 18490007 | NAD(P)^+^ nucleosidase | |
| 18501000 | HLA-B51 antigen | |
| 18509003 | Angiogenesis growth factor | |
| 18532004 | Sassafras oil | |
| 18533009 | Blood group antigen Rh34 | |
| 18535002 | Hypothalamic releasing factor | |
| 18550006 | Thioridazine hydrochloride | |
| 18566008 | Dodecarbonium chloride | |
| 18569001 | Potassium chlorate | |
| 18574009 | Dichloroethylene | |
| 18594000 | Immunoglobulin, GM>16< allotype | |
| 18600008 | Glucurolactone | |
| 18611000 | Blood group antigen Hr | |
| 18616005 | Lithium hydride | |
| 18617001 | Thrombopoietin | |
| 18622001 | Pyridoxal dehydrogenase | |
| 18627007 | Blood group antigen iP>1< | |
| 18633003 | Trimethylamine dehydrogenase | |
| 18659000 | Anti fungal antibody | |
| 18667008 | Hemoglobin Indianapolis | |
| 18681005 | Isopropyl-n-(3-chlorophenyl) carbamate | |
| 18712002 | Phenacemide | |
| 18732001 | Trimethylamine-oxide aldolase | |
| 18737007 | Blood group antigen Duclos | |
| 18743009 | ^228^Actinium | |
| 18754004 | Ytterbium radioisotope | |
| 18759009 | Sodium thioglycolate | |
| 18761000 | Lymphocyte antigen CD69 | |
| 18763002 | Blood group antigen Dropik | |
| 18774006 | Arylamine acetyltransferase | |
| 18786009 | Aspartate carbamoyltransferase | |
| 18800006 | Crotalus atrox metalloproteinase | |
| 18815007 | Diethyl phthalate | |
| 18819001 | Cryoglobulin | |
| 18832006 | Butylphenamide | |
| 18836009 | Bacterial toxin | |
| 18838005 | Pentachloronaphthalene | |
| 18847002 | Tryptamines | |
| 18852007 | Fibrinogen New York IV | |
| 18853002 | Lymphocyte antigen CD2 | |
| 18858006 | Indole | |
| 18916007 | Oxaloacetase | |
| 18924002 | Alkyl dimethyl ethylbenzyl ammonium bromide | |
| 18925001 | Vanadium | |
| 18959002 | Dibenzazepine derivative | |
| 18970009 | Prolactin releasing factor | |
| 18975004 | beta-L-Rhamnosidase | |
| 18989009 | Carbon compound | |
| 18992008 | Triturus species toxin | |
| 19004006 | Dichloro-chloroaniline-triazine | |
| 19007004 | Glycolate dehydrogenase | |
| 19009001 | Lymphocyte antigen CD18 | |
| 19011005 | Blood group antibody N | |
| 19012003 | Fibrinogen Tokyo I | |
| 19013008 | Sulfoacetaldehyde lyase | |
| 19016000 | Copper arsenate | |
| 19022009 | Blood group antigen Jopson | |
| 19023004 | Acetoacetate decarboxylase | |
| 19035000 | Blood group antibody Hall J | |
| 19041007 | Tolazoline hydrochloride | |
| 19046002 | Fibrinogen Pamplona | |
| 19064009 | ^110^Indium (substance) | |
| 19066006 | Dimethylaniline monooxygenase (N-oxide-forming) | |
| 19089003 | Lymphocyte antigen CD16 | |
| 19097005 | w-Amidase | |
| 19113006 | Cellulose 1,4-beta-cellobiosidase | |
| 19114000 | Mafenide acetate | |
| 19126005 | Merbromin | |
| 19136002 | Blood group antibody S1^a^ | |
| 19142003 | Hyaluronate lyase | |
| 19151006 | 3-Hydroxyanthranilate 3,4-dioxygenase | |
| 19152004 | Biotin-[acetyl-CoA-carboxylase] ligase | |
| 19160003 | Xylose | |
| 19163001 | Prohormone | |
| 19173004 | Pyrophosphate-serine phosphotransferase | |
| 19178008 | Blood group antibody U | |
| 19182005 | C>5b67< inhibitor | |
| 19186008 | Krypton isotope | |
| 19205004 | Secretin | |
| 19209005 | Fungicide | |
| 19238008 | Glycolipid | |
| 19277006 | Leukocyte elastase | |
| 19298006 | Calpain | |
| 19299003 | Aminolevulinate aminotransferase | |
| 19323009 | alpha,alpha-Phosphotrehalase | |
| 19331004 | Blood group antigen Rb^a^ | |
| 19395006 | Blood group antigen Pe | |
| 19400007 | Blood group antibody Baumler | |
| 19421007 | Chloroprocaine hydrochloride | |
| 19427006 | ^59^Nickel | |
| 19456006 | Glucosamine-6-phosphate isomerase | |
| 19462001 | Carbon dioxide absorbent | |
| 19495007 | Sodium pertechnetate Tc^99m^ | |
| 19499001 | Carbinoxamine maleate | |
| 19501009 | Hemoglobin Singapore | |
| 19509006 | Bryonidin | |
| 19510001 | Diphenhydramine hydrochloride | |
| 19516007 | ^98^Technetium | |
| 19521005 | Phosphatidylglycerophosphatase | |
| 19524002 | Penthienate | |
| 19530002 | Blood group antibody P>1< | |
| 19543002 | Pantetheine-phosphate adenylyltransferase | |
| 19545009 | ^114m^Indium | |
| 19565002 | Blood group antibody Rios | |
| 19574000 | Immunoglobulin, KM allotype | |
| 19595005 | Phenolphthalein | |
| 19622008 | ^48^Chromium | |
| 19635004 | Rhodium isotope | |
| 19638002 | Formylmethionine deformylase | |
| 19677004 | Lymphocyte antigen CD45 | |
| 19710004 | Plant lectin | |
| 19728002 | Lymphocyte antigen CD17 | |
| 19734009 | 4-Trimethylammoniobutyraldehyde dehydrogenase | |
| 19736006 | ^103^Silver | |
| 19737002 | Renilla-luciferin sulfotransferase | |
| 19747004 | Chlorine radioisotope | |
| 19751002 | Potassium compound | |
| 19755006 | Blood group antibody Shannon | |
| 19759000 | Dipropyl ketone | |
| 19767008 | ^175^Ytterbium | |
| 19775002 | Oil of cubeb | |
| 19783008 | Blood group antibody Groslouis | |
| 19814003 | Endogalactosaminidase | |
| 19823000 | Glucose-1,6-bisphosphate synthase | |
| 19830006 | Blood group antibody | |
| 19839007 | Sorbitol | |
| 19868008 | Lymphocyte antigen CDw78 | |
| 19872007 | Pyocyanin | |
| 19879003 | Di-isobutyl phenoxy ethoxy ethyl dimethyl benzyl ammonium chloride | |
| 19893005 | Potassium dichromate | |
| 19901000 | Pentylenetetrazol (substance) | |
| 19917006 | Hydroperoxy eicosatetraenoic acid | |
| 19918001 | Dihydroergocornine | |
| 19945000 | Blood group antigen M | |
| 19950006 | Brevetoxin | |
| 19964006 | Dinitrophenol | |
| 19967004 | Viomycin | |
| 19971001 | Glucuronate isomerase | |
| 19975005 | Phosphoribosyl-AMP cyclohydrolase | |
| 19978007 | Hexafluorenium | |
| 19985006 | N-Acetyl-gamma-glutamyl-phosphate reductase | |
| 19986007 | Urease | |
| 20009008 | Blood group antigen Rg1 | |
| 20024004 | Demeton | |
| 20028001 | Diborane | |
| 20040001 | Blood group antigen Di^b^ | |
| 20056006 | Dibromosalicylaldehyde | |
| 20057002 | Complement component C6 | |
| 20076000 | Phenylethanolamine N-methyltransferase | |
| 20077009 | Streptomycin-6-phosphatase | |
| 20083007 | Di-isobutyl cresolyl ethoxy ethyl dimethyl benzyl ammonium chloride | |
| 20096008 | Trichlorobenzoic acid | |
| 20120005 | ^230^Thorium | |
| 20125000 | Intracellular fluid | |
| 20138008 | Lethal gene | |
| 20150002 | Hemoglobin J-Luhe | |
| 20160006 | Glucose oxidase | |
| 20170008 | Lung surfactant | |
| 20183009 | Nicotinate-nucleotide-dimethylbenz-imidazole phosphoribosyltransferase | |
| 20211008 | Methylglyoxal synthase | |
| 20214000 | N-Acetylglucosamine-6-phosphate deacetylase | |
| 20217007 | Trimethaphan camsylate | |
| 20221000 | Profilin (substance) | |
| 20228006 | Blood group antigen Ku | |
| 20229003 | Pyrrobutamine | |
| 20230008 | Vital new red stain (substance) | |
| 20231007 | Aminosalicylic sodium | |
| 20238001 | Chlorinated lime | |
| 20265008 | Perchlorate salt | |
| 20296004 | Nitroaniline | |
| 20304007 | Blood group antibody P | |
| 20309002 | Dichloronitroethane | |
| 20327004 | Sodium caprylate | |
| 20337009 | Glycerone-phosphate acyltransferase | |
| 20340009 | Methysergide maleate | |
| 20355000 | Granulocyte antibody (substance) | |
| 20368008 | Diphenadione | |
| 20371000 | Acetylenecarboxylate hydratase (substance) | |
| 20378006 | Methyldimethoxyamphetamine | |
| 20379003 | Neomycin C | |
| 20383003 | Blood group antibody Duclos | |
| 20386006 | Aminoacyl-tRNA hydrolase | |
| 20413008 | Levopropoxyphene | |
| 20450009 | Ciprofloxacin hydrochloride | |
| 20459005 | Abalone viscera poison | |
| 20468007 | Isopropamide | |
| 20478005 | Diaminopimelate decarboxylase | |
| 20493009 | HLA-Dw24 antigen | |
| 20495002 | Fibrinogen Bergamo II | |
| 20507001 | Oil of garlic | |
| 20515003 | Oncogene protein c-ets | |
| 20524007 | Rhamnulokinase | |
| 20527000 | Hemoglobin Willamette | |
| 20532004 | beta-1,3-Galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase | |
| 20539008 | Tyrosine aminotransferase | |
| 20560002 | Cerebroside-sulfatase | |
| 20564006 | Toluene-2-4-diisocyanate | |
| 20569001 | Imidazoleacetate 4-monooxygenase | |
| 20574009 | Prostaglandin-D 15-dehydrogenase (NADP^+^) | |
| 20576006 | Blood group antigen Santano | |
| 20591008 | Blood group antibody Nielsen | |
| 20611000 | Hemoglobin Hotel-Dieu | |
| 20631001 | Convallarin | |
| 20642005 | mRNA guanylyltransferase | |
| 20643000 | 1,2-Dichloropropane | |
| 20645007 | Aspulvinone dimethylallyltransferase | |
| 20651002 | Pyridoxal kinase | |
| 20672004 | Guanine | |
| 20675002 | Inulosucrase | |
| 20685001 | Cholinergic receptor | |
| 20686000 | Fibrinogen Christchurg II | |
| 20732001 | Arthrobacter serine proteinase | |
| 20742004 | Glutaconate CoA-transferase | |
| 20748000 | Blood group antigen VK | |
| 20751007 | Deoxyadenylic acid | |
| 20752000 | Prothrombin antibody | |
| 20761000 | Ketene | |
| 20764008 | Lymphocyte antigen CD57 | |
| 20771003 | Congenital dysfibrinogen | |
| 20777004 | Blood group antibody Margaret | |
| 20792003 | Glucan 1,4-alpha-maltotetraohydrolase | |
| 20807009 | Anti nucleolus antibody | |
| 20821006 | Isopullulanase | |
| 20822004 | rRNA (adenosine-O^2'^)-methyltransferase | |
| 20823009 | Complement | |
| 20832006 | Farnesyl-diphosphate kinase | |
| 20844009 | Oxyprocaine | |
| 20847002 | Streptokinase agent (substance) | |
| 20878003 | Blood group antibody Hut | |
| 20887007 | Triethylenemelamine (substance) | |
| 20898008 | Lymphocyte antigen CD44 | |
| 20907008 | Blood group antibody Cipriano | |
| 20914005 | Adenylate kinase | |
| 20918008 | 3-Mercaptopyruvate sulfurtransferase | |
| 20925001 | Calcium glycerophosphate | |
| 20966001 | ^125^Antimony | |
| 20989009 | Cyanide compound | |
| 20993003 | Oncogene protein P53 | |
| 20994009 | Dinitro-o-amyl phenol | |
| 21004009 | ^199^Thallium | |
| 21023002 | Blood group antigen Rh42 | |
| 21028006 | Fibrinogen Bergamo I | |
| 21064007 | Blood group antibody Rm | |
| 21066009 | Buprenorphine hydrochloride | |
| 21074005 | Fucosylgalactose alpha-N-acetylgalactosaminyltransferase | |
| 21075006 | ^61^Cobalt | |
| 21094001 | Coal tar ointment | |
| 21102006 | Blood group antigen McC^d^ | |
| 21140009 | Mannose-6-phosphate isomerase | |
| 21141008 | ^95^Ruthenium | |
| 21145004 | Blood group antibody Hr>o< | |
| 21149005 | Blood group antibody Pr>1h< | |
| 21158003 | Independent high incidence blood group antibody | |
| 21166007 | Lymphocyte antigen CD21 | |
| 21168008 | Acetosulfone | |
| 21175009 | Methantheline bromide (substance) | |
| 21204003 | Pantetheine kinase | |
| 21209008 | Long-chain-alcohol oxidase | |
| 21231000 | Corticosteroid side-chain-isomerase | |
| 21235009 | Piperoxan | |
| 21239003 | beta-D-fructopyranose | |
| 21246007 | Fibrinogen Detroit | |
| 21256006 | HLA-Dw23 antigen | |
| 21275001 | Plasmalogen synthase | |
| 21289006 | Platelet factor 4 | |
| 21292005 | Mannan endo-1,4-beta-mannosidase | |
| 21302001 | Hemoglobin Denmark Hill | |
| 21303006 | Methoxamine hydrochloride | |
| 21309005 | Estradiol 17beta-dehydrogenase | |
| 21315005 | Blood group antigen St^a^ | |
| 21317002 | Sodium fluoroacetate | |
| 21319004 | Ribulose-phosphate 3-epimerase | |
| 21325000 | beta-Glucosidase | |
| 21373005 | Soap enema | |
| 21378001 | Iodinated I^125^ Rose Bengal | |
| 21380007 | 4-Methoxybenzoate monooxygenase (O-demethylating) | |
| 21383009 | Immunoglobulin, KM>3< allotype | |
| 21394008 | Adiphenine | |
| 21410001 | Protocatechuate decarboxylase | |
| 21416007 | Lead arsenite | |
| 21438009 | Ureidoglycolate dehydrogenase | |
| 21456009 | Glucarate dehydratase | |
| 21458005 | Glucose-6-phosphate isomerase | |
| 21495005 | Glutaryl-CoA dehydrogenase | |
| 21500008 | Dimethoate | |
| 21518006 | Naloxone hydrochloride | |
| 21521008 | HLA-Bw71 antigen | |
| 21533003 | Lyase | |
| 21540002 | Endosulfan | |
| 21541003 | Oncogene protein TCRD | |
| 21556007 | p-Methylaminophenol sulfate | |
| 21559000 | ^69m^Zinc | |
| 21564001 | Thyme oil | |
| 21566004 | Methyldopate hydrochloride | |
| 21568003 | Adrenal cortical hormone | |
| 21572004 | ^123^Iodine | |
| 21576001 | ^13^ Nitrogen | |
| 21585001 | Lysyltransferase | |
| 21592006 | Tartrazine stain (substance) | |
| 21607001 | Agmatine kinase | |
| 21609003 | Gastric vomitus | |
| 21611007 | Boric acid | |
| 21614004 | Phenelzine sulfate | |
| 21621004 | Copying ink | |
| 21625008 | Unsaturated fatty acid | |
| 21627000 | Hemoglobin Beirut | |
| 21632004 | Titanium compound | |
| 21642002 | Blood group antigen G | |
| 21660002 | Taxifolin 8-monooxygenase | |
| 21677002 | Colonic contents | |
| 21680001 | Hemoglobin G-Pest | |
| 21697007 | Rectal mucus | |
| 21706000 | Tetrahydrofolic acid | |
| 21712005 | Polyribonucleotide nucleotidyltransferase | |
| 21713000 | Thermomycolin | |
| 21716008 | 1-Chloro-3-bromopropene-1 | |
| 21728000 | Hemoglobin G-Ferrara | |
| 21729008 | Immunoglobulin, GM>15< allotype | |
| 21733001 | Prolyl endopeptidase | |
| 21736009 | Amine dehydrogenase | |
| 21743003 | N-Acetylglucosamine kinase | |
| 21750004 | Metmyoglobin | |
| 21760008 | Radiogold colloid | |
| 21774001 | Complement component, precursor (substance) | |
| 21790001 | Operon gene | |
| 21802009 | Blood group antibody HEMPAS | |
| 21803004 | Alkyl aryl ammonium chloride | |
| 21822008 | Hemoglobin A>2<^1^ (B>2<) | |
| 21847005 | Oil | |
| 21873000 | Blood group antibody Griffith | |
| 21876008 | Blood group antigen NOR | |
| 21880003 | Aurothioglucose | |
| 21888005 | Nickel carbonyl | |
| 21891005 | Digestive enzyme (substance) | |
| 21899007 | Thiocarbarsone | |
| 21903000 | Bismuth violet | |
| 21907004 | Hemoglobin Pitie-Salpetriere | |
| 21919007 | Opium | |
| 21920001 | Blood group antigen Lu14 | |
| 21936004 | Plutonium radioisotope | |
| 21951008 | Alizarin cyanine green stain (substance) | |
| 21961001 | Oil of spruce | |
| 21966006 | Aldose 1-epimerase | |
| 21977000 | ^121m^Tellurium | |
| 21988006 | Bacterial genome | |
| 21990007 | Phospholipase A venom | |
| 21999008 | 3-Hydroxy-3-isohexenylglutaryl-CoA lyase | |
| 22005007 | Ethyl chloride | |
| 22008009 | Fenchlorphos (substance) | |
| 22018004 | Tropine dehydrogenase | |
| 22021002 | Methyl green stain (substance) | |
| 22023004 | Blood group antigen Le^x^ | |
| 22038003 | Selenium | |
| 22065005 | Paraquat | |
| 22078005 | Pterins | |
| 22086005 | Sodium antimonyl gluconate | |
| 22088006 | 3-Hydroxyanthranilate oxidase | |
| 22092004 | Endopolyphosphatase | |
| 22100000 | Hemoglobin Zürich | |
| 22105005 | Sucrose-1,6-a-glucan 3(6)-alpha-glucosyltransferase | |
| 22110009 | Carnosine synthase | |
| 22129003 | ^123m^Tellurium | |
| 22141005 | Limonin-D-ring-lactonase | |
| 22147009 | Cyclohexylamine oxidase | |
| 22158000 | Sinapine esterase | |
| 22160003 | ^87^Yttrium | |
| 22165008 | Dipyrone (substance) | |
| 22175006 | Hemoglobin Natal | |
| 22179000 | Lysophospholipase | |
| 22183000 | ^119^Tellurium | |
| 22185007 | G protein | |
| 22192002 | Salicylamide | |
| 22196004 | NADPH dehydrogenase (flavin) | |
| 22219004 | Hemoglobin Riverdale-Bronx | |
| 22224001 | Chorismate synthase (substance) | |
| 22236007 | Acetarsone (substance) | |
| 22242006 | Glutaraldehyde | |
| 22244007 | Low density lipoprotein | |
| 22250002 | Fibrinogen Birmingham | |
| 22269007 | Blood group antibody Sa | |
| 22284003 | Glucosyl-DNA beta-glucosyltransferase | |
| 22290004 | Hepatitis B surface antigen (substance) | |
| 22308004 | ^116^Tellurium | |
| 22322004 | Steroid receptor | |
| 22332006 | Blood group antibody McC^e^ | |
| 22340000 | Sodium ricinoleate | |
| 22348007 | HLA-DR5 antigen | |
| 22360008 | Dimethoxane | |
| 22362000 | Calcium phosphate dibasic anhydrous | |
| 22377008 | Alkaline phosphatase isoenzyme, intestinal fraction | |
| 22392009 | Diffusely mineralized extracellular matrix | |
| 22403009 | 5-Oxopent-3-ene-1,2,5-tricarboxylate decarboxylase | |
| 22422000 | Maltose phosphorylase | |
| 22424004 | Ochratoxins | |
| 22453003 | Cathepsin G | |
| 22463006 | Hemoglobin G-San Jose | |
| 22479007 | ^71^Arsenic | |
| 22492005 | Hemoglobin Alamo | |
| 22496008 | Fibrinogen Cleveland I | |
| 22503007 | HLA-Bw50 antigen | |
| 22518008 | Hydrogen telluride | |
| 22538009 | Lead arsenate | |
| 22551004 | Dichlorophenyl dimethyl urea (substance) | |
| 22553001 | Mascara | |
| 22555008 | Sorbose | |
| 22559002 | Glycoasparagine | |
| 22568000 | Blood group antigen Hr>o< | |
| 22579005 | Heparan-alpha-glucosaminide acetyltransferase | |
| 22584004 | Hemoglobin Sydney | |
| 22604005 | Uridine triphosphate | |
| 22606007 | Vitamin K>2< | |
| 22627002 | Blood group antibody Barrett | |
| 22635004 | Factor V antibody | |
| 22643009 | Hemoglobin Belfast | |
| 22654004 | Propantheline bromide | |
| 22691005 | Urea carboxylase (hydrolysing) | |
| 22703005 | Brucine | |
| 22712007 | K-Carrageenase | |
| 22723006 | GABA-benzodiazepine receptor | |
| 22726003 | Cyclohexene | |
| 22727007 | Serum amyloid protein | |
| 22732008 | Pseudomonas aeruginosa alkaline proteinase | |
| 22746008 | Perbromate salt | |
| 22749001 | Victoria blue B stain (substance) | |
| 22769006 | Penthienate bromide | |
| 22771006 | Cellobiose dehydrogenase (quinone) | |
| 22779008 | Coagulation factor II Habana variant | |
| 22790003 | Physostigmine sulfate | |
| 22792006 | Tripelennamine citrate | |
| 22796009 | Hemoglobin D-Iran | |
| 22804007 | Hemoglobin D-Granada | |
| 22827004 | Prochlorperazine maleate | |
| 22836000 | Vegetable | |
| 22839007 | Blood group antibody Au^a^ | |
| 22840009 | Tetraethyl pyrophosphate | |
| 22842001 | Indene | |
| 22864005 | Phosphorylase phosphatase | |
| 22865006 | Anthophyllite | |
| 22880000 | 3-Hydroxypalmitoyl-[acyl-carrier-protein]-dehydratase | |
| 22882008 | Coagulation factor II Molise variant | |
| 22893005 | Inert matter | |
| 22904008 | Hemoglobin K-Ibadan | |
| 22907001 | Heavy metal | |
| 22908006 | Phorbol-diester hydrolase | |
| 22917006 | Hemoglobin D-Los Angeles | |
| 22931006 | Evans blue stain (substance) | |
| 22939008 | Blood group antibody Messenger | |
| 22941009 | 11-Deoxycortisol | |
| 22944001 | ^246^Plutonium | |
| 22947008 | Testosterone 17beta-dehydrogenase | |
| 22951005 | Screening smoke | |
| 22967004 | Drug receptor | |
| 22968009 | Sunset yellow FCF stain (substance) | |
| 22971001 | Blood group antibody I (substance) | |
| 22976006 | Aluminum acetate | |
| 22979004 | Oleic acid I^125^ | |
| 22987003 | Phosphopantothenoylcysteine decarboxylase | |
| 23003008 | Ribosylpyrimidine nucleosidase | |
| 23005001 | Glucose dehydrogenase (NAD) | |
| 23016008 | HLA-DPw1 antigen | |
| 23038005 | Myosin | |
| 23050004 | Small intestinal juice | |
| 23052007 | Hemoglobin O-Padova | |
| 23053002 | Iophenoxic acid (substance) | |
| 23064004 | Blood group antigen Jn^a^ | |
| 23068001 | Caffeine citrate | |
| 23077008 | Barbituric acid | |
| 23095006 | Thevetin | |
| 23101007 | Blood group antigen Dr^a^ | |
| 23103005 | Blood group antigen Niemetz | |
| 23113002 | Glutamine-tRNA ligase | |
| 23126003 | Hemoglobin G-Georgia | |
| 23134009 | Organic sulfide compound | |
| 23164001 | Sp40/40 | |
| 23165000 | Blood group antigen Terrano | |
| 23169006 | Poly (glycerol-phosphate) alpha-glucosyltransferase | |
| 23172004 | Bismuth | |
| 23176001 | Bacampicillin hydrochloride | |
| 23182003 | Cereal | |
| 23200004 | Blood group antigen Fy3 | |
| 23208006 | N-butyl acetanilide | |
| 23216002 | Suppressor gene | |
| 23217006 | Arsenic compound | |
| 23219009 | Hemoglobin Legnano | |
| 23240005 | Homologous restriction factor | |
| 23243007 | Oligonucleotide | |
| 23254002 | Squalene | |
| 23295004 | Coagulation factor I | |
| 23303000 | Silver isotope | |
| 23307004 | Estrogen receptor | |
| 23308009 | Taurine aminotransferase | |
| 23314002 | Blood group antibody Schwend | |
| 23317009 | Saxitoxin | |
| 23318004 | Anti neutrophilic cytoplasm antibody | |
| 23324005 | trans-Pentaprenyltranstransferase | |
| 23349009 | Phosphatidyl ethanolamine | |
| 23367002 | Monofluoroacetate salt | |
| 23369004 | Immune complex | |
| 23375008 | Colistin sulfate | |
| 23378005 | Male genital fluid | |
| 23380004 | Blood group antigen Kp^a^ | |
| 23385009 | Blood group antibody ALe^b^ | |
| 23396001 | Blood group antibody Green | |
| 23408008 | ^236^Plutonium | |
| 23423003 | Sodium hydroxide | |
| 23433006 | Vitamin D>2< | |
| 23434000 | Blood group antigen Or | |
| 23459009 | Selenium radioisotope | |
| 23465009 | 2-Dehydro-3-deoxygalactonokinase | |
| 23475007 | ^73m^Germanium | |
| 23504007 | 2-Deoxy-D-gluconate dehydrogenase | |
| 23519008 | ^180m^Tantalum | |
| 23555000 | Dethiobiotin synthase | |
| 23563004 | Very late antigen receptor | |
| 23564005 | Dyclonine | |
| 23570004 | ^219^Radon | |
| 23571000 | ^115^Cadmium | |
| 23573002 | Acetylcholinesterase | |
| 23590008 | Sialoprotein | |
| 23599009 | Allosteric site | |
| 23601006 | Mesityl oxide | |
| 23603009 | Blood group antigen Ge4 | |
| 23647003 | Hemoglobin Kawachi | |
| 23677009 | 4-Hydroxyglutamate aminotransferase | |
| 23689006 | Platelet antigen HPA-3a | |
| 23692005 | Tribasic calcium phosphate | |
| 23696008 | Catechol oxidase | |
| 23701001 | Trichlorocarbanilide | |
| 23711008 | Alkyl quaternary ammonium chloride | |
| 23733005 | Hemoglobin I-Toulouse | |
| 23734004 | D-Ornithine 4,5-aminomutase | |
| 23736002 | Na^+^/K^+^-transporting ATPase | |
| 23760003 | Blood group antibody Wb | |
| 23774005 | HLA-Dw9 antigen | |
| 23775006 | Blood group antibody Tar | |
| 23783000 | Harmaline | |
| 23788009 | ^97^Ruthenium | |
| 23814005 | Guanethidine monosulfate | |
| 23816007 | Tetrahydrocortisol (substance) | |
| 23832005 | Lavender oil | |
| 23841000 | Acid phosphatase isoenzyme, tartrate-sensitive fraction | |
| 23845009 | Phenylalanine acetyltransferase | |
| 23847001 | UDPglucose dehydrogenase | |
| 23861006 | Phenolsulfonphthalein | |
| 23862004 | Fibrinogen Bethesda III | |
| 23866001 | Fluoroacetic acid | |
| 23878002 | Blood group antibody Whittle | |
| 23883005 | Methadone hydrochloride | |
| 23893003 | Blood group antigen La Fave | |
| 23904000 | Xanthopterin | |
| 23921009 | Zirconium silicate | |
| 23923007 | 3-Hydroxy-2-methylpyridinecarboxylate dioxygenase | |
| 23929006 | Hemoglobin Tacoma | |
| 23942006 | Hemoglobin Titusville | |
| 23956008 | 2,2-Dialkylglycine decarboxylase (pyruvate) | |
| 23959001 | Thyroglobulin | |
| 23964002 | Pumiliotoxin A | |
| 23969007 | Tryparsamide | |
| 23974004 | Hemoglobin J-Abidjan | |
| 23989008 | Indanol dehydrogenase | |
| 24002009 | Blood group antigen Kn^b^ | |
| 24004005 | Hemoglobin St. Mande | |
| 24008008 | Blood group antibody Laine | |
| 24012002 | Sugar-phosphatase | |
| 24022008 | Bupivacaine hydrochloride | |
| 24023003 | Properdin native | |
| 24032001 | Arginine aminopeptidase | |
| 24037007 | Dihydrocoumarin hydrolase | |
| 24041006 | Immunoglobulin, GM>1< allotype | |
| 24049008 | Uronate dehydrogenase | |
| 24070002 | Phosphorylcholine | |
| 24099007 | Oxygen | |
| 24102007 | Chlorothalonil | |
| 24143007 | Platelet antibody HPA-2a | |
| 24156000 | Organic boron compound | |
| 24161003 | ^171^Hafnium | |
| 24167004 | Fast green FCF stain (substance) | |
| 24185006 | Histidine ammonia-lyase | |
| 24186007 | Abnormal pigment | |
| 24189000 | ^189^Platinum | |
| 24202000 | Ranitidine hydrochloride | |
| 24207006 | Blood group antigen Tri W | |
| 24213002 | Lead carbonate | |
| 24215009 | Picric acid | |
| 24237002 | Prostaglandin PGF1 (substance) | |
| 24243000 | Mercurous iodide | |
| 24248009 | Complete antibody | |
| 24254005 | Cerolipoid | |
| 24261009 | Trimethobenzamide hydrochloride | |
| 24276001 | ^132^Tellurium | |
| 24282003 | Hydroxymethylpyrimidine kinase | |
| 24301009 | ^198^Gold | |
| 24304001 | Blood group antibody K11 | |
| 24307008 | Retinyl-palmitate esterase | |
| 24331003 | ^181^Hafnium | |
| 24336008 | Aminophylline anhydrous | |
| 24352006 | Chondroitin ABC lyase | |
| 24357000 | Colony-stimulating factor, macrophage | |
| 24371008 | Mercuric arsenate | |
| 24375004 | Hemoglobin Ottawa | |
| 24391001 | Platelet antigen HPA-4a | |
| 24404002 | Blood group antigen A,B | |
| 24411003 | Sodium metaborate | |
| 24427005 | Metanephrine (substance) | |
| 24434007 | Sodium tartrate | |
| 24435008 | Fibrinogen Versailles | |
| 24479006 | Blood group antibody Kollogo | |
| 24487007 | High incidence antigen | |
| 24492009 | Immunoglobulin, GM>7< allotype | |
| 24503006 | Blood group antibody Vr | |
| 24511001 | Technetium Tc^99m^ succimer | |
| 24515005 | Spice | |
| 24516006 | Meldola blue stain (substance) | |
| 24517002 | Rhamnulose-1-phosphate aldolase | |
| 24521009 | Plastic monomer | |
| 24537003 | Laccase | |
| 24539000 | ^115m^Indium | |
| 24540003 | Blood group antibody En^a^KT | |
| 24544007 | L-erythro-3,5-Diaminohexanoate dehydrogenase | |
| 24545008 | 2-Hydroxyglutarate synthase | |
| 24556008 | N-butyl glycidyl ether | |
| 24570008 | Cathartic | |
| 24574004 | Blood group antigen Fy^b^ | |
| 24583009 | Terbutaline sulfate | |
| 24589008 | Rhodium radioisotope | |
| 24605005 | Mica | |
| 24615004 | Tryptophan aminotransferase | |
| 24634004 | Histone acetyltransferase | |
| 24648004 | Metabolite AND/OR marker of neoplasm | |
| 24650007 | Dihydro-alpha-ergocryptine | |
| 24655002 | Lymphocyte antigen CD4 | |
| 24660003 | Adenosylmethionine cyclotransferase | |
| 24665008 | Cocillana | |
| 24671002 | alpha,alpha-Trehalose-phosphate synthase UDP-forming | |
| 24673004 | HLA-Dw11 antigen | |
| 24675006 | Glial fibrillary acidic protein | |
| 24686008 | Acaricide | |
| 24701006 | Aliphatic saturated hydrocarbon | |
| 24710003 | Blood group antibody Pr^a^ | |
| 24721007 | Chlorothymol | |
| 24732007 | Maleylacetate reductase | |
| 24733002 | ^104^Silver | |
| 24751001 | Oxymorphone | |
| 24756006 | Dimetan | |
| 24769005 | Hydroxypyruvate reductase | |
| 24772003 | Sodium citrate and citric acid | |
| 24778004 | ^101m^Rhodium | |
| 24791003 | Citramalate lyase | |
| 24809001 | Spectinomycin hydrochloride | |
| 24821002 | Blood group antibody Tx | |
| 24823004 | Pipobroman | |
| 24824005 | 3-(Imidazol-5-yl)lactate dehydrogenase | |
| 24837008 | Dinitro-o-cresol | |
| 24838003 | Undecylenic acid and zinc undecylenate | |
| 24839006 | Polynucleotide 3'-phosphatase | |
| 24851008 | Deoxyribonucleic acid | |
| 24853006 | ^223^Radium | |
| 24857007 | Complement fixing antibody | |
| 24860000 | Blood group antibody Don E. W. | |
| 24862008 | Ureidosuccinase | |
| 24869004 | Nifurtimox | |
| 24873001 | Intramitochondrial cell metabolite | |
| 24877000 | Alkyl aryl ammonium bromide | |
| 24898000 | Independent low incidence blood group antibody | |
| 24900003 | Procion brilliant blue MRS stain (substance) | |
| 24903001 | Deoxyribonucleoside | |
| 24908005 | Organic sulfonic acid | |
| 24922005 | Hemoglobin Garden State | |
| 24926008 | Blood group antigen LW^ab^ | |
| 24938004 | Zirconium isotope | |
| 24939007 | Normetanephrine (substance) | |
| 24945004 | Acetylpyruvate hydrolase | |
| 24953007 | Arabinogalactan endo-1,3-beta galactosidase | |
| 24972007 | ^240^Plutonium | |
| 24978006 | Blood group antigen Bert | |
| 24995003 | Blood group antigen Bg^c^ | |
| 25001008 | Lead radioisotope | |
| 25002001 | Perazine | |
| 25013003 | Pyrantel pamoate | |
| 25027008 | Glycoprotein hormone | |
| 25059001 | Methyl oxydemeton | |
| 25071007 | Vaccenic acid | |
| 25077006 | Transketolase | |
| 25079009 | Lissamine fast yellow stain (substance) | |
| 25089008 | Enolase | |
| 25090004 | Nitramine | |
| 25091000 | Solochrome cyanine R stain (substance) | |
| 25095009 | Blood group antigen Ol^a^ | |
| 25108004 | Glutathione synthase | |
| 25111003 | L-Rhamnose dehydrogenase | |
| 25115007 | Hemoglobin Richmond | |
| 25128000 | ^72^Zinc | |
| 25130003 | Methylal | |
| 25141001 | Tubocurarine chloride | |
| 25153002 | Cysteine-tRNA ligase | |
| 25172002 | p-Nitroaniline | |
| 25175000 | UDPgalacturonate decarboxylase | |
| 25176004 | Mumps skin test antigen | |
| 25183006 | Manganese chloride | |
| 25195006 | Endothall | |
| 25204006 | Aluminum soluble salt | |
| 25205007 | Fluorine radioisotope | |
| 25213008 | Bicyclic antidepressant | |
| 25217009 | Pituitary follicle stimulating hormone | |
| 25222009 | Geranylgeranyl-diphosphate geranylgeranyltransferase | |
| 25234001 | Shikimate dehydrogenase | |
| 25249009 | N-Acetylneuraminate O^7^-acetyltransferase | |
| 25254000 | Procainamide hydrochloride | |
| 25282007 | Human leukocyte antigen Bw55 (substance) | |
| 25292004 | Hemoglobin Strumica | |
| 25293009 | Fluorine perchlorate | |
| 25305005 | Long-acting insulin | |
| 25307002 | Petrolatum | |
| 25315004 | HLA-Aw34 antigen | |
| 25329003 | Hemoglobin Ty Gard | |
| 25339009 | Inulinase | |
| 25351006 | Fluorescein sodium stain (substance) | |
| 25356001 | myo-Inositol 2-dehydrogenase | |
| 25386008 | Alanine-glyoxylate aminotransferase | |
| 25390005 | Acid phosphatase | |
| 25399006 | Glycerol dehydrogenase (NADP^+^) | |
| 25400004 | Blood group antibody Yt^b^ | |
| 25401000 | Barbiturate analog | |
| 25403002 | ^106^Rhodium | |
| 25414004 | Hemoglobin Handa | |
| 25426009 | Blood group antigen Bridgewater | |
| 25438000 | Hemoglobin Seattle | |
| 25453008 | Antibody to antigen in Kidd blood group system | |
| 25454002 | D-Pinitol dehydrogenase | |
| 25486007 | Sodium thiosalicylate | |
| 25494000 | Glucuronic acid | |
| 25500001 | ^40^Potassium | |
| 25513007 | Blood group antigen Stewart | |
| 25525005 | Protein C | |
| 25531008 | Protoberberine | |
| 25538002 | Thiothixene hydrochloride (substance) | |
| 25557006 | Blood group antigen Langer | |
| 25571003 | Chlordantoin (substance) | |
| 25574006 | 1-Aminocyclopropane-1-carboxylate deaminase (substance) | |
| 25589002 | Phenylpyruvate decarboxylase | |
| 25597009 | Hemoglobin Shimonoseki | |
| 25607008 | D-dimer | |
| 25608003 | Hemoglobin Ann Arbor | |
| 25620006 | Bitter orange oil | |
| 25644008 | Protein kinase | |
| 25650003 | Tryptophan-tRNA ligase | |
| 25670009 | Fetal fluids | |
| 25701004 | Disodium 3,6-endoxohexahydrophthalate | |
| 25705008 | Cadmium dust | |
| 25709002 | ^170^Hafnium | |
| 25710007 | ^113^Tin | |
| 25717005 | Myeloid-macrophage antibody | |
| 25719008 | MCPA amine | |
| 25722005 | War gas | |
| 25743006 | Skim milk | |
| 25745004 | Dehydrogluconate dehydrogenase | |
| 25747007 | ^135m^Xenon | |
| 25752002 | ^78^Germanium | |
| 25761002 | Glutamine | |
| 25770004 | Octyl alcohol | |
| 25773002 | Blood group antigen Elder | |
| 25780000 | Soap | |
| 25793005 | Poly(A)-specific ribonuclease | |
| 25796002 | Aluminum aspirin | |
| 25818006 | Colloid sulfur | |
| 25826003 | Platelet antibody HPA-5a | |
| 25833003 | Blood group antigen Lu^a^ | |
| 25838007 | 2,3-Dihydro-2,3-dihydroxybenzoate dehydrogenase | |
| 25843000 | Lead ethyl gasoline (substance) | |
| 25867008 | Blood group antigen Haven | |
| 25886000 | Fibrinogen Bergamo III | |
| 25911004 | Prostaglandin PGH2 (substance) | |
| 25926002 | 3-Oxolaurate decarboxylase | |
| 25931000 | Nitrosamine | |
| 25941002 | Orange II stain (substance) | |
| 25946007 | Dichlorophenyl methyl butyl urea | |
| 25958007 | Cobalt compound | |
| 25964000 | Blood group antigen Wk^a^ | |
| 25977009 | Bulan | |
| 25978004 | 3',5'-Cyclic-GMP phosphodiesterase | |
| 25981009 | Barrier grease | |
| 25992005 | Propyl acetate | |
| 26005009 | Blood group antigen Tajama | |
| 26012000 | Cholecystokinin receptor | |
| 26021004 | Blood group antibody Sd^a^ | |
| 26024007 | Pituitary hormone receptor | |
| 26066008 | Blood group antigen U | |
| 26069001 | Homoserine succinyltransferase | |
| 26070000 | Halogenated hydrocarbon-organic sulfur insecticide | |
| 26091008 | Aspartate aminotransferase | |
| 26093006 | Platelet antigen HPA-4b | |
| 26095004 | Gallium radioisotope | |
| 26101003 | Glucan endo-1,3-beta-glucosidase | |
| 26104006 | Maleic acid (substance) | |
| 26109001 | Piperazine citrate | |
| 26120001 | Desipramine hydrochloride | |
| 26131009 | Lead tetramethyl | |
| 26134001 | L-Lysine 6-aminotransferase | |
| 26148001 | Aryl-alcohol dehydrogenase (NADP^+^) | |
| 26159005 | Clostridium tetani toxin | |
| 26160000 | Isomerase | |
| 26161001 | dATP(dGTP)-DNA purinetransferase | |
| 26181000 | CDPdiacylglycerol-inositol 3-phosphatidyltransferase | |
| 26191006 | Bromodiphenhydramine hydrochloride (substance) | |
| 26192004 | Hemoglobin Maputo | |
| 26194003 | Tungsten | |
| 26227005 | Mineral dust | |
| 26233001 | Thioredoxin reductase (NADPH) | |
| 26238005 | Nitrite reductase (NAD(P)H) | |
| 26240000 | Oil of chamomile, Roman | |
| 26258006 | Sarcosine dehydrogenase | |
| 26261007 | Deoxyribonucleic acid (cytosine-5)-methyltransferase (substance) | |
| 26266002 | Arginine deiminase | |
| 26271009 | Glucosaminylgalactosylglucosylceramide beta-galactosyltransferase | |
| 26274001 | Hydroxyeicosatetraenoic acid | |
| 26277008 | Dynorphin | |
| 26282001 | ^231^Thorium | |
| 26288002 | Mitotane | |
| 26304004 | Alliin lyase | |
| 26312007 | Phosphatidylcholine | |
| 26327007 | Red phosphorus | |
| 26346008 | Ethambutol hydrochloride | |
| 26351002 | Prostaglandin | |
| 26353004 | Boron radioisotope | |
| 26355006 | Blood group antibody Cameron | |
| 26371006 | Chlorophacinone | |
| 26379008 | Dimethisoquin (substance) | |
| 26387009 | Threonine synthase | |
| 26405004 | Hemoglobin Brisbane | |
| 26414009 | Hemoglobin Knossos | |
| 26426004 | Ciguatoxin | |
| 26430001 | Taurocyamine kinase | |
| 26434005 | Indium radioisotope | |
| 26437003 | Oil of mustard | |
| 26441004 | Blood group antigen Bg^a^ | |
| 26469007 | Prepro-opiomelanocortin | |
| 26470008 | Hemoglobin Gun Hill | |
| 26473005 | Sucrose-phosphatase | |
| 26490004 | Glucose-6-phosphate 1-epimerase | |
| 26497001 | Viral genome | |
| 26518005 | Coagulation factor XIa | |
| 26521007 | Glycolipid 3-alpha-mannosyltransferase | |
| 26524004 | Catechol oxidase (dimerizing) | |
| 26539003 | N-Acetyllactosaminide alpha-1,3-galactosyltransferase | |
| 26557002 | Pentachloroethane | |
| 26567007 | Hemoglobin Port de France | |
| 26569005 | Gonadotropin receptor | |
| 26575001 | Myrcia oil | |
| 26591003 | Kininogen | |
| 26598009 | 8-Amino-7-oxononanoate synthase | |
| 26645004 | Homocystine | |
| 26647007 | Blood group antibody Coates | |
| 26651009 | Blood group antigen Rd | |
| 26656004 | Aromatic castor oil | |
| 26663004 | Cigar smoking tobacco | |
| 26674008 | Heptachlorocyclopentadiene | |
| 26709006 | Immunoglobulin monomer | |
| 26712009 | Mannan 1,2-(1,3)-alpha-mannosidase | |
| 26720006 | Blood group antibody McC^c^ | |
| 26721005 | Cellular proto-oncogene MYC | |
| 26740004 | Eosinophilic derived inhibitor | |
| 26749003 | Blood group antibody Kaj | |
| 26753001 | Aryl-alcohol dehydrogenase | |
| 26756009 | ^87^Zirconium | |
| 26766001 | Starch glycerite | |
| 26775004 | Dioxin | |
| 26798007 | Hemoglobin P-Nilotic | |
| 26817007 | Methylated naphthalene | |
| 26821000 | Apolipoprotein B | |
| 26822007 | 2-Naphthylamine | |
| 26841005 | DDT-dehydrochlorinase | |
| 26855002 | Blood group antigen K14 | |
| 26856001 | Small intestine contents | |
| 26858000 | Spermine | |
| 26859008 | Cervical mucus | |
| 26898003 | Immunoglobulin IgA1 | |
| 26926006 | Alkyl toluyl methyl trimethyl ammonium chloride | |
| 26930009 | Quercetin 2,3-dioxygenase | |
| 26937007 | Blood group antigen Hil | |
| 26945002 | Phendimetrazine tartrate | |
| 26952000 | Formyl-CoA hydrolase | |
| 26956002 | Glutamate-1-semialdehyde 2,1-aminomutase | |
| 26959009 | Phosphoribosylformylglycinamidine cyclo-ligase (substance) | |
| 26961000 | Benzyl chloride | |
| 26967001 | Sulfate salt | |
| 26979001 | Phenylalanine racemase (ATP-hydrolysing) | |
| 26992003 | Chlorisondamine | |
| 27013004 | Hemoglobin McKees Rocks | |
| 27014005 | Diacylglycerol acyltransferase | |
| 27016007 | Alizarin yellow GG stain (substance) | |
| 27024002 | Blood group antigen By | |
| 27044008 | Blood group antibody Becker | |
| 27045009 | UDP-N-acetylglucosamine 4-epimerase | |
| 27047001 | Blood group antigen Schwend | |
| 27048006 | Blood group antigen Can | |
| 27054007 | ^57^Cobalt | |
| 27076003 | Blood group antibody Rich | |
| 27079005 | Meclocycline sulfosalicylate | |
| 27081007 | ^127^Xenon | |
| 27082000 | Sulfapyridine | |
| 27089009 | Blood group antibody Ce | |
| 27109008 | ^126^Barium | |
| 27119002 | Trimellitic anhydride | |
| 27120008 | Malachite green stain (substance) | |
| 27122000 | ^56^Nickel | |
| 27127006 | Thymidylate 5'-phosphatase | |
| 27130004 | Lymphocyte antigen CD11b | |
| 27138006 | Saccharin | |
| 27177009 | Steam | |
| 27184001 | 17-Hydroxypregnenolone | |
| 27188003 | Cephalosporin-C deacetylase | |
| 27192005 | Aminosalicylic acid | |
| 27200003 | Hemoglobin Doha | |
| 27205008 | Blood group antigen IAB | |
| 27244000 | Lithium isotope | |
| 27247007 | Dioxane | |
| 27248002 | Coagulation factor X R.E.D. variant | |
| 27273002 | Complement component C1s | |
| 27316004 | ^49^Vanadium | |
| 27319006 | Hemoglobin Pierre-Benite | |
| 27332001 | NMN nucleosidase | |
| 27340007 | Blood group antigen HLA-A10 | |
| 27341006 | Pokeweed mitogen | |
| 27345002 | Hemin | |
| 27347005 | Lymphocyte antigen CD4 receptor (substance) | |
| 27349008 | ^135m^Barium | |
| 27361000 | Barium salt | |
| 27363002 | 2-Dehydro-3-deoxy-D-gluconate 6-dehydrogenase | |
| 27370002 | Sulfinoalanine decarboxylase | |
| 27378009 | Tyrosine | |
| 27380003 | Nucleic acid | |
| 27384007 | Blood group antigen LKE | |
| 27390006 | Hydrogen sulfide | |
| 27412001 | D-Glutamate cyclase | |
| 27417007 | Blood group antigen Geslin | |
| 27425009 | Platelet antigen HPA-2a | |
| 27430008 | Chlorobenzene | |
| 27432000 | Guanosine phosphorylase | |
| 27440006 | Convalescent phase reactant | |
| 27453009 | Blood group antigen John Smith | |
| 27459008 | Blood group antigen Co^b^ | |
| 27470001 | Butoxypolypropylene glycol | |
| 27487004 | Blood group antigen Talbert | |
| 27488009 | 1-Phosphatidylinositol kinase | |
| 27489001 | Blood group antigen Don | |
| 27499006 | Oxyphencyclimine | |
| 27512003 | Hemoglobin J-Paris-I | |
| 27562008 | Superoxide dismutase | |
| 27565005 | D-Xylose dehydrogenase (NADP^+^) | |
| 27569004 | Hemoglobin Hirosaki | |
| 27586005 | Undecoylium chloride iodine | |
| 27594003 | Ferric pyrophosphate | |
| 27595002 | Hemoglobin Heathrow | |
| 27602003 | Dichloromonofluoromethane | |
| 27607009 | Blood group antigen Ts | |
| 27610002 | NADPH dehydrogenase | |
| 27626001 | Blood group antibody S | |
| 27631004 | Oligonucleotidase | |
| 27647002 | L-Lysine-lactamase | |
| 27656005 | Gitalin (substance) | |
| 27671009 | Rhodamine B stain (substance) | |
| 27674001 | Fungal structural gene | |
| 27675000 | Hemoglobin Chesapeake | |
| 27730007 | Merodicein | |
| 27736001 | Bacitracin A | |
| 27747008 | NAD(P)^+^ transhydrogenase | |
| 27758004 | delta^24^-Sterol methyltransferase | |
| 27763000 | Hydrochloric acid | |
| 27766008 | Prothipendyl | |
| 27800009 | Blood group antibody BLe^d^ | |
| 27822002 | Phenylpropylmethylamine | |
| 27831002 | Snake venom | |
| 27840003 | Methemoglobin | |
| 27844007 | Benzo fast scarlet stain (substance) | |
| 27847000 | Ceroid | |
| 27850002 | Calycanthine | |
| 27862003 | Blocking antibody | |
| 27888000 | Ribonucleic acid | |
| 27894008 | Amino sugar | |
| 27897001 | Jejunal juice | |
| 27899003 | Blood group antibody Ol^a^ | |
| 27914008 | Hemoglobin Hasharon | |
| 27928002 | Flurazepam hydrochloride | |
| 27931001 | Dipeptidyl peptidase I | |
| 27961009 | Homoaconitate hydratase | |
| 27963007 | Blood group antibody Toms | |
| 27980006 | Ferri-hemoglobin | |
| 27989007 | Coagulation factor II Segovia variant | |
| 27995008 | Hemoglobin Dhofar | |
| 27999002 | Blood group antigen Hands | |
| 28015009 | D-Glutamate (D-aspartate) oxidase | |
| 28021008 | Ethyl acrylate | |
| 28025004 | L-Rhamnose isomerase | |
| 28027007 | Uranium radioisotope | |
| 28029005 | Metescufylline | |
| 28069006 | Refrigerant anesthetic | |
| 28095008 | Hemoglobin Complutense | |
| 28112009 | Meconium stool | |
| 28113004 | Actinolite | |
| 28117003 | Carvone | |
| 28118008 | tRNA-queuosine beta-mannosyltransferase | |
| 28121005 | Iophendylate (substance) | |
| 28142007 | (S,S)-Butanediol dehydrogenase | |
| 28145009 | Blood group antibody Cr3 (substance) | |
| 28162004 | Vinyl bromide (substance) | |
| 28176003 | Dipeptidyl peptidase III | |
| 28203004 | 3-Oxoacyl-[acyl-carrier-protein] reductase | |
| 28223003 | Cycloguanil | |
| 28227002 | Halogen | |
| 28230009 | Poultry | |
| 28243009 | ^226^Radium | |
| 28251007 | Phosphatidylcholine desaturase | |
| 28252000 | Glycine N-choloyltransferase | |
| 28262007 | Blood group antibody Robert | |
| 28268006 | Pregnanediol | |
| 28298004 | Pan-leukocyte antibody | |
| 28344001 | Mephenytoin | |
| 28356000 | Sulfite dehydrogenase | |
| 28361003 | Blood group antibody Mathison | |
| 28406009 | Immunoglobulin IgG1 (substance) | |
| 28408005 | Blood group antigen LW^b^ | |
| 28421003 | Sorbic acid | |
| 28424006 | Lymphocyte antigen CD62 | |
| 28427004 | HLA-DQw9 antigen | |
| 28430006 | Methylsterol monooxygenase | |
| 28444000 | Hemoglobin J-Iran | |
| 28451009 | 4-Hydroxymandelate oxidase | |
| 28464005 | Dioxyline | |
| 28469000 | Intracisternal material, periodic | |
| 28495003 | Blood group antibody El | |
| 28511008 | Biotin-[methylcrotonoyl-CoA-carboxylase] ligase | |
| 28521000 | Coagulation factor II Denver variant | |
| 28525009 | ^193m^Iridium | |
| 28530008 | beta-Galactosidase | |
| 28538001 | Hemoglobin Dagestan | |
| 28539009 | Auxin | |
| 28546000 | Aminopeptidase A | |
| 28549007 | Phosphoketolase | |
| 28564007 | Blood group antibody Reiter | |
| 28577003 | Blood group antibody Chr^a^ | |
| 28580002 | Diprenorphine | |
| 28585007 | Platelet-specific antigen | |
| 28588009 | Cephaloridine (substance) | |
| 28589001 | cis-1,2-Dihydro-1,2-dihydroxynaphthalene dehydrogenase | |
| 28598003 | Fructose-bisphosphate aldolase | |
| 28622002 | Alizarin yellow R stain (substance) | |
| 28632009 | Focally mineralized extracellular matrix | |
| 28647000 | Meat | |
| 28648005 | Oncogene protein TAL 1 | |
| 28649002 | Secondary-alcohol oxidase | |
| 28662003 | Hydralazine hydrochloride | |
| 28666000 | Bentazon | |
| 28673005 | Antiribosomal antibody | |
| 28675003 | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | |
| 28679009 | Lymphocyte antigen CD28 | |
| 28702005 | Ambutonium | |
| 28708009 | Blood group antigen Bovet | |
| 28716000 | Lymphocyte antigen CDw65 | |
| 28721002 | ^99^Rhodium | |
| 28731009 | Blood group antibody Morrison | |
| 28747006 | Kinetins | |
| 28752001 | Pectate lyase | |
| 28767002 | Oligogalacturonide lyase | |
| 28779002 | Blood group antibody Savior | |
| 28785009 | Arginyltransferase | |
| 28787001 | Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase | |
| 28793009 | Right bronchial mucus | |
| 28808000 | Blood group antigen Stevenson | |
| 28819002 | Blood group antibody K12 | |
| 28823005 | Terpineol | |
| 28824004 | ^214^Lead | |
| 28825003 | Sterigmatocystin | |
| 28829009 | Coal tar naphtha | |
| 28832007 | Phenylalanine-tRNA ligase | |
| 28848008 | Hemoglobin O-Arab | |
| 28881009 | Blood group antibody B 9208 | |
| 28917004 | Hydroxy-mercurichlorophenol | |
| 28927005 | Diphenylheptane derivative | |
| 28935008 | Transfer RNA | |
| 28942008 | Coconut oil | |
| 28954008 | Guanylate cyclase | |
| 28957001 | Polypeptide N-acetylgalactosaminyltransferase | |
| 28963005 | Abnormal hemoglobin, deleted residue | |
| 28973007 | Methyl phenol | |
| 28983006 | 6-Ketoprostaglandin PGF>1< | |
| 28999000 | Fusarin | |
| 29004007 | Huratoxin | |
| 29011006 | Manganese trioxide | |
| 29043006 | Cadmium isotope | |
| 29053007 | Chlorodiethylacetamide | |
| 29091007 | Hemoglobin F-La Grande | |
| 29102009 | Methyl chlorophenoxyacetic acid | |
| 29107003 | Platinum radioisotope | |
| 29109000 | Formamide | |
| 29128007 | Karathane | |
| 29135004 | Flax fiber | |
| 29154004 | 3-(p-Chlorophenyl)-1, 1-dimethyl urea | |
| 29157006 | Thiazolsulfone (substance) | |
| 29170002 | Antimony isotope | |
| 29181004 | Haloacetate dehalogenase | |
| 29183001 | Fluorine compound | |
| 29184007 | Diphemanil methylsulfate (substance) | |
| 29190006 | Fentanyl citrate | |
| 29204001 | Alkyl trimethyl ammonium bromide | |
| 29218008 | Indium^111^ pentetate | |
| 29229007 | Hemoglobin Rothschild | |
| 29234006 | Arylamine sulfotransferase | |
| 29244008 | Blood group antibody Lu4 | |
| 29246005 | Immunoglobulin G (substance) | |
| 29247001 | D-Aspartate oxidase | |
| 29252006 | Acridine orange stain (substance) | |
| 29253001 | Nicotinamide phosphoribosyltransferase | |
| 29262004 | UTP-hexose-1-phosphate uridylyltransferase | |
| 29263009 | Coffee | |
| 29266001 | Blood group antigen Sadler | |
| 29275004 | Blood group antibody Tollefsen-Oyen | |
| 29276003 | Chlorine | |
| 29279005 | Glycerophosphocholine phosphodiesterase | |
| 29282000 | 17alpha-Hydroxyprogesterone aldolase | |
| 29285003 | Agarase | |
| 29301006 | Isoproterenol hydrochloride (substance) | |
| 29308000 | tert-Pentyl alcohol | |
| 29327006 | Chloramphenicol palmitate | |
| 29332007 | Acylmuramoyl-alanine carboxypeptidase | |
| 29336005 | Hippuric acid | |
| 29342009 | Kenacid blue R stain (substance) | |
| 29348008 | Pentetate calcium trisodium Yb^169^ | |
| 29349000 | Hydroxy-mercurinitrophenol | |
| 29360009 | Varnish | |
| 29363006 | Diethanolamine | |
| 29377009 | 3-Hydroxyisobutyryl CoA hydrolase | |
| 29382002 | ^5^Helium | |
| 29393000 | Extracellular secretion material following exocytosis, interstitial, endocrine | |
| 29398009 | Oncogene protein TCRB | |
| 29403005 | Aryl sulfotransferase | |
| 29406002 | alpha-Amylase preparation | |
| 29412007 | Dihydrobunolol dehydrogenase | |
| 29414008 | 1D-1-Guanidino-3-amino-1,3-dideoxy-scyllo-inositol aminotransferase | |
| 29436006 | Hemoglobin A>2< Indonesia | |
| 29455006 | Algicide (substance) | |
| 29460005 | Copper^67^ ceruloplasmin | |
| 29461009 | Crotin | |
| 29467008 | Tannase | |
| 29468003 | Blood group antigen ELO | |
| 29496009 | Polyolefin | |
| 29497000 | alpha-N-Acetylglucosaminidase | |
| 29502003 | Blood group antigen IBH | |
| 29516008 | Venerupin shellfish toxin | |
| 29520007 | Protoanemonin | |
| 29522004 | Toluidine blue stain (substance) | |
| 29527005 | Benztropine mesylate (substance) | |
| 29531004 | Nickel radioisotope | |
| 29552007 | Hydroxymethylglutaryl-CoA reductase (NADPH) | |
| 29554008 | Glycine amidinotransferase | |
| 29573007 | Blood group antigen Wade | |
| 29579006 | Choline kinase | |
| 29584000 | Diagnostic antigen | |
| 29588002 | Brompheniramine maleate | |
| 29607004 | tRNA-uridine aminocarboxypropyltransferase | |
| 29614002 | Glyceryl-p-aminobenzoate | |
| 29622009 | Octyl salicylate | |
| 29649009 | Rhodium compound | |
| 29652001 | Blood group antibody Noble | |
| 29661001 | Immunoglobulin A secretory | |
| 29666006 | Nortriptyline hydrochloride | |
| 29671004 | Lithium bromide | |
| 29676009 | 16-alpha-Hydroxysteroid dehydrogenase (substance) | |
| 29677000 | Hemoglobin Pyrgos | |
| 29678005 | ^136^Cesium | |
| 29698000 | Photinus-luciferin 4-monooxygenase (ATP-hydrolysing) | |
| 29705004 | Dimethylaminobenzene | |
| 29706003 | ^102m^Rhodium | |
| 29719004 | Blood group antibody Dav | |
| 29725000 | Heparin calcium | |
| 29735006 | Lymphocyte antigen CD33 | |
| 29750002 | Bacterial exotoxin | |
| 29754006 | ADPribose pyrophosphatase | |
| 29763008 | Deoxy guanosine diphosphate | |
| 29765001 | Fumagillin | |
| 29776002 | Complement component C7 | |
| 29783009 | Chromocarb | |
| 29784003 | Hexachloroethane | |
| 29791000 | ^196^Gold | |
| 29794008 | Diisobutyl ketone | |
| 29797001 | Pyroglobulin | |
| 29805009 | Potassium perchlorate | |
| 29817006 | Indican | |
| 29831006 | Blood group antigen Taylor | |
| 29842002 | Nicotine dehydrogenase | |
| 29876006 | ^129m^Xenon | |
| 29890009 | Blue-green algae product | |
| 29900000 | Pantoate dehydrogenase | |
| 29910009 | GTP cyclohydrolase II | |
| 29917007 | Phosphorous acid | |
| 29919005 | ^100^Palladium | |
| 29925009 | Antimony radioisotope | |
| 29945001 | Liquid oxygen | |
| 29953009 | Hemoglobin Bourmeds | |
| 29973004 | ^235^Plutonium | |
| 29974005 | (R,R)-Butanediol dehydrogenase | |
| 29985007 | Immunoglobulin, L chain, lambda | |
| 29986008 | Immunoglobulin A>1< proteinase | |
| 29988009 | Blood group antibody McC^f^ | |
| 29991009 | Methyl malonyl-CoA epimerase | |
| 29992002 | Cob(II)alamin reductase (substance) | |
| 29998003 | ^31^Silicon | |
| 30022007 | Citrulline (substance) | |
| 30030008 | Interleukin-9 | |
| 30034004 | Dimethoxanate | |
| 30040006 | Chloro-o-phenyl phenol | |
| 30053009 | Brefeldin | |
| 30056001 | Aromatic-amino-acid-glyoxylate aminotransferase | |
| 30065008 | Adenosine deaminase | |
| 30094001 | Riboflavin dinucleotide | |
| 30095000 | Cassaidine | |
| 30096004 | Ricin | |
| 30103001 | Butylamine | |
| 30109002 | Phosphogluconate dehydrogenase | |
| 30137009 | Blood group antigen CE | |
| 30145004 | Activin hormone | |
| 30158003 | Deoxyribose-phosphate aldolase | |
| 30159006 | Hemeprotein | |
| 30178006 | Vitamin D | |
| 30179003 | Carbonyl fluoride | |
| 30192000 | Oncogene protein V-FMS | |
| 30203009 | Paromomycin sulfate | |
| 30205002 | Thymic T lymphocyte factor | |
| 30209008 | Blood group antibody Gladding | |
| 30236005 | Tilorone | |
| 30245006 | Blood group antibody Kelly | |
| 30286004 | Acylglycerol palmitoyltransferase | |
| 30302001 | Hydroxylamine sulfate | |
| 30324001 | ^132^Iodine | |
| 30325000 | Chlorfenvinphos | |
| 30326004 | Atrial natriuretic factor (substance) | |
| 30329006 | Triflupromazine | |
| 30333004 | Mercaptomerin sodium | |
| 30357004 | Blood group antibody Santano | |
| 30363008 | Aldehyde dehydrogenase [NADP+] (substance) | |
| 30364002 | Non-mineralized extracellular matrix | |
| 30375003 | Clinically relevant isoenzyme | |
| 30395009 | UDP-N-acetylglucosamine dehydrogenase | |
| 30403007 | Glycine acyltransferase | |
| 30411002 | 6-Phosphogluconolactonase | |
| 30413004 | Blood group antigen Cad | |
| 30424002 | Proparacaine hydrochloride | |
| 30443002 | H^+^/K^+^-transporting ATPase | |
| 30485003 | Methylamine glutamate methyltransferase | |
| 30487006 | Formaldehyde dehydrogenase | |
| 30498007 | Blood group antigen Emm | |
| 30499004 | ^83m^Krypton | |
| 30511000 | Gold salt | |
| 30525004 | Leucyltransferase | |
| 30531001 | Calcium oxalate | |
| 30540002 | Blood group antibody Simpson | |
| 30551002 | Thioglycolate salt | |
| 30559000 | Glycerol 2-dehydrogenase (NADP^+^) | |
| 30563007 | Hemoglobin Lepore-Hollandia | |
| 30589007 | Dibutyl phosphate | |
| 30594007 | Lymphocyte antigen CD5 | |
| 30603002 | Tyrosine 3-monooxygenase | |
| 30604008 | Platelet antigen HPA-2b | |
| 30607001 | Blood group antigen Lu3 | |
| 30609003 | Blood group antibody Terrano | |
| 30616002 | Malonate CoA-transferase | |
| 30621004 | Autoantibody | |
| 30656000 | Glyoxylate oxidase | |
| 30658004 | Turacoporphyrin | |
| 30676006 | Metharbital (substance) | |
| 30690009 | Porphobilinogen deaminase | |
| 30702003 | Blood group antibody D^w^ | |
| 30703008 | Metaphosphoric acid | |
| 30708004 | alpha-Galactosidase | |
| 30723009 | Blood group antigen Payer | |
| 30734007 | Proline dehydrogenase | |
| 30745005 | Loxapine succinate | |
| 30749004 | Nitrous acid | |
| 30774001 | Mitogen receptor | |
| 30787007 | ^194^Iridium | |
| 30792009 | Hemoglobin Prato | |
| 30797003 | Blood group antigen Tc^c^ | |
| 30804005 | Coagulation factor VII (substance) | |
| 30805006 | Gluconate dehydratase | |
| 30820000 | Phosphorus | |
| 30825005 | Colloidal Indium^111^ | |
| 30827002 | Azapetine | |
| 30841006 | CDP-4-dehydro-6-deoxyglucose reductase | |
| 30848000 | Fibrinogen Oslo III | |
| 30853005 | ^97^Zirconium | |
| 30861000 | Steroid 11-beta-monooxygenase | |
| 30863002 | Desiccated whole bile | |
| 30906008 | Transcobalamin II | |
| 30907004 | Hemoglobin Tokoname | |
| 30932002 | Phylloquinone monooxygenase (2,3-epoxidizing) | |
| 30939006 | ^137m^Barium | |
| 30954000 | Blood group antigen Charles | |
| 30960000 | 1,1,1,2-Tetrachloro-2,2- difluoroethane | |
| 30965005 | Interleukin-6 | |
| 30986005 | 2-Ethoxyethanol | |
| 30987001 | Blood group antibody Rh35 | |
| 30990007 | Abnormal fibrinogen | |
| 31001006 | Lymphocyte antigen CD68 | |
| 31008000 | Blood group antibody Talbert | |
| 31011004 | 4-hydroxycoumarin | |
| 31024004 | Blood group antigen Good | |
| 31034008 | Isoleucine-tRNA ligase | |
| 31036005 | Blood group antigen Mansfield | |
| 31039003 | Cysteamine dioxygenase | |
| 31042009 | Plant structural gene | |
| 31046007 | Cation | |
| 31052008 | Pectin lyase | |
| 31055005 | Gastrointestinal hormone | |
| 31086004 | Gasoline | |
| 31088003 | Chlorophyllase | |
| 31109005 | Acylglycerone-phosphate reductase | |
| 31111001 | Apoatropine | |
| 31119004 | Hypoglycin A | |
| 31121009 | gamma Aminoisobutyric acid | |
| 31147000 | Metoclopramide hydrochloride | |
| 31178001 | Bethanechol chloride | |
| 31182004 | Diethylene glycol monoethyl ether | |
| 31192007 | Ferrous chloride Fe^59^ | |
| 31202008 | Pseudomonas serine proteinase | |
| 31212001 | Calcium compound | |
| 31245001 | Blood group antibody Oca | |
| 31252004 | Hemoglobin Nunobiki | |
| 31260003 | Methylene violet stain (Bernthsen) (substance) | |
| 31278008 | 1,4-alpha-Glucan 6alpha-glucosyltransferase | |
| 31299006 | Hemoglobin A | |
| 31310007 | Ganglioside | |
| 31317005 | Blood group antigen C^w^ | |
| 31324006 | Colloidal oatmeal powder with oil | |
| 31328009 | L-Threonate dehydrogenase | |
| 31347007 | Glycyrrhiza | |
| 31349005 | Aspergillus oryzae aspartic proteinase | |
| 31357008 | Blood group antibody Sc3 | |
| 31369000 | Purine nucleosidase | |
| 31370004 | Dopamine-beta-monooxygenase | |
| 31381001 | Vesicating gas | |
| 31395003 | 3,4-Dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione 4,5-dioxygenase | |
| 31400002 | HLA-Bw63 antigen | |
| 31405007 | Glutamate dehydrogenase [NAD(P)+] (substance) | |
| 31409001 | Valine-3-methyl-2-oxovalerate aminotransferase | |
| 31414002 | Amide | |
| 31422009 | Ox bile extract | |
| 31433007 | Cortisol acetyltransferase | |
| 31444004 | Plant product insecticide | |
| 31480004 | Chlorpyrifos | |
| 31503002 | Steroid 21-monooxygenase | |
| 31522006 | Mild silver protein | |
| 31527000 | Sodium chloride Na^24^ | |
| 31528005 | Nitrite salt | |
| 31538000 | CoA-glutathione reductase (NADPH) | |
| 31539008 | Magnesium compound | |
| 31540005 | Extracellular fiber | |
| 31543007 | 6-Acetylglucose deacetylase | |
| 31555001 | ^234^Plutonium | |
| 31559007 | Ribonuclease P | |
| 31576006 | N-Sulfoglucosamine sulfohydrolase | |
| 31579004 | Oil of champaca | |
| 31603005 | ^190^Iridium | |
| 31617001 | Hydrophilic petrolatum | |
| 31618006 | Difenamide | |
| 31622001 | ^127m^Xenon | |
| 31662002 | Orange flower oil | |
| 31675002 | Capillary blood | |
| 31706007 | Ketamine hydrochloride | |
| 31707003 | Zinc bacitracin | |
| 31714001 | New fuchsin stain (substance) | |
| 31720000 | Diacylglycerol kinase | |
| 31731008 | Magnesium phosphate | |
| 31744003 | Orotate phosphoribosyltransferase | |
| 31756002 | Methionine racemase | |
| 31773000 | Gastric juice | |
| 31775007 | Hemoglobin F-Melbourne | |
| 31780003 | Preproenkephalin | |
| 31787000 | Coagulation factor IX Alabama variant (substance) | |
| 31790006 | Malic acid | |
| 31799007 | Mephentermine sulfate | |
| 31801005 | Benzonatate | |
| 31811003 | Carbon dioxide | |
| 31815007 | Oxybutynin chloride | |
| 31818009 | Deoxyribonuclease (pyrimidine dimer) | |
| 31827005 | Ristocetin | |
| 31849004 | Succinate-citramalate CoA-transferase | |
| 31854008 | Blood group antibody Terschurr | |
| 31856005 | Dimethyl-1,1-dibromo-2-2-dichloroethyl phosphate | |
| 31857001 | (2-Aminoethyl) phosphonate-pyruvate aminotransferase | |
| 31862000 | Galactonolactone dehydrogenase | |
| 31876004 | 6-Methylsalicylate decarboxylase | |
| 31880009 | ^6^Helium | |
| 31895006 | Gonadotropin | |
| 31896007 | Barium radioisotope | |
| 31897003 | Blood group antigen Hop (substance) | |
| 31936008 | Sodium isotope | |
| 31947001 | Carbon isotope | |
| 31953001 | Strontium nitrate Sr^87^ | |
| 31960007 | Anti SS-B antibody | |
| 31963009 | beta-Butoxy beta-thiocyano-diethyl ether | |
| 31979005 | Fatty acid | |
| 31990000 | Fibrinogen Cleveland II | |
| 32027009 | Hemoglobin A>2< Flatbush | |
| 32030002 | Diphenidol hydrochloride (substance) | |
| 32039001 | Glass | |
| 32040004 | Putrescine acetyltransferase | |
| 32049003 | Rhodium dust | |
| 32050003 | Pine oil | |
| 32059002 | ^225^Actinium | |
| 32068000 | Serine-glyoxylate aminotransferase | |
| 32072001 | Dalapon | |
| 32073006 | HLA-Bw60 antigen | |
| 32079005 | Blood group antigen Ramskin | |
| 32083005 | Oxanamide | |
| 32089009 | Blood group antibody VS | |
| 32100007 | Haptoglobin 2-1 | |
| 32103009 | Thyroid hormone receptor | |
| 32120008 | Camphorated oil | |
| 32131000 | Carboxymethylhydantoinase | |
| 32133002 | Microarazide nitrate (substance) | |
| 32138006 | Bile pigment | |
| 32147003 | Blood group antigen Suhany | |
| 32154009 | Inulin | |
| 32157002 | Cathepsin B | |
| 32165004 | N-Acetylneuraminate synthase | |
| 32167007 | Blood group antibody Nickolai | |
| 32180005 | Nicotinic receptor | |
| 32197004 | Clobetasol propionate | |
| 32216001 | Acylamino-acid-releasing enzyme | |
| 32228009 | Butadiene | |
| 32233008 | Blood group antibody Kasamatsuo | |
| 32235001 | Blood group antibody A 8306 | |
| 32237009 | Blood group antibody IBH | |
| 32241008 | Blood group antigen Wr^b^ | |
| 32245004 | Cystathionine gamma-lyase | |
| 32261002 | Blood group antibody Lu6 | |
| 32269000 | Uranium compound | |
| 32277001 | Soluble immune complex | |
| 32281001 | Fibrinogen Oslo IV | |
| 32291007 | Steryl-beta-glucosidase | |
| 32302009 | Ornithine decarboxylase | |
| 32305006 | Blood group antibody Rd^a^ | |
| 32314001 | Blood group antibody Marriott | |
| 32317008 | Hemoglobin J-Bangkok | |
| 32324009 | Blood group antibody BR 726750 | |
| 32329004 | Blood group antigen I^F^ | |
| 32335004 | Sodium fluoroacetamide | |
| 32338002 | Systemic poison chemical warfare agent | |
| 32340007 | Piperonyl butoxide (substance) | |
| 32351007 | Thymus-dependent antigen | |
| 32364008 | Blood group antigen Tm | |
| 32370002 | Dyphylline (substance) | |
| 32378009 | ^147^Gadolinium | |
| 32396000 | Blood group antibody Lu5 | |
| 32403003 | Blood group antibody Pr>a< | |
| 32431007 | ^193m^Platinum (substance) | |
| 32436002 | Phentolamine mesylate | |
| 32437006 | Triphenyl phosphate | |
| 32445001 | Calcium glubionate | |
| 32457005 | Body fluid | |
| 32459008 | Hemoglobin Nigeria | |
| 32467000 | ^204m^Lead | |
| 32481003 | Blood group antibody Mackin | |
| 32498003 | Cortisone | |
| 32500002 | Shellfish toxin | |
| 32505007 | ^32^Phosphorus | |
| 32519007 | Activated charcoal (substance) | |
| 32533007 | Endrin | |
| 32536004 | Glutamate-ammonia-ligase adenylyltransferase | |
| 32601005 | alpha-Chloroacetophenone | |
| 32609007 | Antibody to hepatitis A virus (substance) | |
| 32616008 | Blood group antibody Zim | |
| 32627005 | Eburnetoxin | |
| 32633001 | Phosphatidate phosphatase | |
| 32657001 | D-Malate dehydrogenase (decarboxylating) | |
| 32663005 | Allyl alcohol | |
| 32668001 | Viral oncogene protein | |
| 32669009 | Tryptophan dimethylallyltransferase | |
| 32685004 | Lactose synthase | |
| 32699000 | Blood group antigen R>2<R>2<-202 | |
| 32707001 | Deoxyribonuclease I | |
| 32714004 | Magnesium dust | |
| 32717006 | Hemoglobin J-Lens | |
| 32725008 | Glycolipid 2-alpha-mannosyltransferase | |
| 32741009 | d-Xylulose | |
| 32757009 | Dibenzepin | |
| 32759007 | Agmatine deiminase | |
| 32770000 | Deoxyuridine phosphorylase | |
| 32784005 | N-Acetyl-beta-alanine deacetylase | |
| 32789000 | Ferritin | |
| 32800009 | Ethionamide | |
| 32824001 | Ergot alkaloid | |
| 32826004 | L-Aminoadipate-semialdehyde dehydrogenase | |
| 32830001 | trans-Acenaphthene-1,2-diol dehydrogenase | |
| 32832009 | ^110m^Silver | |
| 32836007 | Sodium acetrizoate (substance) | |
| 32842006 | Blood group antibody Rh42 | |
| 32852005 | beta-Melanocyte stimulating hormone | |
| 32860006 | Blood group antigen HLA-A9 | |
| 32863008 | Methylamine | |
| 32882004 | Coriander oil | |
| 32898006 | Fibrinogen San Francisco | |
| 32901007 | Prostaglandin PGA2 | |
| 32922001 | ^227^Actinium | |
| 32926003 | Iridium | |
| 32932008 | Extracorporeal blood | |
| 32943000 | Lymphocyte antigen CD24 | |
| 32946008 | Fallopian tube secretions | |
| 32948009 | Radical | |
| 32954005 | Iron carbonyl | |
| 32969006 | Ubiquitin | |
| 32974003 | Blood group antigen Banks | |
| 32990003 | Factor H | |
| 33008008 | Dust | |
| 33019006 | Pancreatic amylase | |
| 33029004 | Blood group antibody Bowyer | |
| 33034000 | Oncogene protein sis | |
| 33037007 | Blood group antigen Austin | |
| 33053005 | Blood group antigen Bruno | |
| 33055003 | Trichlorotrifluoroethane | |
| 33057006 | Macrophage antibody | |
| 33063002 | Blood group antigen Lu13 | |
| 33073000 | Gluconate 5-dehydrogenase | |
| 33082006 | Nitroethane | |
| 33119009 | Sugar-1-phosphate adenylyltransferase | |
| 33137005 | Calcium radioisotope | |
| 33161003 | alpha,alpha-Trehalose-phosphate synthase (GDP-forming) | |
| 33166008 | Intramitochondrial lipid | |
| 33174009 | ^175^Hafnium | |
| 33188008 | Blood group antigen Chr^a^ | |
| 33190009 | Hydroxylamine | |
| 33193006 | Physarum polycephalum ribonuclease | |
| 33201007 | Long-chain-fatty-acid-CoA ligase | |
| 33204004 | alpha Sitosterol | |
| 33206002 | Hemoglobin F-Beech Island | |
| 33210004 | Blood group antibody P^k^ | |
| 33218006 | Arsenic isotope | |
| 33238007 | Mesangial matrix | |
| 33239004 | Iridium radioisotope | |
| 33263007 | Trichophyton mentagrophytes keratinase | |
| 33271006 | Iodohippurate I^131^ sodium | |
| 33273009 | CTP synthase | |
| 33278000 | Insecticide | |
| 33280006 | Medicinal zinc peroxide | |
| 33291004 | trans-Octaprenyltranstransferase | |
| 33307008 | Sodium meralein | |
| 33309006 | HLA-DQw5 antigen | |
| 33324002 | Glutamine acyltransferase | |
| 33355008 | Blood group antibody Banks | |
| 33362004 | Cinoxate | |
| 33373006 | Cyclopentane | |
| 33395005 | Monomethyl mercury | |
| 33396006 | Nickel | |
| 33404002 | Endo-1,3(4)-beta-glucanase | |
| 33414006 | Isopropyl-n-phenylcarbamate | |
| 33417004 | Citrate(pro-3S)-lyase | |
| 33418009 | Hemoglobin Cocody | |
| 33435008 | Capillary active drug | |
| 33440000 | Ceftriaxone sodium | |
| 33443003 | Polynucleotide 5'-phosphatase | |
| 33447002 | Bephenium hydroxynaphthoate | |
| 33463005 | Liquid substance | |
| 33465003 | Acridine dye | |
| 33492009 | Heparitin sulfotransferase | |
| 33509005 | Blood group antibody Mur | |
| 33519004 | Animal structural gene | |
| 33524001 | 5-Methyldeoxycytidine-5'-phosphate kinase | |
| 33535006 | Renal hormone | |
| 33545008 | Procollagen glucosyltransferase | |
| 33550002 | Blood group antigen Kirkpatrick | |
| 33566000 | Phosphoglycerate dehydrogenase | |
| 33601001 | Glycosylated hemoglobin A | |
| 33604009 | Blood group antigen Burrett | |
| 33619005 | Plasminogen activator | |
| 33635003 | Serotonin | |
| 33638001 | Isotope | |
| 33642003 | Fibrinogen Sydney I | |
| 33643008 | Nucleoside deoxyribosyltransferase | |
| 33667000 | Mercumatilin | |
| 33680002 | Blood group antigen HLA-B12 | |
| 33691009 | Blood group antibody Co^b^ | |
| 33695000 | Camphor 1,2-monooxygenase | |
| 33709008 | Aryl-alcohol oxidase | |
| 33752008 | Motilin | |
| 33780005 | Dimethyl carbamate | |
| 33785000 | Iodinated I^125^ liothyronine | |
| 33791003 | ^199^Lead | |
| 33797004 | 3-Carboxy-2-hydroxyadipate dehydrogenase | |
| 33817009 | Infusorial earth | |
| 33825006 | Blood group antigen Jk^b^ | |
| 33837008 | Aluminum glycinate | |
| 33844004 | Alginate lyase | |
| 33865005 | Blood group antibody Baltzer | |
| 33922005 | Vitamin L | |
| 33936000 | Toad toxin | |
| 33963004 | Angiotensin III | |
| 33977001 | Microbial aspartic proteinases | |
| 33984009 | Dihydropteroate synthase | |
| 33987002 | Public blood group antibody | |
| 34003008 | Phospho-2-dehydro-3-deoxyoctonate aldolase | |
| 34007009 | Cholelitholytic agent | |
| 34011003 | Acetoarsenite | |
| 34027005 | Inorganic sulfide compound | |
| 34049004 | Blood group antibody Lu9 | |
| 34053002 | Diphenyl | |
| 34057001 | Acetyl-CoA hydrolase | |
| 34060008 | ^84^Rubidium | |
| 34070005 | Fibrinogen Nagoya | |
| 34074001 | Borate salt | |
| 34086003 | Antithrombin III | |
| 34101007 | Phycoerythrin | |
| 34113002 | Acrisorcin | |
| 34119003 | Delphinine | |
| 34120009 | Fibrinogen Amsterdam | |
| 34127007 | ^85^Krypton | |
| 34128002 | Chrome azurol S stain (substance) | |
| 34143000 | Immunoglobulin, GM>10< allotype | |
| 34156007 | Hemoglobin Savaria | |
| 34158008 | Bromine isotope | |
| 34161009 | Blood group antibody Ku | |
| 34174003 | ^224^Actinium | |
| 34180006 | Blood group antibody Min | |
| 34198005 | Folescutol | |
| 34204008 | Blood group antibody Warren | |
| 34208006 | Oxalate salt | |
| 34211007 | ^83^Strontium | |
| 34219009 | Terbufos | |
| 34221004 | Hemoglobin A>2< Yokoshima | |
| 34239008 | Castor oil | |
| 34261003 | Potassium oxalate | |
| 34274009 | Iodine pentafluoride | |
| 34302005 | Uracil dehydrogenase | |
| 34316000 | Blood group antibody Ge1 | |
| 34323004 | Coal | |
| 34329000 | Immunoglobulin, GM>14< allotype (substance) | |
| 34330005 | Calcium oxide | |
| 34332002 | Nitrophenol | |
| 34354000 | Octachloronaphthalene | |
| 34355004 | Inactivated complement enzyme | |
| 34358002 | ^228^Thorium | |
| 34370003 | Glucocerebroside | |
| 34388006 | Blood group antibody Fuerhart | |
| 34392004 | Hemoglobin F-Pordenone | |
| 34400001 | Blood group antibody Teremok | |
| 34410005 | Camphor 5-monooxygenase | |
| 34425005 | Amolanone | |
| 34428007 | Cyclopentadiene | |
| 34429004 | Pericardial fluid | |
| 34443009 | Hemoglobin F-Baskent | |
| 34453005 | HLA-B27 antigen | |
| 34465009 | HLA-DQw7 antigen | |
| 34471003 | ^121^Iodine | |
| 34505008 | Dental adhesive (substance) | |
| 34510007 | Clonal inhibitory factor | |
| 34548002 | Toxaphene | |
| 34549005 | Hemoglobin Palmerston North | |
| 34569000 | Blood group antibody Jn^a^ | |
| 34575009 | Guanidinodeoxy-scyllo-inositol-4-phosphatase (substance) | |
| 34582008 | Catecholamine | |
| 34641002 | Hydrazine | |
| 34654009 | Iodine solution | |
| 34657002 | Isopropamide iodide | |
| 34658007 | Met-enkephalin | |
| 34659004 | Lysine dehydrogenase | |
| 34690002 | 3-Hydroxybenzyl-alcohol dehydrogenase | |
| 34692005 | Hemoglobin Miyada | |
| 34700000 | Fast blue B salt stain (substance) | |
| 34722007 | Hemoglobin K-Woolwich | |
| 34737006 | C1 esterase inhibitor | |
| 34744002 | Plant asparagine | |
| 34745001 | Slow reacting substance-A of anaphylaxis | |
| 34750007 | Blood group antigen Panzar | |
| 34754003 | Myxobacter b-lytic proteinase | |
| 34757005 | Cystathionine beta-lyase | |
| 34763001 | Potassium hydroxide | |
| 34768005 | Cholestanetetraol 26-dehydrogenase | |
| 34771002 | Hemoglobin Quin-Hai | |
| 34788009 | Tartrate epimerase | |
| 34792002 | Coniine | |
| 34793007 | Octanol dehydrogenase | |
| 34800005 | beta-Nitroacrylate reductase | |
| 34820006 | Kynurenate 7,8-hydroxylase | |
| 34829007 | Complement component | |
| 34832005 | Blood group antibody I^s^ | |
| 34848006 | Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase | |
| 34856009 | UDPglucuronate 4-epimerase | |
| 34862004 | Aromatic hydrocarbon | |
| 34864003 | Benzoyl formate decarboxylase | |
| 34865002 | Chromium compound | |
| 34868000 | HLA-DQw3 antigen | |
| 34888001 | Aspartate-ammonia ligase (ADP-forming) | |
| 34895005 | Basic cupric sulfate | |
| 34900009 | Blood group antigen B | |
| 34904000 | Beryllium compound | |
| 34912008 | Blood group antibody Ramskin | |
| 34914009 | Serine-pyruvate aminotransferase | |
| 34915005 | Pyridostigmine bromide | |
| 34919004 | Potassium tartrate | |
| 34940003 | Phosphoserine aminotransferase | |
| 34946009 | Calcium sulfide | |
| 34953000 | Colocynth | |
| 34957004 | Acid | |
| 34968004 | Blood group antigen Lee | |
| 34970008 | Blood group antigen JAL | |
| 34978001 | Perchloromethyl mercaptan | |
| 34982004 | Uroporphyrinogen decarboxylase | |
| 34983009 | Epicillin | |
| 34999003 | tRNA (guanine-N^2^)-methyltransferase | |
| 35000003 | Hurain | |
| 35003001 | Maleate isomerase | |
| 35012004 | Blood group antibody HLA-A9 | |
| 35016001 | Argon radioisotope | |
| 35027004 | Pyrophosphoric acid | |
| 35040009 | Blood group antibody Rh29 | |
| 35059006 | Nicotinate-nucleotide pyrophosphorylase (carboxylating) | |
| 35060001 | Testicular hormone | |
| 35068008 | Blood group antibody C | |
| 35069000 | Neurotransmitter | |
| 35072007 | HLA-B16 antigen | |
| 35077001 | Nerve gas | |
| 35079003 | Volatile oil | |
| 35092000 | Lymphocyte antigen CD70 | |
| 35094004 | Tropaeolin O stain (substance) | |
| 35098001 | Imidazole | |
| 35118003 | Blood group antibody Fy5 | |
| 35124009 | Clupeotoxin | |
| 35131008 | Histidine decarboxylase | |
| 35133006 | Immunoglobulin IgG4, H chain | |
| 35135004 | Aglycone | |
| 35148000 | Protein-glutamine glutaminase | |
| 35150008 | Glucocorticoid hormone | |
| 35151007 | Ruthenium radioisotope | |
| 35181004 | Maleate hydratase | |
| 35190006 | Depilatory | |
| 35192003 | 2,3-Diaminopropionate oxalyltransferase | |
| 35196000 | Ethyl iodide | |
| 35206004 | ^242m^Americium | |
| 35213004 | Blood group antibody Wallin | |
| 35215006 | Scarlet fever streptococcus toxin | |
| 35231003 | Sphingosine acyltransferase | |
| 35233000 | Polyvinyl chloride | |
| 35234006 | Ethylene chlorobromide | |
| 35236008 | Thenyldiamine | |
| 35251004 | Chlordecone | |
| 35257000 | Entsulfon | |
| 35281007 | Acetophenazine | |
| 35292008 | Lipoxygenase | |
| 35293003 | 3-Carboxyethylcatechol 2,3-dioxygenase | |
| 35296006 | S-Alkylcysteine lyase | |
| 35297002 | Alkyl hydroxyethyl imidazolinium chloride | |
| 35310003 | Polyclonal antibody | |
| 35312006 | Gluconokinase | |
| 35318005 | Esmolol hydrochloride | |
| 35321007 | Fluorodeoxyglucose F^18^ | |
| 35331000 | Toxic substance | |
| 35337001 | ^68^Gallium | |
| 35342009 | 1-Acylglycerophosphocholine acyltransferase | |
| 35343004 | Cefonicid sodium | |
| 35344005 | Ribulose | |
| 35352008 | Fluorescent stain | |
| 35353003 | Zygacine | |
| 35367007 | Blood group antigen McC^e^ | |
| 35406002 | Clocortolone | |
| 35410004 | Blood group antibody Kp^c^ | |
| 35415009 | Homocysteine desulfhydrase | |
| 35416005 | Sex-linked gene | |
| 35422001 | Hemoglobin Bundury | |
| 35431001 | Adenosine | |
| 35432008 | ^87^Rubidium (substance) | |
| 35457003 | Narcotic drug receptor | |
| 35464001 | Trioxsalen (substance) | |
| 35466004 | Relaxin | |
| 35467008 | Pseudouridylate synthase | |
| 35473009 | Fibrinogen St. Louis | |
| 35477005 | Phenol methyltransferase | |
| 35479008 | Hemoglobin Mozhaisk | |
| 35488004 | Abnormal hemoglobin, alpha-chain variant | |
| 35499002 | 3-Hydroxypropionate dehydrogenase | |
| 35503008 | Cationic detergent | |
| 35527005 | Sanguinarine (substance) | |
| 35530003 | Hemoglobin J-Lome | |
| 35556005 | Sessile antibody | |
| 35573007 | Hemoglobin Las Palmas | |
| 35584000 | Sodium bitartrate | |
| 35589005 | Gadolinium isotope | |
| 35605007 | Anhydrous lanolin | |
| 35609001 | Azophloxin stain (substance) | |
| 35614002 | Blood group antigen Lu17 | |
| 35617009 | Isotomin | |
| 35628008 | Animal gene | |
| 35645003 | Blood group antigen French | |
| 35651008 | Cholest-5ene-3beta,7alpha-diol 3beta dehydrogenase | |
| 35659005 | Dinitrocresol | |
| 35663003 | Asphalt | |
| 35668007 | Endometrial secretions | |
| 35677000 | Heat stable bacterial toxin | |
| 35684008 | Tetranitromethane | |
| 35690007 | Hypochlorous acid | |
| 35724001 | Lacmoid stain (substance) | |
| 35733004 | Fat-soluble vitamin | |
| 35740003 | Stable isotope | |
| 35747000 | Osmium compound | |
| 35748005 | Wine | |
| 35760006 | Myeloid antibody | |
| 35765001 | Sincalide | |
| 35780007 | Isochorismatase | |
| 35798006 | Elastic fiber | |
| 35808006 | Ornithine cyclodeaminase | |
| 35815003 | Cadmium sulfide | |
| 35825008 | Cat scratch disease antigen | |
| 35841009 | Macrophage inhibitory factor | |
| 35864006 | Pyrathiazine (substance) | |
| 35866008 | Acyl-CoA desaturase | |
| 35867004 | Cytochrome-c>3< hydrogenase | |
| 35871001 | Oleandrin | |
| 35878007 | Thyroid-hormone aminotransferase | |
| 35883004 | Fluorine | |
| 35884005 | Iodine^131^ polyvinylpyrrolidone | |
| 35891008 | Liquid cyanamide | |
| 35895004 | Aspartyltransferase | |
| 35903003 | Potassium bromide | |
| 35906006 | Blood group antibody MPD | |
| 35922007 | Blood group antibody Black | |
| 35946000 | Pentolinium | |
| 35952004 | Blood group antibody Block | |
| 35954003 | Coagulation factor II variant | |
| 35960003 | Arachidonate-CoA ligase | |
| 35966009 | Ouabain | |
| 35976007 | Pancreatic peptide | |
| 35978008 | ^252^Californium | |
| 35997008 | Metacresylacetate | |
| 36005003 | Blood group antibody Tofts | |
| 36012007 | Nitrogen | |
| 36016005 | Blood group antibody Haase | |
| 36020009 | Factor IX antibody | |
| 36021008 | Cefadroxil monohydrate | |
| 36022001 | Fibrinogen Freiberg | |
| 36028002 | Aldehyde reductase | |
| 36058008 | Oil of myrtle | |
| 36062002 | Xanthurenic acid | |
| 36065000 | Oxine benzoate | |
| 36066004 | Coumarate reductase | |
| 36085001 | Pantoate-beta-alanine ligase | |
| 36093001 | Crotonic acid | |
| 36095008 | Glycine aminotransferase | |
| 36098005 | Malate synthase | |
| 36100005 | Blood group antigen Do^b^ | |
| 36130002 | dTDP-4-dehydrorhamnose 3,5-epimerase | |
| 36136008 | Penitrem-A | |
| 36137004 | Triacylglycerol-sterol acyltransferase | |
| 36156009 | Oxynervonic acid | |
| 36167005 | Fibrinogen Torino | |
| 36173006 | Tetraiodothyroacetic acid | |
| 36176003 | Thrombin | |
| 36178002 | Chromate salt | |
| 36197002 | Ecdysone 20-monooxygenase | |
| 36212002 | Myxobacter-a-lytic proteinase | |
| 36220000 | Chloric acid | |
| 36231008 | Proteinglutamine gamma-glutamyltransferase | |
| 36232001 | Mucinaminylserine mucinaminidase | |
| 36235004 | Pine needle oil | |
| 36238002 | Chlorobromomethane | |
| 36240007 | Alkyl sodium n-methyltaurate | |
| 36260004 | Blood group antibody Raison | |
| 36264008 | Lupinine | |
| 36270002 | Arylformamidase | |
| 36301000 | ^198m^Thallium | |
| 36312000 | Xylan 1,3-beta-xylosidase | |
| 36322006 | Acetylindoxyl oxidase | |
| 36326009 | Pteridine | |
| 36343007 | beta>2B< Glycoprotein | |
| 36345000 | 1-Phosphatidylinositol-4-phosphate kinase | |
| 36372008 | GDP-6-deoxy-D-talose dehydrogenase | |
| 36377002 | Isomaltulose synthase | |
| 36378007 | Lithium compound | |
| 36380001 | Oxyphencyclimine hydrochloride | |
| 36381002 | Hemoglobin P-Congo | |
| 36385006 | Synaptic receptor | |
| 36387003 | DNA-directed DNA polymerase | |
| 36393006 | Nonionic detergent | |
| 36396003 | Blood group antigen Van Buggenhout | |
| 36397007 | Muramic acid | |
| 36403001 | Blood group antibody ELO (substance) | |
| 36410007 | Lactone dye | |
| 36413009 | CDPribitol ribitolphosphotransferase | |
| 36418000 | Blood group antigen McC^b^ | |
| 36434002 | 1-Methyl histidine | |
| 36443006 | Hemoglobin E-Saskatoon | |
| 36445004 | Spectrin | |
| 36461002 | Oncogene protein TAL | |
| 36466007 | Furocoumarin | |
| 36494004 | Galactose dehydrogenase | |
| 36513006 | Boron carbide | |
| 36516003 | Pyrilamine maleate | |
| 36541005 | Mercuric iodide | |
| 36562006 | Haemolysin | |
| 36567000 | Prostaglandin-H>2< E-isomerase | |
| 36569002 | Isocyanide compound | |
| 36572009 | Sudan black B stain | |
| 36613003 | Blood group antigen Pr>1h< | |
| 36632009 | Mannokinase | |
| 36636007 | Thiamine-triphosphatase (substance) | |
| 36641004 | Potassium chloride K^42^ | |
| 36651003 | Bismuth salt | |
| 36652005 | Blood group antigen H>T< | |
| 36661005 | Tyrothricin | |
| 36663008 | ^121^Tellurium | |
| 36671007 | Nitrogen pentoxide | |
| 36677006 | Phenylalanine decarboxylase | |
| 36687005 | Uronolactonase | |
| 36690004 | Nitrate reductase (NADPH) | |
| 36694008 | Hemoglobin Bologna | |
| 36704006 | 5' Acylphosphoadenosine hydrolase | |
| 36707004 | Polydeoxyribonucleotide synthase (NAD^+^) | |
| 36712003 | Factor XII antibody | |
| 36713008 | Blood group antibody McC^d^ | |
| 36726007 | Nicotinate methyltransferase | |
| 36744004 | Blood group antigen E | |
| 36747006 | Psychosine sulfotransferase | |
| 36757007 | Blood group antigen Raison | |
| 36759005 | HLA-Bw6 antigen | |
| 36766006 | Succinyldiaminopimelate desuccinylase | |
| 36774007 | Cadmium compound | |
| 36801006 | Tagatose kinase | |
| 36804003 | Blood group antigen Tasich | |
| 36806001 | Bhilawanol oil | |
| 36816009 | Glucose-1-phosphate | |
| 36824004 | Dauricine | |
| 36842009 | HLA-Dw16 antigen | |
| 36848008 | Citrate dehydratase | |
| 36853003 | Blood group antigen Vienna | |
| 36856006 | Flavanone 3-dioxygenase | |
| 36863006 | 2-Dehydro-3-deoxy-D-gluconate 5-dehydrogenase (NAD(P)^+^) | |
| 36864000 | Paint | |
| 36872003 | Tridihexethyl | |
| 36879007 | Water soluble eosin stain (substance) | |
| 36887008 | Mineralocorticoid hormone | |
| 36888003 | Exodeoxyribonuclease VII | |
| 36900006 | Iodohippurate I^125^ sodium | |
| 36907009 | Blood group antibody Kennedy | |
| 36933001 | Antibody to antigen in Rh blood group system (substance) | |
| 36934007 | Alkylglycerol kinase | |
| 36953002 | Fibrinogen Nancy | |
| 36993004 | Fucokinase | |
| 36998008 | Glycogen | |
| 37000002 | ^35^Sulfur | |
| 37004006 | Immunoglobulin, Fc' fragment | |
| 37006008 | Cyclothiazide | |
| 37010006 | Tetraphylline | |
| 37013008 | Dipivefrin hydrochloride (substance) | |
| 37015001 | UDP-N-acetyl muramoylalanine-D-glutamate ligase | |
| 37023004 | Deoxyribodipyrimidine photo-lyase | |
| 37052001 | Tellurium hexafluoride | |
| 37067002 | Blood group antibody Shier | |
| 37077000 | ^122^Xenon | |
| 37078005 | Nitromersol | |
| 37080004 | Phoabol | |
| 37086005 | Oil of pennyroyal-American | |
| 37094003 | Chlorotoluene | |
| 37100000 | Blood group antigen Bradford | |
| 37112001 | Ceramide | |
| 37123002 | Copper dust and mist | |
| 37148004 | Hemoglobin F-Malaysia | |
| 37150007 | Streptomycin 3''-adenylyltransferase | |
| 37162006 | Polypeptide receptor | |
| 37177003 | Deoxyribonucleic acid, single stranded | |
| 37196004 | L-Glutamate oxidase | |
| 37202001 | Plant fiber | |
| 37225000 | ^52^Manganese | |
| 37237003 | Vitamin E | |
| 37241004 | Corticosterone 18-monooxygenase | |
| 37243001 | Hemoglobin A>2< Coburg | |
| 37262003 | Phenyl p-aminosalicylate | |
| 37264002 | Glucomannan 4-beta-mannosyltransferase | |
| 37276002 | Polypeptide hormone | |
| 37282004 | Blood group antibody B 7358 | |
| 37287005 | HLA-A1 antigen | |
| 37300006 | Blood group antibody h | |
| 37315007 | n-Acetyl mannosamine | |
| 37318009 | Ethylene chlorohydrin | |
| 37329008 | Hemoglobin J-Taichung | |
| 37334007 | Thyroxine deiodinase | |
| 37346006 | Adenylosuccinate synthase (substance) | |
| 37352007 | Fungus antigenic product | |
| 37357001 | L-Arabinonolactonase | |
| 37365003 | Fibrinogen Rouen | |
| 37375000 | L-Arabinitol dehydrogenase (ribulose-forming) | |
| 37379006 | ^191m^Osmium | |
| 37411004 | Tissue plasminogen activator | |
| 37433002 | Polycarbophil | |
| 37437001 | Iodinated I^125^ sealed source | |
| 37451001 | Laudanum | |
| 37462001 | Oncogene protein c-fes | |
| 37484001 | Dopamine receptor | |
| 37489006 | Fructokinase | |
| 37513004 | Hemoglobin Lepore-Baltimore | |
| 37526000 | Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6N-acetylglucosaminyltransferase | |
| 37527009 | Sufentanil citrate | |
| 37536008 | Dehydrobufotenine | |
| 37566001 | Dinitrochlorobenzene | |
| 37569008 | Galactose-6-sulfurylase | |
| 37575004 | Carmoisine A stain (substance) | |
| 37583005 | Blood group antigen Buckalew | |
| 37588001 | Immunoglobulin polymer | |
| 37595005 | Suspension | |
| 37620000 | Lipopolysaccharide glucosyltransferase I | |
| 37624009 | Cyclomaltodextrin glucanotransferase | |
| 37648000 | Clindamycin phosphate | |
| 37654004 | Blood group antigen K19 | |
| 37656002 | Methimazole (substance) | |
| 37662007 | 5,10-Methylenetetrahydrofolate reductase (FADH>2<) | |
| 37663002 | Venom | |
| 37681004 | S-Formylglutathione hydrolase | |
| 37683001 | Tanghin extract | |
| 37691005 | Hetacillin | |
| 37704004 | Perichromatin granule | |
| 37713002 | Blood group antigen Dautriche | |
| 37716005 | White ointment | |
| 37751002 | Beta 2 blocking agent | |
| 37756007 | Gastric inhibitory polypeptide | |
| 37758008 | Drug-induced coagulation inhibitor | |
| 37765000 | Diethylpropion hydrochloride (substance) | |
| 37784002 | Striatoxin | |
| 37838004 | Hemoglobin F-Minoo | |
| 37841008 | Menstrual fluid | |
| 37850005 | 2-Acetolactate mutase | |
| 37852002 | Indirect reacting bilirubin | |
| 37861002 | Blood group antigen Js^b^ | |
| 37863004 | Pyruvate,orthophosphate dikinase | |
| 37881001 | Dolichyl-diphosphooligosaccharide-protein glycotransferase | |
| 37889004 | Gonadoliberin receptor | |
| 37892000 | Exodeoxyribonuclease (Phage SP>3<-induced) | |
| 37902007 | Blood group antigen A.M. | |
| 37905009 | Copper 3-phenyl salicylate | |
| 37912000 | Heterotricyclic dye | |
| 37915003 | Protein-tyrosine-phosphatase | |
| 37927000 | Cystine | |
| 37930007 | Neon isotope | |
| 37932004 | LDL receptor | |
| 37938000 | Carbonic acid | |
| 37947008 | Colloidal gold Au^198^ | |
| 37950006 | sn-Glycerol-3-phosphate 1-galactosyltransferase | |
| 37951005 | Fibrinogen Paris I | |
| 37957009 | Pentoxyverine | |
| 37959007 | Prealbumin | |
| 37969001 | ^119^Antimony | |
| 37970000 | Phosphogluconate dehydratase | |
| 37978007 | Nitrofurantoin sodium | |
| 37984005 | Blood group antibody Don | |
| 37986007 | Tremorgen | |
| 37994000 | Fibrinogen Hanover | |
| 38000004 | Lymph | |
| 38019009 | Plastic object | |
| 38044001 | Paromomycin | |
| 38065007 | Hemoglobin G-Copenhagen | |
| 38082009 | Hemoglobin | |
| 38088008 | 2-Dehydro-3-deoxygluconokinase | |
| 38100002 | Isopropyl acetone | |
| 38120001 | Progesterone 5alpha-reductase | |
| 38122009 | Anisindione | |
| 38123004 | Trichlorofluoromethane (substance) | |
| 38132002 | (+)-Neomenthol dehydrogenase | |
| 38148001 | Ribosylhomocysteinase | |
| 38154000 | ^239^Americium | |
| 38156003 | Hemoglobin Tottori | |
| 38167002 | Aquacobalamin reductase | |
| 38174007 | ^237^Americium | |
| 38182007 | Galactose | |
| 38207009 | Hemoglobin Regina | |
| 38218009 | Hyaluronic acid | |
| 38227005 | Blood group antigen He | |
| 38229008 | UDP-N-acetylgalactosamine-4-sulfate sulfotransferase | |
| 38245005 | Thymic hormone | |
| 38262000 | Active C5b678 | |
| 38263005 | N-ethylmercuri-p-toluene sulphonanilide | |
| 38269009 | Lymphocyte antigen CD1c | |
| 38271009 | Saffron stain (substance) | |
| 38289005 | ^200^Lead | |
| 38319003 | Mercuric sulfide | |
| 38327007 | Plutonium | |
| 38344006 | Sodium iodomethamate | |
| 38347004 | 2,5-Diaminovalerate aminotransferase | |
| 38348009 | Body water | |
| 38367008 | Blood group antigen Hoalzel | |
| 38373009 | Glutathione-CoA-glutathione transhydrogenase | |
| 38379008 | Alcohol sulfotransferase | |
| 38399002 | ^135^Xenon | |
| 38401008 | Crocidolite | |
| 38408002 | Paregoric | |
| 38410000 | Acyl-CoA dehydrogenase | |
| 38415005 | ^44^Titanium | |
| 38424001 | Strontium chloride Sr^87^ | |
| 38445008 | Blood group antigen Rils | |
| 38446009 | Diflorasone diacetate | |
| 38457004 | Kerasin | |
| 38476002 | Interleukin | |
| 38482004 | Apocrine sweat | |
| 38496005 | Phenyl dimethyl urea | |
| 38499003 | Blood group antibody Naz | |
| 38519002 | Blood group antigen Donaldson | |
| 38543004 | Lissamine green B stain (substance) | |
| 38553003 | Blood group antigen Schuppenhauer | |
| 38554009 | HLA-B5 antigen | |
| 38558007 | Blood group antibody Ghawiler | |
| 38588003 | bis-(Dimethylamino)-phosphorous anhydride | |
| 38595007 | Trimethyl phosphite | |
| 38612004 | Chitin synthase | |
| 38622005 | Aluminum oxide ore | |
| 38623000 | ^69^Zinc | |
| 38647007 | Ribonucleoside-diphosphate reductase | |
| 38648002 | Mephentermine | |
| 38649005 | Dichloroethane | |
| 38652002 | Acylglycerol lipase | |
| 38684009 | Alclometasone dipropionate | |
| 38686006 | Colistimethate sodium | |
| 38705000 | Acetaldehyde | |
| 38707008 | Celestine blue B stain (substance) | |
| 38710001 | Procollagen N-proteinase | |
| 38714005 | Somatomedin A | |
| 38726000 | Hemoglobin G-Taiwan Ami | |
| 38730002 | p-Methylaminophenol hydrochloride | |
| 38733000 | ^207^Bismuth | |
| 38744008 | Progesterone binding protein | |
| 38747001 | Penicillium notatum extracellular proteinase | |
| 38758005 | ^229^Actinium | |
| 38765002 | Hemoglobin Nottingham | |
| 38771008 | HLA-DPw6 antigen | |
| 38778002 | Deacetyl-[citrate-(pro-3S)-lyase] acetyltransferase | |
| 38779005 | Blood group antibody Ht^a^ | |
| 38794009 | Molybdenum isotope | |
| 38808007 | Glutathione transferase | |
| 38810009 | Hemoglobin Olympia | |
| 38833005 | Vinyl chloride | |
| 38834004 | Glutamate 1-kinase | |
| 38839009 | Glycerol teichoic acid | |
| 38854003 | Adenosinetriphosphatase | |
| 38874005 | Blood group antigen V.G. | |
| 38899006 | Hemoglobin North Shore | |
| 38902009 | Solochrome dark blue stain (substance) | |
| 38908008 | Blood group antigen Lu6 | |
| 38909000 | Glutamic acid hydrochloride | |
| 38914001 | Thymol iodide | |
| 38922008 | Urinary tract fluid | |
| 38932001 | Hemoglobin J-Nayanza | |
| 38937007 | Water in oil agent | |
| 38947005 | Pyrithiamin deaminase | |
| 38957006 | Hemoglobin Kofu | |
| 38990006 | Hydrogen-sulfide acetyltransferase | |
| 39004000 | Hemoglobin Ypsilanti | |
| 39006003 | 3alpha,7alpha,12alpha-Trihydroxycholestan-26-al 26-dehydrogenase | |
| 39012008 | Thiram | |
| 39013003 | Galactocerebroside | |
| 39022002 | Deoxycytidine diphosphate (substance) | |
| 39024001 | Blood group antibody Yt^a^ | |
| 39044007 | Aluminum alkyl | |
| 39049002 | Nasopharyngeal mucus | |
| 39053000 | Complement factor D | |
| 39081006 | Iron ore | |
| 39082004 | Hepatitis B core antigen | |
| 39102003 | Food particle | |
| 39110002 | Protein-arginine deiminase | |
| 39118009 | High incidence antibody | |
| 39123009 | Cephaloglycin (substance) | |
| 39135008 | Phosphoribosylaminoimidazole-succinocarboxamide synthase | |
| 39138005 | Blood group antibody Milano | |
| 39152007 | Erythromycin stearate | |
| 39162000 | Bronsted-Lowry acid | |
| 39173007 | Estradiol 6beta-monooxygenase | |
| 39192009 | ^235m^Uranium | |
| 39200002 | Iodinated I^131^ albumin | |
| 39203000 | Conanine | |
| 39212003 | Acylpyruvate hydrolase | |
| 39223004 | Stipitatonate decarboxylase | |
| 39240008 | Hemoglobin Sherwood Forest | |
| 39241007 | HLA-Dw1 antigen | |
| 39254000 | S-Succinylglutathione hydrolase | |
| 39263003 | Amisometradine | |
| 39265005 | Free radical | |
| 39276009 | Aldehyde dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) | |
| 39290007 | Barium | |
| 39292004 | Iodine trichloride | |
| 39294003 | Iron carbohydrate complex | |
| 39313006 | Phosphonoacetaldehyde hydrolase | |
| 39318002 | Hemoglobin Yokohama | |
| 39327001 | Blood group antibody Craw | |
| 39331007 | Hemoglobin Djelfa | |
| 39337006 | Blood group antibody Es^a^ | |
| 39339009 | Oil of linaloe | |
| 39340006 | Cycloate | |
| 39360003 | Starch | |
| 39368005 | Arsenate compound | |
| 39378008 | Hydrastinine | |
| 39383000 | Dihydrolipoamide dehydrogenase | |
| 39385007 | Riboflavin kinase | |
| 39411007 | Glycocyaminase | |
| 39428005 | Deuteroporphyrin | |
| 39442002 | Antibody binding site | |
| 39467004 | ^124^Antimony | |
| 39469001 | beta-Phenylisopropylamine | |
| 39477002 | Feces | |
| 39494000 | Indole-3-acetaldehyde reductase (NADPH) | |
| 39505006 | Hemoglobin Chongqing | |
| 39514001 | Decamethonium | |
| 39515000 | Blood group antigen Ht^a^ | |
| 39522008 | ^253^Californium | |
| 39525005 | Tumor necrosis factor alpha | |
| 39529004 | Chromous sulfate | |
| 39546001 | Manganese isotope | |
| 39552000 | Scabicide | |
| 39554004 | Propane | |
| 39560004 | Hemoglobin Bicetre | |
| 39576008 | Galactose dehydrogenase (NADP^+^) | |
| 39580003 | Benzoate 4-monooxygenase | |
| 39581004 | Trimethyl benzene | |
| 39588005 | Lipstick | |
| 39605000 | Hemoglobin Niteroi | |
| 39635007 | ^195m^Platinum | |
| 39650003 | HLA-Bw54 antigen | |
| 39665002 | Blood group antigen Pr>2< | |
| 39669008 | ^202^Bismuth | |
| 39678002 | Blood group antigen Kominarek | |
| 39694009 | Kynurenic acid | |
| 39701004 | Metabolite AND/OR marker of carcinogen | |
| 39705008 | ^238^Americium (substance) | |
| 39736000 | Sodium sulfide | |
| 39757008 | Cinnamoyl-CoA reductase | |
| 39765006 | Uroporphyrinogen-III synthase | |
| 39769000 | Inert gas | |
| 39777001 | Sudan III stain (substance) | |
| 39789004 | Snuff tobacco | |
| 39805003 | Hemoglobin Aztec | |
| 39806002 | Oil of niaouli | |
| 39808001 | Dibucaine hydrochloride (substance) | |
| 39815009 | Clorazepate | |
| 39817001 | Prothrombin fragment 1.2 | |
| 39830000 | N-Sulfoglucosamine-6-sulfatase | |
| 39840002 | Blood group antibody Di^a^ | |
| 39862002 | Imino acid | |
| 39867008 | Hemoglobin F-Xinjiang | |
| 39909008 | dGTPase | |
| 39932007 | ^117^Cadmium | |
| 39933002 | Pancreatic hormone | |
| 39953003 | Tobacco | |
| 39954009 | Cellobiose phosphorylase | |
| 39962001 | Coagulation factor II Barcelona variant | |
| 39972003 | Sodium | |
| 39973008 | C peptide | |
| 39979007 | T-2 fungal toxin | |
| 39985000 | Beryllium oxide | |
| 39988003 | Skin reactive factor | |
| 39989006 | Serotonin receptor | |
| 39999001 | Blood group antigen C^G^ | |
| 40012004 | Methionine adenosyltransferase | |
| 40018000 | Blood group antibody Oliver | |
| 40030006 | Blood group antigen M^c^ | |
| 40034002 | Hemoglobin Minneapolis-Laos | |
| 40036000 | Sulfamethazine (substance) | |
| 40044000 | HLA-DRw11 antigen | |
| 40048002 | Blood group antigen Englund | |
| 40057008 | Ozone | |
| 40065006 | HLA-Bw73 antigen | |
| 40076005 | Erie garnet stain (substance) | |
| 40078006 | Quercitrinase | |
| 40082008 | Prostaglandin-A>1< delta-isomerase | |
| 40112002 | Ichthyotoxin (substance) | |
| 40115000 | Aluminum hydroxychloride | |
| 40140007 | Blood group antibody Kirkpatrick | |
| 40147005 | Diphenylmethane dye | |
| 40154004 | Blood group antibody Singleton | |
| 40164008 | Glycerol-3-phosphate cytidylyltransferase | |
| 40179001 | Tremolite | |
| 40185008 | Serum amyloid A protein | |
| 40200005 | Cytochrome-c peroxidase | |
| 40205000 | Hemoglobin Cheverly | |
| 40217003 | Glucan 1,4-alpha-maltohexaosidase | |
| 40235007 | Hydroxymalonate dehydrogenase | |
| 40239001 | Esophageal mucus | |
| 40256009 | Indole-3-acetaldehyde oxidase | |
| 40263009 | ^231^Uranium | |
| 40270009 | Blood group antibody Truax | |
| 40327006 | Hemoglobin Petah Tikva | |
| 40342009 | Thiamylal sodium | |
| 40346007 | ^207^Thallium | |
| 40351001 | Isocyanate compound | |
| 40352008 | Ryanodine | |
| 40356006 | beta Fetoprotein | |
| 40364000 | Blood group antigen A>1< Le^b^ | |
| 40404004 | Papaverine hydrochloride | |
| 40414008 | Hemoglobin Peterborough | |
| 40424000 | dUTP pyrophosphatase | |
| 40426003 | Sucrose phosphate synthase | |
| 40431001 | Tears | |
| 40438007 | Antimony sodium tartrate | |
| 40447004 | Blood group antibody Hy | |
| 40456007 | Blood group antigen IB | |
| 40469006 | Parathion | |
| 40471006 | Magnesium stearate | |
| 40479008 | Fructose-1-phosphate | |
| 40534007 | Aflatrem | |
| 40545005 | Amphotericin A | |
| 40558006 | Blood group antigen VA | |
| 40565003 | ^11^Carbon | |
| 40569009 | Aminomethyltransferase | |
| 40581008 | Alanylphosphatidylglycerol synthase | |
| 40584000 | Uranium | |
| 40588002 | Hexadecanal dehydrogenase (acylating) | |
| 40601003 | Chlordiazepoxide hydrochloride | |
| 40621002 | Blood group antigen Vr | |
| 40647006 | Hexane | |
| 40660000 | Organic silicon compound | |
| 40699008 | Barium fluorosilicate | |
| 40706003 | Blood group antigen Toms | |
| 40710000 | Iodopyracet (substance) | |
| 40718007 | Fast red B salt stain (substance) | |
| 40728003 | ^201m^Lead | |
| 40730001 | Hemoglobin Kariya | |
| 40734005 | Rhus toxin | |
| 40744007 | Alanine carboxypeptidase | |
| 40755007 | Hemoglobin J-Kurosh | |
| 40756008 | Membrane lipid (substance) | |
| 40763008 | Oil of petitgrain | |
| 40776002 | Strictosidine beta-glucosidase | |
| 40783009 | Sec-hexyl acetate | |
| 40789008 | Adrenocorticotropic hormone | |
| 40808006 | Oil red O stain | |
| 40813005 | Cardamom oil | |
| 40817006 | Rubidium compound (substance) | |
| 40830007 | Abnormal hemoglobin, beta-chain variant | |
| 40840005 | Glycerol-1-phosphatase | |
| 40848003 | Malate dehydrogenase (NADP^+^) | |
| 40856000 | Leukotriene A | |
| 40879004 | NADH dehydrogenase (ubiquinon) | |
| 40922007 | Nylon 46 | |
| 40924008 | Water-soluble vitamin | |
| 40937006 | ^124^Iodine | |
| 40940006 | Human chorionic gonadotropin, beta subunit | |
| 40942003 | Taurine dehydrogenase | |
| 40955002 | Hemoglobin Wien | |
| 40968005 | Silver nitrate ophthalmic preparation | |
| 40971002 | Adenylyl-[glutamate-ammonia ligase] hydrolase | |
| 40991009 | alpha-L-Arabinofuranosidase | |
| 40992002 | Lymphocyte antigen | |
| 40996004 | Glutamin-(asparagin-)ase | |
| 41043002 | Chemical solution | |
| 41044008 | Blood group antigen Woit | |
| 41062004 | Methoxsalen | |
| 41067005 | Oxiconazole nitrate | |
| 41091001 | Mebutamate | |
| 41093003 | Blood group antibody E^w^ | |
| 41094009 | Cyanidin-3-rhamnosylglucoside O^5^-glucosyltransferase | |
| 41096006 | Blood group antibody Y. Bern | |
| 41097002 | Hemoglobin F-Kingston | |
| 41105002 | Halogenated hydrocarbon | |
| 41126002 | Glycerate dehydrogenase | |
| 41143004 | Ursodeoxycholic acid | |
| 41153003 | Amyl nitrate | |
| 41175001 | Organic compound | |
| 41198009 | ^117^Antimony | |
| 41199001 | Melatonin | |
| 41220002 | Dugaldin | |
| 41233008 | Chlorophenyl dimethyl urea trichloroacetate | |
| 41247007 | Dephospho-[reductase kinase] kinase | |
| 41255000 | Dihydrolipoamide acetyltransferase | |
| 41261002 | Quinethazone | |
| 41268008 | Pyruvate,water dikinase | |
| 41282008 | Hemoglobin Boras | |
| 41285005 | Blood group antigen Jones | |
| 41301002 | H-2 locus | |
| 41311009 | Hemoglobin F-Auckland | |
| 41317008 | Asterosaponin | |
| 41318003 | Blood group antibody Js^b^ | |
| 41322008 | Hemoglobin Shenyang | |
| 41332001 | Oleandomycin | |
| 41343009 | ^222^Radium | |
| 41372005 | Anthranilate phosphoribosyltransferase | |
| 41383001 | Hemoglobin York | |
| 41389002 | Ethyl hexanediol | |
| 41395001 | Tamoxifen citrate | |
| 41401001 | 1,2-alpha-L-Fucosidase | |
| 41403003 | Blood group antigen Mt^a^ | |
| 41410009 | Intrinsic factor | |
| 41412001 | Tannic acid | |
| 41414000 | Methylmalonyl-CoA decarboxylase | |
| 41420004 | Content of exocytic membrane invagination | |
| 41433005 | Aluminum compound | |
| 41441005 | Erythrose | |
| 41459008 | Sodium bisulfite | |
| 41464007 | ^90^Molybdenum | |
| 41465008 | Glutamate decarboxylase (substance) | |
| 41469002 | Oncogene protein | |
| 41485007 | Leuc-enkephalin | |
| 41492002 | Satratoxins | |
| 41499006 | 3-Hydroxybenzoate 2-monooxygenase | |
| 41503000 | Zinc compound | |
| 41504006 | Lauric acid | |
| 41508009 | Cerumen | |
| 41509001 | Potassium warfarin | |
| 41528008 | 2-Hydroxyacylsphingosine 1-beta-galactosyltransferase | |
| 41540008 | Ribonucleoside-triphosphate reductase | |
| 41548001 | Protochlorophyllide reductase | |
| 41551008 | Right lower lobe mucus | |
| 41558002 | Immunoglobulin, GM>8< allotype | |
| 41562008 | Blood group antibody Tm | |
| 41568007 | Arabinonate dehydratase | |
| 41573001 | Linseed oil | |
| 41576009 | Blood group antigen Rh26 | |
| 41577000 | Tellurium | |
| 41579002 | beta-N-acetylhexosaminidase | |
| 41583002 | ^32^Silicon | |
| 41592004 | ^82^Strontium | |
| 41598000 | Estrogen | |
| 41606000 | Tetrahydrofuran | |
| 41612005 | 3-Chloro-D-alanine dehydrochlorinase | |
| 41613000 | Adenylosuccinate lyase | |
| 41623009 | Syntenic gene | |
| 41641001 | ^196^Thallium | |
| 41644009 | Blood group antigen Baltzer | |
| 41646006 | Corticotropin binding globulin | |
| 41649004 | Calmodulin | |
| 41667006 | Blood group antigen Begovitch | |
| 41691002 | ^210^Radon | |
| 41692009 | Hemoglobin Ube-4 | |
| 41711007 | Thymidine phosphorylase | |
| 41718001 | N-(5'-Phospho-D-ribosylformimino)-5-amino-1-(5''-phosphoribosyl)-4-imidazole-carboxamide isomerase | |
| 41722006 | Cefotaxime sodium | |
| 41748003 | Organic tin compound | |
| 41750006 | Brazilin stain (substance) | |
| 41758004 | ^169^Ytterbium | |
| 41759007 | Trimetaphosphatase | |
| 41761003 | Blood group antibody Stewart | |
| 41771001 | Blood group antigen Gallner | |
| 41773003 | Formiminoglutamate deiminase | |
| 41793006 | Calcium cyanamide | |
| 41805004 | Lipoprotein lipase | |
| 41810000 | beta Aminoisobutyric acid | |
| 41830001 | Aromatic-L-amino-acid decarboxylase | |
| 41834005 | Olive oil | |
| 41856008 | Dioxotetrahydropyrimidine phosphoribosyltransferase | |
| 41858009 | Blood group antigen Wetz | |
| 41861005 | 2-Hydroxy-3-oxopropionate reductase | |
| 41875003 | Glutathione-cystine transhydrogenase | |
| 41886001 | Blood group antigen Kenneddy | |
| 41896005 | Hemoglobin Toyama | |
| 41903005 | Hexapradol | |
| 41917001 | Hemoglobin Potomac | |
| 41924000 | NAD^+^ kinase | |
| 41926003 | Cholesterol 7alpha-monooxygenase | |
| 41930000 | Blood group antigen McDermott | |
| 41937002 | Hemoglobin Gower-1 | |
| 41940002 | Mannosyl-oligosaccharide glucosidase | |
| 41945007 | Alkylpiperidine derivative of phenothiazine | |
| 41956007 | Propylene imide | |
| 41967008 | Silver | |
| 41978000 | Blood group antibody V.G. | |
| 41989007 | Lolitrem | |
| 41990003 | Mannosyl-glycoprotein endo-beta-N-acetyl-glucosaminidase | |
| 41994007 | Animal alkaloid | |
| 41999002 | Blood group antibody Joslin | |
| 42001007 | Polychlorinated biphenyl | |
| 42013002 | Banisterine | |
| 42027007 | Alcohol radical | |
| 42033003 | Sterculia gum | |
| 42038007 | HLA-Bw62 antigen | |
| 42048009 | Blood group antibody Terry | |
| 42053004 | Plant teratogen | |
| 42056007 | Placental hormone | |
| 42076001 | Crystallin | |
| 42078000 | Blood group antigen Kursteiner | |
| 42092006 | Blood group antigen Allchurch | |
| 42104001 | L-Fuculokinase | |
| 42107008 | HLA-Cw antigen | |
| 42121005 | Hemopexin | |
| 42122003 | Blood group antibody M^v^ | |
| 42124002 | Glutamate-tRNA ligase | |
| 42130002 | Prephenate dehydratase | |
| 42133000 | Sulfur pentafluoride | |
| 42144008 | Bisulfate salt | |
| 42145009 | Fibrinogen Copenhagen | |
| 42146005 | Iodide salt | |
| 42151004 | ^73^Arsenic | |
| 42159002 | Mushroom poison | |
| 42163009 | Methylphenidate hydrochloride | |
| 42165002 | Immunoglobulin gene | |
| 42166001 | Blood group antigen Kx | |
| 42172001 | Uca pugilator collagenolytic proteinase | |
| 42180008 | Vitamin D>2<, phosphate ester | |
| 42184004 | Hemoglobin G-Norfolk | |
| 42193003 | Stannous fluoride | |
| 42204005 | Cyclic guanosine monophosphate | |
| 42210005 | Leukocyte-membrane neutral endopeptidase | |
| 42212002 | Sodium pentachlorophenate | |
| 42230009 | Bentonite | |
| 42231008 | Bilirubin diglucuronide | |
| 42240007 | Duplicating ink | |
| 42242004 | Aminomuconate-semialdehyde dehydrogenase | |
| 42244003 | Debromoaplysiatoxin | |
| 42248000 | Methyl orange stain (substance) | |
| 42255003 | Blood group antibody Zaw | |
| 42257006 | ^183^Iridium | |
| 42281004 | Cellobiose dehydrogenase (acceptor) | |
| 42303002 | Phytolaccigenin | |
| 42319009 | Lipotropin | |
| 42325008 | Lacrimator gas | |
| 42328005 | o-Chlorobenzylidenemalononitrile | |
| 42333009 | Blood group antibody LW^b^ | |
| 42342002 | Aspartate-semialdehyde dehydrogenase | |
| 42363000 | Ethyl mercury chloride | |
| 42370000 | Mannitol dehydrogenase (cytochrome) | |
| 42371001 | Heterocytotropic antibody | |
| 42382009 | 4-Ipomeanol | |
| 42416001 | Lanolin | |
| 42417005 | Carbon^14^ triolein | |
| 42428009 | Hemoglobin N-Baltimore | |
| 42435001 | Hemoglobin Saint Jacques | |
| 42449005 | Antimony | |
| 42464005 | p-Phenylenediamine | |
| 42465006 | 3-Dehydroquinate dehydratase | |
| 42473002 | Blood group antibody Cross | |
| 42489004 | Cysteine aminotransferase | |
| 42490008 | Blood group antibody Tn (substance) | |
| 42503003 | AMP thymidine kinase | |
| 42507002 | Calmodulin-lysine methyltransferase | |
| 42520004 | Bulrush millet ergot alkaloid | |
| 42549007 | alpha 2 macroglobulin (substance) | |
| 42558000 | Californium radioisotope | |
| 42564007 | Bensulfide | |
| 42566009 | Toluidine | |
| 42580002 | Hemoglobin Etobicoke | |
| 42589001 | ^176^Tantalum | |
| 42605004 | Aldosterone | |
| 42607007 | Carbamoyl-phosphate synthase (ammonia) | |
| 42634005 | GTP cyclohydrolase I | |
| 42657004 | Cyclamate sulfohydrolase | |
| 42664002 | HLA-Dw17 antigen | |
| 42671007 | Rye ergot alkaloid | |
| 42674004 | Sucrose synthase | |
| 42692007 | Naproxen sodium | |
| 42702005 | ^237^Plutonium | |
| 42710006 | Coagulation factor XI variant type II | |
| 42722009 | Hydrogenase | |
| 42728008 | Indium^113^ pentetate | |
| 42730005 | Periodate salt | |
| 42732002 | Lymphocyte antigen CD1a | |
| 42735000 | Carbamoyl-phosphate synthase (glutamine-hydrolysing) | |
| 42753006 | Dextrin dextranase | |
| 42757007 | Hydrofluoric acid | |
| 42761001 | Pyrocatechol | |
| 42768007 | Blood group antigen En^a^TS | |
| 42784008 | Blood group antibody Wd^a^ | |
| 42789003 | ^95^Technetium (substance) | |
| 42799008 | Immunoglobulin idiotype | |
| 42804003 | Lymphocyte antigen CD13 | |
| 42830004 | Blood group antibody Wilson (substance) | |
| 42831000 | ^87m^Yttrium | |
| 42832007 | 2-Dehydro-3-deoxyglucarate aldolase | |
| 42841002 | Zinc oxide | |
| 42848008 | Blood group antigen MPD | |
| 42850000 | Fluorinated hydrocarbon | |
| 42860009 | Hemoglobin Mexico | |
| 42877009 | Anhydrous borate | |
| 42884001 | Neuraminic acid | |
| 42885000 | dTDP-6-deoxy-L-talose dehydrogenase | |
| 42888003 | Blood group antigen Cipriano | |
| 42891003 | Lymphocyte antigen CD56 | |
| 42897004 | Blood group antigen Donati | |
| 42907009 | Carboxylic acid | |
| 42918009 | Arginine 2-monooxygenase | |
| 42922004 | Methemalbumin | |
| 42926001 | Blood group antigen Seymour | |
| 42934007 | Hydroxy phenylpyruvic acid, ortho | |
| 42938005 | alpha-Adrenergic receptor | |
| 42951000 | Methomyl | |
| 42958006 | 5-methyl-3-heptanone | |
| 43004008 | Glucagon-like peptide 1 | |
| 43013005 | Hemoglobin Fannin-Lubbock | |
| 43024007 | Iron salt | |
| 43032004 | Anabasine | |
| 43041009 | Acetate-CoA ligase (ADP-forming) | |
| 43042002 | Platelet antibody HPA-5b | |
| 43048003 | Amphomycin (substance) | |
| 43076006 | Blood group antibody Evans | |
| 43095004 | Complement receptor CRI | |
| 43097007 | Pantothenoylcysteine decarboxylase | |
| 43106008 | Pyronine G stain (substance) | |
| 43117009 | Imidazoleglycerol-phosphate dehydratase | |
| 43136004 | Strontium | |
| 43161001 | Fluoroacetate salt | |
| 43169004 | N-Methyl-2-oxoglutaramate hydrolase | |
| 43171004 | Ovarian hormone | |
| 43181000 | Blood group antibody Cl^a^ (substance) | |
| 43201005 | Amine | |
| 43211003 | n-Acetyl neuraminic acid | |
| 43212005 | Concanavalin A | |
| 43215007 | Glucan 1,3-alpha-glucosidase | |
| 43230003 | Rubber | |
| 43237000 | Succinyldiaminopimelate aminotransferase | |
| 43239002 | ^75^Selenium | |
| 43241001 | Blood group antibody Pelletier | |
| 43268001 | Copper compound | |
| 43278003 | Platelet activating factor | |
| 43289005 | Dihydrofolic acid | |
| 43290001 | Sedoheptulose-bisphosphatase | |
| 43305003 | Protein-tyrosine kinase | |
| 43314008 | Extracellular material | |
| 43328002 | Oxalate-CoA ligase | |
| 43332008 | Coagulation factor IX Lake Elsinor variant | |
| 43342005 | Capric acid | |
| 43347004 | Blood group antigen A>1< Le^d^ | |
| 43356007 | Betaine | |
| 43357003 | Hemoglobin Baylor | |
| 43360005 | Aconitine | |
| 43365000 | L-Threonine 3-dehydrogenase | |
| 43374003 | [Pyruvate dehydrogenase (lipoamide)] kinase | |
| 43397000 | Idiotope | |
| 43417002 | Blood group antibody IH | |
| 43419004 | Bitter almond oil | |
| 43425000 | Blood group antigen Dahl | |
| 43431002 | Maltose | |
| 43436007 | Chromic salt | |
| 43440003 | Melanocyte stimulating hormone releasing factor | |
| 43461005 | Bryonal | |
| 43462003 | Para-aminohippuric acid | |
| 43494008 | Acetoacetyl-CoA hydrolase | |
| 43506001 | Tephrosin | |
| 43514007 | Disodium ethylene bis-(dithiocarbonate) | |
| 43538006 | Non radiopaque medium | |
| 43541002 | Pentapiperide | |
| 43549000 | Solochrome azurine (BS) stain (substance) | |
| 43564000 | Hematite | |
| 43576000 | Blood group antibody N^A^ | |
| 43585000 | Sulfonamide diuretic | |
| 43588003 | Immunoglobulin, GM>9< allotype | |
| 43592005 | Cactinomycin | |
| 43596008 | HLA-Bw64 antigen | |
| 43597004 | Chymodenin | |
| 43605008 | Hemoglobin C-Makassar | |
| 43613009 | Phosphorous pentachloride | |
| 43621003 | Coagulation factor IX Oxford 2 variant | |
| 43625007 | Cholesterol oxidase | |
| 43632003 | Blood group antibody K14 | |
| 43677001 | ^148^Gadolinium | |
| 43678006 | Blood group antigen Pr>3< | |
| 43687002 | Hemoglobin Quong Sze | |
| 43688007 | Testosterone | |
| 43698001 | Hydroxystilbamidine isethionate | |
| 43706004 | Ascorbic acid | |
| 43708003 | Animal feed additive | |
| 43709006 | Phosphatidyl 3-0-alanylglycerol | |
| 43710001 | Butylidene chloride | |
| 43713004 | NAD^+^ synthase | |
| 43723008 | Tributyl phosphate | |
| 43728004 | beta-D-fructofuranose | |
| 43735007 | Sulfur | |
| 43740004 | ^210^Lead | |
| 43743002 | Polyvinyl acetate | |
| 43751004 | RNA-directed RNA polymerase | |
| 43775004 | CMP-N-acetylneuraminate-alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase | |
| 43784004 | Thymic lymphopoietin suppressing factor | |
| 43788001 | Blood group antibody Davis | |
| 43803003 | 2-(Acetamidomethylene) succinate hydrolase | |
| 43804009 | Ethyl silicate | |
| 43807002 | Blood group antigen In^b^ | |
| 43813006 | Phosphoribosylglycinamide formyltransferase | |
| 43819005 | Hemoglobin Kansas | |
| 43821000 | Alcohol dehydrogenase (acceptor) | |
| 43827001 | Blood group antigen Mineo | |
| 43835003 | Zinc gelatin | |
| 43839009 | Aminocarboxymuconate-semialdehyde decarboxylase | |
| 43848004 | Agkistrodon serine proteinase | |
| 43850007 | ^105^Rhodium | |
| 43862006 | Isovitexin beta-glucosyltransferase | |
| 43864007 | Blood group antigen Ull | |
| 43866009 | UDP-N-acetylglucosamine-lysosomal-enzyme-N-acetylglucosaminephosphotransferase | |
| 43871002 | HLA-Dw7 antigen | |
| 43880002 | Chloroacetamide | |
| 43886008 | Boron oxide | |
| 43896004 | p-Dichlorobenzene | |
| 43897008 | ^56^Manganese | |
| 43909000 | Thiamine triphosphate | |
| 43920000 | Hemoglobin A,a | |
| 43921001 | Nickel compound | |
| 43936003 | Oncogene protein fins | |
| 43953005 | Ammonia | |
| 43965009 | Phenothioxin | |
| 43974006 | Alkyl sodium sulphates | |
| 43984007 | Alpha amino acid | |
| 43987000 | Acacia | |
| 43989002 | 3,4-Methylenedioxybenzyl methyl ketone | |
| 44007007 | Padimate O | |
| 44027008 | Seafood | |
| 44033004 | Anthracene | |
| 44035006 | Nitromethane | |
| 44040003 | HLA-Bw57 antigen | |
| 44044007 | Calcium phosphate | |
| 44045008 | Blood group antibody Tasich | |
| 44046009 | Blood group antibody Paular | |
| 44048005 | Geranoyl-CoA carboxylase | |
| 44049002 | Blood group antigen Lindsay | |
| 44059001 | Gamboge | |
| 44063008 | Blood group antigen Pt^a^ | |
| 44068004 | Doxylamine | |
| 44079009 | Urobilinogen | |
| 44090004 | Hemoglobin Handsworth | |
| 44093002 | Blood group antibody KL | |
| 44112005 | Blood group antigen Lu11 | |
| 44120007 | 2,5-Diokovalerate dehydrogenase | |
| 44121006 | Transferase | |
| 44125002 | Aconitate delta-isomerase | |
| 44127005 | alpha, alpha-Trehalase | |
| 44139002 | Blood group antigen Don E. W. | |
| 44142008 | Hemoglobin Ocho Rios | |
| 44153002 | Cytokinin 7-beta-glucosyltransferase | |
| 44158006 | Lymphocyte antigen CD64 | |
| 44159003 | Barium oxide | |
| 44179006 | Renilla-luciferin 2-monooxygenase | |
| 44205007 | Grayanotoxin | |
| 44207004 | Methylaspartate ammonia-lyase | |
| 44212003 | Anti SS-A antibody | |
| 44220001 | Formate acetyltransferase | |
| 44225006 | Oncogene protein N-RAS | |
| 44234001 | Strontium isotope (substance) | |
| 44239006 | Platelet antibody HPA-1 | |
| 44262008 | Oxidized cellulose | |
| 44293009 | Phenoxybenzamine hydrochloride | |
| 44302008 | Peptidyl-glutaminase | |
| 44320004 | alpha-Naphthol | |
| 44330008 | Pyrvinium pamoate | |
| 44331007 | Blood group antibody In^b^ | |
| 44344002 | Abscisic acid | |
| 44347009 | Lergotrile | |
| 44368005 | Oncogene protein HER-2/neu | |
| 44369002 | Anaphylatoxin | |
| 44370001 | Oncogene protein c-fos | |
| 44394001 | Copper naphthenate | |
| 44404008 | Sulfoxide | |
| 44406005 | Polyethylene glycol alkyl ether | |
| 44407001 | [Acyl-carrier-protein] malonyltransferase | |
| 44411007 | GC globulin | |
| 44413005 | beta-Thiocyanoethyl fatty acid ester | |
| 44417006 | Monoterpenol beta-glucosyltransferase | |
| 44439008 | Blood group antigen Smith | |
| 44446004 | Petroleum product | |
| 44447008 | Blood group antigen Fleming | |
| 44459007 | Interleukin-8 | |
| 44461003 | Homoserine acetyltransferase | |
| 44469001 | Fibrinogen Petoskey | |
| 44472008 | Blood group antibody Begovitch | |
| 44475005 | Fucoidanase | |
| 44488008 | Bismark brown R stain (substance) | |
| 44495004 | ^126^Antimony | |
| 44506007 | ^112^Silver | |
| 44508008 | Hydromorphone | |
| 44510005 | UDPglucose-hexose-1-phosphate uridylyltransferase | |
| 44517008 | Glycerol-3-phosphate dehydrogenase | |
| 44520000 | Nylidrin hydrochloride | |
| 44533006 | Benzaldehyde dehydrogenase (NAD^+^) | |
| 44555003 | Methylenedioxyamphetamine | |
| 44556002 | Pyruvate decarboxylase | |
| 44581004 | 1-1-Dichloro-1-nitroethane | |
| 44588005 | Iodine | |
| 44590006 | Callistin toxin | |
| 44603007 | Iodinated glycerol | |
| 44609006 | Calcitonin gene-related peptide | |
| 44611002 | Nitrosyl chloride | |
| 44624002 | Fibrinogen New Orleans I | |
| 44632005 | 4,7,10,13,16,19-Docosahexaenoic acid | |
| 44639001 | Solid carbon dioxide | |
| 44644008 | Mycotoxin | |
| 44675004 | Blood group antibody Nou | |
| 44680008 | Factor VIII antigen | |
| 44681007 | Hypothalamic inhibiting factor | |
| 44686002 | Blood group antigen Lud | |
| 44706009 | Lymphocyte antigen CD3 | |
| 44711006 | Gastrin II | |
| 44719008 | Mediator of immune response | |
| 44728009 | Complement component C1 | |
| 44740009 | Choline oxidase | |
| 44742001 | Hemoglobin Louisville | |
| 44746003 | Bufotalin | |
| 44753007 | Thymine,2-oxoglutarate dioxygenase | |
| 44770004 | Intracisternal granule of ER | |
| 44776005 | Xenon radioisotope | |
| 44822001 | Ethyl bromide | |
| 44824000 | Blood group antibody Pearl | |
| 44837002 | Cyclopropane | |
| 44839004 | Armillaria mellea neutral proteinase | |
| 44858008 | Hemoglobin Q-Iran | |
| 44896009 | Hemoglobin Hamilton | |
| 44908000 | Chlorzoxozone | |
| 44924004 | Endorphin receptor (substance) | |
| 44931000 | Adenosylhomocysteinase | |
| 44937001 | beta-Ureidopropionase | |
| 44954009 | Oncogene protein TCRG | |
| 44970006 | Aspartic acid | |
| 44971005 | Thromboxane synthase | |
| 44973008 | ^182^Tantalum | |
| 44976000 | Hydroxy-mercuricresol | |
| 45001002 | Bone matrix | |
| 45003004 | Virus receptor | |
| 45011009 | Tyramine N-methyltransferase | |
| 45018003 | Steroid N-acetylglucosaminyltransferase | |
| 45025005 | Permanganic acid | |
| 45026006 | Blood group antigen M^v^ | |
| 45032001 | Hemoglobin D-Ibadan | |
| 45041006 | Dicycloxylamine | |
| 45044003 | Blood group antibody Lud | |
| 45047005 | Lymphokine | |
| 45060004 | Yttrium compound | |
| 45065009 | myo-Inosose-2 dehydratase | |
| 45068006 | 3-Hydroxybutyryl-CoA epimerase | |
| 45084007 | Fibrin degradation product, D fragment | |
| 45087000 | Oleoyl-[acyl-carrier-protein] hydrolase | |
| 45095001 | Blood group antigen K18 | |
| 45106005 | Congo red stain (substance) | |
| 45108006 | Lysosomal carboxypeptidase B | |
| 45119009 | Glycine salt of bile acid | |
| 45120003 | Ester | |
| 45137005 | Hemoglobin Suresnes | |
| 45141009 | Ornithine carbamoyltransferase | |
| 45158004 | Fluorine isotope | |
| 45159007 | Azatadine maleate | |
| 45160002 | Oxazine dye | |
| 45174009 | Alkylglycerophosphoethanolamine phosphodiesterase | |
| 45193006 | Blood group antibody Horw | |
| 45199005 | Oil of geranium | |
| 45207006 | Dextroamphetamine sulfate (substance) | |
| 45209009 | Epsilon-chain hemoglobin | |
| 45215009 | Tantalum | |
| 45219003 | Sodium monofluoroacetate | |
| 45246008 | C4bp complement protein | |
| 45262002 | Mercury | |
| 45266004 | Antiplasmin | |
| 45273009 | Blood group antigen hr^H^ | |
| 45285001 | Hemoglobin Arya | |
| 45321005 | Blood group antibody M | |
| 45333000 | Blood group antigen Sl^a^ | |
| 45345009 | Hemoglobin A>2< Victoria | |
| 45367005 | Tungsten radioisotope | |
| 45373006 | NADH peroxidase | |
| 45375004 | Hemoglobin F-Carlton | |
| 45380008 | ^134m^Cesium | |
| 45386002 | Purine | |
| 45388001 | Blood group antigen Laine | |
| 45389009 | Tissue stain | |
| 45394009 | Monophenol monooxygenase | |
| 45396006 | Cardiolipin antibody | |
| 45397002 | Hemoglobin Matsue-Oki | |
| 45407009 | Blood group antigen Ghawiler | |
| 45425002 | Tellurium compound | |
| 45428000 | Blood group antibody Perry | |
| 45436009 | Tenebrio alpha-proteinase | |
| 45441001 | Blood group antigen Tk (substance) | |
| 45442008 | Phenyl mercuric chloride | |
| 45454008 | Cerebrin | |
| 45457001 | Lipopolysaccharide N-acetylglucosaminyltransferase | |
| 45470005 | Bromacil | |
| 45475000 | Indigo carmine stain (substance) | |
| 45483006 | Psilocin | |
| 45487007 | Trifluridine ophthalmic preparation | |
| 45510000 | Blood group antibody Jopson | |
| 45524001 | Dextranomer | |
| 45528003 | Blood group antibody Dugstad | |
| 45530001 | Antinuclear antibody | |
| 45537003 | Farnesyltranstransferase | |
| 45539000 | Succinate dehydrogenase (ubiquinone) | |
| 45542006 | Thiosulfate salt | |
| 45555007 | Norepinephrine | |
| 45570008 | Mevaldate reductase (NADPH) | |
| 45585002 | beta-1 Adrenergic receptor | |
| 45601001 | Blood group antibody A.M. | |
| 45604009 | Tranquilizer | |
| 45609004 | Hemoglobin F-Pendergrass | |
| 45620004 | Pyrethrin | |
| 45622007 | 3-Deoxy-D-manno-octulosonate aldolase | |
| 45627001 | ^41^Argon | |
| 45637006 | Blood group antibody Bonde | |
| 45641005 | Hemoglobin Atlanta | |
| 45648004 | Angiotensin receptor | |
| 45656001 | HLA-Bw22 antigen | |
| 45668005 | Blood group antigen Bouteille | |
| 45672009 | Blood group antibody Lu11 | |
| 45695000 | Plant alkaloid | |
| 45698003 | Putrescine | |
| 45710003 | Sputum | |
| 45717000 | Coniferyl-alcohol dehydrogenase | |
| 45729009 | Glucosamine-phosphate acetyltransferase | |
| 45733002 | Magnesium chloride | |
| 45737001 | Glycolic acid | |
| 45754009 | Alpha interferon | |
| 45784001 | Xanthine oxidase | |
| 45791003 | Mannose-1-phosphate guanylyltransferase (GDP) | |
| 45799001 | Tissue-endopeptidase degrading collagenase-synthetic-substrate | |
| 45800002 | L-Arabinose isomerase | |
| 45807004 | Coagulation factor IX variant | |
| 45849009 | Technetium Tc^99m^ sodium glucoheptonate | |
| 45857007 | Antilysosomal antibody | |
| 45867002 | Glyoxylate dehydrogenase (acylating) | |
| 45878005 | Immunologic receptor | |
| 45883002 | Mitochondrial RNA | |
| 45922005 | Amphibole asbestos | |
| 45932003 | Anti Jo-1 antibody | |
| 45934002 | Blood group antigen Os^a^ | |
| 45940009 | Theophylline anhydrous | |
| 45946003 | Proglucagon | |
| 45947007 | Amylo-1,6-glucosidase | |
| 45952002 | 1-Acylglycerol-3-phosphate acyltransferase | |
| 45954001 | Arginine racemase | |
| 45957008 | Vinyl acetate | |
| 45960001 | Naepaine | |
| 45962009 | Collodion | |
| 45969000 | Blood group antibody i | |
| 45986006 | Teratogenic substance | |
| 45992000 | Blood group antigen s | |
| 45996002 | CDPacylglycerol arachidonyltransferase | |
| 45997006 | Omega amino acid | |
| 46015007 | Melanocyte stimulating hormone | |
| 46016008 | Mancozeb | |
| 46021006 | ^91^Strontium | |
| 46031004 | Salt water | |
| 46046006 | Immunoglobulin A (substance) | |
| 46058006 | Prostaglandin PGG2 | |
| 46064004 | Asparagine-oxo-acid aminotransferase | |
| 46066002 | dTDPglucose 4,6 dehydratase | |
| 46075000 | Oligosaccharide | |
| 46084000 | 2-Aminoadipate aminotransferase | |
| 46096007 | Blood group antibody Knudsen | |
| 46097003 | Lactated Ringer's solution | |
| 46120009 | 17-Ketosteroid | |
| 46122001 | Antitreponemal agent | |
| 46134009 | Prostaglandin PGA1 | |
| 46137002 | Borneol | |
| 46139004 | Martius yellow stain (substance) | |
| 46146008 | Cefotetan disodium | |
| 46150001 | HLA-Bw4 antigen | |
| 46158008 | HLA-Dw14 antigen | |
| 46164001 | ^109^Indium | |
| 46187009 | Abequosyltransferase | |
| 46188004 | D-Glutamyltransferase | |
| 46191004 | Cataglykin | |
| 46195008 | Blood group antibody Smith | |
| 46201000 | Piperidolate | |
| 46225008 | Cholecystokinin | |
| 46234003 | Blood group antigen Nob (substance) | |
| 46242002 | Body secretion | |
| 46243007 | Methyl sulfate difenzoquat | |
| 46245000 | Haemoglobin Korle-Bu | |
| 46250006 | Slaframine | |
| 46257009 | Triiodomethane | |
| 46261003 | Blood group antigen C^x^ | |
| 46281002 | Caffeate o-methyltransferase | |
| 46290009 | Bisphosphoglycerate phosphatase | |
| 46293006 | Bromocriptine mesylate | |
| 46310006 | Glycine dehydrogenase (decarboxylating) | |
| 46320001 | N-Acylsphingosine galactosyltransferase | |
| 46321002 | Asterotoxin | |
| 46329000 | Chocolate milk | |
| 46331009 | Blood group antibody K13 | |
| 46335000 | Sulisobenzone | |
| 46336004 | Complement component C2b | |
| 46338003 | Cysteine-S-conjugate N-acetyltransferase | |
| 46344004 | Alginate synthase | |
| 46346002 | Tabernamontanain | |
| 46358002 | ^118^Antimony | |
| 46384008 | Ink | |
| 46407003 | GDPmannose 4,6 dehydratase | |
| 46409000 | Bilirubin-glucuronoside glucuronosyltransferase | |
| 46417008 | Chlorate salt | |
| 46425005 | Intestinal vomitus | |
| 46445002 | 11beta-Hydroxysteroid dehydrogenase | |
| 46461000 | Fucose-1-phosphate guanylyltransferase | |
| 46469003 | Properdin convertase, complement component | |
| 46484007 | Bleaching powder | |
| 46491005 | Menthyl anthranilate | |
| 46492003 | Nivalenol | |
| 46509002 | 1-Phosphofructokinase | |
| 46512004 | Tertiary butyl chromate | |
| 46514003 | Calcium mandelate | |
| 46519008 | Blood group antibody ILe^bH^ | |
| 46520002 | Immunoglobulin, GM>2< allotype | |
| 46539007 | Complement component C1r | |
| 46543006 | ^107^Palladium | |
| 46548002 | Leukotriene B | |
| 46558003 | Imipenem | |
| 46566007 | Arylamine N-methyltransferase | |
| 46572007 | Coagulation factor XI | |
| 46583003 | Actin | |
| 46591007 | Superfatted soap | |
| 46601006 | Diazomethane | |
| 46602004 | Electron | |
| 46610003 | 3-Dehydrosphinganine reductase | |
| 46613001 | HLA-Bw58 antigen | |
| 46654009 | Tetrahydrocortisone | |
| 46663006 | Blood group antibody Lee | |
| 46668002 | Homatropine methylbromide | |
| 46682002 | Ribonuclease T>2< | |
| 46684001 | Hemoglobin N-Seattle | |
| 46685000 | Serine-ethanolaminephosphate phosphodiesterase | |
| 46691003 | Organoalkyl mercury | |
| 46711008 | Diglycol hydroiodide (substance) | |
| 46730008 | Blood group antigen Bio-5 | |
| 46736002 | Glutamate racemase | |
| 46743008 | Nucleotide pyrophosphatase | |
| 46749007 | Medicinal iodine | |
| 46755002 | Blood group antigen Schor | |
| 46757005 | Hemoglobin St. Antoine | |
| 46769002 | Immune suppressor gene | |
| 46810001 | Flint | |
| 46815006 | Connective tissue matrix | |
| 46840004 | Animal oil | |
| 46841000 | Blood group antigen BOW | |
| 46843002 | Xanthine | |
| 46845009 | Tyrosine phenol-lyase | |
| 46859002 | Septicine | |
| 46861006 | Deoxynivalenol | |
| 46864003 | Thiocyanate isomerase | |
| 46887006 | Ambenonium chloride | |
| 46921009 | Quinoline dye | |
| 46932009 | Thyroid colloid | |
| 46942006 | Oxamic acid | |
| 46943001 | Cortolone (substance) | |
| 46950002 | Protriptyline hydrochloride | |
| 46959001 | Lymphocyte antigen CD11c | |
| 46961005 | Hydroxypyruvate isomerase | |
| 46974004 | Hemoglobin Oleander | |
| 46978001 | Cyclopentanol dehydrogenase | |
| 46985002 | 1,2-Dichloroethene | |
| 47019005 | Blood group antigen Hildebrandt | |
| 47023002 | Lymphocyte antigen CD66 | |
| 47026005 | Thymol oxide | |
| 47030008 | Insoluble berlin blue stain (substance) | |
| 47038001 | HLA antigen | |
| 47052004 | Chemical suspension | |
| 47053009 | ^193^Gold | |
| 47068005 | Blood group antibody Jr^a^ | |
| 47088009 | Carboxymethylenebutenolidase | |
| 47097008 | Oxaloacetic acid | |
| 47104007 | Blood group antigen Co3 | |
| 47121003 | Bismuth isotope | |
| 47136000 | Blood group antigen Manley | |
| 47151009 | Blood group antibody Win | |
| 47167003 | Glyceraldehyde-3-phosphate | |
| 47169000 | Aminoacyl-methylhistidine dipeptidase | |
| 47172007 | Sulfuric acid | |
| 47174008 | Glutamine-pyruvate aminotransferase | |
| 47176005 | Methdilazine hydrochloride | |
| 47180000 | Methisazone (substance) | |
| 47184009 | Silver compound | |
| 47189004 | ^195^Thallium | |
| 47192000 | Meglumine diatrizoate | |
| 47201006 | 5-Hydroperoxy-6,8,11,14-eicosatetraenoic acid | |
| 47204003 | Ferbam | |
| 47205002 | Cobalt blue | |
| 47215008 | Blood group antigen Sc2 | |
| 47218005 | Fibrinogen Giessen II (substance) | |
| 47232007 | Alkyl quaternary ammonium bromide | |
| 47245006 | Dolichyl-phosphate alpha-N-acetylglucosaminyltransferase | |
| 47247003 | Fibrinogen Kyoto | |
| 47280005 | Macrocyclic trichothecenes | |
| 47291003 | Mucor pusillus aspartic proteinase | |
| 47310000 | Exoribonuclease II | |
| 47313003 | Hemoglobin A>2< Adria | |
| 47336007 | Fibrinogen Manchester | |
| 47341004 | Blood group antigen Driver | |
| 47343001 | N-Formyl methionylaminoacyl-transfer ribonucleic acid deformylase (substance) | |
| 47349002 | beta Neoendorphin | |
| 47350002 | Pregnenolone | |
| 47355007 | Benzodiazepine nucleus | |
| 47358009 | Polystyrene | |
| 47364002 | Blood group antigen Ryan | |
| 47368004 | Nucleoside | |
| 47379009 | Technetium compound | |
| 47380007 | ^210^Bismuth | |
| 47383009 | Cephaeline | |
| 47389008 | Methyl tert-butyl ether | |
| 47407008 | Sphingolipid | |
| 47408003 | Naftifine hydrochloride | |
| 47413004 | Fat emulsion | |
| 47414005 | Trimethidinium | |
| 47419000 | Long-chain-alcohol fatty-acyltransferase | |
| 47425001 | ^187^Iridium | |
| 47431003 | Dichlorobenzene | |
| 47448006 | Hot water | |
| 47463009 | ^209^Lead | |
| 47464003 | Blood group antibody Woit | |
| 47469008 | Blood group antibody Seymour | |
| 47472001 | 4-Hydroxy-3-methoxy mandelic acid | |
| 47486002 | Fast red ITR stain (substance) | |
| 47500008 | Borate pentahydrate | |
| 47521008 | ^109^Palladium | |
| 47543000 | Exodeoxyribonuclease I | |
| 47553004 | Blood group antibody Sul | |
| 47562002 | 4-Hydroxybutyrate dehydrogenase | |
| 47565000 | I region, MHC | |
| 47581005 | Type 1 chain precursor structure (lacto-N-tetraosylceramide) | |
| 47588004 | ^203^Lead | |
| 47601000 | Blood group antigen Savery | |
| 47603002 | Blood group antibody Pillsbury (substance) | |
| 47617006 | Basic amino acid | |
| 47618001 | (R)-Aminopropanol dehydrogenase | |
| 47619009 | Phosphoramidate-hexose phosphotransferase | |
| 47626009 | Blood group antibody Kemma | |
| 47635002 | Lauryl isoquinolinium bromide | |
| 47646004 | Antiarin | |
| 47662005 | Blood group antigen h | |
| 47663000 | Clindamycin palmitate hydrochloride | |
| 47670000 | Colonic mucus | |
| 47674009 | Blood group antigen Pr>1d< | |
| 47676006 | ^39^Chlorine | |
| 47677002 | Orange oil | |
| 47691008 | Fibrin degradation product, first derivative | |
| 47692001 | Blood group antigen Rm | |
| 47702003 | Carboxylesterase | |
| 47703008 | Lactose | |
| 47707009 | Anion | |
| 47711003 | Allyl chloride | |
| 47714006 | Fibrinogen Troyes | |
| 47716008 | Nucleotide pyrophosphokinase | |
| 47729008 | Potassium chloride K^43^ | |
| 47733001 | Blood group antibody Bradford | |
| 47735008 | Chalcone isomerase | |
| 47737000 | Valine dehydrogenase (NADP^+^) | |
| 47769009 | Platelet antibody HPA-5 | |
| 47773007 | D-Nopaline dehydrogenase | |
| 47784000 | Blood group antibody IP | |
| 47786003 | Hemoglobin Austin | |
| 47788002 | Hemoglobin J-Medellin | |
| 47799000 | ^126^Cesium | |
| 47809000 | Arsenic | |
| 47826006 | Thiourea | |
| 47832001 | Alkaline phosphatase isoenzyme | |
| 47834000 | Oxophenarsine hydrochloride | |
| 47845002 | Glycoprotein 4-beta-galactosyltransferase | |
| 47851007 | HLA-Aw69 antigen | |
| 47853005 | Parachlorophenol | |
| 47857006 | Quinine sulfate | |
| 47860004 | HLA-A3 antigen | |
| 47862007 | Schizozygine | |
| 47888005 | Propionyl-CoA carboxylase | |
| 47894002 | Tumor necrosis factor beta | |
| 47899007 | Oxyhemoglobin F | |
| 47900002 | Adenylylsulfate reductase | |
| 47901003 | 5-Trimethoxyamphetamine | |
| 47910006 | Neurophysin | |
| 47929000 | Hemoglobin M-Milwaukee-I | |
| 47937008 | Ipecac syrup | |
| 47946002 | Hemoglobin F-Heather | |
| 47950009 | Taurocholic acid | |
| 47974007 | Blood group antibody Tg^a^ | |
| 47994003 | Immunoglobulin, GM>25< allotype | |
| 47995002 | Alcohol soluble nigrosine stain (substance) | |
| 47998000 | Hemoglobin Connecticut | |
| 48006008 | Ion | |
| 48041007 | Benomyl | |
| 48050009 | Glycosylceramidase | |
| 48051008 | Carnitine acetyltransferase | |
| 48052001 | Enalaprilat | |
| 48060000 | Blood group antigen Ritter (substance) | |
| 48070003 | Phenylpiperidine derivative | |
| 48078005 | Butyl aminobenzoate | |
| 48095002 | Nicotinate dehydrogenase | |
| 48102008 | 3alpha-Hydroxysteroid dehydrogenase | |
| 48109004 | Blood group antigen Js^a^ | |
| 48110009 | 4-Hydroxyphenylacetate 1-monooxygenase | |
| 48111008 | Immunoglobulin, J piece | |
| 48116003 | Blood group antigen Paris | |
| 48131007 | Blood group antibody Neut | |
| 48132000 | Fibrinogen New York I | |
| 48140006 | Blood group antibody Whittaker | |
| 48154003 | Blood group antibody Zwal | |
| 48161004 | Galactosylgalactosylglucosylceramidase | |
| 48170001 | HLA-Cw1 antigen | |
| 48172009 | Cefamandole nafate | |
| 48175006 | Sea-urchin-hatching proteinase | |
| 48179000 | Hemoglobin T-Cambodia | |
| 48181003 | Trimethylamine | |
| 48184006 | Tropomyosin | |
| 48199006 | Diamthazole (substance) | |
| 48207007 | Methylcytisine | |
| 48209005 | ^232^Thorium | |
| 48212008 | Hemoglobin Chemilly | |
| 48214009 | Oncogene protein TCL5 | |
| 48217002 | Complement regulator | |
| 48244007 | L-Xylulose reductase | |
| 48265001 | 1,3-Dichloro-5,5- dimethylhydantoin | |
| 48270008 | Lymphocyte antigen CDw49f | |
| 48271007 | ^105^Silver | |
| 48282004 | Sorbose dehydrogenase | |
| 48284003 | Antigen in Kell (KEL) blood group system | |
| 48302003 | Methylcyclohexanone | |
| 48323009 | Blood group antibody Schneider | |
| 48324003 | Vinyl cyclohexene dioxide | |
| 48332006 | Plant cyanogenic glycoside | |
| 48341001 | ^192^Iridium | |
| 48358006 | Heme oxygenase (decyclizing) | |
| 48366002 | Blood group antigen Rh39 | |
| 48369009 | ^183^Tantalum | |
| 48384000 | Amitriptyline hydrochloride | |
| 48401006 | Blood group antigen I | |
| 48416009 | Blood group antigen Green | |
| 48417000 | HLA-Dw26 antigen | |
| 48444005 | Freund's adjuvant | |
| 48464000 | Blood group antibody Sw^a^ | |
| 48474002 | Albuterol sulfate (substance) | |
| 48478004 | Aminoglycoside N^3'^-acetyltransferase | |
| 48486004 | Immunoglobulin IgG4 (substance) | |
| 48494006 | N-Acetylgalactosamine-4-sulfatase | |
| 48517003 | Pepsin A | |
| 48540004 | Patent blue V sodium salt stain (substance) | |
| 48551004 | Fusion oncogene protein | |
| 48562004 | Monobutyl phenyl phenol sodium monosulfonate | |
| 48581007 | Plastic reagent (substance) | |
| 48583005 | Immunoglobulin E | |
| 48590000 | 1,2-Cyclic-inositol-phosphate phospho-diesterase | |
| 48593003 | Safrol | |
| 48605006 | Glycolaldehyde dehydrogenase | |
| 48618003 | Sodium para-aminohippurate | |
| 48650008 | Procollagen galactosyltransferase | |
| 48663002 | Alkylhalidase | |
| 48682006 | Metridium proteinase A | |
| 48686009 | Aluminum radioisotope | |
| 48693008 | Phenaglycodol | |
| 48699007 | Blood group antigen Carson | |
| 48714008 | Palladium | |
| 48727007 | Interleukin-4 | |
| 48736006 | Ribitol teichoic acid | |
| 48741003 | Toothpaste | |
| 48751002 | Blood group antibody Can | |
| 48753004 | Cefuroxime sodium | |
| 48766004 | Glycerate kinase | |
| 48779008 | Blood group antibody Hamet | |
| 48798005 | Antigen in Lutheran (LU) blood group system | |
| 48802006 | Chlorogenate hydrolase | |
| 48815002 | Blood group antigen Shannon | |
| 48821003 | Lymphocyte antigen CD19 | |
| 48824006 | Aminoimidazolase | |
| 48830006 | 2-Acylglycerol-3-phosphate acyltransferase | |
| 48847007 | Hemolysin venom | |
| 48861002 | ^99^Molybdenum | |
| 48869000 | Blood group antigen Jordan | |
| 48885005 | Vanadium pentoxide dust | |
| 48893005 | Sodium dinitro-ortho-cresylate | |
| 48895003 | ^113m^Indium | |
| 48898001 | Hemoglobin Buenos Aires | |
| 48910008 | ^21^Neon | |
| 48915003 | Chitinase | |
| 48919009 | Blood group antigen Block | |
| 48931006 | Enoyl-[acyl-carrier-protein] reductase (NADPH) | |
| 48940005 | Methoxypromazine (substance) | |
| 48945000 | Oxalate decarboxylase | |
| 48949006 | Hemoglobin Duan | |
| 48968009 | Histidine aminotransferase | |
| 48978007 | Cesium hydroxide | |
| 48988008 | Prostaglandin PGE1 (substance) | |
| 49003009 | Osmium radioisotope | |
| 49009008 | NAPH cytochrome-c>2< reductase | |
| 49010003 | Paraprotein | |
| 49022000 | Merethoxylline procaine | |
| 49028001 | Blood group antibody K16 | |
| 49046007 | Human structural gene | |
| 49053003 | Tuftsin | |
| 49056006 | Sucrose alpha-glucosidase | |
| 49060009 | mRNA (guanine-N^7^)-methyltransferase | |
| 49067007 | Thymic neuromuscular function blocking agent | |
| 49069005 | Lead isotope | |
| 49106003 | HLA-DR1 antigen | |
| 49115005 | Polyphosphate-glucose phosphotransferase | |
| 49119004 | Blood group antigen Bryant | |
| 49143001 | ^201m^Bismuth | |
| 49145008 | Demecarium bromide | |
| 49146009 | Cutaneous fluid | |
| 49148005 | HLA-Cw11 antigen | |
| 49163008 | Blood group antigen Sd^a^ | |
| 49173005 | Oil of spike | |
| 49174004 | ^85^Yttrium | |
| 49185002 | Germanium radioisotope | |
| 49193002 | Pyranose oxidase | |
| 49208007 | Cinerin | |
| 49212001 | Blood group antigen D 1276 | |
| 49214000 | Concanavalin receptor | |
| 49251006 | scyllo-Inosamine kinase | |
| 49254003 | ^201^Bismuth | |
| 49291009 | Glycine dehydrogenase (cytochrome) | |
| 49313009 | Nialamide | |
| 49314003 | Flavonol O^3^-glucosyltransferase | |
| 49318000 | ^173^Hafnium | |
| 49322005 | Hemoglobin F-Sardinia | |
| 49327004 | Interferon | |
| 49328009 | myo-Inositol 1-methyltransferase | |
| 49344000 | Blood group antibody VK | |
| 49352002 | Mediator of inflammation (substance) | |
| 49354001 | Acetolactate synthase | |
| 49358003 | Linoleate isomerase | |
| 49371000 | Methscopolamine bromide | |
| 49377001 | Blood group antigen Davis | |
| 49378006 | Eccrine sweat | |
| 49382008 | Oil of cherry laurel | |
| 49383003 | Maltose acetyltransferase | |
| 49389004 | Protoporphyrinogen III | |
| 49399009 | Magnesium salicylate | |
| 49419007 | Active C4b | |
| 49426007 | Lewis acid | |
| 49427003 | 3,5 Diiodothyronine | |
| 49444004 | Maleic hydrazide | |
| 49449009 | Blood group antibody Wimberly | |
| 49451008 | Ethaverine | |
| 49461001 | Hemoglobin Hobart | |
| 49469004 | Phosphoribokinase | |
| 49471004 | Diacetoxyscirpenol | |
| 49477000 | Phosalone | |
| 49478005 | ^195m^Mercury | |
| 49495002 | HLA-A antigen | |
| 49506005 | Gluconic acid | |
| 49508006 | Heparitin-sulfate lyase | |
| 49519009 | Immunoglobulin, F(ab')>2< fragment | |
| 49529002 | UDP glucose 4,6-dehydratase | |
| 49543007 | Succinate dehydrogenase | |
| 49551005 | Oil of organum | |
| 49559007 | Zinc pelargonate | |
| 49560002 | Heptachloro-camphene | |
| 49565007 | Disopyramide phosphate | |
| 49568009 | Blood group antigen Terrell | |
| 49576006 | 1,1,1-Trichloroethane | |
| 49582009 | Blood group antigen Dantu | |
| 49599005 | Private blood group antibody | |
| 49602000 | Isoproterenol sulfate (substance) | |
| 49613002 | Hemoglobin Malmo | |
| 49616005 | Monoclonal antibody | |
| 49633003 | Prolyl dipeptidase | |
| 49636006 | Lochia | |
| 49643000 | Oil of cypress | |
| 49653004 | Blood group antigen Taur | |
| 49660005 | Methylmalonyl-CoA carboxyltransferase | |
| 49677005 | HLA-Dw22 antigen | |
| 49686000 | Propanediol dehydratase | |
| 49687009 | Coriphosphine stain (substance) | |
| 49695008 | Lead sulfide | |
| 49702009 | Phenylacetaldehyde dehydrogenase | |
| 49722008 | Somatostatin | |
| 49724009 | Pyrvinium chloride | |
| 49733006 | 2-Oxopent-4-enoate hydratase | |
| 49739005 | n-1-Naphthyl-phthalamic acid | |
| 49743009 | ^241^Californium | |
| 49744003 | Blood group antibody M1^a^ | |
| 49745002 | Adenosine diphosphate | |
| 49772005 | Blood group antigen Simon | |
| 49775007 | 15-Hydroxyprostaglandin dehydrogenase (NADP^+^) | |
| 49777004 | bis-(Isopropylamido) fluorophosphate | |
| 49797009 | ^193^Osmium | |
| 49821006 | Immunoglobulin, KM>1< allotype | |
| 49837000 | Blood group antigen Horn | |
| 49839002 | Hexamethonium | |
| 49846006 | Carboxymethyloxysuccinate lyase | |
| 49849004 | Trichlorfon (substance) | |
| 49858006 | Lymphocyte antigen CDw52 | |
| 49867006 | Leucine 2,3-aminomutase | |
| 49869009 | Gonadotropin releasing factor | |
| 49873007 | Tetrahymena aspartic proteinase | |
| 49884000 | Barium isotope | |
| 49889005 | Formiminoglutamic acid | |
| 49893004 | Polyamine methylene resin | |
| 49902002 | Hemoglobin Himeji | |
| 49909006 | Mucus | |
| 49912009 | Blood group antigen D^w^ | |
| 49944008 | alpha Fetoprotein | |
| 49952006 | 4-Dimethylaminoazobenzene | |
| 49977007 | Lead compound | |
| 49991001 | Blood group antigen Mateja | |
| 49997002 | HLA-Bw59 antigen | |
| 49998007 | Sufentanil | |
| 50010001 | 4-Nitrobiphenyl | |
| 50028004 | Blood group antibody Boston | |
| 50045009 | Heparin sodium | |
| 50062004 | Fuchsin basic stain (substance) | |
| 50068000 | Phytochrome | |
| 50073006 | Dimethylglycine dehydrogenase | |
| 50095005 | Hemoglobin S | |
| 50096006 | 3-Isopropylmalate dehydrogenase | |
| 50100007 | Chrysotile | |
| 50106001 | Formate dehydrogenase (cytochrome-c-553) | |
| 50107005 | Immunoglobulin, GM>5< allotype | |
| 50129009 | Hemoglobin St. Louis | |
| 50139003 | Glycoprotein 6-alpha-L-fucosyltransferase | |
| 50140001 | Choline acetyltransferase | |
| 50142009 | NADPH-ferrihemoprotein reductase | |
| 50151001 | Flavoprotein | |
| 50156006 | Blood group antigen Le^b^ | |
| 50191003 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase | |
| 50195007 | O-Acetylserine (thiol)-lyase | |
| 50213009 | Chloride salt | |
| 50218000 | Melarsonyl | |
| 50221003 | Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase | |
| 50233008 | gamma-Ketovaleric acid | |
| 50254001 | Viral gene | |
| 50272007 | Blood group antibody hr^s^ | |
| 50298001 | ^235^Uranium | |
| 50306007 | Sodium tetraborate (substance) | |
| 50309000 | Sodium oxalate | |
| 50352000 | Organic phosphorus compound | |
| 50358001 | Heparin lyase | |
| 50359009 | ^45^Calcium | |
| 50371003 | Carnosine | |
| 50374006 | ^120^Iodine | |
| 50383001 | HLA-Bw76 antigen | |
| 50418002 | Hexose oxidase | |
| 50423002 | Formamidase | |
| 50425009 | ^114^Indium | |
| 50431007 | Cortisone alpha-reductase | |
| 50456001 | Urine protein | |
| 50470001 | Human genome | |
| 50473004 | Female genital fluid | |
| 50479000 | Soy protein-iron complex | |
| 50480002 | Blood group antigen Ri^a^ | |
| 50491009 | Yttrium isotope | |
| 50502005 | ^194^Gold | |
| 50507004 | N-phenylacetamide | |
| 50512003 | Phospholipase A>1< | |
| 50526007 | Blood group antibody S^D^ | |
| 50533007 | Adenosine nucleosidase | |
| 50550009 | 6-Phospho 2-dehydro-3-deoxygalactonate aldolase | |
| 50580004 | Sulthiamine | |
| 50593009 | Casein | |
| 50605001 | L-Amino-acid oxidase | |
| 50622004 | Cholesterol esterase | |
| 50627005 | Labetalol hydrochloride | |
| 50641001 | Hemoglobin G-Taichung | |
| 50656005 | Creatininase | |
| 50661007 | Bismuth subgallate | |
| 50665003 | Hydrocortisone butyrate | |
| 50668001 | Oncogene protein TCRA | |
| 50672002 | Hafnium | |
| 50685004 | Epinephrine hydrochloride | |
| 50700004 | Blood group antigen Heibel | |
| 50706005 | Fibrinogen Malmoe | |
| 50716002 | ^122^Antimony | |
| 50735002 | Coagulation factor X Melbourne variant | |
| 50750006 | Hexachlorobenzene | |
| 50752003 | Blood group antibody Wiley | |
| 50754002 | Trifluoperazine hydrochloride | |
| 50762005 | Interleukin-1 | |
| 50767004 | 5-Methylthioribose kinase (substance) | |
| 50778007 | Hemoglobin J-Wenchang-Wuming | |
| 50784005 | Intracisternal material, amorphous (substance) | |
| 50791008 | Tetramethyl succinonitrile | |
| 50825000 | Food coloring | |
| 50848005 | Sulfamoxole | |
| 50852005 | Seminal vesicle fluid | |
| 50854006 | alpha-Amino-acid esterase | |
| 50863008 | Plasma | |
| 50864002 | Blood group antibody CE | |
| 50898006 | UDPglucosamine 4-epimerase | |
| 50899003 | Blood group antibody Je^a^ | |
| 50912007 | Oncogene protein trk | |
| 50914008 | Adamsite | |
| 50925004 | Amidophosphoribosyltransferase | |
| 50948009 | rRNA (guanine-N^1^)-methyltransferase | |
| 50951002 | Neuropeptide Y | |
| 50957003 | Leukopterin | |
| 50969006 | Tetrahydrozoline hydrochloride (substance) | |
| 50973009 | Methacycline hydrochloride (substance) | |
| 50981005 | Hemoglobin Takamatsu | |
| 50988004 | Lymphocyte antigen CD10 | |
| 51034002 | Phosphoglycerate kinase | |
| 51076005 | Fibrinogen Argenteuil | |
| 51079003 | Pelargonic acid | |
| 51090008 | NADH kinase | |
| 51125005 | Diacetylaminoazotoluene | |
| 51137007 | Sodium arsenate | |
| 51139005 | Tetrabromo-o-cresol | |
| 51148000 | Dicamba | |
| 51161000 | Coagulation factor XIII | |
| 51162007 | Holo-[acyl-carrier-protein] synthase | |
| 51163002 | Lanosterol synthase | |
| 51172005 | Cryofibrinogen | |
| 51173000 | Muconolactone delta-isomerase | |
| 51177004 | Citreoviridin | |
| 51179001 | Alkyl dimethyl benzyl ammonium bromide | |
| 51200005 | Strychnine | |
| 51202002 | Sepiapterin deaminase | |
| 51222003 | Blood group antigen IP>1< | |
| 51224002 | Carboxymethylcellulose sodium | |
| 51238009 | Lymphocyte antigen CD2R | |
| 51242007 | Blood group antigen Riv | |
| 51245009 | Barium propionate | |
| 51248006 | Dihydroneopterin aldolase | |
| 51250003 | Hemoglobin J-Buda | |
| 51256009 | Cystathionine beta-synthase | |
| 51260007 | Metabutoxycaine | |
| 51262004 | Blood group antibody Donati | |
| 51263009 | 3alpha-Hydroxy-5beta-androstane-17-one 3alpha-dehydrogenase | |
| 51276003 | Blood group antibody Bothrops | |
| 51280008 | Sebum | |
| 51285003 | Hemoglobin J-Toronto | |
| 51293003 | Blood group antigen rr-35 | |
| 51303009 | (-)-Menthol dehydrogenase | |
| 51304003 | Rubidium (substance) | |
| 51305002 | Thymosin | |
| 51311004 | Blood group antigen B 9208 | |
| 51314007 | Hyponitrite reductase | |
| 51321007 | Propylhexedrine | |
| 51364000 | 2-Dehydro-3-deoxy-L-pentonate aldolase | |
| 51366003 | Ammonium chloride | |
| 51369005 | Phosmet | |
| 51372003 | Blood group antibody An^a^ | |
| 51379007 | Fibrinogen Alba/Geneva | |
| 51386004 | Food preservative | |
| 51389006 | Histidinol dehydrogenase | |
| 51390002 | Hemoglobin F-Clarke | |
| 51397004 | Hemoglobin Guizhou | |
| 51405003 | Ammonia kinase | |
| 51414008 | Human leukocyte antigen DR2 (substance) | |
| 51415009 | Blood group antibody Kn^a^ | |
| 51419003 | Mucoprotein | |
| 51420009 | Silicon | |
| 51426003 | Vanadium radioisotope | |
| 51437002 | 3-Deoxy-manno-octulosonate cytidylyltransferase | |
| 51441003 | Reiterated gene | |
| 51447004 | Blood group antibody Kam | |
| 51462002 | Hematoporphyrin | |
| 51466004 | Retinal isomerase | |
| 51468003 | Blood group antibody Tajama | |
| 51483008 | Naringenin-chalcone synthase | |
| 51503008 | Rose oil | |
| 51511003 | Blood group antigen Kosis | |
| 51515007 | HLA-DRw antigen | |
| 51542008 | Appendiceal contents | |
| 51562000 | 2-Bromo-4-phenyl phenol | |
| 51567006 | Sirius red F3B stain (substance) | |
| 51569009 | Sulfaphenazole | |
| 51598008 | Coproporphyrin | |
| 51610006 | Quercetin O^3^methyltransferase | |
| 51612003 | Hydrocortisone valerate | |
| 51622009 | Adenine deaminase | |
| 51644004 | Electrolytic agent | |
| 51645003 | Blood group antibody Good | |
| 51663003 | Plant mutagen | |
| 51664009 | Metallic amalgam | |
| 51674007 | ^241^Plutonium | |
| 51704000 | Phospholipase C | |
| 51708002 | Hemoglobin Rainier | |
| 51718007 | HLA-Bw46 antigen | |
| 51739000 | Ethyl biscoumacetate | |
| 51765001 | Carbon monoxide | |
| 51769007 | Pyrimidine-5'-nucleotide nucleosidase | |
| 51770008 | Cyclic AMP receptor | |
| 51774004 | ^123^Tin | |
| 51775003 | Estrone | |
| 51776002 | Singlet oxygen | |
| 51800004 | ^222^Radon | |
| 51803002 | Fibrinogen Chapel Hill II | |
| 51809003 | Blood group antibody Pantaysh | |
| 51810008 | Proliferative inhibitory factor | |
| 51824007 | NADH dehydrogenase | |
| 51844001 | Tetracaine hydrochloride | |
| 51856000 | Hemoglobin J-Sardegna | |
| 51859007 | Organic thiocyanate insecticide | |
| 51866008 | Protoporphyrin | |
| 51873003 | Blood group antibody Lagay | |
| 51874009 | Proline iminopeptidase | |
| 51876006 | [Hydroxymethylglutaryl-CoA reductase (NADPH)] kinase | |
| 51880001 | Isohexenylglutaconyl-CoA hydratase | |
| 51888008 | Calcium salt (substance) | |
| 51889000 | Oxaloglycolate reductase (decarboxylating) | |
| 51905005 | Mustard | |
| 51910009 | N-ethylmorpholine | |
| 51913006 | Sorbose dehydrogenase (NADP^+^) | |
| 51918002 | Hemoglobin Milledgeville | |
| 51922007 | Magnetite | |
| 51927001 | Dipropylene glycol methyl ether | |
| 51931007 | Nail polish remover | |
| 51934004 | Hemocyanin | |
| 51941005 | Blood group antibody B | |
| 51950007 | Antimitochondrial antibody | |
| 51955002 | Asclepain | |
| 51961004 | ^101^Palladium | |
| 51963001 | Sulfite salt | |
| 51964007 | Deoxydenylate kinase | |
| 51965008 | Amsinckine | |
| 51967000 | Sulfite reductase (NADPH) | |
| 51974005 | Geranyl-diphosphate cyclase | |
| 51990005 | Ganglioside galactosyltransferase | |
| 52021000 | Tetrachlorobenzoquinone | |
| 52024008 | Upper respiratory tract mucus | |
| 52027001 | Crimidine | |
| 52053009 | Epididymal fluid | |
| 52062006 | Oxythioquinox | |
| 52078008 | Epitope | |
| 52081003 | Blood group antigen Griffith | |
| 52086008 | Glycol | |
| 52094001 | ^117m^Indium | |
| 52104007 | Right upper lobe mucus | |
| 52119008 | beta Endorphin preparation | |
| 52126008 | Cortol | |
| 52129001 | Protamine kinase | |
| 52130006 | Quercetin | |
| 52140009 | Benoxinate (substance) | |
| 52141008 | Coal dust | |
| 52160001 | Lymphocyte antigen CD9 | |
| 52162009 | 2-Oxobutyrate synthase | |
| 52169000 | Platelet antibody HPA-2 | |
| 52193005 | Blood group antibody Lindsay | |
| 52209008 | Calcium citrate | |
| 52210003 | Blood group antibody Manley | |
| 52227006 | Platelet antibody HPA-3b | |
| 52243004 | 1,3-Dichloro-2-propanol | |
| 52258007 | Blood group antibody C^x^ | |
| 52261008 | Hemoglobin Vanderbilt | |
| 52264000 | Hemoglobin Yakima | |
| 52269005 | Muramoyl-pentapeptide carboxypeptidase | |
| 52275001 | Benactyzine | |
| 52282002 | Histamine receptor | |
| 52283007 | Peppermint oil | |
| 52293000 | Abnormal hemoglobin, fusion defect | |
| 52310000 | Blood group antibody Dp | |
| 52313003 | Complement component C8 | |
| 52315005 | o-Dichlorobenzene | |
| 52326004 | Indoleacetaldoxime dehydratase | |
| 52339000 | Nitrogen chloride (substance) | |
| 52354006 | Zirconium compound | |
| 52358009 | D-Serine dehydratase | |
| 52360006 | Estrone sulfotransferase | |
| 52370008 | Psyllium (substance) | |
| 52371007 | Hemoglobin Westmead | |
| 52380007 | Glycine dehydrogenase | |
| 52394008 | Potassium acetate (substance) | |
| 52398006 | Phospho-2-dehydro-3-deoxyheptonate aldolase | |
| 52401009 | Thrombin-antithrombin complex | |
| 52408003 | Iodinated I^131^ gamma globulin | |
| 52418008 | Chondroitin sulfotransferase | |
| 52419000 | HLA-Bw72 antigen | |
| 52422003 | 20-Hydroxyprogesterone | |
| 52442007 | Betaine-homocysteine methyltransferase | |
| 52454007 | Albumin | |
| 52458005 | Hemoglobin J-Kaohslung | |
| 52467005 | Blood group antigen Krog | |
| 52470009 | Nickel salt | |
| 52480008 | Alkenylglycerophosphoethanolamine hydrolase | |
| 52493003 | ^129^Antimony | |
| 52502000 | bis-(Trichlorohydroxy ethyl) urea | |
| 52503005 | Argon | |
| 52513002 | Hemoglobin Ferndown | |
| 52518006 | Amino acid | |
| 52525004 | Pyrimidine-nucleoside phosphorylase (substance) | |
| 52541003 | Proline | |
| 52546008 | Perilymph | |
| 52555006 | Blood group antigen Shier | |
| 52560005 | Norleucine | |
| 52573009 | Blood group antibody Tj^a^ | |
| 52574003 | Amiodarone hydrochloride | |
| 52587009 | ^113^ Silver | |
| 52596009 | Inosamine-phosphate amidinotransferase | |
| 52601000 | Deproteinated pancreatic extract | |
| 52609003 | Hemoglobin Pontoise | |
| 52610008 | Glucuronolactone reductase | |
| 52625008 | Arginine | |
| 52642002 | Peptide | |
| 52646004 | Actinium isotope | |
| 52679004 | Submandibular proteinase A | |
| 52680001 | Hepatitis B surface antigen subtype adr | |
| 52690009 | ^133m^Xenon | |
| 52701005 | ^210^Thallium | |
| 52717004 | Iodate salt | |
| 52720007 | Bismuth compound | |
| 52722004 | Biotinidase | |
| 52733001 | Overlapping gene | |
| 52736009 | Threonine | |
| 52740000 | meso-Tartrate dehydrogenase | |
| 52745005 | ^51^Chromium | |
| 52752007 | ^85m^Strontium | |
| 52764004 | Blood group antibody Cad | |
| 52770005 | Acetoacetic acid | |
| 52786003 | Immunoglobulin, hinge region | |
| 52793004 | Liquid nitrogen | |
| 52797003 | Non structural gene | |
| 52800001 | Marine toxin | |
| 52803004 | Trimeprazine tartrate (substance) | |
| 52804005 | o-Nitro-p-phenylenediamine | |
| 52806007 | Chenopodium oil | |
| 52830009 | Glyceryl-ether monooxygenase | |
| 52834000 | Hemoglobin A>2< Canada | |
| 52836003 | Paraformaldehyde | |
| 52841006 | Methyl malonic acid | |
| 52850008 | Ethopropazine (substance) | |
| 52854004 | Stilbene dye | |
| 52860004 | Manganese radioisotope | |
| 52881004 | Glucosaminate ammonia-lyase | |
| 52885008 | Alphaprodine | |
| 52886009 | Minocycline hydrochloride | |
| 52905007 | L-Arabinokinase | |
| 52912003 | Blood group antibody Marks | |
| 52935000 | HLA-Bw42 antigen | |
| 52959005 | ^108m^Silver | |
| 52973001 | 3-Methyleneoxindole reductase | |
| 52978005 | Coagulation factor II Brussels variant | |
| 52991006 | Blood group antibody Bryant | |
| 53005004 | Cerebroside | |
| 53008002 | Acetic anhydride | |
| 53022002 | Chaulmoogra oil | |
| 53023007 | Leukotriene D | |
| 53027008 | Dinitrotoluene | |
| 53034005 | Coal tar | |
| 53041004 | Alcohol | |
| 53047000 | HLA-DR3 antigen | |
| 53048005 | Hematin | |
| 53052005 | Methazolamide | |
| 53072000 | Leukotriene E | |
| 53082004 | Blood group antibody Le^c^ | |
| 53090004 | Sulfacytidine | |
| 53117004 | Hepatitis delta virus antibody (substance) | |
| 53130003 | Venous blood (substance) | |
| 53136009 | Chloroquine phosphate | |
| 53149004 | Hydrophilic ointment | |
| 53158006 | Luteolin methyltransferase | |
| 53164004 | Perchloryl fluoride | |
| 53166002 | trans-Cinnamate 2-monooxygenase | |
| 53171009 | Lead-free gasoline (substance) | |
| 53172002 | Protein-glucosylgalactosylhydroxylysine glucosidase | |
| 53175000 | Oil of celery | |
| 53207004 | Diiodofluorescein I^131^ (substance) | |
| 53211005 | Cyanogen chloride | |
| 53235000 | Protamine zinc insulin | |
| 53246002 | Ethylene | |
| 53252001 | Mullerian regression factor | |
| 53268007 | Ipomea | |
| 53278005 | Hemoglobin Mississippi | |
| 53287001 | HLA-A32 antigen | |
| 53289003 | Oil of savin | |
| 53302008 | Platelet antibody HPA-1a | |
| 53306006 | Glutamate synthase (NADH) | |
| 53307002 | Blood group antigen Hu | |
| 53315004 | ^68^Germanium | |
| 53323002 | Histidine acetyltransferase | |
| 53327001 | Blood group antibody Caw | |
| 53331007 | Platelet antibody HPA-1b | |
| 53353009 | Stibophen | |
| 53368005 | Phosphatidylserine decarboxylase | |
| 53382005 | B-cell antigen receptor (substance) | |
| 53393007 | Bromine radioisotope | |
| 53398003 | Staphylococcus toxin | |
| 53404008 | Thyroid aspartic proteinase | |
| 53405009 | Tripelennamine hydrochloride | |
| 53409003 | Blood group antigen Sieb | |
| 53410008 | Beer | |
| 53415003 | Plant anthraquinone glycoside | |
| 53426009 | Phosphoribosylamine-glycine ligase | |
| 53468009 | Acetylenedicarboxylate hydratase | |
| 53473003 | Apolipoprotein C | |
| 53475005 | beta-Glucoside kinase | |
| 53491008 | Aspergillus saitoi aspartic proteinase | |
| 53493006 | Dimethyl chlorthal | |
| 53499005 | Riboflavin mononucleotide | |
| 53511009 | Tropaeolin OO stain (substance) | |
| 53513007 | Psilocybine | |
| 53517008 | ^249^Californium | |
| 53519006 | Dichlorotetrafluoromethane | |
| 53527002 | Alcoholic beverage | |
| 53532001 | Cesium isotope | |
| 53545002 | Blood group antibody Cr1 | |
| 53553005 | HLA-DPw5 antigen | |
| 53557006 | Blood group antibody Starcher | |
| 53560004 | Zinc isotope | |
| 53563002 | Bismuth telluride | |
| 53577004 | Phthalylsulfacetamide | |
| 53588005 | Elaterin | |
| 53594002 | Abnormal hemoglobin, delta-chain variant | |
| 53598004 | Blood group antibody Ge3 | |
| 53606004 | IMP cyclohydrolase | |
| 53609006 | Thiaminase | |
| 53646005 | Fructose-6-phosphate | |
| 53673006 | Captan | |
| 53681007 | Colony-stimulating factor, granulocyte-macrophage | |
| 53682000 | Endorphin | |
| 53689009 | tRNA (adenine-N^1^)-methyltransferase | |
| 53692008 | ^150^Gadolinium | |
| 53699004 | Hemoglobin Alberta | |
| 53700003 | ^67^Copper | |
| 53716001 | Blood group antibody Kursteiner | |
| 53749005 | Glutathione thiolesterase | |
| 53777001 | Ethoxyquin | |
| 53784009 | Low incidence antibody | |
| 53794004 | Immunoglobulin, heavy chain fragment | |
| 53806002 | ^205^Bismuth | |
| 53817001 | Alkyl trimethyl ammonium chloride | |
| 53831001 | 3-Carboxy-cis,cis-muconate cycloisomerase | |
| 53834009 | Hemicellulose | |
| 53845007 | Bromisovalum (substance) | |
| 53856007 | Single chain urokinase-like plasminogen activator | |
| 53859000 | Methyl lomustine | |
| 53871006 | Blood group antigen Kp^b^ | |
| 53875002 | Colostrum | |
| 53876001 | Blood group antibody Suhany | |
| 53878000 | Diacetone alcohol | |
| 53882003 | Blood group antigen McC^a^ | |
| 53902004 | UDP-N-acetylglucosamine 2-epimerase | |
| 53914007 | Acetyl-CoA acetyltransferase | |
| 53934008 | Hemoglobin St. Lukes | |
| 53946007 | Butene | |
| 53951001 | Technetium Tc^99m^ oxidronate | |
| 53962001 | beta 1C/A globulin | |
| 53971005 | Blood group antibody Kuhn | |
| 53990002 | 4-alpha-Glucanotransferase | |
| 54005009 | Yeast ribonuclease | |
| 54024007 | Duodenal juice | |
| 54028005 | tRNA (cytosine-5)-methyltransferase | |
| 54041009 | Safflower oil | |
| 54045000 | Glyceraldehyde | |
| 54062005 | Cephalexin hydrochloride (substance) | |
| 54083004 | Iodic acid | |
| 54086007 | Hexylresorcinol | |
| 54103000 | Immunoglobulin, GM>18< allotype | |
| 54107004 | Sandalwood oil | |
| 54108009 | Sodium silicate | |
| 54112003 | Hemoglobin Gainesville | |
| 54140008 | Hemoglobin F-Dickinson | |
| 54141007 | Psyllium seed | |
| 54144004 | Factor IX complex preparation | |
| 54152001 | Nitrite reductase | |
| 54158002 | Procollagen-proline,2-oxoglutarate 3-dioxygenase | |
| 54159005 | Blood group antigen Es^a^ | |
| 54163003 | Diaminopimelate dehydrogenase | |
| 54167002 | Hemoglobin Sabine | |
| 54168007 | Plant quinolizidine alkaloid | |
| 54170003 | ^74^Arsenic | |
| 54172006 | Metaproterenol sulfate (substance) | |
| 54175008 | Hemoglobin St. Claude | |
| 54179002 | Strontium radioisotope | |
| 54180004 | S protein complement component | |
| 54188006 | Human placental lactogen | |
| 54195002 | Tissue factor antibody | |
| 54197005 | Cyclomethycaine | |
| 54202003 | Oil of ginger | |
| 54221006 | Orange G stain (substance) | |
| 54223009 | Glycerol-3-phosphate acyltransferase | |
| 54228000 | Fibrinogen Montreal I | |
| 54235008 | Histamine | |
| 54237000 | Lymphocyte antigen CD8 | |
| 54239002 | Aconitate hydratase | |
| 54245005 | Lithocholic acid | |
| 54248007 | Formate kinase | |
| 54252007 | Minor histocompatibility loci | |
| 54256005 | Aluminum isotope | |
| 54313002 | ^184^Tantalum | |
| 54323006 | Glycogen (starch) synthase | |
| 54331001 | Isooctyl alcohol | |
| 54338007 | Type 1 H substance | |
| 54340002 | Antimony potassium tartrate | |
| 54343000 | Blood group antibody Ryan | |
| 54346008 | D-Arginase | |
| 54351002 | Glutamine phenylacetyltransferase | |
| 54352009 | Histoplasmin | |
| 54353004 | Blood group antigen Hall J | |
| 54370007 | Coagulation factor IX Long Beach variant | |
| 54371006 | Alkyl mercuric chloride | |
| 54375002 | Oncogene protein LYL | |
| 54378000 | Coagulation factor IX | |
| 54390003 | Exodeoxyribonuclease V | |
| 54396009 | Leptodactylin | |
| 54401008 | Adenosylmethionine-8-amino-7-oxononanoate aminotransferase | |
| 54413003 | Blood group antibody Heibel | |
| 54416006 | von Willebrand receptor | |
| 54423007 | Testosterone 17beta-dehydrogenase (NADP^+^) | |
| 54428003 | Peptide-tryptophan 2,3-dioxygenase | |
| 54432009 | Alizarin blue S stain (substance) | |
| 54434005 | Hemoglobin Russ | |
| 54442006 | Right pleural fluid | |
| 54446009 | Lysolecithin | |
| 54456008 | Ribonuclease F | |
| 54462003 | Direct reacting bilirubin | |
| 54465001 | Lymphocyte antigen CD45RB | |
| 54475003 | Blood group antibody Lu16 | |
| 54481006 | HLA-B antigen | |
| 54506001 | Galactitol dehydrogenase | |
| 54508000 | Ferrocholinate | |
| 54517000 | Hydrogen selenide | |
| 54524004 | Blood group antigen Er^a^ | |
| 54526002 | Acetate | |
| 54534008 | 1-Chloro-1-nitropropane | |
| 54543004 | Plant triterpene | |
| 54546007 | Blood group antibody Jk^b^ | |
| 54548008 | Dichlobenil | |
| 54557002 | Blood group antigen Lagay | |
| 54563006 | Dental cement | |
| 54579007 | Deoxy adenosine diphosphate | |
| 54588003 | Croton oil | |
| 54592005 | Angiotensinogen | |
| 54600003 | Hemoglobin F-Hull | |
| 54628009 | D-Xylulose reductase | |
| 54633008 | ^232^Uranium | |
| 54643006 | Thiosulfate-thiol sulfurtransferase | |
| 54651009 | Maneb | |
| 54661002 | Alkyl sodium sulfonates | |
| 54663004 | Active C3b | |
| 54669000 | Dihydropteridine reductase | |
| 54673002 | Perchloric acid | |
| 54681001 | Blood group antigen Fy4 | |
| 54708003 | Extended zinc insulin | |
| 54717003 | Ethinamate | |
| 54724002 | Bile acid AND/OR bile salt (substance) | |
| 54729007 | Oxytetracycline hydrochloride | |
| 54732005 | Persic oil | |
| 54751004 | Chloroacetic acid | |
| 54753001 | Secondary amyl acetate | |
| 54760007 | Bryonin | |
| 54769008 | Serine acetyltransferase | |
| 54774000 | O-Succinyl homoserine (thiol)-lyase | |
| 54788001 | Hemoglobin F-Texas-II | |
| 54791001 | Metanil yellow stain (substance) | |
| 54800000 | Guanidinoacetate kinase | |
| 54804009 | ^181^Tungsten | |
| 54808007 | Cobalt | |
| 54813006 | Blood group antigen Jr^a^ | |
| 54821000 | Tryptophan (substance) | |
| 54832000 | Fructose-bisphosphatase | |
| 54835003 | Lithium chloride | |
| 54841005 | Hydrocyanic acid | |
| 54843008 | Plant terpene | |
| 54850007 | Blood group antibody Doughty | |
| 54855002 | Blood group antigen Gomez | |
| 54871002 | Acyl-lysine deacylase | |
| 54894001 | ^228^Radium | |
| 54901002 | Acetylesterase | |
| 54911009 | GDPglucosidase | |
| 54918003 | Dialkyl sodium sulfosuccinate | |
| 54932001 | Thymol | |
| 54939005 | Dimethylmalate dehydrogenase | |
| 54941006 | Adenosine phosphate | |
| 54965009 | Hemoglobin Porto Alegre | |
| 54966005 | Phenyl ether-biphenyl vapor mixture | |
| 54968006 | Tetraethyl dithiopyrophosphate | |
| 54976008 | Phenyl ether | |
| 54994002 | 1,3-beta-Oligoglucan phosphorylase | |
| 55035009 | Blood group antibody Kopman | |
| 55036005 | HLA-Aw66 antigen | |
| 55049000 | Carbon trichloride | |
| 55090002 | Chondro-4-sulfatase | |
| 55092005 | Blood group antigen Sw^a^ | |
| 55100009 | Blood group antigen M>1< | |
| 55110000 | Pentasodium tripolyphosphate | |
| 55117002 | ^137^Cesium | |
| 55119004 | Immunoglobulin IgA1, H chain (substance) | |
| 55122002 | Blood group antigen Tg^a^ | |
| 55123007 | Diphtheria toxin | |
| 55124001 | Molindone hydrochloride | |
| 55128003 | Allyl cinerin (substance) | |
| 55138008 | Permanganate salt | |
| 55159001 | Blood group antigen Binge | |
| 55170008 | Uroporphyrin | |
| 55201001 | Amine receptor | |
| 55202008 | Methoxychlor | |
| 55203003 | Loliine | |
| 55224008 | Trichloropropane | |
| 55261004 | Fumonisin | |
| 55291009 | Pholcoline | |
| 55302006 | Phosphoribosyl-ATP pyrophosphatase | |
| 55316001 | Colestipol hydrochloride | |
| 55324006 | Helium isotope | |
| 55325007 | Homoisocitrate dehydrogenase | |
| 55328009 | ^28^Magnesium | |
| 55330006 | Subtilisin | |
| 55354001 | Fructose-2,6-bisphosphatase | |
| 55358003 | Thiouracil | |
| 55368008 | Vanadium compound | |
| 55386006 | Ricinine nitrilase | |
| 55403000 | Sulfate adenylyltransferase | |
| 55435000 | Nafcillin sodium | |
| 55443005 | Hydroxycyclohexanecarboxylate dehydrogenase | |
| 55450009 | Extracellular fluid | |
| 55451008 | Blood group antigen Nou (substance) | |
| 55452001 | Oxycodone | |
| 55477000 | Glutathione | |
| 55486005 | Antipyrine (substance) | |
| 55491006 | Strophanthin | |
| 55494003 | Technetium Tc^99m^ albumin microspheres (substance) | |
| 55495002 | Acidulated phosphate fluoride | |
| 55500004 | Hemoglobin Perth | |
| 55503002 | Sex steroid binding globulin | |
| 55507001 | Iron oxide fumes | |
| 55508006 | Bufogenin | |
| 55515003 | Hemoglobin Köln (substance) | |
| 55521004 | Phosphatidyl inositol | |
| 55522006 | Fc receptor | |
| 55527000 | Geraniol | |
| 55535002 | ^113m^Cadmium | |
| 55540005 | Ferrous carbonate | |
| 55549006 | Blood group antigen Ridd | |
| 55559007 | ^36^Chlorine | |
| 55579004 | Coagulation factor II San Juan 2 variant | |
| 55582009 | Arginase | |
| 55583004 | Lathyrus poison | |
| 55624000 | Inosine nucleosidase | |
| 55633003 | Unstable hemoglobin | |
| 55636006 | Octyl cresol | |
| 55657003 | Estradiol 17alpha-dehydrogenase | |
| 55660005 | Blood group antigen f | |
| 55667008 | UDP-N-acetylmuramoylalanyl-D-glutamyl-lysine-D-alamyl-D-alanine ligase | |
| 55683008 | Hemoglobin Kokura | |
| 55691004 | Dibenzocycloheptane derivative | |
| 55695008 | Blood group antigen Kemma | |
| 55700001 | Nylon | |
| 55706007 | Fibrinogen Wiesbaden (substance) | |
| 55723003 | Fibrin degradation product, intermediate derivative | |
| 55724009 | Potassium salt | |
| 55727002 | Barium dust | |
| 55729004 | Blood group antibody At^a^ | |
| 55741006 | Methenamine hippurate | |
| 55753005 | Furfuraldehyde | |
| 55755003 | Blood group antigen Pollio | |
| 55762007 | Acrylic acid | |
| 55763002 | Micrococcal nuclease | |
| 55789002 | Porphobilinogen | |
| 55792003 | Rotenone | |
| 55793008 | Anileridine | |
| 55795001 | Human leukocyte antigen abnormal (substance) | |
| 55808004 | Malonate-semialdehyde dehydrogenase (acetylating) | |
| 55813000 | 4-Enoyl-CoA reductase (NADPH) | |
| 55814006 | Iodinated I^131^ aggregated albumin | |
| 55816008 | Amino alcohol (substance) | |
| 55831004 | Xylene cyanol FF stain (substance) | |
| 55835008 | Blood group antibody Wu | |
| 55840000 | CMP-N-acetylneuraminate-alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase | |
| 55848007 | Blood group antibody Gon | |
| 55877008 | Hemoglobin Fort Gordon | |
| 55880009 | p-Toluenediamine | |
| 55882001 | White wax | |
| 55884000 | ^189m^Osmium | |
| 55886003 | Cytosol aminopeptidase | |
| 55895006 | Soft coal | |
| 55900005 | Fatty-acid peroxidase | |
| 55902002 | Benzyl alcohol | |
| 55917003 | Glucosamine kinase | |
| 55922003 | Blood group antigen Ge2 | |
| 55939001 | Dihydrosphingosine | |
| 55944008 | Niridazole | |
| 55946005 | Pectin (substance) | |
| 55951004 | ^38^Chlorine | |
| 55972001 | Silicate salt | |
| 56003000 | Glycerol-3-phosphate dehydrogenase (NAD(P)^+^) | |
| 56006008 | Indium^113^ oxoquinoline platelet label | |
| 56022009 | Right middle lobe mucus | |
| 56024005 | Methylmalonyl-CoA mutase | |
| 56025006 | D-Lactaldehyde dehydrogenase | |
| 56065005 | Spermaceti | |
| 56066006 | Turacin | |
| 56071004 | Blood group antigen Thompson | |
| 56085009 | Hyoscyamine sulfate | |
| 56104009 | D-Lysine 5,6-aminomutase | |
| 56114000 | HLA-Dw6 antigen | |
| 56117007 | Air bubble | |
| 56139009 | Glutaminyl-tRNA cyclotransferase | |
| 56146000 | Androstenedione | |
| 56147009 | Bufotenine | |
| 56150007 | ^243^Plutonium | |
| 56156001 | Desoxycorticosterone acetate | |
| 56158000 | ^58m^Cobalt (substance) | |
| 56163001 | Burr | |
| 56167000 | Potassium radioisotope | |
| 56181003 | Chlorinated hydrocarbon | |
| 56227008 | Trolnitrate phosphate | |
| 56232009 | HLA-Dw10 antigen | |
| 56248005 | Blood group antigen Kp^c^ | |
| 56261005 | Hydroxy phenylpyruvic acid, para | |
| 56282004 | 2,3-Dihydroxybenzoate 2,3-dioxygenase | |
| 56286001 | Blood group antibody Bouteille | |
| 56297001 | Propoxyphene hydrochloride (substance) | |
| 56312005 | HLA-Cw10 antigen | |
| 56314006 | Silver fluoride | |
| 56325002 | Carbromal | |
| 56328000 | Fibrinogen Homberg III | |
| 56339002 | Saprol | |
| 56352007 | Fibrinogen Giessen I (substance) | |
| 56355009 | Clostridium histolyticum collagenase | |
| 56362000 | L-Gulonolactone oxidase | |
| 56363005 | Adenosine kinase | |
| 56374001 | Plasminogen activator inhibitor-2 | |
| 56382001 | Hemoglobin G-Galveston | |
| 56383006 | Leucocyanidin | |
| 56389005 | Etafedrine | |
| 56410003 | Heterophil antibody | |
| 56412006 | Arsine | |
| 56414007 | Galactolipase | |
| 56427006 | Metallic alloy | |
| 56436005 | Sulfanilamide | |
| 56448008 | Kallidin I | |
| 56455005 | Anthranilate synthase | |
| 56471005 | Colonic vomitus | |
| 56473008 | Ethyl dipropylthiocarbamate | |
| 56475001 | Disodium indium^111^ | |
| 56489006 | Blood group substance | |
| 56499001 | Blood group antigen Ul^a^ | |
| 56516007 | Very low density lipoprotein | |
| 56521005 | Lymphocyte antigen CDw49b | |
| 56523008 | Sequoyitol dehydrogenase | |
| 56534006 | Hemoglobin Chico | |
| 56564003 | Fusion protein BCR-ABL | |
| 56566001 | ^88^Krypton | |
| 56567005 | Lymphocyte antigen CD39 | |
| 56586002 | Skatole | |
| 56590000 | Methylene biphenyl isocyanate | |
| 56592008 | Hemoglobin C-Ziguinchor | |
| 56594009 | di-trans,poly-cis-Decaprenylcistransferase | |
| 56609000 | ^111^Indium | |
| 56613007 | Bretylium tosylate (substance) | |
| 56617008 | Blood group antibody Gerhany | |
| 56634000 | Methyl formate | |
| 56695001 | Guanosine-triphosphate guanylyltransferase | |
| 56702000 | Pyruvate dehydrogenase (lipoamide) | |
| 56714008 | Bombesin | |
| 56715009 | Chlorcyclizine | |
| 56723006 | Penicillin V potassium (substance) | |
| 56735005 | Blood group antibody Dropik | |
| 56736006 | Methionine-tRNA ligase | |
| 56740002 | Triiodotyrosine | |
| 56747004 | Lymphocyte antigen CD40 | |
| 56750001 | Blood group antibody In^a^ | |
| 56755006 | Actinium compound | |
| 56762002 | Stimulant laxative | |
| 56773009 | Ichthyocrinotoxin | |
| 56774003 | 4,5-Dihydroxyphthalate decarboxylase | |
| 56781005 | Rhodotorula aspartic proteinase (substance) | |
| 56796009 | Alloxan | |
| 56822005 | Quaternary ammonium salt | |
| 56838004 | NADH dehydrogenase (quinone) | |
| 56846003 | N-Acetylglucosamine deacetylase | |
| 56866007 | Blood group antibody Ri^a^ | |
| 56867003 | Indium^113^ oxoquinoline RBC label | |
| 56877001 | Kanamycin kinase | |
| 56885005 | Blood group antibody Carson | |
| 56886006 | Strontium compound | |
| 56891007 | Independent high incidence blood group antigen | |
| 56898001 | Protein S | |
| 56899009 | ^125^Xenon | |
| 56902007 | Methylitaconate delta-isomerase | |
| 56904008 | Tungsten isotope | |
| 56926009 | Hemoglobin J-Daloa | |
| 56933009 | Blood group antibody Nijhuis | |
| 56935002 | Alanine aminotransferase | |
| 56942002 | Free fatty acid-albumin complex | |
| 56945000 | Blood group antibody Fy3 | |
| 56958004 | Barium compound (substance) | |
| 56980001 | Hemoglobin Rahere | |
| 57031001 | 1,1,-Dichloropropane | |
| 57037002 | Fibrin degradation product, small peptide | |
| 57040002 | Dibutyl adipate | |
| 57051002 | Hemoglobin C-Harlem | |
| 57056007 | Alkaline phosphatase | |
| 57064001 | Fibrinogen Quebec I | |
| 57076001 | Active C3bBb | |
| 57078000 | H^+^-transporting ATP synthase | |
| 57082003 | Arylesterase | |
| 57090003 | Collagen type III | |
| 57091004 | Methylisocitrate lyase | |
| 57126000 | Glue | |
| 57133000 | HLA antigen absent | |
| 57150003 | Blood group antibody Eggenberger | |
| 57155008 | Pyruvate dehydrogenase lipoamide-phosphatase | |
| 57164003 | Dyclonine hydrochloride | |
| 57178002 | Hemoglobin Henri Mondor | |
| 57198007 | Lemon oil | |
| 57199004 | Plasminogen activator inhibitor-1 | |
| 57228007 | Blood group antibody Knoebnchild | |
| 57244003 | 11-Ketoandrosterone | |
| 57251007 | 2,6-beta-Fructan 6-levan biohydrolase | |
| 57259009 | Gallbladder bile | |
| 57268006 | Blood group antigen Oliver | |
| 57272005 | Iodine compound | |
| 57273000 | Zinc radioisotope | |
| 57279001 | ^57^Nickel | |
| 57281004 | Blood group antigen Re^a^ (substance) | |
| 57294002 | Z line material | |
| 57308006 | Acetylcholine | |
| 57318001 | Blood group antibody Lu7 | |
| 57362005 | 3-Oxoadipate enol-lactonase | |
| 57377002 | Blood group antigen Lu9 | |
| 57400003 | Phenol 2-monooxygenase | |
| 57439007 | Blood group antigen JMH | |
| 57440009 | Glycine hydroxymethyltransferase | |
| 57442001 | Acylphosphatase | |
| 57452002 | Homocitrate synthase | |
| 57454001 | Metalloporphyrin | |
| 57466007 | Phenyl cyclohexanol | |
| 57471000 | Methyl flamprop | |
| 57479003 | Air contaminant | |
| 57519005 | Inorganic tin compound | |
| 57528006 | Furylfuramide isomerase | |
| 57529003 | Blood group antibody Marcus | |
| 57533005 | Thioglucosidase | |
| 57542003 | Glycerol dehydratase | |
| 57562006 | dTDPdihydrostreptose-streptidine-6-phosphate dihydrostreptosyltransferase | |
| 57573004 | Hemoglobin Beijing | |
| 57574005 | Loperamide hydrochloride | |
| 57575006 | Alkali-resistant hemoglobin | |
| 57583000 | Naphazoline hydrochloride | |
| 57595000 | Blood group antibody Kowanski | |
| 57601008 | ^238^Plutonium | |
| 57634005 | Iodophenol methyltransferase | |
| 57635006 | N-butyl lactate | |
| 57641004 | HLA-Dw2 antigen | |
| 57649002 | Rhodopsin | |
| 57678001 | Blood group antibody Jones | |
| 57679009 | Ethanolamine-phosphate phospho-lyase | |
| 57707004 | 2-Haloacid dehalogenase | |
| 57720001 | Anise oil | |
| 57743005 | Butyrate-CoA ligase | |
| 57753006 | Brilliant yellow stain (substance) | |
| 57763003 | Uridine | |
| 57765005 | Aminopeptidase | |
| 57795002 | Chemical element | |
| 57808000 | beta-Thromboglobulin | |
| 57813001 | Heme | |
| 57818005 | Scillaren B | |
| 57827006 | Dihydroxyfumarate decarboxylase | |
| 57830004 | Immunoglobulin, joining region | |
| 57837001 | Blood group antibody Ridd | |
| 57842009 | Coagulation factor X Friuli variant | |
| 57843004 | Hemoglobin Okayama | |
| 57851001 | Propyl nitrate | |
| 57858007 | Guanosine diphosphate | |
| 57859004 | Cyclohexamide | |
| 57860009 | Hemoglobin Genova | |
| 57868002 | Dichlorvos | |
| 57880005 | Ascorbate 2,3-dioxygenase | |
| 57894006 | Hemoglobin Lille | |
| 57899001 | Zineb | |
| 57911003 | Methotrimeprazine hydrochloride | |
| 57912005 | Blood group antigen Enriquez | |
| 57913000 | Anisotropine | |
| 57915007 | Propylene oxide | |
| 57916008 | Pyruvate oxidase | |
| 57939002 | Benzene | |
| 57959003 | ^205^Lead | |
| 57960008 | Ferrochelatase | |
| 57969009 | Deoxyadenosine kinase | |
| 57979006 | Picrotoxin | |
| 57986003 | Semisynthetic alkaloid | |
| 58014006 | Diphosphomevalonate decarboxylase | |
| 58017004 | Blood group antigen P1 | |
| 58018009 | Cevadine | |
| 58035008 | Blood group antibody Arun | |
| 58043003 | NAD(P)^+^ arginine ADP-ribosyltransferase | |
| 58046006 | gamma-Butyrobetaine, 2-oxoglutarate dioxygenase | |
| 58049004 | Glutamate synthase (NADPH) | |
| 58072002 | Monokine | |
| 58089005 | mRNA (nucleoside-O^2^)'-methyltransferase | |
| 58131001 | Alpha particle | |
| 58132008 | Monodehydroascorbate reductase (NADH) | |
| 58138007 | Thiamin pyrophosphokinase | |
| 58139004 | Zirconium oxide | |
| 58151002 | HLA-DPw4 antigen | |
| 58152009 | Bacitracin C | |
| 58163007 | Lactic dehydrogenase isoenzyme | |
| 58165000 | Hemoglobin Gavello | |
| 58173009 | Prostaglandin PGF2 alpha tromethamine (substance) | |
| 58182003 | Blasticidin-S deaminase | |
| 58186000 | Methyl phenyl ethyl hydantoin | |
| 58187009 | Phosphoenolpyruvate carboxykinase (pyrophosphate) | |
| 58195008 | Genetic code | |
| 58202007 | Fructose | |
| 58232004 | Blood group antibody Ven | |
| 58233009 | Meclofenamate sodium | |
| 58254002 | Blood group antigen Hg^a^ | |
| 58257009 | D-Lactate dehydrogenase (cytochrome) | |
| 58272008 | n-Acetyl muramic acid | |
| 58279004 | Selenium hexafluoride | |
| 58281002 | Gadolinium | |
| 58292001 | Selenium sulfide | |
| 58295004 | Inorganic chemical | |
| 58305007 | Blood group antibody McC^a^ | |
| 58313008 | Succinate-CoA ligase (GDP-forming) | |
| 58319007 | Blood group antigen Kollogo | |
| 58325006 | Methsuximide (substance) | |
| 58339006 | Saccharopine dehydrogenase (NAD^+^,L-lysine-forming) | |
| 58343005 | Cefonicid | |
| 58345003 | Phosphoric acid | |
| 58348001 | Sex chromatin | |
| 58364009 | Blood group antibody HLA-A10 | |
| 58368007 | Blood group antibody Englund | |
| 58369004 | Pyrroline-5-carboxylate reductase | |
| 58370003 | Coproporphyrinogen oxidase | |
| 58376009 | Anisidine | |
| 58397005 | Alkanal monooxygenase (FMN-Iinked) | |
| 58402009 | HLA-A11 antigen | |
| 58414001 | Hemoglobin Yusa | |
| 58416004 | Kanamycin 6'-acetyltransferase | |
| 58422008 | Methyl acrylate | |
| 58441006 | Mannitol dehydrogenase | |
| 58447005 | Tetrachlorodibenzofuran | |
| 58449008 | Industrial smog | |
| 58453005 | Blood group antigen Duvall | |
| 58461000 | Metaraminol bitartrate | |
| 58466005 | Propionate CoA-transferase | |
| 58505008 | Plant isoquinoline alkaloid | |
| 58520002 | Collagen type I | |
| 58529001 | Hydroxylamine reductase (NADH) | |
| 58536000 | Antimony dimercaptosuccinate | |
| 58541008 | ^24^Sodium | |
| 58560001 | Blood group antigen Teremok | |
| 58573002 | 2-Ethoxyethyl acetate | |
| 58578006 | UDPgalacturonosyltransferase | |
| 58591007 | Nucleoside-triphosphate-adenylate kinase | |
| 58594004 | Blood group antigen Zwal | |
| 58595003 | Carboxylic salt | |
| 58597006 | DNA-deoxyinosine glycosidase | |
| 58607005 | Neutron | |
| 58613001 | Interleukin-3 | |
| 58616009 | Githagenin | |
| 58620008 | Sporidesmin | |
| 58624004 | Fibrinogen Philadelphia | |
| 58630004 | Protein-disulfide reductase (NAD(P)H) | |
| 58631000 | Eriochrome blue black SE stain (substance) | |
| 58644005 | Dolichol kinase | |
| 58649000 | Cosmetic cream | |
| 58652008 | N^4^(beta-N-Acetylglucosaminyl)-L-asparaginase | |
| 58656006 | Ferredoxin-nitrite reductase | |
| 58674002 | Naphthol | |
| 58679007 | Blood group antibody Peacock | |
| 58680005 | Glutamate acetyltransferase | |
| 58687008 | p-tert-Butylphenol | |
| 58693000 | Sodium bromide | |
| 58721000 | Limonite | |
| 58730008 | Factor VIII antibody | |
| 58732000 | Red wine | |
| 58739009 | Valine-pyruvate aminotransferase | |
| 58745001 | ^195^Gold | |
| 58753009 | Alanine | |
| 58755002 | Water soluble anthracene brown stain (substance) | |
| 58765008 | Uroporphyrin I | |
| 58775006 | Phosphatidylinositol deacylase | |
| 58782005 | ^85m^Yttrium | |
| 58783000 | Amylase isoenzyme | |
| 58787004 | Aspartate-tRNA ligase | |
| 58789001 | Nicotinamidase | |
| 58792002 | ^149^Gadolinium | |
| 58793007 | Pinene hydrochloride | |
| 58794001 | Monoterpenol acetyltransferase | |
| 58796004 | ^211^Bismuth | |
| 58799006 | Cucurbitacin | |
| 58804001 | Fibrinogen Bern II | |
| 58831003 | Hemoglobin Sawara | |
| 58847001 | Thiamin-diphosphate kinase | |
| 58876003 | ^186^Platinum | |
| 58891001 | Salivary amylase | |
| 58900009 | Properdin | |
| 58907007 | Succinylcholine chloride (substance) | |
| 58910000 | Fibrinogen Genova I | |
| 58927008 | Beryllium fumes | |
| 58955007 | Adenylate isopentenyltransferase | |
| 58956008 | Trazodone hydrochloride | |
| 58962003 | Chrysarobin | |
| 58971007 | Petroleum sulfonate | |
| 58975003 | Blood group antigen Dh^a^ | |
| 58977006 | Magnesium salt | |
| 58995009 | Pseudomonas aeruginosa neutral proteinase | |
| 58996005 | Dieldrin | |
| 59001002 | ^197m^Platinum | |
| 59015000 | Guanosine 3',5'-bis(diphosphate) 3'-pyrophosphatase | |
| 59025005 | Iridium compound | |
| 59027002 | Peroxidase | |
| 59031008 | Liquefied phenol | |
| 59034000 | Tromethamine (substance) | |
| 59036003 | Silver radioisotope | |
| 59040007 | Sarcina neutral proteinase | |
| 59045002 | Hemoglobin Winnipeg | |
| 59071003 | Vinyl ether | |
| 59072005 | 3-Hydroxy-2-methylbutyryl-CoA dehydrogenase | |
| 59074006 | Butyrate-acetoacetate CoA-transferase | |
| 59075007 | Blood group antibody Paris | |
| 59082006 | Urokinase (substance) | |
| 59087000 | Coagulation factor XI variant type I | |
| 59094002 | Melanin | |
| 59111007 | Blood group antigen K22 | |
| 59119009 | Ichthyosarcotoxin | |
| 59134003 | Lymphogranuloma venereum antigen | |
| 59147008 | Active C5b6 | |
| 59149006 | Tetrodotoxin | |
| 59161003 | Thymic erythropoietin suppression factor | |
| 59162005 | Lysophosphatide | |
| 59163000 | Fibrinogen Valencia | |
| 59170000 | Dextrothyroxine | |
| 59195004 | Site-specific methyltransferase (adenine-specific) | |
| 59202000 | Actinium radioisotope | |
| 59203005 | Thiol sulfotransferase | |
| 59205003 | Blood group antibody Ge2 | |
| 59208001 | Adrenergic receptor | |
| 59224000 | Ethyl nitrophenyl thiobenzene | |
| 59226003 | 4-2,4-Dichlorophenoxybutanoic acid | |
| 59231001 | 5-Hydroxyfuranocoumarin O^5^-methyltransferase | |
| 59241003 | 5-Oxoprolinase (ATP-hydrolysing) | |
| 59243000 | Nucleotidase | |
| 59259000 | ^191^Mercury | |
| 59267008 | L-Fuconate dehydratase | |
| 59268003 | Tubulin | |
| 59271006 | C6 inactivator | |
| 59287009 | ^180m^Hafnium | |
| 59308003 | Dimethylsulfate | |
| 59312009 | Blood group antigen Pr>a< | |
| 59314005 | Pipradrol | |
| 59318008 | Arsenic pentoxide | |
| 59334006 | Cement, industrial | |
| 59338009 | Methapyrilene | |
| 59339001 | Hemoglobin Albany-Suma | |
| 59347001 | Blood group antigen A 8306 | |
| 59351004 | Citrate | |
| 59353001 | ^187^Tungsten | |
| 59365002 | Caraway oil | |
| 59375004 | Lymphocyte antigen CD53 | |
| 59386002 | Fetuin | |
| 59406000 | Blood group antibody Krog | |
| 59414006 | Stercobilin | |
| 59431004 | Ketone | |
| 59433001 | Human chorionic gonadotropin | |
| 59435008 | Creatine kinase isoenzyme | |
| 59439002 | Conglutinogen | |
| 59440000 | Diglycidyl ether | |
| 59442008 | Nitric acid | |
| 59485004 | Hemoglobin Koya Dora | |
| 59488002 | Phenprocoumon | |
| 59489005 | Calusterone | |
| 59497003 | Choline sulfotransferase | |
| 59501008 | Actinomycin lactonase | |
| 59525000 | Hemoglobin J-Cape Town | |
| 59526004 | Florantyrone | |
| 59533004 | Food additive | |
| 59541004 | ^175^Tantalum | |
| 59542006 | Blood group antibody IB | |
| 59545008 | Pesticide | |
| 59549002 | Fibrinogen Milano II | |
| 59560006 | Mepivacaine | |
| 59570008 | Transferrin | |
| 59584003 | Mercurous sulfate | |
| 59595009 | Verdochromogen | |
| 59605005 | Blood group antigen Whittaker | |
| 59610009 | Left lower lobe mucus | |
| 59718005 | N-Acylneuraminate-9-phosphate synthase (substance) | |
| 59723005 | HLA-A31 antigen | |
| 59732007 | Hemoglobin Perspolis | |
| 59737001 | Blood group antibody Co^a^ | |
| 59755005 | Muscarine | |
| 59759004 | Bacitracin B | |
| 59776000 | Calcium cyanide | |
| 59779007 | Human chorionic gonadotropin, alpha subunit | |
| 59787008 | Hemoglobin Creteil | |
| 59801003 | Rhodium | |
| 59804006 | Glycoprotein | |
| 59808009 | Blood group antibody Man | |
| 59815001 | Azoxybenzene | |
| 59822009 | Histamine H2 receptor | |
| 59835000 | Lymphocyte antigen CDw50 | |
| 59840008 | Blood group antibody Zt^a^ | |
| 59842000 | Nicotinate-nucleotide adenylyltransferase | |
| 59844004 | ^42^Potassium | |
| 59865005 | Complement component C1q | |
| 59872006 | ^198^Thallium | |
| 59880004 | Hemoglobin J-Calabria | |
| 59882007 | Aminocaproic acid | |
| 59888006 | Carnitine | |
| 59895002 | Blood group antibody Tichmeyer | |
| 59905008 | Isoantibody | |
| 59906009 | Glucose dehydrogenase (pyrroloquinolinequinone) | |
| 59924006 | Polynucleotide adenylyltransferase | |
| 59937009 | Cephalothin sodium (substance) | |
| 59938004 | ^208^Thallium | |
| 59951009 | 4-Pyridoxolactonase | |
| 59954001 | Oxaloacetate tautomerase | |
| 59961002 | Eye liner | |
| 59964005 | ^192^Gold | |
| 59987002 | Polyoxyethelene 4 sorbitan monostearate | |
| 60018006 | Amrinone lactate | |
| 60047004 | Oncogene protein c-fms | |
| 60052009 | Venom exonuclease | |
| 60057003 | ^201^Thallium | |
| 60061009 | Protein N-acetylglucosaminyltransferase | |
| 60069006 | Plutonium compound | |
| 60085001 | Chromatin | |
| 60135007 | Homosalate | |
| 60141000 | Ribonuclease P4 | |
| 60153001 | gamma-Glutamyltransferase | |
| 60175004 | Formate-tetrahydrofolate ligase | |
| 60187006 | NADPH peroxidase | |
| 60200001 | Glyoxylate reductase | |
| 60208008 | Coagulation factor V | |
| 60215000 | HLA-A2 antigen | |
| 60244003 | 3-Dehydroretinol | |
| 60245002 | ^240^Californium | |
| 60253005 | Aminoacylase | |
| 60260004 | Histidine | |
| 60266005 | Chloroquine hydrochloride | |
| 60273000 | ^220^Radon | |
| 60289002 | Mepenzolate bromide | |
| 60292003 | Blood group antigen I^D^ | |
| 60300004 | Blood group antibody C^G^ | |
| 60303002 | Dinitrobenzene | |
| 60310008 | Mytilidase | |
| 60323001 | Mercuric oxycyanide | |
| 60343007 | D-Lyxose ketol-isomerase | |
| 60344001 | Malonate-semialdehyde dehydrogenase | |
| 60345000 | Cobalt hydrocarbonyl | |
| 60349006 | Uridylic acid | |
| 60351005 | Salicylate 1-monooxygenase | |
| 60352003 | Anthocyanin | |
| 60355001 | Hemoglobin Philly | |
| 60364006 | Blood group antibody McC^b^ | |
| 60373003 | Cathepsin H | |
| 60376006 | Succinic acid | |
| 60381002 | Nickel fluoride | |
| 60403001 | beta-Amylase | |
| 60407000 | Lymphocyte antigen CD46 | |
| 60418000 | Serine dehydrogenase | |
| 60424006 | Acetylserotonin methyltransferase | |
| 60430006 | FSH receptor | |
| 60441008 | Trypan blue stain (substance) | |
| 60444000 | tRNA (guanosine-O^2'^)-methyltransferase | |
| 60449005 | Putrescine oxidase | |
| 60455000 | Racephedrine | |
| 60457008 | Proprionic acid | |
| 60459006 | Iron Fe^59^ labeled dextran | |
| 60469000 | C>5b678< inhibitor | |
| 60470004 | Blood group antigen Marcus | |
| 60471000 | Sodium compound | |
| 60489004 | Hemoglobin J-Habana | |
| 60491007 | Blood group antigen Bothrops | |
| 60500000 | Cysteine lyase | |
| 60516003 | Blood group antibody McDermott | |
| 60526005 | Acetyl salicylate | |
| 60530008 | Aldehyde | |
| 60543008 | ^78^Arsenic | |
| 60544002 | Aminoamide | |
| 60556001 | Glutamate-methylamine ligase | |
| 60575006 | Blood group antibody Wiggins | |
| 60577003 | Glucan 1,4-beta-glucosidase | |
| 60596004 | Hemoglobin Providence | |
| 60598003 | Operator gene | |
| 60605004 | Hepatitis B e antigen | |
| 60617002 | Nitrogenase (flavodoxin) | |
| 60663008 | Phosphatidyl-N-methylethanolamine methyltransferase | |
| 60702005 | Myelin protein | |
| 60714002 | Fibrin degradation product, E fragment | |
| 60717009 | Blood group antibody John Smith | |
| 60722009 | Serine-sulfate ammonia-lyase | |
| 60727003 | Miconazole nitrate | |
| 60739006 | Waxoline blue stain (substance) | |
| 60740008 | Dolichyl-phosphatase (substance) | |
| 60760000 | Reverse T>3< | |
| 60762008 | Cysteine-conjugate beta-lyase | |
| 60764009 | Neovitamin A | |
| 60769004 | Hard metal | |
| 60772006 | Blood group antibody Rasmussen | |
| 60792004 | HLA-Cw4 antigen | |
| 60793009 | Smegma | |
| 60803009 | Protocollagen | |
| 60808000 | Fibrinogen Marburg | |
| 60838006 | Blood group antigen Holmes | |
| 60840001 | Blood group antigen Horw | |
| 60842009 | Hemoglobin Agenogi | |
| 60848008 | Blood group antibody Lu17 | |
| 60860009 | Hemoglobin F-Caltech | |
| 60868002 | Blood group antigen MZ 443 | |
| 60872003 | Acetic naphthalene | |
| 60874002 | Blood group antigen Au^a^ | |
| 60884001 | Procollagen | |
| 60885000 | Trisulfapyrimidines | |
| 60886004 | Morphine sulfate | |
| 60889006 | Hemoglobin Guangzhou-Hangzhou | |
| 60904002 | HLA-Cw6 antigen | |
| 60905001 | Salicylanilide | |
| 60908004 | ^125^Tin | |
| 60917004 | Cholinesulfatase | |
| 60920007 | Fuchsin acid stain (substance) | |
| 60924003 | Fibrinogen Paris II | |
| 60925002 | Hemoglobin Tübingen | |
| 60943003 | Glutamate-5-semialdehyde dehydrogenase | |
| 60976004 | w-Hydroxydecanoate dehydrogenase | |
| 60988002 | Tolmetin sodium | |
| 61004005 | Blood group antigen Wiggins | |
| 61010005 | Solvent | |
| 61015000 | Blood group antibody Craig | |
| 61024009 | Blood group antibody Bruno | |
| 61025005 | Colloidal iodine | |
| 61029004 | Hemoglobin Arlington Park | |
| 61044003 | Acipenserin | |
| 61045002 | Sedoheptulose | |
| 61068006 | Thioflavine T stain (substance) | |
| 61076008 | Hemoglobin Beth Israel | |
| 61078009 | Progesterone receptor | |
| 61088005 | Plastic | |
| 61103002 | Choline-phosphate cytidylyltransferase | |
| 61114004 | Chymase | |
| 61116002 | Immunoglobulin, GM allotype | |
| 61133009 | Cytochrome-c-lysine methyltransferase | |
| 61149006 | 4-Acetamidobutyryl-CoA deacetylase | |
| 61171001 | Maleylpyruvate isomerase | |
| 61177002 | Arachidonate 15-lipoxygenase | |
| 61178007 | Neamine | |
| 61188008 | Extracellular fibril | |
| 61190009 | Blood group antibody Payer | |
| 61195004 | D-Glutaminase | |
| 61201007 | Pheophytin | |
| 61205003 | Molten metal (substance) | |
| 61224000 | Deoxyribonuclease V | |
| 61226003 | ^201^Lead | |
| 61238007 | Creatine kinase isoenzyme, MM fraction | |
| 61243000 | Orotidine-5'-phosphate decarboxylase | |
| 61244006 | Monobasic potassium phosphate | |
| 61245007 | Hemoglobin Cochin-Port Royal | |
| 61268003 | Gastrointestinal contents | |
| 61271006 | Blood group antibody s | |
| 61275002 | Triiodothyronine | |
| 61298005 | Acyl-CoA dehydrogenase (NADP^+^) | |
| 61299002 | Enkephalin | |
| 61306004 | Methylrosaniline | |
| 61308003 | Putrescine carbamoyltransferase | |
| 61321005 | Cancer-related substance | |
| 61348006 | Lombricine kinase | |
| 61357000 | Paramethadione | |
| 61359002 | Thiosulfuric acid | |
| 61360007 | Polymyxin B sulfate | |
| 61384004 | Camphene | |
| 61391001 | Temuline | |
| 61398007 | Chlophedianol (substance) | |
| 61418009 | Nitroquinoline-N-oxide reductase | |
| 61425002 | C reactive protein | |
| 61429008 | Bismuth radioisotope | |
| 61450004 | Dibromochloropropane | |
| 61453002 | Glutarate-CoA ligase | |
| 61454008 | Immune response gene | |
| 61466002 | Uridine nucleosidase | |
| 61467006 | Ribitol dehydrogenase | |
| 61471009 | Chloride trifluoride | |
| 61472002 | Collagen | |
| 61479006 | Galactosylxylosylprotein 3-beta-galactosyltransferase | |
| 61481008 | Amanitine | |
| 61483006 | Azaribine | |
| 61489005 | 1-Aminocyclopropane-1-carboxylate synthase | |
| 61497003 | Latia-luciferin monooxygenase (demethylating) | |
| 61505004 | Plant mitogen | |
| 61527008 | Radium radioisotope | |
| 61529006 | 4-Cresol dehydrogenase (hydroxylating) | |
| 61540003 | Oil of hyssop | |
| 61541004 | Dichlorophenoxy ethyl sulfate | |
| 61566000 | Benzene 1,2-dioxygenase | |
| 61573005 | Dehydro-L-gulonate decarboxylase | |
| 61580007 | Red cell neutral endopeptidase | |
| 61581006 | Carbendazim | |
| 61588000 | Thymidine kinase | |
| 61595009 | Octane | |
| 61615004 | Aspergillus nuclease S>1< | |
| 61617007 | 7alpha-Hydroxysteroid dehydrogenase | |
| 61630008 | Chondroitin AC lyase | |
| 61643008 | Isocitrate lyase (substance) | |
| 61644002 | Solanain | |
| 61655002 | Blood group antigen Kasamatsuo | |
| 61664007 | Ribonuclease V | |
| 61678008 | Fluphenazine hydrochloride | |
| 61684006 | ^211^Radon | |
| 61692002 | Chromoprotein | |
| 61694001 | Ribonucleoside | |
| 61709008 | Cinchophen | |
| 61716009 | ^81m^Krypton | |
| 61730004 | Ketotetrose-phosphate aldolase | |
| 61731000 | Methyl isobutyl carbinol | |
| 61736005 | Heavy metal compound | |
| 61742009 | Biperiden lactate | |
| 61765004 | Hemoglobin Altdorf | |
| 61773008 | Lidocaine hydrochloride | |
| 61789006 | Dye | |
| 61795007 | Corticotropin-like intermediate lobe peptide | |
| 61813008 | Fibrinogen Chapel Hill I | |
| 61833007 | Blood group antibody Li^a^ | |
| 61841007 | Complement activator | |
| 61849009 | Disperse orange | |
| 61863003 | Barium sulfide | |
| 61864009 | Vinca alkaloid | |
| 61871004 | Alanine-oxo-acid aminotransferase | |
| 61872006 | Lactaldehyde reductase | |
| 61899008 | Dextrothyroxine sodium | |
| 61904007 | Phensuximide | |
| 61905008 | Methylcyclohexanol | |
| 61915002 | Blood group antigen Walin | |
| 61925007 | Rubratoxin | |
| 61936000 | Nicotinamide methyltransferase | |
| 61944000 | Collagen type II | |
| 61967003 | Hemoglobin C | |
| 61971000 | Butyrate kinase | |
| 61978006 | Blood group antibody Burrett | |
| 61993005 | Allergoid | |
| 61994004 | Haptoglobin 2-2 | |
| 62003001 | Blood group antigen Boldog | |
| 62004007 | Blood group antigen Lu8 | |
| 62007000 | Blood group antigen Kowanski | |
| 62027004 | Hexadecanol dehydrogenase | |
| 62032003 | Dextransucrase | |
| 62036000 | Titanium dioxide | |
| 62038004 | HLA-DR antigen | |
| 62039007 | Diclofenac sodium | |
| 62044000 | Isopentenyl-diphosphate delta-isomerase | |
| 62046003 | Pyrophosphate-protein phosphotransferase | |
| 62053007 | Nylon 6 | |
| 62059006 | Gastric contents | |
| 62070004 | Dibromsalicylanilide | |
| 62077001 | 2-Methoxyethanol acetate | |
| 62097006 | Chlorate reductase | |
| 62128007 | Kerosene | |
| 62135004 | Protein xylosyltransferase | |
| 62145002 | Fibrinogen Aarhus | |
| 62150008 | Hemoglobin Sendagi | |
| 62162007 | ^90m^Zirconium | |
| 62167001 | Quinate dehydrogenase | |
| 62168006 | Fibrinogen antibody | |
| 62174006 | Fructose-1-6-phosphate | |
| 62177004 | Tantalum compound | |
| 62183001 | Collagen fiber | |
| 62184007 | Hemoglobin Collingwood | |
| 62194002 | Lung irritant chemical warfare agent | |
| 62197009 | Nucleoside-diphosphate kinase | |
| 62214005 | Phosphatidic acid | |
| 62237004 | Mesoporphyrin | |
| 62249003 | HLA-Cw5 antigen | |
| 62252006 | Plasminogen | |
| 62256009 | Bilirubin monoglucuronide | |
| 62265002 | Acylagmatine amidase | |
| 62267005 | Capsular-polysaccharide endo-1,3-alpha-galactosidase | |
| 62298007 | Melanocyte hormone inhibiting factor | |
| 62301006 | Thiamin oxidase | |
| 62304003 | Mercuric sulfate | |
| 62346007 | Phloretin hydrolase | |
| 62352008 | 6-beta Hydroxycortisol | |
| 62358007 | Blood group antibody Bio-5 | |
| 62364000 | Monomethyl aniline | |
| 62368002 | Erythrityl tetranitrate (substance) | |
| 62384001 | Fibrinogen Oslo I | |
| 62387008 | ^109m^Silver | |
| 62412007 | Dipeptidyl peptidase IV | |
| 62416005 | Formaldehyde transketolase | |
| 62417001 | trans-Cinnamate 4-monooxygenase | |
| 62421008 | Blood group antibody Henry | |
| 62442005 | Chloriodized oil | |
| 62443000 | Hemoglobin Christchurch | |
| 62444006 | Cyclopentamine | |
| 62451002 | Alcohol acetyltransferase | |
| 62483008 | Hydroxycinnamate 4-beta-glucosyltransferase | |
| 62486000 | ^10^Beryllium | |
| 62492006 | Frangula | |
| 62504002 | Antigen recognition site | |
| 62506000 | Agavain | |
| 62515007 | Heterophil antigen | |
| 62517004 | Sodium chromate Cr^51^ | |
| 62523009 | Blood group antibody e | |
| 62543003 | Gallium | |
| 62544009 | ^87^Krypton | |
| 62545005 | Ammonium carbonate | |
| 62547002 | ^251^Californium | |
| 62563005 | Blood group antigen Anuszewska | |
| 62569009 | Transferrin receptor | |
| 62576004 | Carboxyhemoglobin | |
| 62600002 | Blood group antibody Bert | |
| 62601003 | 3-Phosphoglycerate phosphatase | |
| 62613008 | Blood group antigen Balkin | |
| 62632002 | Blood group antibody Kx | |
| 62649009 | Butyl fluazifop | |
| 62652001 | beta-Aspartyldipeptidase | |
| 62661001 | ^80m^Bromine | |
| 62666006 | Histamine phosphate | |
| 62673001 | Platelet antibody HPA-3a | |
| 62680004 | Glycerophosphoinositol inositolphosphodiesterase | |
| 62694003 | Aflatoxin | |
| 62699008 | Complement component C5 | |
| 62707007 | ^110^Silver | |
| 62721009 | Fibrinopeptide A | |
| 62741004 | Alkaline phosphatase isoenzyme, liver fraction | |
| 62754006 | Sodium iodide | |
| 62763008 | Teichoic acid | |
| 62775003 | Fusion protein GAG-ONC | |
| 62776002 | Fatty-acid synthase | |
| 62797001 | Arginine kinase | |
| 62800004 | Blood group antigen En^a^FS | |
| 62812000 | Pharyngeal contents | |
| 62817006 | Verruculogen | |
| 62821004 | Hydroxybutyric acid | |
| 62832004 | Blood group antigen Tollefsen-Oyen | |
| 62841009 | Blood group antibody Stairwalt | |
| 62848003 | Amphibian venom | |
| 62854002 | Gastrin | |
| 62873003 | Plant product | |
| 62874009 | Bisalbumin | |
| 62882009 | Hemoglobin A>2< Sphakia | |
| 62885006 | Blood group antigen Ok^a^ | |
| 62902008 | Oncogene protein L-MYC | |
| 62915004 | Acrylonitrile | |
| 62916003 | Polyvinylidene chloride | |
| 62929003 | Blood group antibody Le^bL^ | |
| 62934004 | Myxobacter AL-1 proteinase II | |
| 62948004 | Hemoglobin J-Rajappen | |
| 62957005 | ^237^Uranium | |
| 62959008 | Immunoglobulin IgG1, H chain | |
| 62963001 | Blood group antibody Rh41 | |
| 62975006 | Methyl acetylene-propadiene mixture | |
| 62998003 | Lymphocyte antigen CD74 | |
| 63004003 | Phenylalanine | |
| 63006001 | 3-Oxoacid CoA-transferase | |
| 63026002 | Anti lymphocyte antibody | |
| 63028001 | Indolelactate dehydrogenase | |
| 63037001 | Phytotoxin | |
| 63045006 | Berry | |
| 63047003 | Blood group antigen K11 | |
| 63083007 | Cyclobenzaprine hydrochloride | |
| 63084001 | Clindamycin hydrochloride | |
| 63089006 | Mannose | |
| 63096008 | m^7^G(5')pppN pyrophosphatase | |
| 63108002 | Dimethylallyltranstransferase | |
| 63123007 | Estrogen binding protein | |
| 63133004 | Phenylhydrazine | |
| 63134005 | 2,5-Dihydroxypyridine 5,6-dioxygenase | |
| 63146009 | Blood group antigen Covas | |
| 63155007 | Blood group antibody Rh33 | |
| 63167009 | Warfarin sodium | |
| 63169007 | Blood group antibody Fy^a^ | |
| 63188000 | Carbenicillin indanyl sodium | |
| 63203003 | Ethoxyzolamide | |
| 63222007 | 2,4-Diaminopentanoate dehydrogenase (substance) | |
| 63229003 | Blood group antigen Win | |
| 63261004 | Chloroxuron | |
| 63266009 | Blood group antibody Anton | |
| 63271002 | Hemoglobin Lufkin | |
| 63281003 | Enterobacter ribonuclease | |
| 63282005 | Thiphenamyl (substance) | |
| 63306009 | Immunoglobulin IgG2 | |
| 63307000 | Lactoyl-CoA dehydratase | |
| 63326008 | Inhibin hormone | |
| 63330006 | Nonessential amino acid | |
| 63341008 | Mevinphos | |
| 63349005 | Zinc cyanide | |
| 63350005 | Hepatitis B surface antigen subtype adw | |
| 63360001 | ^89^Zirconium | |
| 63366007 | Immune reactive locus | |
| 63374008 | Hemoglobin Castilla | |
| 63379003 | Coal tar pitch volatiles | |
| 63383003 | Zinc stearate | |
| 63399009 | Reduced glutathione | |
| 63408009 | Cysteinyl-glycine dipeptidase | |
| 63441007 | Isobutyl alcohol | |
| 63447006 | Ribokinase | |
| 63461001 | Cumene | |
| 63478005 | Blood group antibody M^c^ | |
| 63482007 | Gentamicin 3'-acetyltransferase | |
| 63494003 | Inosine kinase (substance) | |
| 63497005 | Dibutoline | |
| 63522006 | Plant gene | |
| 63527000 | Methionine decarboxylase | |
| 63538000 | Blood group antigen Ny^a^ | |
| 63545000 | Halazepam | |
| 63559007 | Doxycycline calcium | |
| 63591008 | Chromic sulfate | |
| 63595004 | Blood group antigen Bultar | |
| 63598002 | Blood group antigen Mi^a^ | |
| 63606002 | Tin oxide | |
| 63615009 | Bromdimethoxyamphetamine | |
| 63621008 | Lymphocyte antigen CD47 | |
| 63635005 | Blood group antigen Cross | |
| 63652009 | Oncogene protein C-ABL | |
| 63658008 | Methylenetetrahydrofolate-tRNA-(uracil-5)-methyltransferase (FADH>2<-oxidizing) | |
| 63664001 | Glycine methyltransferase | |
| 63676001 | Arginine hydrochloride | |
| 63679008 | 2-Amino-4-hydroxy-6-hydroxymethyl-dihydropteridine pyrophosphokinase | |
| 63689007 | Jatropham | |
| 63704005 | Thermophilic aminopeptidase | |
| 63707003 | Hemoglobin F-Texas-I | |
| 63718003 | Folic acid | |
| 63730009 | Calcitonin | |
| 63735004 | Immunoglobulin, KM>2< allotype | |
| 63754004 | Yttrium | |
| 63759009 | Trehalose-phosphatase | |
| 63760004 | ^135^Cesium | |
| 63766005 | Flour | |
| 63768006 | Type II site-specific deoxyribonuclease | |
| 63770002 | Hemoglobin Dunn | |
| 63779001 | Diphenidol (substance) | |
| 63788005 | Blood group antibody Davis J | |
| 63789002 | Carbamyl phosphate | |
| 63793008 | Phosphorus compound | |
| 63798004 | Hemoglobin Caribbean | |
| 63809007 | Sphingosine beta-galactosyltransferase | |
| 63813000 | Alkali | |
| 63842008 | Dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase | |
| 63852007 | Catkin | |
| 63854008 | Isopropylmethylpyrimidyl diethyl thiophosphate | |
| 63856005 | Coagulation factor IXa | |
| 63857001 | Candida skin test antigen | |
| 63862000 | 1, 2-Diacylglycerol | |
| 63865003 | Blood group antigen Margaret | |
| 63867006 | Blood group antigen Dav | |
| 63868001 | ^193m^Mercury | |
| 63869009 | Khellin | |
| 63882001 | Aromatic solvent naphtha | |
| 63889005 | Dichromate salt | |
| 63896007 | Taurine salt of bile acid | |
| 63920006 | Platelet antibody HPA-4 | |
| 63927009 | Bromate salt | |
| 63929007 | Alkali blue 6B stain (substance) | |
| 63950003 | Immunoglobulin IgA2 (substance) | |
| 63969008 | Regulator gene | |
| 63984004 | Fibrinogen Awaji | |
| 63999004 | Testolactone | |
| 64011005 | Cyhalothrin | |
| 64020001 | Blood group antibody A. Owens | |
| 64026007 | Thiamin-phosphate kinase | |
| 64029000 | Ticrynafen (substance) | |
| 64032002 | Blood group antigen Tn | |
| 64037008 | Blood group antibody Bregi | |
| 64039006 | Cuprous oxide | |
| 64053006 | Triokinase | |
| 64055004 | 21-Hydroxysteroid dehydrogenase (NAD^+^) | |
| 64070003 | Blood group antibody Schor | |
| 64082007 | Plant toxalbumin | |
| 64086005 | Formic acid | |
| 64093009 | Blood group antigen Bx^a^ | |
| 64095002 | Quinone oxime benzoyl hydrazine | |
| 64096001 | Blood group antibody Giaigue | |
| 64099008 | Oligo-1,6-glucosidase | |
| 64105005 | Blood group antibody LW^a^ | |
| 64112001 | Fast blue RR salt stain (substance) | |
| 64128006 | Phosphoglycerate mutase | |
| 64130008 | Troleandomycin | |
| 64142003 | Spermine synthase | |
| 64147009 | Nephrotoxic mycotoxin | |
| 64170001 | Blood group antigen Whittle | |
| 64179000 | Zinc chloride | |
| 64182005 | Pituitary luteinizing hormone | |
| 64187004 | Cellulase | |
| 64191009 | Naltrexone hydrochloride | |
| 64197008 | Smoke | |
| 64221009 | Tropinesterase | |
| 64238008 | Blood group antigen Ce | |
| 64242006 | Aerosol | |
| 64244007 | Plant genome | |
| 64257004 | D-Ribitol-5-phosphate cytidylyltransferase | |
| 64259001 | Blood group antigen e | |
| 64263008 | 3-Oxoadipate CoA-transferase | |
| 64267009 | Hemoglobin Saki | |
| 64273005 | HLA-A25 antigen | |
| 64276002 | Calcium antacid | |
| 64279009 | HLA-B13 antigen | |
| 64288000 | Oncogene protein TCL1 | |
| 64291000 | Blood group antibody Kamiya | |
| 64365003 | Granulopoietin | |
| 64385004 | Pyridoxal oxidase | |
| 64416009 | Ganglioside GM>1< | |
| 64426002 | Ribonuclease alpha | |
| 64436005 | Fibrinogen Giessen III (substance) | |
| 64437001 | Phycocyanin | |
| 64447003 | Dihydroergocristine | |
| 64449000 | Dhurrin | |
| 64463006 | Ethotoin | |
| 64471005 | Blood group antibody Lucy | |
| 64472003 | Immunoreactive parathormone | |
| 64488003 | Iodinated I^125^ human serum albumin | |
| 64493000 | Immunoglobulin, GM>22< allotype | |
| 64494006 | Dinoseb | |
| 64499001 | Blood group antibody Lu8 | |
| 64505000 | Uracil phosphoribosyltransferase | |
| 64507008 | Amantadine hydrochloride | |
| 64511002 | Cholestanetriol 26-monooxygenase | |
| 64517003 | Yersinia pestis V antigen | |
| 64520006 | Protamine sulfate | |
| 64527009 | Orsellinate decarboxylase | |
| 64530002 | Amyl acetate | |
| 64535007 | Padimate A | |
| 64538009 | Iodine heptafluoride | |
| 64543002 | ^178^Tungsten | |
| 64547001 | Naphthalene acetamide | |
| 64563009 | Oncogene protein P190, BCR-ABL | |
| 64566001 | HLA-Aw19 antigen | |
| 64570009 | HLA-B44 antigen | |
| 64601002 | Wood dust | |
| 64602009 | Blood group antibody Kominarek | |
| 64618003 | 2-Chloroethyl 2-(4-1,1-dimethylethyl) phenoxy-1 methylethyl ester | |
| 64629004 | Antibody to hepatitis E virus (substance) | |
| 64648000 | Herbicide oil | |
| 64652000 | Horseradish peroxidase | |
| 64659009 | Microbial metalloproteinases | |
| 64669003 | Succinylsulfathiazole | |
| 64686009 | Benzalkonium chloride | |
| 64687000 | Halogenated hydrocarbon insecticide | |
| 64699007 | Ferredoxin-NAD^+^ reductase | |
| 64709009 | Dead space air | |
| 64734009 | Starch (bacterial glycogen) synthase | |
| 64763007 | 2-Dehydropantoyl-lactone reductase | |
| 64769006 | Hemoglobin F-Marietta | |
| 64778000 | Mammary fluid | |
| 64780006 | Glycerophosphoinositol glycerophosphodiesterase | |
| 64783008 | Chlormequat chloride | |
| 64788004 | Blood group antigen Pr^a^ | |
| 64790003 | Vertebrate collagenase | |
| 64796009 | Malt soup extract | |
| 64797000 | Blood group antibody Emma | |
| 64806009 | Retinol dehydrogenase | |
| 64813009 | Aminopentamide (substance) | |
| 64821003 | Isobornyl thiocyanoacetate | |
| 64823000 | Blood group antibody IP>1< | |
| 64827004 | Quartz | |
| 64843006 | Tungsten compound | |
| 64845004 | Freund antigen | |
| 64846003 | Blood group antigen i | |
| 64856004 | Digestive system fluid | |
| 64868008 | ^115m^Cadmium | |
| 64869000 | Conotoxin | |
| 64871000 | Insoluble immune complex | |
| 64881001 | Phosphatidyl serine | |
| 64888007 | Methicillin sodium (substance) | |
| 64891007 | Urea cream | |
| 64893005 | Immunoglobulin, L chain, kappa | |
| 64895003 | Blood group antibody R.M. | |
| 64896002 | Allergenic extract | |
| 64901000 | Rubidium isotope | |
| 64903002 | Methylguanidinase | |
| 64918001 | HLA-Aw43 antigen | |
| 64940005 | Ethoheptazine | |
| 64974009 | Calcium isotope | |
| 64991008 | Soluble berlin blue stain (substance) | |
| 64993006 | Placental fluid | |
| 65016007 | Tetrabromobenzoquinone | |
| 65025001 | Pyridine | |
| 65054007 | ^62^Zinc | |
| 65070009 | L-Ascorbate peroxidase | |
| 65081007 | Blood group antibody Tk | |
| 65086002 | ^240^Americium | |
| 65088001 | Propranolol hydrochloride | |
| 65097002 | Immunoglobulin, GM>3< allotype | |
| 65104003 | Furfuryl alcohol | |
| 65114007 | Blood group antigen Boil | |
| 65115008 | Sepia proteinase | |
| 65123005 | Choline | |
| 65125003 | Immunoglobulin, GM>20< allotype | |
| 65134008 | Hemoglobin Athens-Ga | |
| 65148008 | Xanthosine | |
| 65149000 | Exhaled air | |
| 65150000 | Autoantigen | |
| 65151001 | Blood group antibody Bridgewater | |
| 65156006 | Technetium Tc^99m^ pyrophosphate and polyphosphate | |
| 65170006 | Arginine-tRNA ligase | |
| 65183007 | Vitamin K | |
| 65216001 | Cerebrospinal fluid | |
| 65222005 | Calcium aminosalicylate | |
| 65227004 | Blood group antigen Gilbraith | |
| 65236000 | Blood group antigen Tx | |
| 65246003 | Aldicarb | |
| 65248002 | Blood group antigen HLA-A8 | |
| 65249005 | Terphenyl | |
| 65257008 | Phosphate butyryltransferase | |
| 65269000 | Blood group antibody K20 | |
| 65270004 | Hydroxyacylglutathione hydrolase | |
| 65282008 | CMP-N-acetylneuraminate-galactosyldiacyl-glycerol alpha-2,3-sialyltransferase | |
| 65283003 | Tryptophan 2-monooxygenase | |
| 65285005 | Aflatoxin G | |
| 65288007 | Hemoglobin Boyle Heights | |
| 65302009 | Choline salicylate | |
| 65311009 | ^196m^Thallium | |
| 65345002 | Epoxy resin | |
| 65386009 | Bocillus thermoproteolyticus neutral proteinase | |
| 65395001 | Phosphoglucomutase | |
| 65403003 | Novobiocin sodium | |
| 65407002 | Androgen receptor | |
| 65414000 | Hemoglobin Hamadan | |
| 65418002 | Glucose-1-phosphate guanylyltransferase (substance) | |
| 65423002 | Isosparteine | |
| 65426005 | Benzaldehyde | |
| 65428006 | Thyroid stimulating hormone | |
| 65436002 | Light metal | |
| 65445001 | Ethyl violet stain (substance) | |
| 65449007 | Blood group antibody R>2<R>2<-202 | |
| 65456001 | Blood group antibody Donavieski | |
| 65458000 | Aminopyrine (substance) | |
| 65459008 | Blood group antibody U^x^ | |
| 65465008 | Fibrinogen Munich II | |
| 65479000 | Inseparable antibody | |
| 65480002 | Dihydroorotate dehydrogenase | |
| 65485007 | Immunoglobulin, switch region | |
| 65488009 | Citramalate CoA-transferase | |
| 65495000 | Butopyronoxyl | |
| 65509001 | Fibrinogen Stony Brook | |
| 65512003 | Blood group antibody Thompson | |
| 65527003 | ^190m>1<^Iridium | |
| 65530005 | Oil of basil | |
| 65543005 | Blood group antibody Haven | |
| 65555004 | 11-beta Hydroxyandrostenedione | |
| 65557007 | Graphite dust | |
| 65580004 | Alizarin red S stain (substance) | |
| 65586005 | Phosphorus oxychloride | |
| 65589003 | Blood group antibody Fy^b^ | |
| 65592004 | Nutmeg oil | |
| 65601005 | Hemoglobin Kempsey | |
| 65639002 | Uridine diphosphate | |
| 65640000 | Sulfhemoglobin | |
| 65644009 | Coke oven emission | |
| 65665003 | Acylneuraminate cytidylyltransferase | |
| 65669009 | Strong acid | |
| 65674001 | ^190^Platinum | |
| 65682001 | Proline dipeptidase | |
| 65699000 | beta globulin | |
| 65716002 | Blood group antigen Terry | |
| 65730007 | Ponceau 3R stain (substance) | |
| 65738000 | Coagulation factor VIIIa | |
| 65741009 | Mepivacaine hydrochloride | |
| 65746004 | Blood group antigen Lu5 | |
| 65757009 | Non-protein nitrogen | |
| 65773003 | Chloropicrin | |
| 65777002 | Blood group antigen Joslin | |
| 65799005 | Epiglottic mucus | |
| 65802001 | Complement enzyme, active (substance) | |
| 65806003 | Blood group antibody Much | |
| 65826004 | Oil of rue | |
| 65863008 | Pigment | |
| 65868004 | Propiomazine hydrochloride | |
| 65874004 | Hemoglobin Le Lamentin | |
| 65887005 | Blood group antigen Jk^a^ | |
| 65889008 | Hypoxanthine phosphoribosyltransferase | |
| 65898006 | Bothrops atrox serine proteinase | |
| 65903005 | Hemoglobin Ohio | |
| 65914008 | Glyceric acid | |
| 65919003 | D-Ribulokinase | |
| 65923006 | Pumice | |
| 65925004 | Hemoglobin F-Bonaire-GA | |
| 65932008 | Carbolineum | |
| 65945007 | ^88^Zirconium | |
| 65948009 | Aluminum ammonium sulfate | |
| 65951002 | L-Ribulose-phosphate 4-epimerase | |
| 65955006 | Dihydroxyphenylalanine | |
| 65972004 | Daunorubicin hydrochloride | |
| 65973009 | Hemoglobin Fort Worth | |
| 65982003 | Triprolidine hydrochloride | |
| 65988004 | [Acyl-carrier-protein] phosphodiesterase | |
| 65992006 | Streptomycin 3''-kinase | |
| 66004009 | Isoetharine (substance) | |
| 66015004 | Transplantation antigen | |
| 66037006 | Hydroxymethylglutaryl-CoA synthase | |
| 66043008 | Pyruvate dehydrogenase (cytochrome) | |
| 66044002 | Skin antiviral agent | |
| 66086008 | Lepromin | |
| 66103001 | Malyl-CoA lyase | |
| 66124006 | Trypsin | |
| 66128009 | Creatine kinase isoenzyme, BB fraction | |
| 66143006 | alpha-Methyl styrene | |
| 66147007 | Lymphocyte antigen CD14 | |
| 66148002 | Sabadilla | |
| 66153007 | 1-Alkylglycerophosphocholine acetyltransferase | |
| 66178006 | ^117m^Cadmium | |
| 66194004 | myo-Inositol oxygenase | |
| 66196002 | Inositol 1-alpha-galactosyltransferase | |
| 66202004 | Alkenylglycerophosphocholine hydrolase | |
| 66203009 | Branched-chain-amino-acid aminotransferase | |
| 66209008 | Hemoglobin Montgomery | |
| 66228001 | Actinocongestin | |
| 66234008 | Alanine-oxomalonate aminotransferase | |
| 66235009 | Oncogene protein bcl-1 | |
| 66240001 | Blood group antibody Parra | |
| 66263006 | Lysine racemase | |
| 66290002 | Benzthiazide | |
| 66296008 | Hemoglobin J-Altgeld Gardens | |
| 66322002 | Dextran 40 | |
| 66365001 | N-m-tolyl phthalamic acid | |
| 66384003 | Isophane insulin | |
| 66389008 | Magnesium oxide | |
| 66395009 | Blood group antigen Mitch | |
| 66396005 | Fibrinogen Zürich II | |
| 66404001 | Lochia rubra | |
| 66428004 | Blood group antigen Wu | |
| 66431003 | Alkyl dimethyl 3,4-dichlorobenzene ammonium chloride | |
| 66440004 | HLA-DRw8 antigen | |
| 66458005 | Thiol methyltransferase | |
| 66460007 | Single stranded anti DNA antibody | |
| 66461006 | Diamine aminotransferase | |
| 66465002 | Silicon isotope | |
| 66472001 | Fibrinogen Parma | |
| 66481007 | Semisynthetic human insulin | |
| 66497002 | Blood group antibody Weeks | |
| 66506002 | Peptidoglycan endopeptidase | |
| 66508001 | Quinine hydrochloride | |
| 66509009 | Vancomycin hydrochloride | |
| 66511000 | Blood group antigen Gf | |
| 66524000 | Sphingomyelin | |
| 66533003 | gamma-Glutamyl hydrolase | |
| 66538007 | Glucan endo-1,2-beta-glucosidase | |
| 66560005 | Rubredoxin-NAD^+^ reductase | |
| 66562002 | Cigarette smoking tobacco | |
| 66565000 | ^209^Bismuth | |
| 66566004 | Gastrointestinal hormone receptor | |
| 66573009 | Bordeaux mixture | |
| 66586000 | Cadmium | |
| 66587009 | Kallikrein | |
| 66594007 | Phosphopentomutase | |
| 66603002 | Glucagon | |
| 66632004 | Lymphocyte antigen CD6 | |
| 66639008 | Secobarbital sodium | |
| 66644001 | Blood group antibody Sieb | |
| 66653008 | Oxolinic acid | |
| 66656000 | Vitamin K>1< (substance) | |
| 66676006 | Vinyl carbazole | |
| 66684005 | Sulfur dye | |
| 66685006 | Pion | |
| 66686007 | D-Arabinose dehydrogenase (NAD(P)^+^) | |
| 66687003 | Tetrahydronaphthalene | |
| 66716008 | ^234^Thorium | |
| 66726001 | Acetaldehyde dehydrogenase (acetylating) | |
| 66733001 | Hachimycin | |
| 66734007 | Nicotinamide-nucleotide amidase | |
| 66741001 | Fibrinogen Marseille | |
| 66753002 | Heat labile bacterial toxin | |
| 66756005 | ^115^Antimony | |
| 66766002 | Dimethyl acetamide | |
| 66770005 | Acid phosphatase isoenzyme, prostatic fraction | |
| 66781008 | Cobalt dust | |
| 66796007 | Oligoclonal protein | |
| 66805006 | Hemoglobin J-Antakya | |
| 66811009 | Plant aldehyde oil | |
| 66815000 | Blood group antigen Baumler | |
| 66817008 | Vasoprotectant | |
| 66820000 | Hemoglobin J-Amiens | |
| 66831008 | Blood group antibody Lu3 | |
| 66832001 | Blood group antibody Vw | |
| 66833006 | Coagulation factor II Clamart variant | |
| 66843009 | Pentobarbital sodium | |
| 66849008 | Cytotoxin venom | |
| 66850008 | ^96^Technetium | |
| 66875007 | Surface immunoglobulin | |
| 66891005 | Cytotoxic antibody | |
| 66901003 | Chloroacetaldehyde | |
| 66906008 | Blood group antigen VS | |
| 66925006 | Copper | |
| 66945003 | Phosphite salt | |
| 66956003 | ^122^Iodine | |
| 67007009 | Blood group antigen McCall | |
| 67008004 | Roridin | |
| 67011003 | Cyanohydrin beta-glucosyltransferase | |
| 67014006 | Glycerol kinase | |
| 67025002 | Methionyl dipeptidase | |
| 67029008 | Acetophenazine maleate | |
| 67036009 | Plant growth regulator | |
| 67054008 | Zinc phosphide | |
| 67060008 | Vitamin D>3<, phosphate ester | |
| 67064004 | HLA-Dw4 antigen | |
| 67065003 | Serratia marcescens extracellular proteinase | |
| 67079006 | Glucose | |
| 67080009 | Glucuronate reductase | |
| 67098008 | ^226^Actinium | |
| 67100008 | GDP-4-dehydro-D-rhamnose reductase | |
| 67127007 | Methyl benzene | |
| 67131001 | Amino-acid racemase | |
| 67152009 | Hemoglobin Torino | |
| 67154005 | ^66^Nickel | |
| 67164001 | Lymphocyte antigen CD54 | |
| 67174003 | Bronchial mucus | |
| 67194007 | Syngraft | |
| 67200004 | Pyrophosphate-glycerol phosphotransferase | |
| 67215003 | Isoflavone O^4'^-methyltransferase | |
| 67216002 | Pipazethate (substance) | |
| 67218001 | Complement component C4b | |
| 67221004 | Azathioprine sodium | |
| 67246004 | Carcinoembryonic antigen | |
| 67250006 | Blood group antibody Inaba | |
| 67265007 | Fumigant | |
| 67266008 | Chromium isotope | |
| 67271001 | Gene | |
| 67273003 | Blood group antigen HLA-A7 | |
| 67296003 | Pork insulin | |
| 67324005 | Rice | |
| 67339006 | Levansucrase | |
| 67340008 | Hemoglobin Hiroshima | |
| 67342000 | Blood group antibody Jo^a^ | |
| 67345003 | Blood group antibody He | |
| 67347006 | Levorphanol tartrate | |
| 67355004 | Hemoglobin M-Saskatoon | |
| 67366006 | Hair spray | |
| 67368007 | Glycine carboxypeptidase | |
| 67377000 | Pangamic acid | |
| 67379002 | 2-Hexadecenal reductase | |
| 67384008 | UTP-xylose-1-phosphate uridylyltransferase | |
| 67386005 | Blood group antibody Rx | |
| 67404005 | 1,2-beta-fructan 1^F^-fructosyltransferase | |
| 67412002 | Phosphoenolpyruvate carboxykinase (GTP) | |
| 67428007 | Benzphetamine (substance) | |
| 67436003 | Blood group antibody Lu^b^ | |
| 67449008 | Pyruvate synthase | |
| 67451007 | Hemoglobin J-Rovigo | |
| 67471003 | Jasmolin | |
| 67473000 | Lithium hydroxide | |
| 67485008 | Isoamylase | |
| 67517005 | 25-Hydroxy ergocalciferol | |
| 67518000 | ^195^Mercury | |
| 67535001 | Thiamine monophosphate | |
| 67538004 | Citrinin | |
| 67552002 | Inorganic polysulfide compound | |
| 67560001 | Polypyrrole | |
| 67568008 | D-Lactate dehydrogenase | |
| 67575009 | ^125m^Tellurium | |
| 67584009 | Glutamate dehydrogenase (NADP+) (substance) | |
| 67586006 | Nonylphenoxy P.H. ethanol | |
| 67594004 | 4-Hydroxy-4-methyl-2-oxoglutarate aldolase | |
| 67609008 | 8,11,14-Eicosatrienoic acid | |
| 67610003 | Leukoagglutinin | |
| 67618005 | Isopropyl ether | |
| 67620008 | Quinoline | |
| 67634008 | Hydrogenated terphenyls | |
| 67636005 | Guaiacol | |
| 67639003 | Sulfonmethane | |
| 67650000 | Xenograft | |
| 67652008 | 1-Alkyl-2-acetylglycerol cholinephospho-transferase | |
| 67658007 | tRNA sulfurtransferase | |
| 67659004 | Sequestered antigen | |
| 67675001 | Eosinophilic chemotactic factor-anaphylaxis | |
| 67686004 | Tripalmitin | |
| 67687008 | 16-Hydroxysteroid epimerase | |
| 67690002 | Sodium iodide I^123^ | |
| 67695007 | Cytidylate kinase (substance) | |
| 67713006 | Blood group antibody Le^x^ | |
| 67719005 | Iodine isotope | |
| 67771002 | Deoxyribonuclease II | |
| 67774005 | Blood group antibody Le^a^ | |
| 67785007 | tRNA (guanine-N^7^)-methyltransferase | |
| 67803007 | Thiamin pyridinylase | |
| 67812009 | [Pyruvate kinase] phosphatase | |
| 67831003 | Hemoglobin J-Singapore | |
| 67836008 | Chelidonine | |
| 67844008 | 1-Methyladenosine nucleosidase | |
| 67846005 | Scopoletin glucosyltransferase | |
| 67866001 | Insulin | |
| 67899004 | Complement component, classic pathway | |
| 67903006 | D-Iditol dehydrogenase | |
| 67906003 | Etiocholanolone | |
| 67910000 | Hydroxylamine reductase | |
| 67921009 | ^203^Bismuth | |
| 67922002 | Serum | |
| 67927008 | HLA-A29 antigen | |
| 67928003 | Suramin sodium | |
| 67938008 | Amnesic shellfish poison | |
| 67956008 | Neutral red stain (substance) | |
| 67957004 | Vinyl toluene | |
| 67958009 | Blood group antibody Towey | |
| 67980007 | Amcinonide | |
| 67990004 | White wine | |
| 67994008 | Kynurenate-7,8-dihydrodiol dehydrogenase | |
| 68005004 | Chlorflurecol | |
| 68020005 | dCTP pyrophosphatase | |
| 68024001 | Cellulose acetate | |
| 68039000 | beta-Naphthol | |
| 68051003 | Dichloropropene | |
| 68077006 | Rutin (substance) | |
| 68101005 | Oxidoreductase | |
| 68105001 | Decahydronaphthalene | |
| 68110002 | Sphinganine kinase | |
| 68117004 | Yttrium radioisotope | |
| 68120007 | AMP nucleosidase | |
| 68132006 | N-b-bis (2-chloroethyl)-2-naphthylamine | |
| 68134007 | CDPdiacylglycerol pyrophosphatase | |
| 68144009 | Formyltetrahydrofolate dehydrogenase | |
| 68149004 | Blood group antigen Tofts | |
| 68153002 | ^123^Xenon | |
| 68174001 | Pyrroline-2-carboxylate reductase | |
| 68175000 | Complement component C3a | |
| 68185004 | Hemoglobin Abruzzo | |
| 68198008 | Extracellular metabolic product | |
| 68224005 | Ammonium sulfamate | |
| 68238003 | ^186^Iridium (substance) | |
| 68249009 | Blood group antigen Kn^a^ | |
| 68263003 | Janus green B stain (substance) | |
| 68277000 | Phorate | |
| 68283002 | beta-Fructofuranosidase | |
| 68293009 | Methenamine mandelate | |
| 68296001 | 1,6-Dihydroxycyclohexa-2,4-diene-1-carboxylate dehydrogenase | |
| 68310009 | Lucanthone | |
| 68321000 | Perthane | |
| 68326005 | Central myelin | |
| 68329003 | Fuller's earth | |
| 68332000 | Digoxin immune fab | |
| 68334004 | Pyrophosphate salt | |
| 68356001 | Chlorine compound | |
| 68357005 | Sodium hexafluorosilicate | |
| 68374005 | Blood group antibody Rg^a^ | |
| 68379000 | Cinnamon oil | |
| 68396004 | Ethyl butyl propanediol | |
| 68399006 | Fibrinogen Bondy | |
| 68420003 | HLA-Dw13 antigen | |
| 68429002 | Alanine-tRNA ligase | |
| 68430007 | 21-Hydroxysteroid dehydrogenase (NADP^+^) | |
| 68459007 | Crystal ponceau stain (substance) | |
| 68475005 | Intermediate-acting insulin | |
| 68484005 | Glyceraldehyde-3-phosphate dehydrogenase | |
| 68498002 | Antibody | |
| 68522008 | Blood group antigen Lucy | |
| 68524009 | Tragacanth | |
| 68527002 | Blood group antibody S1^b^ | |
| 68537007 | Anti DNA histone antibody | |
| 68540007 | Nicotine | |
| 68561000 | Hemoglobin Hirose | |
| 68580003 | ^59^Iron | |
| 68593008 | CDPabequose epimerase | |
| 68615006 | Bicarbonate | |
| 68617003 | N-Acetyllactosamine 3-alpha-galactosyltransferase | |
| 68620006 | Phosphorylase kinase | |
| 68630002 | ^125^Iodine | |
| 68639001 | Blood group antibody Wade | |
| 68657000 | CDPglucose 4,6-dehydratase | |
| 68669008 | Cyclobarbital | |
| 68674000 | Folpet | |
| 68680008 | Dexchlorpheniramine maleate | |
| 68691001 | Sabadine | |
| 68692008 | Complement component C3g | |
| 68699004 | Phenylephrine bitartrate | |
| 68715002 | Hexaethyl tetraphosphate | |
| 68725007 | NAD^+^ nucleosidase | |
| 68753007 | Amosite | |
| 68762009 | Blood group antigen In^a^ | |
| 68767003 | Blood group antibody Kp^b^ | |
| 68783003 | HLA-DRw13 antigen | |
| 68794004 | Uracil | |
| 68803005 | 1-Pyrroline-5-carboxylate dehydrogenase | |
| 68810004 | Methane monooxygenase | |
| 68826003 | Allyl-alcohol dehydrogenase | |
| 68831001 | Carbathiin | |
| 68836006 | Phosphoadenylylsulfatase | |
| 68837002 | Cadaverine | |
| 68839004 | 2',3'-Cyclic-nucleotide 2'-phosphodiesterase | |
| 68851002 | Lymphocyte antigen CD7 | |
| 68868003 | Clostripain | |
| 68871006 | Technetium isotope | |
| 68909008 | Hemoglobin Nagasaki | |
| 68929009 | Cadmium radioisotope | |
| 68941002 | Blood group antigen Vil | |
| 68945006 | Interleukin-2 | |
| 68967007 | Iodocholesterol I^131^ | |
| 68970006 | Glycerol-3-phosphate oxidase | |
| 68971005 | Coproantibody | |
| 68975001 | Blood group antibody Hey | |
| 68990002 | Blood group antibody Taylor | |
| 68991003 | Chromous salt | |
| 68992005 | Cellulose | |
| 69038000 | Biliverdin | |
| 69042002 | Immunoconglutinin | |
| 69049006 | Blood group antibody Meteja | |
| 69050006 | Physostigmine salicylate | |
| 69055001 | Acetate kinase (pyrophosphate) | |
| 69059007 | Cone | |
| 69076006 | Strontium chloride Sr^85^ | |
| 69084005 | Butilate | |
| 69088008 | Hemoglobin S-Antilles | |
| 69089000 | ^52^Iron | |
| 69091008 | Hemoglobin Rush | |
| 69095004 | Cinnamyl-alcohol dehydrogenase | |
| 69108009 | Hemoglobin Parchman | |
| 69118004 | Blood group antibody Greenlee | |
| 69122009 | Methyl dichlorfop | |
| 69133007 | Sudan IV stain (substance) | |
| 69136004 | Prostaglandin PGE3 alpha | |
| 69149009 | Blood group antigen Be^a^ | |
| 69151008 | Glutamate formiminotransferase | |
| 69169004 | Vitamin K>3< | |
| 69172006 | Cyclonite | |
| 69180004 | Threonine dehydratase | |
| 69184008 | Blood group antigen M^e^ | |
| 69187001 | Pseudouridine kinase | |
| 69211003 | Blood group antibody BOA 3150 | |
| 69225002 | Nail polish | |
| 69241001 | Butorphanol tartrate | |
| 69268001 | ^131m^Tellurium | |
| 69296007 | 2-Ethylhexyl-2-cyano-3,3-diphenylacrylate | |
| 69298008 | Phospholipase A>2< | |
| 69306002 | 6-Phytase | |
| 69307006 | Heterochromatin | |
| 69308001 | Vinylacetyl-CoA delta-isomerase | |
| 69311000 | Immunoglobulin, Fc fragment (substance) | |
| 69313002 | Fibronectin | |
| 69314008 | Benzophenone | |
| 69324000 | Phosphorus pentasulfide | |
| 69340002 | Napropamide | |
| 69342005 | Lymphocyte antigen CD27 | |
| 69351002 | Methoxyphenamine | |
| 69373009 | Blood group antigen Alda | |
| 69411001 | Lymphocyte antigen CD11a | |
| 69418007 | Platelet antigen HPA-5b | |
| 69419004 | 3-Oxoacyl-acyl-carrier-protein synthase | |
| 69433004 | Blood group antigen Lu7 | |
| 69435006 | Blood group antibody Go^a^ | |
| 69440003 | Cardiotonic drug | |
| 69451003 | beta-D-Fucosidase | |
| 69453000 | Hemoglobin Burke | |
| 69457004 | Candida albicans aspartic proteinase | |
| 69459001 | Thiamin-phosphate pyrophosphorylase | |
| 69467009 | Formylaspartate deformylase | |
| 69469007 | Lymphocyte antigen CD77 | |
| 69473005 | Kveim-Silzbach antigen | |
| 69504003 | beta-(9-Cytokinin)-alanine synthase | |
| 69506001 | Oxyphenonium | |
| 69507005 | Phthalic acid ester | |
| 69513001 | 5-Dehydro-4-deoxyglucarate dehydratase | |
| 69519002 | Ethylenediamine tetra-acetate | |
| 69522000 | Pine tar | |
| 69526002 | Noxious fumes | |
| 69542009 | Blood group antigen Gibson | |
| 69544005 | Hemoglobin Tours | |
| 69553003 | Geraniol dehydrogenase | |
| 69557002 | sn-Glycerol-3-phosphate 2-alpha-galactosyltransferase | |
| 69563006 | Heat labile alpha>1< glycoprotein | |
| 69583007 | Plant goitrogen | |
| 69594006 | Dinitro-o-cyclohexyl phenol | |
| 69606009 | Trimethyllysine,2-oxoglutarate dioxygenase | |
| 69612004 | Fetal antigen | |
| 69613009 | ^244^Plutonium | |
| 69637009 | Waxes | |
| 69644000 | Calcium arsenite | |
| 69654001 | 3-Hydroxyaspartate aldolase | |
| 69662009 | alpha Actinin | |
| 69674008 | Agmatinase | |
| 69680000 | Blood group antigen Co^a^ | |
| 69700005 | tRNA (adenine-N^6^)-methyltransferase | |
| 69703007 | Cesium radioisotope | |
| 69705000 | Fibrinogen Bicêtre | |
| 69719000 | Blood group antibody Le^b^ | |
| 69750003 | ^63^Nickel | |
| 69751004 | Galactinol-raffinose galactosyltransferase | |
| 69755008 | Blood group antigen Mathison | |
| 69756009 | Hemoglobin Vancouver | |
| 69760007 | Imidazo pyruvic acid | |
| 69764003 | (R)-3-Amino-2-methylpropionate aminotransferase | |
| 69770009 | Iron radioisotope | |
| 69780008 | Polynucleotide 5'-hydroxyl-kinase | |
| 69783005 | Meglumine iodipamide | |
| 69813006 | N-Acylglucosamine-6-phosphate 2-epimerase | |
| 69814000 | Methylenetetrahydrofolate dehydrogenase (NADP^+^) | |
| 69832000 | Lymphocyte antigen CD38 | |
| 69839009 | Iodinated I^125^ povidone | |
| 69844002 | 1-Chloro-1-nitroethane | |
| 69870001 | Thallium isotope | |
| 69871002 | Methylchlormethyl ether | |
| 69893007 | Cyanazine | |
| 69899006 | Oxymorphone hydrochloride | |
| 69900001 | Blood group antigen Haase | |
| 69901002 | Platelet-specific antibody | |
| 69904005 | 2,6-Dihydroxypyridine 3-monooxygenase | |
| 69908008 | Messenger RNA | |
| 69932001 | Potassium chromate | |
| 69936003 | Hemoglobin Tunis | |
| 69940007 | Blood group antigen Mit | |
| 69941006 | Blood group antibody Enriquez | |
| 69958001 | Sodium sulfate | |
| 69979001 | Blood group antibody Simon (substance) | |
| 69992003 | Blood group antigen T | |
| 69993008 | Mevaldate reductase | |
| 69995001 | 3-Hydroxyoctanoyl-[acyl-carrier-protein]-dehydratase | |
| 70001008 | Piperacetazine | |
| 70012008 | L-Lactate dehydrogenase | |
| 70016006 | Complementary DNA | |
| 70032009 | Phosphoribosylaminoimidazole carboxylase | |
| 70050002 | Hemoglobin H | |
| 70059001 | Blood group antigen At^a^ | |
| 70069007 | Patulin | |
| 70077006 | Colony-stimulating factor, granulocyte-monocyte | |
| 70078001 | Aromatic-hydroxylamine acetyltransferase | |
| 70084003 | Methyl (n-amyl) ketone | |
| 70086001 | Cholyl-carbon^14^ glycine | |
| 70088000 | Tyrosine 2,3-aminomutase | |
| 70095009 | Immunoglobulin isotype | |
| 70106000 | Lipid | |
| 70113000 | Branched-chain amino acid | |
| 70150004 | Bile | |
| 70154008 | Iodinated I^125^ sodium iodine | |
| 70155009 | Immunoglobulin dimer | |
| 70161007 | 3-Hydroxybutyryl-CoA dehydratase | |
| 70168001 | Copper sulfate | |
| 70169009 | Ciclopirox olamine | |
| 70170005 | Acetylornithine deacetylase | |
| 70184000 | Deoxycytidine monophosphate deaminase | |
| 70198008 | Mannitol-1-phosphate dehydrogenase | |
| 70203000 | Adenine | |
| 70213008 | Tryptophan synthase | |
| 70214002 | Hemoglobin Moskva | |
| 70221002 | Phosgene | |
| 70237008 | Glucosamine | |
| 70251008 | Ethyl di-(p-chlorophenyl) glycolate | |
| 70265005 | Lathosterol oxidase | |
| 70269004 | beta-Lysine 5,6-aminomutase | |
| 70271004 | Coagulation factor X Stuart variant | |
| 70276009 | Dimethylpropiothetin dethiomethylase | |
| 70282007 | Acetylspermidine deacetylase | |
| 70288006 | Methionine | |
| 70290007 | Indium compound | |
| 70304009 | Blood group antigen Crawford | |
| 70309004 | Calcidiol 1-monooxygenase | |
| 70319005 | Cobalt fumes | |
| 70335003 | Blood group antigen Bi | |
| 70338001 | Nepenthes aspartic proteinase | |
| 70352004 | Blood group antibody Gill | |
| 70354003 | Polypeptide | |
| 70365008 | ^239^Uranium | |
| 70367000 | Valine decarboxylase | |
| 70368005 | Guanidinoacetate methyltransferase | |
| 70391009 | Uridine diphosphate glucose | |
| 70392002 | Prolactin inhibiting factor | |
| 70400004 | Immunoglobulin, GM>4< allotype | |
| 70403002 | Ribonucleotide | |
| 70430007 | Blood group antigen Black | |
| 70434003 | Complement factor Ba | |
| 70438000 | ^88^Rubidium | |
| 70440005 | Coagulation factor XII | |
| 70444001 | Recessive gene | |
| 70454002 | Prolactin | |
| 70469001 | Blood group antigen L Harris | |
| 70487003 | Hexosamine | |
| 70489000 | Algal toxin | |
| 70496003 | Lipoic acid | |
| 70508008 | beta-Aspartyl-N-acetylglucosaminidase | |
| 70519006 | Hemoglobin G-Philadelphia | |
| 70520000 | Ponceau xylidine stain (substance) | |
| 70524009 | Chloroallyl diethyldithiocarbamate | |
| 70535004 | Arylamine glucosyltransferase | |
| 70544003 | ^199^Gold | |
| 70561000 | 2-Pivalyl-1,3- indandione | |
| 70562007 | Leuprolide acetate | |
| 70563002 | Blood group antibody Walin | |
| 70564008 | Allantoate deiminase | |
| 70565009 | Sulfur dioxygenase | |
| 70566005 | Glycine-oxaloacetate aminotransferase | |
| 70570002 | Sulfadoxine | |
| 70584007 | Blood group antigen Cr^a^ (substance) | |
| 70587000 | beta Alanine | |
| 70588005 | Acetoin dehydrogenase | |
| 70592003 | 2-Nitropropane dioxygenase | |
| 70597009 | Boron | |
| 70608003 | UDPglucuronate decarboxylase | |
| 70613004 | Zirconyl hydroxychloride | |
| 70620006 | Plant glycoside | |
| 70623008 | Fusion protein GAG-POL | |
| 70643002 | Lead tetroxide | |
| 70672001 | Glycerophosphocholine cholinephosphodiesterase | |
| 70675004 | Lipopolysaccharide glucosyltransferase II | |
| 70684004 | Oxybenzone and dioxybenzone | |
| 70695005 | Dihydropyrimidinase | |
| 70699004 | ^185^Tungsten | |
| 70706009 | Troxerutin | |
| 70724006 | Streptomycin 6-kinase | |
| 70725007 | Paecilomyces varioti aspartic proteinase | |
| 70726008 | Selenium compound | |
| 70732003 | Trimethadione | |
| 70734002 | alpha-L-Fucosidase | |
| 70741008 | Blood group antigen K16 | |
| 70744000 | Hemoglobin F-Jamaica | |
| 70748002 | Hemosiderin | |
| 70750005 | 3-Cyanoalanine hydratase | |
| 70773002 | Dimethylallylcistransferase | |
| 70785005 | Tryptophan-phenylpyruvate aminotransferase | |
| 70787002 | Alcohol dehydrogenase (NADP+) (substance) | |
| 70799009 | Pumiliotoxin B | |
| 70800008 | Ecdysone oxidase | |
| 70807006 | 1,2-Diacylglycerol 3-beta-galactosyltransferase | |
| 70813002 | Milk | |
| 70825004 | Somatomedin | |
| 70828002 | Major histocompatibility complex | |
| 70832008 | Immunoglobulin, GM>6< allotype | |
| 70844006 | Hemoglobin Necker Enfants-Malades | |
| 70846008 | Sarin | |
| 70863007 | Alkylamidase | |
| 70869006 | Blood group antigen Milne | |
| 70886000 | Dicloxacillin sodium | |
| 70888004 | Diethyl ketone | |
| 70906001 | bis-(Diethylthiocarbamyl) disulfide | |
| 70941002 | Chrome green | |
| 70961008 | Neomycin sulfate | |
| 70963006 | Antigen receptor | |
| 70972003 | Active C5b6789 (substance) | |
| 70990002 | Quinone | |
| 71006008 | Blood group antigen Sia-b1 | |
| 71012003 | UDParabinose 4-epimerase | |
| 71017009 | Blood group antigen Todd | |
| 71024005 | Blood group antigen Rh41 | |
| 71027003 | Xylose isomerase | |
| 71032002 | UDP-N-acetylmuramate dehydrogenase | |
| 71043005 | Dicyclomine hydrochloride (substance) | |
| 71058002 | Myxobacter AL-l proteinase I | |
| 71076009 | Strontium iodide | |
| 71079002 | Blood group antigen IA | |
| 71082007 | Hemoglobin O-Indonesia | |
| 71108007 | Cycrimine | |
| 71128006 | Molybdenum | |
| 71138001 | Sulfacytine (substance) | |
| 71146000 | Blood group antibody Pr>2< | |
| 71152004 | ^20^Neon | |
| 71159008 | Pregnanetriol | |
| 71165008 | Cycloheximide (substance) | |
| 71168005 | alpha,alpha-Trehalose phosphorylase | |
| 71183000 | Indomethacin sodium trihydrate (substance) | |
| 71185007 | Nucleoprotein | |
| 71211001 | Nucleotide | |
| 71227008 | Siderite | |
| 71230001 | Hemoglobin Mequon | |
| 71242006 | Prephenate dehydrogenase (NADP^+^) | |
| 71250002 | Butethamine | |
| 71251003 | ^192^Platinum | |
| 71263008 | Thioethanolamine acetyltransferase | |
| 71281006 | Coagulation factor X Padua 1 variant | |
| 71283009 | NADPH dehydrogenase (quinone) | |
| 71288000 | Oncogene protein GP120, V-FMS | |
| 71291000 | Superbine | |
| 71334007 | Ethyl mercaptan | |
| 71342008 | Mannan endo-1,6-beta-mannosidase | |
| 71348007 | Deblocking antibody | |
| 71365003 | beta Endorphin | |
| 71368001 | Complement component C3d | |
| 71370005 | HLA-DP antigen | |
| 71374001 | Sodium hypochlorite | |
| 71380009 | Benzarone | |
| 71391002 | Ethanolamine ammonia-lyase | |
| 71396007 | HLA-B17 antigen | |
| 71411004 | Blood group antibody Dahl | |
| 71415008 | Blood group antigen Wallin | |
| 71417000 | Doxycycline hyclate | |
| 71422000 | Clostridium perfringens toxin | |
| 71423005 | Hemoglobin Queens | |
| 71425003 | ^61^Copper | |
| 71428001 | Oil of copaiba | |
| 71430004 | Oil of pepper | |
| 71437001 | Histone-lysine methyltransferase | |
| 71454009 | Dimethylformamide | |
| 71459004 | Fibrinogen Bern I | |
| 71463006 | Polyethylene | |
| 71470006 | N-Methyl-L-amino-acid oxidase | |
| 71474002 | Immunoglobulin IgG3, H chain (substance) | |
| 71482002 | Iron compound | |
| 71494006 | Aspartate acetyltransferase | |
| 71499001 | Dioscin | |
| 71500005 | Hemoglobin S-Travis | |
| 71522003 | ^192^Mercury | |
| 71532005 | Indoleacetic acid | |
| 71533000 | Pentazocine lactate | |
| 71544008 | Polysaccharide | |
| 71549003 | Interchromatin granule | |
| 71560007 | ^129^Tellurium | |
| 71561006 | Chelonitoxin | |
| 71562004 | Mexicanain | |
| 71563009 | Diphenoxylate hydrochloride | |
| 71589009 | Benzidine | |
| 71611009 | Lactate 2-monooxygenase (substance) | |
| 71630009 | Coagulation factor IX Leyden variant | |
| 71633006 | ^22^Sodium | |
| 71636003 | Fibrinogen I^123^ | |
| 71640007 | Acid phosphatase isoenzyme | |
| 71647005 | ^14^Carbon | |
| 71656002 | Hemoglobin Iwata | |
| 71668006 | Chloroprocaine | |
| 71669003 | Alkyl aryl polyether sulfonate | |
| 71681004 | Blood group antigen Dugstad | |
| 71686009 | Matrix of fibrocartilage | |
| 71700008 | Hemoglobin J-Singa | |
| 71714008 | Calcium gluceptate (substance) | |
| 71726003 | Aflatoxin M | |
| 71730000 | 5alpha-Hydroxysteroid dehydratase | |
| 71756007 | Veratridine | |
| 71763007 | Thallium | |
| 71774003 | Gibberellin | |
| 71789007 | Technetium | |
| 71797000 | Lymphocyte antigen CD22 | |
| 71805008 | Isocitrate epimerase | |
| 71813009 | Methaqualone | |
| 71818000 | Herbicide | |
| 71823000 | Monomethyl hydrazine | |
| 71845004 | Epithelial antibody (substance) | |
| 71862009 | Antitoxin | |
| 71916002 | Hydrastine | |
| 71921004 | Hemoglobin G-Szuhu | |
| 71935002 | Hemoglobin A>2< | |
| 71957009 | Phloxin B stain (substance) | |
| 71971001 | Corticotropin releasing factor | |
| 71972008 | Blood group antibody Jc^a^ | |
| 71975005 | Pyruvate kinase | |
| 71976006 | Blood group antibody Lu14 | |
| 71992001 | Amine ethoxylate | |
| 72003002 | Biphenamine (substance) | |
| 72015003 | Iodinated I^125^ albumin | |
| 72024007 | Tetrahydrocannabinol | |
| 72025008 | Crotamine venom | |
| 72034003 | DNA beta-glucosyltransferase | |
| 72036001 | Blood group antigen Bell | |
| 72069001 | Cytosine | |
| 72081002 | Divinyl benzene | |
| 72084005 | GMP synthase | |
| 72088008 | HLA-Bw41 antigen | |
| 72113008 | Transcobalamin I | |
| 72131009 | Silver iodide | |
| 72134001 | Ankyrin | |
| 72138003 | Lysine acetyltransferase | |
| 72156003 | Protein-D-aspartate methyltransferase | |
| 72159005 | Cyanocobalamin Co^60^ | |
| 72164009 | Inositol | |
| 72165005 | Antibody to hepatitis C virus | |
| 72170003 | Blood group antigen Starcher | |
| 72179002 | Oxybenzone | |
| 72186005 | FAD pyrophosphatase | |
| 72192004 | (Deoxy)nucleoside phosphate kinase | |
| 72233001 | Galacturonokinase | |
| 72251000 | Arsenic trioxide | |
| 72271009 | Blood group antigen Fuller | |
| 72305003 | ^107^Cadmium | |
| 72309009 | Bioflavonoid | |
| 72322001 | Para-aminobenzoic acid esters in alcohol | |
| 72340002 | Plotolysin toxin | |
| 72341003 | Blood urea nitrogen | |
| 72344006 | Sodium psylliate | |
| 72358008 | Agglutinogen | |
| 72359000 | Gonyautoxin | |
| 72361009 | Blood group antigen Wimberly | |
| 72368003 | Citrullinase | |
| 72371006 | Fast violet B salt stain (substance) | |
| 72380006 | Blood group antigen Vel | |
| 72384002 | Alkylglycerone-phosphate synthase | |
| 72387009 | Acyclovir sodium | |
| 72393001 | Butyl acrylate | |
| 72400009 | Blood group antibody Swietlik | |
| 72433004 | 3beta-Hydroxy-4alpha-methylcholestenecarboxylate dehydrogenase (decarboxylating) | |
| 72444007 | Iron-cytochrome-c reductase | |
| 72453000 | Trimethylamine-N-oxide reductase | |
| 72454006 | ^99m^Technetium | |
| 72455007 | ^83^Rubidium | |
| 72460006 | 7,8-Dihydroxykynurenate 8,8a-dioxygenase | |
| 72464002 | Pantothenase | |
| 72469007 | Acetazolamide sodium | |
| 72499003 | Rubidium chloride | |
| 72507005 | 2-Ethylmalate synthase | |
| 72511004 | Fruit | |
| 72520008 | p-Aminophenol | |
| 72522000 | Mephenesin | |
| 72526002 | Blood group antibody Hil | |
| 72546007 | Hemoglobin G-Audhali | |
| 72551001 | Metal fumes | |
| 72559004 | Streptomyces alkalophilic keratinase | |
| 72563006 | Gastrin I | |
| 72571005 | Platelet antibody HPA-3 | |
| 72572003 | Diamond black stain (substance) | |
| 72578004 | Osmium | |
| 72582002 | Hemoglobin Sassari | |
| 72584001 | HLA-Dw5 antigen | |
| 72586004 | beta-Alanine-pyruvate aminotransferase | |
| 72590002 | Cerebronic acid | |
| 72602006 | Blood group antigen ENKT (substance) | |
| 72625007 | 3,4-Dihydroxyphenylacetate 2,3-dioxygenase | |
| 72636000 | Pinene | |
| 72675009 | Simple physiological organic compound | |
| 72685005 | Blood group antigen Maliff | |
| 72717003 | Magnesium | |
| 72737004 | (S)-Tricyclamol | |
| 72745009 | Flavodoxin | |
| 72748006 | Blood group antibody Mansfield (substance) | |
| 72750003 | Nucleoside-phosphate kinase | |
| 72752006 | Atracurium besylate (substance) | |
| 72763009 | Hydriodic acid | |
| 72766001 | 2',3'-Cyclic-nucleotide 3'-phosphodiesterase | |
| 72770009 | Metoprolol tartrate | |
| 72772001 | Blood group antigen Boston | |
| 72773006 | Linuron | |
| 72774000 | Potassium p-aminosalicylate | |
| 72778002 | Tyrosine-tRNA ligase | |
| 72784004 | Lactated potassic saline | |
| 72802008 | Acetal | |
| 72805005 | Chymopapain | |
| 72808007 | Trolamine salicylate | |
| 72812001 | Aspartate 4-decarboxylase (substance) | |
| 72822007 | Homogentisate 1,2-dioxygenase | |
| 72833005 | HLA-A30 antigen | |
| 72835003 | ^119m^Tin | |
| 72840006 | Valine | |
| 72843008 | 2-Hydroxy-2,2-bis-(4-chlorophenyl) ethyl acetate | |
| 72844002 | ^187^Platinum | |
| 72857005 | Methitural | |
| 72869002 | Upper respiratory fluids | |
| 72873004 | Blood group antigen I^T^P>1< | |
| 72886008 | Blood group antigen B 9724 | |
| 72887004 | Pirimicarb | |
| 72890005 | NAD(P)H dehydrogenase (quinone) | |
| 72891009 | Cytotropic antibody | |
| 72909000 | Tumor-associated antigen | |
| 72926006 | HLA-Bw48 antigen | |
| 72927002 | Radon | |
| 72929004 | Phosphate acetyltransferase | |
| 72949008 | Pepsin C | |
| 72955003 | Acetate-CoA ligase | |
| 72984007 | Muscarinic receptor | |
| 72989002 | Blood group antibody Th^a^ | |
| 72990006 | Alveolar air | |
| 72993008 | Triacylglycerol lipase | |
| 73010004 | Methyl silicate | |
| 73029005 | Fibrinogen Baltimore IV | |
| 73031001 | alpha Ketoglutarate | |
| 73040002 | Vanadium pentoxide fumes | |
| 73065000 | Gallium^67^ citrate | |
| 73076001 | Emylcamate | |
| 73084002 | Ethylene glycol ester | |
| 73085001 | Chlordane | |
| 73106004 | Cycle-phase nonspecific agent | |
| 73126000 | Digalloyl trioleate | |
| 73127009 | Hemoglobin Bougardirey-Mali | |
| 73129007 | ^131m^Xenon | |
| 73131003 | Carotene | |
| 73135007 | Soluble antigen (substance) | |
| 73187006 | Thyroxine | |
| 73195005 | Blood group antibody HLA-B15 | |
| 73196006 | Manganese compound | |
| 73204005 | Myosin ATPase | |
| 73213007 | Chlorphenesin carbamate | |
| 73236003 | Hemoglobin Detroit | |
| 73246001 | Streptomycin sulfate | |
| 73251007 | Auramine G stain (substance) | |
| 73254004 | CMP-N-acetylneuraminate-beta-galactoside alpha-2,6-sialyltransferase | |
| 73267001 | 1-1-bis-(p-chlorophenyl)-2-Nitrobutane | |
| 73268006 | Para-aminobenzoic acid and ethyl alcohol | |
| 73276008 | Staphylococcus aureus antibody test kit | |
| 73279001 | 2-Dehydropantoate reductase | |
| 73300004 | Hemoglobin F-Tokyo | |
| 73314004 | Blood group antibody Wolfe | |
| 73334003 | Scillaren A | |
| 73347008 | Blood group antibody JMH | |
| 73353008 | ^54^Manganese | |
| 73360002 | Hemoglobin M-Hyde Park | |
| 73362005 | Blood group antigen Rh37 | |
| 73377002 | Propyl diethyl succinamate | |
| 73386007 | Carbofuran | |
| 73388008 | 1,3-beta-Glucan phosphorylase | |
| 73389000 | Blood group antigen Groslouis | |
| 73393006 | Oil of balm | |
| 73404007 | Cyanamide compound | |
| 73407000 | Yohimbine | |
| 73417005 | Zetekitoxin | |
| 73421003 | Fusel oil | |
| 73427004 | Cholesterol ester (substance) | |
| 73434002 | Fonofos | |
| 73436000 | Lergotrile mesylate | |
| 73440009 | Methyl chloro methyl ether | |
| 73444000 | Procaine hydrochloride | |
| 73461002 | Fibrinogen London II | |
| 73469000 | Radium | |
| 73476005 | Mipafox | |
| 73520004 | Blood group antigen Bregi | |
| 73522007 | ^105^Ruthenium | |
| 73537006 | Purinergic receptor | |
| 73553009 | Rosemary oil | |
| 73559008 | Dialkyl dimethyl ammonium chloride | |
| 73563001 | Hexose-1-phosphate guanylyltransferase | |
| 73567000 | HLA-DQw antigen | |
| 73579000 | Carbidopa | |
| 73586008 | L-3-Cyanoalanine synthase | |
| 73591009 | Cytochalasin | |
| 73596004 | 2-Amino-5-nitrothiazole | |
| 73606003 | Gallate 1-beta-glucosyltransferase | |
| 73613003 | Orotate reductase (NADH) | |
| 73628003 | Progesterone 11alpha-monooxygenase | |
| 73637003 | Blood group antigen B 7358 | |
| 73640003 | ^188^Iridium | |
| 73656008 | Blood group antibody Langer | |
| 73661005 | Hepatitis B surface antigen subtype ayw | |
| 73667009 | N^6^-Acetyl-beta-lysine aminotransferase | |
| 73680007 | Oil of levant wormseed | |
| 73685002 | Thallous chloride Tl^201^ | |
| 73694008 | Blood group antibody A | |
| 73708009 | Diphenylchloroarsine | |
| 73709001 | Blood group antibody hr^B^ | |
| 73710006 | Blood group antibody K22 | |
| 73717009 | Muconate cycloisomerase | |
| 73722009 | Dibasic potassium phosphate | |
| 73723004 | Estriol | |
| 73734001 | ^8^Helium | |
| 73741007 | Zearalenone | |
| 73743005 | Oil of chamomile, German | |
| 73745003 | Iodinated I^125^ oleic acid and triolein | |
| 73748001 | alpha Ketobutyric acid | |
| 73755004 | Blood group antigen Neut | |
| 73758002 | ^117^Indium | |
| 73778005 | Hemoglobin M-Boston | |
| 73794003 | Folylpolyglutamate synthase | |
| 73801006 | Coagulation factor VIIa | |
| 73803009 | Glaucarubin | |
| 73827006 | Econazole nitrate | |
| 73828001 | Bilirubin-albumin complex | |
| 73838006 | Phosphatidyl myo-inositol alpha-mannosyltransferase | |
| 73842009 | Thymic ectopic endocrine substance | |
| 73846007 | Blood group antigen RASM | |
| 73858007 | Mandelate racemase | |
| 73875001 | UDPglucuronate 5'-epimerase | |
| 73880005 | Ribonuclease III | |
| 73892005 | Carmine stain (substance) | |
| 73909007 | Trifluoromonobromomethane | |
| 73916008 | 5-Hydroxy tryptophan | |
| 73923009 | Trinitrophenylmethylnitramine | |
| 73925002 | ^152^Gadolinium | |
| 73941001 | Chelated calcium | |
| 73946006 | Phenylephrine hydrochloride | |
| 73971009 | Dihydroorotate oxidase | |
| 73980009 | Blood group antigen Rh29 | |
| 73987007 | Oncogene | |
| 73991002 | Connective tissue protein | |
| 73992009 | 1-Alkylglycerophosphocholine acyltransferase | |
| 74000003 | Lead chromate | |
| 74002006 | Gliadin antibody | |
| 74014003 | Phenylalanine ammonia-lyase | |
| 74027004 | Protocatechuate 4,5-dioxygenase | |
| 74032003 | Steroid 17-alpha-monooxygenase | |
| 74054001 | Sodium 2,4-dichlorophenoxyethyl sulfate | |
| 74055000 | Plant ketone oil | |
| 74064005 | Blood group antibody JAL | |
| 74075009 | Americium radioisotope | |
| 74085005 | L-Fuculose-phosphate aldolase (substance) | |
| 74090008 | Dimozide | |
| 74124009 | alpha-1,4-Glucan-protein synthase (ADP-forming) | |
| 74130009 | ^71^Germanium | |
| 74131008 | 4-Deoxy-L-threo-5-hexosulose-uronate ketol-isomerase | |
| 74138002 | Interleukin-11 | |
| 74143009 | Lysine 2-monooxygenase | |
| 74144003 | Blood group antigen Sj | |
| 74145002 | Carnitine decarboxylase | |
| 74149008 | Blood group antibody Boldog | |
| 74171003 | 1,1-Dimethylhydrazine | |
| 74199007 | Galactosylceramide sulfotransferase | |
| 74209006 | Hemoglobin Aichi | |
| 74210001 | I-J region, MHC | |
| 74237004 | Atropine sulfate | |
| 74242007 | Food starch | |
| 74243002 | Prostaglandin-D>2< 11-ketoreductase | |
| 74271008 | Formaldehyde dehydrogenase (glutathione) | |
| 74273006 | Cocaine hydrochloride | |
| 74292008 | Blood group antibody Bullock | |
| 74306001 | Aspartate racemase | |
| 74330004 | Betaine-aldehyde dehydrogenase | |
| 74374002 | Blood group antibody Th (substance) | |
| 74405003 | Hemoglobin G-Waimanalo | |
| 74407006 | Hemoglobin Bethesda | |
| 74412007 | Blood group antibody Gero | |
| 74420009 | Galactosylgalactosylglucosylceramide beta-D-acetyl-galactosaminyltransferase | |
| 74426003 | Hemoglobin I | |
| 74452009 | ^248^Californium | |
| 74482003 | Lymphocyte antigen CD73 | |
| 74483008 | Urethral secretion (substance) | |
| 74484002 | Blood group antibody McKenney | |
| 74505001 | Hemoglobin Savannah | |
| 74510002 | Blood group antigen Xg^a^ | |
| 74515007 | Hemoglobin Port Phillip | |
| 74521006 | DNA-directed RNA polymerase | |
| 74523009 | Sulfadiazine | |
| 74526001 | D-Octopine dehydrogenase | |
| 74554008 | Iodophthalein | |
| 74564004 | Argininosuccinate lyase | |
| 74567006 | Blood group antibody Bg^a^ | |
| 74586003 | Streptococcus toxin | |
| 74589005 | Chlormerodrin | |
| 74600002 | Bisacodyl tannex | |
| 74605007 | Triphosphatase | |
| 74616000 | Sweat | |
| 74623004 | Hemoglobin Icaria | |
| 74628008 | Hydrolase | |
| 74634001 | Pituitary pars intermedia colloid | |
| 74639006 | D-Alanine-poly(phosphoribitol) ligase | |
| 74640008 | Mevalonate kinase | |
| 74643005 | Malate oxidase | |
| 74646002 | ^129^Barium | |
| 74652001 | Blood group antigen K | |
| 74656003 | ^177^Tantalum | |
| 74661001 | Blood group antibody c-like | |
| 74665005 | Aluminum welding fumes | |
| 74678005 | (R)-2-Methylmalate dehydratase | |
| 74684008 | ^182^Osmium | |
| 74690007 | Diiodophenylpyruvate reductase | |
| 74700009 | Fibrinogen Homberg II | |
| 74713003 | Thiopropazate | |
| 74718007 | Zinc arsenate | |
| 74719004 | ^99m^Rhodium | |
| 74722002 | Rectal contents | |
| 74727008 | Hydroxyproline | |
| 74750002 | Tetrachloronaphthalene | |
| 74755007 | Immunoglobulin IgG2, H chain | |
| 74794008 | Exodeoxyribonuclease (Lambda-induced) | |
| 74801000 | Sugar | |
| 74804008 | 3-Hydroxybenzoate 4-monooxygenase | |
| 74826009 | Hemoglobin Randwick | |
| 74835002 | Phosphoserine phosphatase | |
| 74849006 | Aspartoacylase | |
| 74860002 | Citrate CoA-transferase | |
| 74866008 | Deoxycytidylic acid | |
| 74868009 | Dihydrouracil dehydrogenase (NADP^+^) | |
| 74880001 | Yellow ointment | |
| 74889000 | Immunoglobulin M (substance) | |
| 74897007 | Bromine trifluoride (substance) | |
| 74905005 | Ethyl morphine | |
| 74913006 | Pelletierine | |
| 74916003 | Inorganic arsenic | |
| 74941005 | Lactaldehyde reductase (DADPH) | |
| 74947009 | Gaseous substance | |
| 74950007 | Apomorphine hydrochloride | |
| 74959008 | Protein disulfide-isomerase | |
| 74979000 | Anthranilate 3-monooxygenase | |
| 74981003 | Lewisite | |
| 74985007 | Glucokinase | |
| 74993007 | Low molecular weight kininogen | |
| 74994001 | Blood group antigen Jk3 | |
| 74997008 | Glucose dehydrogenase | |
| 75025002 | Adrenal medullary hormone | |
| 75026001 | Fluorine monoxide | |
| 75034007 | Blood group antigen BR 726750 | |
| 75044009 | Sisal fiber | |
| 75055009 | Nucleoside-triphosphate-hexose-1-phosphate nucleotidyltransferase | |
| 75062000 | 2-Oxoaldehyde dehydrogenase | |
| 75064004 | Plasmin inhibitor | |
| 75081008 | Candida lipolytica serine proteinase | |
| 75092009 | Histamine H1 receptor | |
| 75097003 | beta-Glucuronidase (substance) | |
| 75115009 | Fluoxetine hydrochloride | |
| 75139004 | Auxin B | |
| 75153004 | Blood group antigen Gerhany | |
| 75163007 | 2-Methylcitrate synthase | |
| 75175002 | Oil of cascarilla | |
| 75197000 | Ytterbium isotope | |
| 75214004 | Platelet antibody HPA-2b | |
| 75215003 | Blood group antigen AnWj (substance) | |
| 75225008 | Phosphoglucomutase (glucose-cofactor) | |
| 75228005 | Blood group antibody Vienna | |
| 75239008 | 3-Hydroxyacyl-CoA dehydrogenase | |
| 75247008 | Penicillin G benzathine (substance) | |
| 75265007 | Cytidine | |
| 75268009 | Mesoridazine besylate | |
| 75272008 | Aldehyde dehydrogenase [NAD(P)+] (substance) | |
| 75274009 | Fumarate reductase (NADH) | |
| 75277002 | Oncogene protein H-RAS | |
| 75284005 | Glutamate dehydrogenase | |
| 75285006 | D-Arabinokinase | |
| 75288008 | Cuprous salt | |
| 75289000 | Fusarinine-C ornithinesterase | |
| 75298002 | Proline-tRNA ligase | |
| 75322009 | Blood group antigen Arun | |
| 75327003 | Xylometazoline hydrochloride | |
| 75341007 | Ethacrynate sodium | |
| 75348001 | 4-Androstene-3,17-dione monooxygenase | |
| 75359005 | Timolol maleate | |
| 75362008 | Tetrachloroethylene | |
| 75363003 | Verrucarin | |
| 75368007 | 4-Hydroxyphenylpyruvate dioxygenase | |
| 75371004 | Theobromine | |
| 75384008 | Hemoglobin Volga | |
| 75399008 | Citric acid | |
| 75405006 | 5-Aminopentanamidase | |
| 75417008 | Cyclopiazonic acid | |
| 75421001 | Triose-phosphate isomerase | |
| 75466005 | Alkyl naphthyl methyl pyridinium chloride | |
| 75476008 | Bovine growth hormone | |
| 75495001 | Dimethylbenzene | |
| 75512004 | Hemoglobin City of Hope | |
| 75520002 | Hemoglobin Brigham | |
| 75536000 | Metaldehyde | |
| 75550005 | Chitin deacetylase | |
| 75553007 | Protease inhibitor venom | |
| 75560001 | 1-Nitropropane | |
| 75561002 | Dihydro-beta-ergocryptine (substance) | |
| 75563004 | alpha-1,3-Mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase | |
| 75574008 | 42-kDa Protein | |
| 75590008 | Liquefied petroleum gas | |
| 75604003 | ^105m^Rhodium | |
| 75619002 | Somatotropin binding globulin | |
| 75624004 | Aluminum-based antacid | |
| 75627006 | Insect repellent | |
| 75635009 | Urobilin | |
| 75645006 | Butaperazine | |
| 75665004 | Monosodium glutamate | |
| 75666003 | Blood group antibody M>2< | |
| 75678004 | ^206^Bismuth | |
| 75696008 | ^45^Titanium | |
| 75698009 | Hemoglobin F-Urumqi | |
| 75701001 | Deoxynucleotide 3'-phosphatase | |
| 75725009 | Hydroxyglutamate decarboxylase | |
| 75735003 | Blood group antigen M1^a^ | |
| 75750007 | Escherichia coli antigen test kit | |
| 75777003 | Cytokine | |
| 75799006 | Lysine | |
| 75808003 | Complement component C3b | |
| 75811002 | HLA-A26 antigen | |
| 75812009 | Blood group antibody Wr^a^ | |
| 75815006 | Zinc undecylenate | |
| 75816007 | Blood group antibody f | |
| 75819000 | Blood group antigen P^k^ | |
| 75820006 | Blood group antibody C^w^ | |
| 75828004 | Creatine kinase | |
| 75839001 | ^77^Arsenic | |
| 75840004 | Coagulation factor XIIa | |
| 75842007 | Azobenzene | |
| 75849003 | 3-Hydroxy-2-methylpyridine-4,5-dicarboxylate 4-decarboxylase | |
| 75850003 | L-Idonate dehydrogenase | |
| 75861006 | Hemoglobin Okazaki | |
| 75871008 | Argininosuccinic acid | |
| 75874000 | Krypton radioisotope | |
| 75876003 | Sodium alginate | |
| 75925000 | Vimentin | |
| 75951003 | Iodine monobromide | |
| 75956008 | Hematein stain (substance) | |
| 75966000 | Steroid-lactonase (substance) | |
| 75967009 | ^92^Strontium | |
| 75982004 | N-Acetyl-beta-glucosaminidase | |
| 75989008 | Pepsin B | |
| 75999003 | Diiodotyrosine aminotransferase | |
| 76001002 | Pyronine B stain (substance) | |
| 76002009 | Fibrinogen Vancouver | |
| 76003004 | Triiodobenzoic acid | |
| 76004005 | Dioxybenzone | |
| 76008008 | Blood group antibody Or^a^ | |
| 76044003 | Nasal mucus | |
| 76048000 | Azocarmine G (GX) stain (substance) | |
| 76071003 | Blood group antigen Kuhn | |
| 76088005 | alpha-L-Rhamnosidase | |
| 76128005 | Antibody to hepatitis B core antigen, IgG type | |
| 76134003 | Neurotensin | |
| 76136001 | Antibody to antigen in LW blood group system | |
| 76150006 | Bacteriorhodopsin | |
| 76159007 | ^193^Mercury | |
| 76176006 | Acrolein phenylhydrazine | |
| 76178007 | Mercuric cyanide | |
| 76190009 | Talbutal | |
| 76198002 | Ammonium hydroxide | |
| 76213002 | Exhaust fumes | |
| 76239004 | Hemoglobin San Diego | |
| 76250001 | Beta lysin | |
| 76252009 | Blood group antibody Lan | |
| 76269006 | Ferroxidase | |
| 76283008 | Cytisine | |
| 76297000 | Ethanolamine-phosphate cytidylyltransferase | |
| 76300005 | GTP pyrophosphokinase | |
| 76320006 | Fibrinogen London IV | |
| 76325001 | Phosphoribosylaminoimidazolecarboxamide formyltransferase | |
| 76370009 | Nomadic nitrogen | |
| 76389009 | Phosphomethylpyrimidine kinase | |
| 76411003 | Platelet antigen HPA-5a | |
| 76421006 | Nabam | |
| 76439002 | Fat red 7B stain (substance) | |
| 76442008 | Hydroxylamine hydrochloride | |
| 76448007 | Phosphoglycerate phosphatase | |
| 76470005 | Flavonoid 3'-monooxygenase | |
| 76488002 | Hemoglobin Camperdown | |
| 76501008 | Pyrogallol | |
| 76506003 | Fibrinogen Munich I | |
| 76525000 | Ephedrine sulfate | |
| 76526004 | ^194^Mercury | |
| 76527008 | Sodium radioisotope | |
| 76533004 | Mustard gas | |
| 76557004 | Hemoglobin C-Georgetown | |
| 76560006 | Ribulose-bisphosphate carboxylase | |
| 76575003 | Podophyllotoxin | |
| 76587005 | Ganciclovir sodium | |
| 76592007 | Monoterpenyl-pyrophosphatase | |
| 76595009 | Geranyltranstransferase | |
| 76596005 | N-Acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase | |
| 76600000 | ^102^Rhodium | |
| 76605005 | Biebrich scarlet stain (substance) | |
| 76607002 | Blood group antibody Bx^a^ | |
| 76613006 | Glycidol | |
| 76617007 | Ferrous chloride | |
| 76622007 | Alternansucrase | |
| 76633005 | Fast red TR salt stain (substance) | |
| 76638001 | N-Acylglucosamine 2-epimerase | |
| 76639009 | Chorionic fluid | |
| 76643008 | Isopentenyladenosine | |
| 76645001 | Prodigiosin | |
| 76655002 | Methylene chloride | |
| 76669002 | Cellobiose epimerase | |
| 76672009 | Cardiac lipoprotein | |
| 76674005 | Oil of fleabane | |
| 76688009 | Blood group antibody K19 | |
| 76698003 | Conjugate | |
| 76701006 | Pseudogene | |
| 76711004 | Adenosine triphosphate | |
| 76716009 | Membrane-bound antibody | |
| 76721007 | Blood group antigen Yh^a^ (substance) | |
| 76728001 | GDPmannose dehydrogenase | |
| 76731000 | Double stranded anti DNA antibody | |
| 76734008 | Blood group antigen Dalman | |
| 76736005 | Perinucleolar chromatin | |
| 76743004 | ^99^Technetium | |
| 76767007 | Peyote preparation | |
| 76770006 | N-Acetylgalactosamine-6-sulfatase | |
| 76781009 | Ketone body (substance) | |
| 76787008 | Tridihexethyl chloride | |
| 76829000 | Plant pyrrolizidine alkaloid | |
| 76861001 | Laminaribiose phosphorylase | |
| 76874007 | Blood group antibody Berrio | |
| 76881000 | Borate decahydrate | |
| 76885009 | Bleach | |
| 76897005 | Blood group antibody Tc^c^ | |
| 76898000 | Phenobarbital sodium | |
| 76904007 | ^75^Germanium | |
| 76907000 | Dodecenoyl -CoA delta-isomerase | |
| 76918000 | HLA-Bw53 antigen | |
| 76925007 | Alkali blue 5B (4B) stain (substance) | |
| 76958003 | Blood group antibody Le^d^ | |
| 76964005 | Blood group antigen Welsh | |
| 76965006 | Blood group antigen Inaba | |
| 76977001 | Aminopeptidase (human liver) | |
| 76979003 | Sugar-1-phosphate nucleotidyltransferase | |
| 77001006 | Protein-disulfide reductase (glutathione) | |
| 77004003 | ^18^Fluorine | |
| 77010003 | Blood group antigen BLe^d^ | |
| 77012006 | Amniotic fluid | |
| 77014007 | Fixed oil | |
| 77023005 | Cardiac muscle antibody (substance) | |
| 77025003 | Pentachlorophenol | |
| 77033002 | Diaminohydroxyphosphoribosylaminopyrimidine deaminase | |
| 77036005 | 2,4,5-Trimethoxyamphetamine | |
| 77037001 | Decylcitrate synthase | |
| 77042009 | Methyl mercaptan | |
| 77043004 | Ethyl nitrite | |
| 77073008 | Nile blue stain (substance) | |
| 77079007 | Hemoglobin G-Honolulu | |
| 77089006 | Rheumatoid factor | |
| 77101008 | Blood group antibody Mi^a^ | |
| 77118007 | Methyl ethyl ketone | |
| 77124001 | Hemoglobin Lyon | |
| 77132009 | Rocket fuel | |
| 77136007 | alpha-Melanocyte stimulating hormone | |
| 77148005 | Blood group antigen Cooper | |
| 77160006 | Private blood group antigen | |
| 77168004 | Phosphoribosylformylglycinamidine synthase | |
| 77190004 | Hemoglobin F-Victoria Jubilee | |
| 77192007 | Abrin | |
| 77200000 | Endo-1,4-beta-xylanase | |
| 77210009 | GMP reductase | |
| 77222007 | Spiperone | |
| 77242003 | 4-Hydroxyphenylacetate 3-monooxygenase | |
| 77245001 | 8-Hydroxyquinoline | |
| 77247009 | 3-Phytase | |
| 77249007 | Phthalic anhydride | |
| 77275006 | Blood group antibody Big | |
| 77313009 | Technetium Tc^99m^ exametazime | |
| 77314003 | Serine carboxypeptidase | |
| 77315002 | Antigen in LW blood group system | |
| 77321003 | Hemoglobin F-Meinohama | |
| 77322005 | 2-Oxoisovalerate dehydrogenase (lipoamide) | |
| 77328009 | Microbial serine proteinases | |
| 77339007 | Hemoglobin Ube-2 | |
| 77347007 | alpha-1,6-Mannosyl-glycoprotein beta-1,2-N-acetylglucosaminyltransferase | |
| 77353007 | Fenoprofen calcium | |
| 77370004 | Lactic acid | |
| 77387002 | 2-Acylglycerophosphocholine acyltransferase | |
| 77394004 | Cyclobutane | |
| 77400002 | Territrem | |
| 77404006 | Homoserine | |
| 77409001 | Intramitochondrial ferritin | |
| 77431009 | Potassium nitrate | |
| 77433007 | Fullerene | |
| 77438003 | C1q complement receptor | |
| 77454000 | Mannoheptulose | |
| 77473001 | Hemoglobin Contaldo | |
| 77481000 | Pentamidine diisothionate | |
| 77487001 | Blood group antibody VA | |
| 77496001 | gamma Benzene hexachloride | |
| 77499008 | Very high density lipoprotein | |
| 77504008 | Fatty-acyl-CoA synthase | |
| 77510008 | Indium^113^ oxoquinoline WBC label | |
| 77512000 | Blood group antibody HLA-B12 | |
| 77515003 | Curare | |
| 77523001 | Microbody matrix | |
| 77525008 | B cell antibody | |
| 77530007 | (S)-2-Methylmalate dehydratase | |
| 77536001 | Dinocap | |
| 77537005 | Blood group antigen Truax | |
| 77544001 | Nicotine polacrilex | |
| 77557009 | Lymphocyte antigen CD41b | |
| 77582009 | Fibrinogen Nijmegen | |
| 77586007 | D-Arabinose dehydrogenase | |
| 77594000 | 2-N-dibutylamino-ethanol | |
| 77597007 | 1,4-beta-D-Xylan synthase | |
| 77610004 | 1,4-Lactonase | |
| 77611000 | Inorganic dust | |
| 77617001 | Hemoglobin Olomouc | |
| 77625004 | Glycerol 2-phosphatase | |
| 77632008 | Quinidine gluconate | |
| 77662002 | Immunoprecipitate | |
| 77671006 | Antidiuretic hormone | |
| 77673009 | Norepinephrine bitartrate | |
| 77683008 | Amygdalin | |
| 77703004 | Amphotericin B | |
| 77710005 | Plasmalogen | |
| 77722008 | Poultry bone | |
| 77729004 | Tetrasodium pyrophosphate | |
| 77752000 | Hemoglobin K-Cameroon | |
| 77756002 | L-Ascorbate-cytochrome-b>5< reductase | |
| 77760004 | Neotran | |
| 77762007 | Desulfoheparin sulfotransferase | |
| 77764008 | Guanabenz acetate | |
| 77767001 | Anti viral antibody | |
| 77774006 | Blood group antibody Stowe | |
| 77793008 | Isoamyl acetate | |
| 77799007 | Aluminum phenolsulfonate | |
| 77812005 | C3a complement receptor | |
| 77824003 | Coprostanol | |
| 77828000 | myo-Inositol-1-phosphate synthase | |
| 77829008 | Hypotaurine dehydrogenase | |
| 77832006 | Acetyl-CoA carboxylase | |
| 77847002 | Ceramide glucosyltransferase | |
| 77849004 | Potassium bicarbonate | |
| 77850004 | Organic arsenic | |
| 77864004 | Antioncogene | |
| 77901009 | Cycloartenol synthase | |
| 77907008 | Blood group antibody To^a^ | |
| 77923008 | Phosphorus radioisotope | |
| 77927009 | ^128^Barium | |
| 77929007 | Hemoglobin Chicago | |
| 77932005 | O-Acetylhomoserine (thiol)-lyase | |
| 77934006 | Sulfurated lime solution | |
| 77942007 | Integrin leukocyte adhesive protein | |
| 77951004 | Aspartate carboxypeptidase | |
| 77963009 | Central myelin protein | |
| 77983005 | Lighter fluid | |
| 77998007 | Deoxythymidine diphosphate | |
| 78003007 | Fibrinogen New Orleans II | |
| 78014005 | Urine | |
| 78020006 | Blood group antigen Westerlund | |
| 78023008 | ^87m^Strontium | |
| 78032005 | Resorcinol | |
| 78036008 | Complement component fragment | |
| 78047001 | 1-1-bis-(p-chlorophenyl)-2-Nitropropane | |
| 78059002 | Bisulfite salt | |
| 78073006 | Acetyldiaminopimelate deacetylase | |
| 78075004 | 12alpha-Hydroxysteroid dehydrogenase (substance) | |
| 78116009 | Ceramide cholinephosphotransferase | |
| 78130004 | Dihydrostreptomycin-6-phosphate 3'alpha-kinase | |
| 78134008 | Piminodine | |
| 78137001 | Pumiliotoxin C | |
| 78151001 | Trichloroacetic acid | |
| 78173008 | T cell antibody | |
| 78175001 | Glutarate-semialdehyde dehydrogenase | |
| 78178004 | Anti rickettsial antibody | |
| 78215002 | Blood group antigen Rh35 | |
| 78219008 | Gelsemine | |
| 78221003 | Cobra venom | |
| 78228009 | ^129m^Tellurium | |
| 78231005 | Blood group antibody Js^a^ | |
| 78232003 | Acylglycerol kinase | |
| 78242001 | Oncogene protein KS3 | |
| 78249005 | Hemoglobin North Chicago | |
| 78252002 | Blood group antibody Finlay | |
| 78255000 | Coagulation factor II San Juan 1 variant | |
| 78257008 | Sternutator | |
| 78258003 | Deoxycholic acid | |
| 78263004 | Immunoglobulin, constant region | |
| 78286006 | Lantadene A | |
| 78316004 | Dehydroepiandrosterone | |
| 78327002 | Hypotaurocyamine kinase | |
| 78334000 | CMP-N-acylneuraminate phosphodiesterase | |
| 78339005 | HLA-B14 antigen | |
| 78343009 | Isopropylamine | |
| 78346001 | Spermidine dehydrogenase | |
| 78350008 | Triethylamine | |
| 78369003 | Alizarin 2-beta-glucosyltransferase | |
| 78386009 | Blood group antigen I^S^ | |
| 78388005 | Histidine-tRNA ligase | |
| 78400000 | Crotonoyl-[acyl-carrier-protein] hydratase | |
| 78404009 | Ethanolamine oxidase | |
| 78414000 | Rubber compound | |
| 78433005 | Methylaminoheptane | |
| 78445001 | Hemoglobin Jackson | |
| 78446000 | ^194^Osmium | |
| 78447009 | Phospholipid | |
| 78452004 | Xanthosine-5-phosphate | |
| 78454003 | Immunoglobulin, GM>11< allotype | |
| 78460003 | Antistreptolysin O | |
| 78462006 | ^134^Cesium | |
| 78467000 | Lymphocyte antigen CDw60 | |
| 78481003 | Iofetamine I^123^ hydrochloride | |
| 78491009 | Trinitrobenzene | |
| 78505007 | Glutamate-cysteine ligase | |
| 78520001 | Dazomet | |
| 78527003 | Fucose | |
| 78529000 | ^130^Iodine | |
| 78552001 | Chloral betaine (substance) | |
| 78556003 | Dihydroorotase | |
| 78570003 | Indium^111^ transferrin | |
| 78573001 | Lignoceric acid | |
| 78588006 | Fibrinolysin, human | |
| 78589003 | Diphenylcyanoarsine | |
| 78594003 | Blood group antigen Bonde | |
| 78597005 | Intracisternal material of known identity | |
| 78602003 | Shikimate kinase | |
| 78604002 | Sphingosine cholinephosphotransferase | |
| 78605001 | HLA-Dw15 antigen | |
| 78617004 | Barium hydroxide | |
| 78636009 | Aminopyridine | |
| 78637000 | 3-Ethylmalate synthase | |
| 78650004 | Adenosylhomocysteine nucleosidase | |
| 78655009 | Benzoyl chloride | |
| 78661007 | Blood group antibody Rb^a^ | |
| 78665003 | Hemoglobin Daneshgah-Tehran | |
| 78671009 | Zinc arsenite | |
| 78686003 | Copper^64^ acetate | |
| 78688002 | Blood group antigen Henry | |
| 78702007 | Thalidomide | |
| 78707001 | Blood group antibody Fl | |
| 78708006 | Sodium arsanilate | |
| 78709003 | Human leukocyte antigen Bw67 (substance) | |
| 78713005 | Caproic acid | |
| 78720003 | N-Acyl mannosamine kinase | |
| 78721004 | Nervonic acid | |
| 78730007 | ^189^Iridium | |
| 78736001 | alpha>2< HS glycoprotein | |
| 78744001 | Hydrogen dehydrogenase | |
| 78749006 | HLA-DQ antigen | |
| 78750006 | Blood group antibody Sc2 | |
| 78751005 | Kynurenine-oxoglutarate aminotransferase | |
| 78758004 | 2,3-Dimethylmalate lyase | |
| 78759007 | Pyridoxamine-phosphate aminotransferase | |
| 78760002 | Angiotensinase | |
| 78772008 | Phenanthrene | |
| 78774009 | FMN adenylyltransferase | |
| 78782009 | Silver chloride | |
| 78787003 | Hydroxyphenyl mercurichloride | |
| 78796003 | 7-Dehydrocholesterol reductase | |
| 78802001 | Blood group antigen Norlander | |
| 78825000 | Fibrinogen Leuven | |
| 78833004 | ^246^Californium | |
| 78834005 | Fucosylglycoprotein 3-alpha-galactosyltransferase | |
| 78837003 | Glycine benzoyltransferase | |
| 78851003 | Lipoprotein-X | |
| 78859001 | Morrhuate sodium | |
| 78866000 | HLA-Aw68 antigen | |
| 78869007 | Nuclear fast red stain (substance) | |
| 78870008 | Cobalt radioisotope | |
| 78903005 | Pancreatic elastase | |
| 78910004 | Solid substance | |
| 78924000 | Hemoglobin J-Cubujuqui | |
| 78936006 | Propoxycaine hydrochloride | |
| 78955006 | Blood group antibody Hollister | |
| 78959000 | Sulfathiourea | |
| 78966004 | Metham sodium | |
| 78971006 | Toluenediamine | |
| 79005005 | Immunoglobulin gene GM allotype | |
| 79006006 | Methylglutaconyl-CoA hydratase | |
| 79007002 | Industrial product | |
| 79008007 | Blood group antibody Dh^a^ | |
| 79018002 | Amylosucrase | |
| 79027001 | Hemoglobin J-Cairo | |
| 79029003 | Blood group antibody Mitch | |
| 79039009 | Methacrylic acid | |
| 79055002 | Hydroxylamine oxidase | |
| 79061004 | Germanium | |
| 79066009 | Hemoglobin Cranston | |
| 79080002 | Blood group antibody Rh39 | |
| 79084006 | Clostridial toxin | |
| 79098003 | Hemoglobin Beograd | |
| 79124006 | Blood group antigen To^a^ | |
| 79127004 | Fibrin monomer | |
| 79135001 | Promazine hydrochloride | |
| 79136000 | ^146^Gadolinium | |
| 79141008 | Crotalus adamanteus serine proteinase (substance) | |
| 79146003 | Citrated calcium carbimide | |
| 79166007 | Acyl-phosphate-hexose phosphotransferase | |
| 79176005 | Blood group antigen Rh40 | |
| 79193005 | Fibrinogen Homberg I | |
| 79197006 | ^82^Rubidium | |
| 79198001 | Alloalbumin | |
| 79209008 | Dicumarol (substance) | |
| 79211004 | Alcohol dehydrogenase [NAD(P)+] (substance) | |
| 79212006 | Proinsulin | |
| 79219002 | Hemoglobin Sunnybrook | |
| 79226002 | Blood group antigen Stairwalt | |
| 79242009 | [Acyl carrier-protein] acetyltransferase | |
| 79245006 | Glutamate synthase (ferredoxin) | |
| 79249000 | Lochia flava | |
| 79251001 | Glyceraldehyde-3-phosphate dehydrogenase (NADP^+^) (phosphorylating) | |
| 79271005 | Tremetol | |
| 79288003 | Cross reacting antigen | |
| 79293000 | Nucleoside-triphosphatase | |
| 79316006 | Alkyl aryl polyether sulfate | |
| 79326004 | Lymphocyte antigen CD23 | |
| 79328003 | Lysine decarboxylase | |
| 79329006 | Serum protein | |
| 79330001 | Zinc trichlorophenate | |
| 79331002 | Blood group antibody Hr | |
| 79338008 | ^97m^Technetium | |
| 79341004 | Lymphocyte antigen CD71 | |
| 79343001 | Oil of parsley | |
| 79370008 | Thiocyanate compound | |
| 79375003 | Proteoglycan | |
| 79380007 | Hydrocortisone acetate | |
| 79388000 | Aryl acylamidase | |
| 79391000 | ATP phosphoribosyltransferase | |
| 79396005 | Purine-nucleoside phosphorylase | |
| 79415006 | Procollagen-proline,2-oxoglutarate 4-dioxygenase | |
| 79422003 | Gadolinium radioisotope | |
| 79428004 | Dihydroxyaluminum aminoacetate | |
| 79446005 | Imidazole acetyltransferase | |
| 79448006 | ^91m^Yttrium | |
| 79477007 | ^66^Gallium | |
| 79482000 | ^174^Hafnium | |
| 79496006 | Blood group antigen Y. Bern | |
| 79498007 | Zeta-chain hemoglobin | |
| 79506002 | ^196m^Iridium | |
| 79514008 | Methylenetetrahydrofolate reductase (NADPH) | |
| 79522001 | Carbamate pesticide | |
| 79523006 | ^76^Bromine | |
| 79531001 | Aminopeptidase P | |
| 79545007 | trans-L-3-Hydroxyproline dehydratase | |
| 79549001 | Cyanoacrylate | |
| 79550001 | ^197^Gold | |
| 79568003 | Acetylornithine aminotransferase | |
| 79576001 | Titanium sulfate | |
| 79580006 | Adrenal hormone | |
| 79581005 | Hydrated sodium borate | |
| 79610008 | Technetium Tc^99m^ serum albumin | |
| 79612000 | Myelin | |
| 79625008 | Methylenetetrahydrofolate dehydrogenase (NAD^+^) | |
| 79630007 | Extracellular secretion material following exocytosis, luminal, exocrine | |
| 79638000 | Blood group antibody Hr^B^ | |
| 79640005 | Deoxythymidylic acid | |
| 79651005 | Naphthyl acetic acid | |
| 79657009 | Type III site-specific deoxyribonuclease | |
| 79680001 | Sporotrichum proteinase I | |
| 79685006 | 5-Aminolevulinate synthase | |
| 79689000 | Amprotropine | |
| 79691008 | Oximinotransferase | |
| 79697007 | Leukocyte-adhesion receptor | |
| 79706000 | Bilirubin | |
| 79721006 | Flavone apiosyltransferase | |
| 79744009 | beta-Lactamase | |
| 79761007 | Di-2-ethylhexyl phthalate | |
| 79769009 | Anti parasitic antibody | |
| 79773007 | Active C4b2a | |
| 79775000 | Terebene | |
| 79778003 | Acetylene | |
| 79784000 | Lead acetate | |
| 79796007 | Blood group antibody Pt^a^ | |
| 79798008 | Spleen exonuclease | |
| 79803004 | Chloroacetophenone | |
| 79813007 | Blood group antibody H | |
| 79846001 | Coagulation factor IX Cambridge variant | |
| 79850008 | Augusticeps-type venom | |
| 79862007 | Alanopine dehydrogenase | |
| 79900002 | Methionine S-methyltransferase | |
| 79907004 | Aminobenzoic acid derivative | |
| 79912003 | Squalene monooxygenase | |
| 79937008 | Sodium cacodylate | |
| 79943005 | Nucleoside-diphosphatase | |
| 79973001 | Complement component C9 | |
| 79976009 | 2-Isopropoxyethanol | |
| 80044001 | Polysaccharide methyltransferase (substance) | |
| 80048003 | Blood group antibody Walls | |
| 80086007 | Hemoglobin Toyoake | |
| 80105007 | Blood group antibody iP>1< | |
| 80120001 | Tryptophan 2,3-dioxygenase | |
| 80122009 | HLA-B40 antigen | |
| 80133007 | Blood group antibody Westerlund | |
| 80143005 | GMP synthase (glutamine-hydrolysing) | |
| 80164009 | Cinnabar | |
| 80188006 | HLA-C antigen | |
| 80189003 | Plant steroid alkaloid | |
| 80191006 | Protocatechuate 3,4-dioxygenase | |
| 80214006 | Micrococcus caseolyticus neutral proteinase | |
| 80222004 | 5'-Nucleotidase | |
| 80230003 | 2,6-Dichloro-4-nitrobenzenamine | |
| 80234007 | Matrix of cartilage | |
| 80237000 | Cocoa butter | |
| 80238005 | Prodipidine | |
| 80253002 | Aminometradine | |
| 80259003 | Food flavoring agent | |
| 80260008 | Iodinated I^125^ levothyroxine | |
| 80263005 | Aminotriazole | |
| 80269009 | Keratan-sulfate endo-1,4-beta-galactosidase | |
| 80276004 | Blood group antigen Savior | |
| 80283006 | UDPgalactopyranose mutase | |
| 80305003 | Pontamine sky blue 6BX stain (substance) | |
| 80312007 | Platinum isotope | |
| 80322001 | Synthetic alkaloid | |
| 80324000 | Stone dust | |
| 80343000 | Anti bacterial antibody | |
| 80344006 | ^85m^Krypton | |
| 80373009 | Sedoheptulokinase | |
| 80382003 | Hydrocarbon | |
| 80393001 | Diiodotyrosine | |
| 80403006 | Blood group antibody Clements | |
| 80413003 | Blood group antigen Stowe | |
| 80424001 | Blood group antigen McKenney | |
| 80429006 | UDP-N-acetylglucosamine pyrophosphorylase | |
| 80453000 | Proline racemase | |
| 80458009 | Aminoacyl-lysine dipeptidase | |
| 80464002 | Anthranilate 1,2-dioxygenase (deaminating, decarboxylating) | |
| 80465001 | Blood group antigen Lan | |
| 80472000 | Hemoglobin Strasbourg | |
| 80482004 | Blood group antigen Rh32 | |
| 80485002 | Sulfur monochloride | |
| 80492007 | Alkyl dimethyl ethylbenzyl ammonium chloride | |
| 80494008 | Reticulin | |
| 80506001 | Aldose dehydrogenase | |
| 80516009 | Blood group antigen Davis J | |
| 80517000 | Heparosan-N-sulfate-glucuronate 5-epimerase | |
| 80521007 | ^200^Platinum | |
| 80532007 | Aprobarbital | |
| 80537001 | Peptide YY | |
| 80539003 | Cobalt salt | |
| 80540001 | Succinyl-CoA hydrolase | |
| 80553003 | Tetrachloroquinone | |
| 80558007 | Blood group antibody HLA-A8 | |
| 80562001 | Deoxy guanosine triphosphate | |
| 80572003 | Colony-stimulating factor, granulocytic | |
| 80575001 | Blood group antigen Kaj | |
| 80582002 | Glycerol | |
| 80590002 | Lymphocyte antigen CDw12 | |
| 80591003 | N-Acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase | |
| 80605008 | Acokantherin | |
| 80613009 | Mannitol dehydrogenase (NADP^+^) | |
| 80616001 | Hemoglobin Radcliffe | |
| 80620002 | HLA-B35 antigen | |
| 80630006 | Sodium arsenite | |
| 80652002 | Phenyl mercuric salt | |
| 80688007 | Pro-opiomelanocortin | |
| 80705000 | Blood group antigen Knoebnchild | |
| 80706004 | Alkyl dimethyl ethyl ammonium chloride | |
| 80741000 | Plasma kinin | |
| 80743002 | Mustard black | |
| 80745009 | Barium thioglycolate | |
| 80751004 | ^133^Xenon | |
| 80754007 | Blood group antigen Hut | |
| 80760007 | Blood group antigen Nijhuis | |
| 80789009 | Diosgenin | |
| 80819005 | Proline carboxypeptidase | |
| 80832000 | Ketopantoaldolase | |
| 80837006 | Sialidase | |
| 80839009 | D-Amino-acid dehydrogenase (substance) | |
| 80854003 | ^211^Lead | |
| 80861004 | Nucleolus organizer region | |
| 80869002 | Immunoglobulin, GM>19< allotype | |
| 80873004 | Oxyhemoglobin | |
| 80876007 | Phosphomannan mannosephosphotransferase | |
| 80892002 | Blood group antibody Zd | |
| 80903004 | Haplotoxin | |
| 80911009 | Exodeoxyribonuclease III | |
| 80916004 | Potassium phosphate | |
| 80917008 | Toxin | |
| 80918003 | Protoporphyrin IX | |
| 80920000 | ^176^Tungsten | |
| 80929004 | Blood group antigen Cs^a^ | |
| 80946001 | Thromboxane | |
| 80959009 | Methylprednisolone acetate | |
| 80972005 | Cephazolin sodium | |
| 80987000 | Animal genome | |
| 80992003 | erythro-3-Hydroxyaspartate dehydratase | |
| 80994002 | 4-Aminopyridine | |
| 81017004 | Encainide hydrochloride | |
| 81044009 | 2-Ethoxyacetate | |
| 81053002 | Blood group antibody Welsh | |
| 81080009 | Blood group antigen En^a^FR | |
| 81100008 | Pentose | |
| 81111000 | Glycogen-synthase-D phosphatase | |
| 81114008 | Phosphatidylcholine-dolichol acyltransferase | |
| 81118006 | Gonadal hormone | |
| 81123006 | Interleukin-5 | |
| 81172004 | Creatinase | |
| 81176001 | Batrachotoxin | |
| 81181005 | Chitobiosyldiphosphodolichol alpha-mannosyltransferase | |
| 81195008 | Pentane | |
| 81205009 | Blood group antigen Do^a^ | |
| 81213005 | Blood group antigen Snyder | |
| 81222006 | Sutilains | |
| 81243007 | Isocitrate dehydrogenase (NADP^+^) | |
| 81255001 | Acetyl-CoA acyltransferase | |
| 81262005 | Blood group antibody Gy^a^ | |
| 81273003 | Fibrinogen Louisville | |
| 81286007 | Growth factor | |
| 81290009 | Tyrosine decarboxylase | |
| 81297007 | Blood group antibody Boil | |
| 81312003 | 5-Aminovalerate aminotransferase | |
| 81322009 | Phosphoamidase | |
| 81324005 | Zirconium radioisotope | |
| 81329000 | Blood group antibody PeCo | |
| 81332002 | Blood group antibody N>2< | |
| 81357007 | Aspartate ammonia-lyase | |
| 81362008 | Hexobarbital | |
| 81365005 | Levamisole hydrochloride | |
| 81384008 | Blood group antibody Dautriche | |
| 81394003 | Bence Jones protein | |
| 81395002 | Arachidonate 12-lipoxygenase | |
| 81397005 | Auramine O stain (substance) | |
| 81419006 | Chemical fumes | |
| 81426006 | Blood group antigen HLA-B8 | |
| 81430009 | Titanium oxide | |
| 81432001 | HLA-Dw18 antigen | |
| 81444003 | Coagulation factor X | |
| 81458001 | Eucatropine | |
| 81461000 | Fetal fibrinogen | |
| 81473000 | Sulfite reductase | |
| 81481004 | 4-Aminobutyrate aminotransferase | |
| 81494002 | Cholinephosphotransferase | |
| 81508005 | Doxycycline monohydrate | |
| 81522005 | Deoxythymidine triphosphate | |
| 81537009 | Tartronate-semialdehyde synthase | |
| 81578006 | Lymphocyte antigen CD25 | |
| 81582008 | Hemoglobin Santa Ana | |
| 81584009 | Brombenzyl cyanide | |
| 81589004 | Moniliformin | |
| 81599009 | Paraoxon | |
| 81600007 | Blood group antigen Gy^a^ | |
| 81602004 | Naled | |
| 81605002 | gamma Fetoprotein | |
| 81610003 | Blood group antigen Frando | |
| 81615008 | Hypercalcemic steroid preparation | |
| 81620008 | HLA-A23 antigen | |
| 81621007 | Indium^111^ red cell label | |
| 81625003 | 3beta-Hydroxy-delta 5-steroid dehydrogenase | |
| 81641002 | Blood group antigen Chase | |
| 81651001 | Diagnostic antiserum | |
| 81655005 | Protoporphyrinogen oxidase | |
| 81663006 | Glucuronokinase | |
| 81679007 | Blood group antibody Chase | |
| 81689006 | Prostatic secretions | |
| 81692005 | ATP deaminase | |
| 81702008 | Active C5b67 | |
| 81719005 | Tremorgenic mycotoxin | |
| 81732000 | Indolepyruvate methyltransferase | |
| 81761004 | Technetium Tc^99m^ microaggregated albumin | |
| 81778008 | Mercurophylline injection | |
| 81784006 | Blood group antibody Rod | |
| 81801009 | Alcohol oxidase | |
| 81809006 | Fumarylacetoacetase | |
| 81810001 | Vanillylmandelic acid | |
| 81816007 | Candicidin | |
| 81821005 | ^243^Americium | |
| 81837004 | Uridine kinase | |
| 81847001 | Hemoglobin Setif | |
| 81859002 | Dichlorophenarsine hydrochloride | |
| 81860007 | Isoetharine mesylate (substance) | |
| 81863009 | Watasemia-luciferin 2-monooxogenase | |
| 81867005 | Tantalum isotope | |
| 81868000 | Linolenic acid | |
| 81880008 | beta-Alanyl-CoA ammonia-lyase | |
| 81886002 | Ethylene glycol | |
| 81901008 | Hemoglobin Deer Lodge | |
| 81905004 | Globulin | |
| 81911001 | Chewing tobacco | |
| 81926004 | T-cell antigen receptor | |
| 81929006 | Hemoglobin Raleigh | |
| 81945008 | Chloromuconate cycloisomerase | |
| 81946009 | Dantrolene sodium | |
| 81948005 | Iron silicate | |
| 81963008 | Blood group antigen BOA 3150 (substance) | |
| 81969007 | Phosphoenolpyruvate carboxylase | |
| 81989008 | Nucleoside phosphoacylhydrolase | |
| 82004000 | Methyl acetate | |
| 82017002 | 5-Carboxymethyl-2-hydroxymuconate delta-isomerase | |
| 82021009 | Lotus aspartic proteinase | |
| 82026004 | Butyl methyl ketone | |
| 82055007 | Spermidine synthase | |
| 82061005 | Triphenylamine | |
| 82064002 | Coproporphyrinogen I | |
| 82075003 | Bismuth subsalicylate | |
| 82083009 | Phosphoprotein phosphatase | |
| 82100006 | IMP dehydrogenase | |
| 82122004 | Bacillus thuringiensis preparation | |
| 82131004 | Heptabarbital (substance) | |
| 82134007 | Apyrase | |
| 82149004 | Hemoglobin Hofu | |
| 82150004 | Diisopropyl-fluorophosphatase | |
| 82154008 | Rubber cis-polyprenylcistransferase | |
| 82160008 | Cathepsin L | |
| 82171009 | Blood group antibody Hoalzel | |
| 82175000 | tRNA (guanine-N^1^)-methyltransferase | |
| 82176004 | Blood group antigen Koopman | |
| 82183006 | Cytoadhesin receptor | |
| 82205007 | Tetrachloro-1,4- benzoquinone | |
| 82216000 | Metazocine | |
| 82220001 | Staphylococcal serine proteinase | |
| 82222009 | Acetoacetate-CoA ligase | |
| 82224005 | Ethyl mercury phosphate | |
| 82227003 | D-Lysopine dehydrogenase | |
| 82230005 | Quinidine sulfate | |
| 82239006 | Blood group antigen Naz | |
| 82246002 | Exoribonuclease H | |
| 82256003 | Human gene | |
| 82270003 | Blood group antibody Bi | |
| 82279002 | Blood group antibody Rh32 | |
| 82282007 | Apigenin O^4'^-methyltransferase | |
| 82299008 | Blood group antibody M^A^ | |
| 82322007 | Oil of dill | |
| 82332000 | Chlorodimethyl phenoxy ethanol | |
| 82335003 | Gluconolactonase | |
| 82337006 | Isopentyl alcohol | |
| 82359008 | Prulaurasin | |
| 82391009 | Hemoglobin F-Poole | |
| 82394001 | Glucose-1-phosphate adenylyltransferase | |
| 82395000 | CMP-N-acetylneuraminate-beta-galactoside alpha-2,3-sialyltransferase | |
| 82398003 | Chlorinated biphenyl oxide | |
| 82409003 | Antibody to hepatitis B core antigen | |
| 82411007 | Rose bengal stain (substance) | |
| 82412000 | Adenosylmethionine hydrolase | |
| 82444001 | 3-Hydroxybutyryl-CoA dehydrogenase | |
| 82450006 | Cottonseed oil | |
| 82469001 | Glutathione dehydrogenase (ascorbate) | |
| 82481002 | White phosphorus | |
| 82485006 | Pentamethonium bromide | |
| 82489000 | Blood group antibody IAB | |
| 82490009 | Chenodeoxycholic acid | |
| 82503004 | ^164^Ytterbium | |
| 82544003 | Hemoglobin Bibba | |
| 82549008 | Hemoglobin J-Broussais | |
| 82565009 | Mucopolysaccharide | |
| 82566005 | Animal feed | |
| 82570002 | Glucose-1-phosphatase | |
| 82571003 | Blood group antigen Zim | |
| 82572005 | Sulphenone | |
| 82592003 | Complement factor Bb | |
| 82594002 | Blood group antibody Riv | |
| 82604001 | Echis carnatus prothrombin-activating proteinase | |
| 82609006 | Haptoglobin 1-1 | |
| 82620006 | Blood group antigen M^g^ | |
| 82622003 | Vitamin A | |
| 82623008 | Dihydrodipicolinate synthase | |
| 82645009 | Antibody to hepatitis B surface antigen | |
| 82671008 | Alkylmercury lyase | |
| 82682000 | Victoria blue 4R stain (substance) | |
| 82693003 | Myoglobin | |
| 82720002 | Blood group antigen Lu16 | |
| 82753007 | Lymphocyte antigen CD20 | |
| 82759006 | Dihydrofolate synthase | |
| 82772007 | Formiminoaspartate deiminase | |
| 82778006 | Uroporphyrin III | |
| 82786006 | Citrate (re)-synthase | |
| 82787002 | Chloridazon-catechol dioxygenase | |
| 82792000 | Biotin-[methylmalonyl-CoA-carboxyltransferase] ligase | |
| 82798001 | Coagulation factor X Prower variant | |
| 82803005 | Blood group antibody Juneau | |
| 82846008 | L-Arabinitol dehydrogenase | |
| 82850001 | Fibrinogen Charlottsville | |
| 82855006 | ^115^Indium | |
| 82861009 | Blood group antigen Kelly | |
| 82863007 | Incomplete antibody | |
| 82873009 | Abnormal hemoglobin, extended chain | |
| 82885001 | Colistimethate | |
| 82890003 | Hemoglobin Tashikuergan | |
| 82906001 | Aldose-6-phosphate reductase (NADPH) | |
| 82912006 | Non-ionized calcium | |
| 82922000 | Coagulation factor II Poissy variant | |
| 82927006 | High molecular weight kininogen | |
| 82931000 | Sodium succinate | |
| 82937001 | Factor VII antibody | |
| 82963006 | Polygalacturonase | |
| 82981009 | Decaborane | |
| 82983007 | Euchromatin | |
| 82989006 | Decylhomocitrate synthase | |
| 83003003 | Lymphocyte antigen CD37 | |
| 83024008 | Oil of patchouli | |
| 83026005 | RNA uridylyltransferase | |
| 83034004 | Monocrotaline | |
| 83036002 | Lactate | |
| 83042003 | Erythropoietin | |
| 83051006 | Cimetidine hydrochloride | |
| 83054003 | Undecaprenol kinase | |
| 83055002 | Escin | |
| 83064007 | Hemoglobin J-Guantanamo | |
| 83066009 | Hemoglobin Harbin | |
| 83068005 | Factor XI antibody | |
| 83078008 | Blood group antibody Os^a^ | |
| 83087004 | 6-Phospho-beta-galactosidase | |
| 83098003 | Intracellular fibril | |
| 83102006 | Sorbitol-6-phosphatase | |
| 83108005 | Blood group antigen Vg^a^ | |
| 83109002 | Blood group antibody Baugh | |
| 83115002 | Dichlorophenazone | |
| 83131005 | Blood group antigen Perry | |
| 83143006 | Glutethimide | |
| 83149005 | Transaldolase | |
| 83177001 | Thallium compound | |
| 83180000 | Phenylpyruvate tautomerase | |
| 83182008 | 2-Dehydro-3-deoxy-L-arabinonate dehydratase | |
| 83184009 | Asparagine-tRNA ligase | |
| 83188007 | Adenylylsulfate-ammonia adenylyltransferase | |
| 83191007 | Organic sulfone compound | |
| 83205002 | ^76^Krypton | |
| 83235009 | Bovine growth hormone recombinant | |
| 83237001 | Titanium isotope | |
| 83261008 | myo-Inositol 1-kinase | |
| 83267007 | Phenacetin | |
| 83280005 | Fibrinogen Lille | |
| 83283007 | Chloramphenicol acetyltransferase | |
| 83298009 | Ethyl acetate | |
| 83309005 | Ethopropazine hydrochloride (substance) | |
| 83310000 | Cupric salt | |
| 83334005 | Adenine phosphoribosyltransferase | |
| 83342006 | Cyanate hydrolase | |
| 83348005 | Phosphatidylinositol-bisphosphatase | |
| 83349002 | Viomycin kinase | |
| 83357004 | Red veterinary petrolatum | |
| 83388000 | UDP-N-acetylglucosamine-dolichyl-phosphate-N-acetylglucosaminephosphotransferase | |
| 83391000 | HLA-Bw antigen | |
| 83399003 | Glycerone kinase | |
| 83400005 | Phosphoglycerate kinase (GTP) | |
| 83404001 | Blood group antibody K | |
| 83407008 | Protoveratrine A | |
| 83423008 | Sodium diprotrizoate | |
| 83432005 | Blood group antigen 1123K | |
| 83438009 | Dobesilate calcium | |
| 83446005 | Riboflavin synthase | |
| 83475004 | Desmin | |
| 83496006 | HLA class I antigen | |
| 83499004 | Blood group antibody Maliff | |
| 83515009 | HLA-DRw17 antigen | |
| 83534009 | Cyclopentolate hydrochloride | |
| 83539004 | Dihydrofolate reductase | |
| 83545007 | Fumitremorgen | |
| 83552009 | Pharyngeal mucus | |
| 83581005 | Silicon dioxide | |
| 83595008 | Goat's milk | |
| 83596009 | Iron oxide | |
| 83598005 | Xenon | |
| 83600004 | Spirit soluble eosin stain (substance) | |
| 83601000 | ^38^Sulfur | |
| 83614004 | ^229^Thorium | |
| 83615003 | Hemoglobin A>2< Fitzroy | |
| 83616002 | Thrombomodulin-thrombin complex (substance) | |
| 83619009 | Polyvinyl alcohol | |
| 83621004 | Complement receptor 5 | |
| 83625008 | Antimony thioglycolate | |
| 83640005 | UDP-N-acetylmuramoylalanyl-D-glutamate-2,6 diaminopimelate ligase | |
| 83667004 | Enterogastrone | |
| 83671001 | Hydroxylysine kinase | |
| 83672008 | Pentachloronitrobenzene (substance) | |
| 83682009 | Methylaspartate mutase (substance) | |
| 83688008 | Flumethrin | |
| 83695004 | Hemoglobin Spanish Town | |
| 83696003 | Oncogene protein LYL1 | |
| 83700006 | Glyceraldehyde-3-phosphate dehydrogenase (NADP^+^) | |
| 83701005 | Erythrulose reductase | |
| 83702003 | Bialamicol | |
| 83704002 | Pipethanate | |
| 83705001 | Nitrogenase | |
| 83717004 | Big big gastrin | |
| 83732006 | Hb 114(G16), Leu (substance) | |
| 83734007 | Blood group antigen Eggenberger | |
| 83737000 | Tedion | |
| 83749004 | Acid radical | |
| 83769009 | Phosphoglycolate phosphatase (substance) | |
| 83770005 | Phospho-2-dehydro-3-deoxygluconate aldolase | |
| 83792009 | Succinate-coenzyme A ligase (adenosine diphosphate-forming) (substance) | |
| 83797003 | Leucine (substance) | |
| 83814001 | Sorghum aspartic proteinase | |
| 83815000 | Hemoglobin E | |
| 83847005 | Palladium radioisotope | |
| 83849008 | 1,1-Dichloroethylene | |
| 83863002 | Deoxyguanosine kinase | |
| 83869003 | Blood group antibody Co3 | |
| 83871003 | Hemoglobin Sogn | |
| 83872005 | Phenyramidol (substance) | |
| 83873000 | Sodium monofluorophosphate | |
| 83881004 | Aluminium oxide | |
| 83882006 | Juniper oil (substance) | |
| 83884007 | Blood group antigen Lu4 | |
| 83897009 | Paralytic shellfish toxin (substance) | |
| 83912003 | ^129^Iodine | |
| 83933007 | Hydroxyzine pamoate | |
| 83945003 | Hydroxyzine hydrochloride | |
| 83963003 | Uranium nitrate | |
| 83968007 | Clemastine fumarate | |
| 83972006 | ^233^Uranium | |
| 83981000 | Erythromycin gluceptate | |
| 83989003 | Blood group antigen Messenger | |
| 84006004 | Dihydrodipicolinate reductase (substance) | |
| 84019000 | DNA alpha-glucosyltransferase | |
| 84024002 | Dolichyl-phosphate beta-glucosyltransferase | |
| 84035007 | Cystathionine | |
| 84055008 | ^204^Bismuth (substance) | |
| 84059002 | Pinguinain | |
| 84079005 | Blood group antigen Clements | |
| 84083005 | Hemoglobin Khartoum | |
| 84103009 | Phenoxyethanol | |
| 84123005 | Nitrofurfuryl methylether | |
| 84131000 | Urate oxidase (substance) | |
| 84136005 | Hemoglobin Stanleyville-II | |
| 84144005 | Sodium cyanide | |
| 84145006 | Cryptenamine | |
| 84147003 | Thymidine,2-oxoglutarate dioxygenase | |
| 84163006 | Blood group antigen Je^a^ | |
| 84164000 | Chloramben | |
| 84165004 | Cefoxitin sodium (substance) | |
| 84169005 | Collidine | |
| 84171005 | Blood group antibody Tc^b^ | |
| 84181009 | Styrene | |
| 84191003 | ^193^Platinum | |
| 84212004 | Ethylenimine | |
| 84213009 | Midazolam hydrochloride | |
| 84217005 | Titan yellow stain (substance) | |
| 84230006 | Plant sesquiterpene | |
| 84242001 | ^245^Plutonium | |
| 84250005 | Fumitoxin | |
| 84259006 | Blood group antigen Wb | |
| 84270004 | Cade oil | |
| 84274008 | Hydrobromic acid | |
| 84276005 | Lymphocyte antigen CD43 | |
| 84317008 | Phosphonacetic acid | |
| 84323003 | Mercocresols | |
| 84341006 | ^254^Californium | |
| 84342004 | Rubidium radioisotope | |
| 84345002 | Hemoglobin Saverne | |
| 84348000 | Fructose 5-dehydrogenase (NADP^+^) | |
| 84361000 | Fibrinogen Los Angeles | |
| 84363002 | Hydroxyketone dye | |
| 84372005 | Blood group antibody Hartley | |
| 84373000 | Hyaluronoglucuronidase (substance) | |
| 84375007 | Hemoglobin J-Sicilia | |
| 84377004 | Staphylococcal cysteine proteinase | |
| 84381004 | Menthyl anthranilate and titanium oxide | |
| 84386009 | Tribromoethanol | |
| 84406006 | HLA-DPw antigen | |
| 84424008 | Potassium cyanide | |
| 84429003 | Rubredoxin-nicotinamide adenine dinucleotide phosphate ^+^ reductase (substance) | |
| 84430008 | Cross reacting antibody | |
| 84433005 | HLA-Bw56 antigen | |
| 84443008 | ^225^Radium | |
| 84464007 | Lymphocyte antigen CD42b | |
| 84486008 | Mannose-1-phosphate guanylyltransferase (substance) | |
| 84488009 | Compound blood group antigen iH (substance) | |
| 84498003 | Pipe smoking tobacco (substance) | |
| 84509001 | Hemoglobin Siriraj | |
| 84520001 | Viral structural gene | |
| 84524005 | Iduronate 2-sulfatase | |
| 84536004 | Fibrinogen Metz | |
| 84538003 | Blood group antigen C | |
| 84547006 | L-Ascorbate oxidase | |
| 84553006 | ^93m^Molybdenum | |
| 84560000 | Leucine aminotransferase | |
| 84583002 | Active C5b | |
| 84601005 | Immunoglobulin, GM>24< allotype | |
| 84609007 | Blood group antibody Xg^a^ | |
| 84616008 | Dolichyl-xylosyl-phosphate-protein xylosyltransferase | |
| 84629008 | Androgen | |
| 84650004 | Intestinal contents (substance) | |
| 84653002 | Blood group antibody Swarts | |
| 84656005 | Atebrin FS stain (substance) | |
| 84658006 | Blood group antibody Elder | |
| 84671009 | Acyl-[acyl-carrier-protein] desaturase | |
| 84698008 | Cholesterol | |
| 84704008 | Pyridoxamine-oxaloacetate aminotransferase (substance) | |
| 84708006 | Blood group antigen Gill | |
| 84717006 | Diacylglycerol-sterol acyltransferase | |
| 84718001 | Alkyl dimethyl ethyl ammonium bromide | |
| 84720003 | Complement component C4a | |
| 84746004 | Pituitary hormone | |
| 84748003 | Doxapram hydrochloride | |
| 84761003 | Phosphodiesterase I | |
| 84770000 | Polyphosphate kinase (substance) | |
| 84771001 | D-Xylose dehydrogenase | |
| 84786007 | Dehydrogluconokinase | |
| 84791008 | Sodium metabisulfite | |
| 84802001 | Equinatoxin | |
| 84818007 | 17,21-Dihydroxypregnenolone | |
| 84822002 | Methyl methacrylate (substance) | |
| 84823007 | tRNA isopentenyltransferase | |
| 84835006 | Cyclic adenosine monophosphate (substance) | |
| 84847000 | Platinum | |
| 84865001 | Active C1r/C1s (substance) | |
| 84870008 | Blood group antibody Horn | |
| 84874004 | Iodohippurate I^123^ sodium | |
| 84896005 | Oncogene protein TCL3 | |
| 84905003 | Beta interferon (substance) | |
| 84922001 | Blood group antibody McAuley | |
| 84926003 | Homovanillic acid | |
| 84927007 | Fungal gene | |
| 84933003 | Germanium tetrahydride | |
| 84934009 | Hemoglobin Cowtown | |
| 84935005 | Tumor-angiogenesis factor | |
| 84960005 | Auxin A | |
| 84963007 | ^3^Helium | |
| 84973009 | Glucan 1,6-alpha-isomaltosidase | |
| 84987009 | Ethyl phosphate | |
| 84990003 | ^80^Bromine | |
| 85012003 | Protein-glutamate methyltransferase | |
| 85024005 | Plant estrogenic glycoside | |
| 85035000 | Griseofulvin microsize | |
| 85037008 | Doxepin hydrochloride (substance) | |
| 85043005 | D-Alanine aminotransferase | |
| 85060000 | Blood group antibody Duvall | |
| 85066006 | Azo black stain (substance) | |
| 85074007 | ^103m^Rhodium | |
| 85105005 | Hemoglobin Inkster | |
| 85112001 | Cellodextrin phosphorylase (substance) | |
| 85115004 | Methylmalonate-semialdehyde dehydrogenase (acylating) | |
| 85122007 | Globoside alpha-N-acetylgalactosaminyltransferase (substance) | |
| 85129003 | Blood group antigen Wr^a^ | |
| 85134004 | Phospholipase D | |
| 85137006 | Tetrachlorophenol | |
| 85142003 | Germanium isotope | |
| 85146000 | Thorium radioisotope | |
| 85155002 | Anti RANA antibody | |
| 85172009 | Bromine pentafluoride | |
| 85174005 | Phthalocyanine dye | |
| 85181003 | Fibrous protein | |
| 85185007 | p-Nitrobiphenyl (substance) | |
| 85190005 | Bismark brown Y stain (substance) | |
| 85197008 | Coagulation factor IX Vancouver variant | |
| 85205004 | beta-Adrenergic receptor | |
| 85214009 | Glutamic acid | |
| 85236007 | D region, MHC | |
| 85242006 | Levamphetamine (substance) | |
| 85246009 | Barbiturase | |
| 85252005 | Cuscohygrine | |
| 85253000 | Blood group antigen Bp^a^ | |
| 85254006 | Opheline kinase | |
| 85258009 | Chromic acid | |
| 85267009 | Angiotensin II | |
| 85268004 | 5-Dehydro-2-deoxygluconokinase | |
| 85270008 | Wood splinter | |
| 85283009 | Glutamine-phenylpyruvate aminotransferase | |
| 85287005 | Hypoxanthine | |
| 85294008 | Haptoglobin | |
| 85297001 | Maltose synthase | |
| 85310002 | Bis(5'-adenosyl)-triphosphatase | |
| 85335008 | beta Pyridyl carbinol | |
| 85347002 | Cardiotoxin venom | |
| 85351000 | Aldehyde oxidase | |
| 85364004 | Coagulation factor II Madrid variant (substance) | |
| 85369009 | Tin radioisotope (substance) | |
| 85374001 | Blood group antigen Donavieski | |
| 85378003 | Bromine (substance) | |
| 85391002 | Meralluride (substance) | |
| 85393004 | Blood group antigen ILe^bH^ | |
| 85404003 | ^131^Tellurium | |
| 85410003 | Hemoglobin Linkoping | |
| 85427006 | Hemoglobin Owari | |
| 85433002 | Butoconazole nitrate | |
| 85451001 | Nitrite reductase (cytochrome) | |
| 85459004 | Exophthalmos producing substance | |
| 85460009 | Oncogene protein K-RAS | |
| 85462001 | Pentanone | |
| 85475001 | Cypermethrin | |
| 85482002 | Sorbitol-6-phosphate dehydrogenase | |
| 85491003 | Catalase | |
| 85494006 | Gold sodium thiosulfate (substance) | |
| 85504001 | Complement component C5a | |
| 85508003 | 5-Pyridoxate dioxygenase | |
| 85565002 | Blood group antigen Fy5 | |
| 85574000 | Zinc oxide fumes | |
| 85577007 | Diaminobutyrate-pyruvate aminotransferase | |
| 85580008 | Capreomycin sulfate | |
| 85584004 | Achromobacter iophogus collagenase | |
| 85594009 | Blood group antigen Sc1 | |
| 85596006 | Fluorescein stain (substance) | |
| 85600001 | Triacylglycerol | |
| 85603004 | Triphenamyl | |
| 85608008 | Methacrylonitrile (substance) | |
| 85609000 | Methionine gamma-lyase | |
| 85612002 | Atrazine | |
| 85633006 | Para-nitrosulfathiazole (substance) | |
| 85643009 | Filicin | |
| 85661000 | 5-Methyltetrahydropteroyltriglutamate-homo-cysteine methyltransferase | |
| 85668006 | Starch powder | |
| 85673000 | Intracisternal material | |
| 85689002 | Coproporphyrinogen III | |
| 85693008 | Technetium Tc^99m^ aggregated albumin | |
| 85701007 | Ganglioside GM>2< (substance) | |
| 85717001 | Carbonate dehydratase | |
| 85724000 | Oxacillin sodium | |
| 85727007 | Xanthine phosphoribosyltransferase (substance) | |
| 85731001 | Immunoglobulin, secretory piece | |
| 85737002 | Chlorpheniramine maleate (substance) | |
| 85751002 | 17-Hydroxyprogesterone | |
| 85760005 | Hyperosmotic laxative | |
| 85766004 | myo-Inositol 3-methyltransferase | |
| 85773009 | Hemoglobin D-Ouled Rabah | |
| 85784002 | Cytosine deaminase | |
| 85788004 | Thioglycolic acid | |
| 85794007 | Blood group antibody Snyder | |
| 85822005 | Zeatin | |
| 85829001 | Left bronchial mucus | |
| 85834002 | Blood group antibody Cooper | |
| 85839007 | Glutamine-scyllo-inosose aminotransferase | |
| 85854001 | Alkane 1-monooxygenase | |
| 85860001 | Nervous system hormone-like substance | |
| 85877001 | Ethanolamine kinase | |
| 85886006 | Blood group antigen Peretz | |
| 85889004 | ^191^Platinum | |
| 85894004 | Ketol-acid reductoisomerase | |
| 85899009 | Lithium | |
| 85906005 | Bulbogastrone | |
| 85923001 | Oil of marjoram | |
| 85937005 | Acrolein | |
| 85943007 | Ca^2+^-transporting ATPase | |
| 85954002 | Blood group antigen Berrio | |
| 85955001 | Hemoglobin A>2< Zagreb | |
| 85958004 | ^72^Selenium | |
| 85969001 | Hemoglobin Rampa | |
| 85977002 | Crag herbicide | |
| 85981002 | Chromotrope 2R stain (substance) | |
| 85984005 | Hemoglobin Memphis | |
| 85988008 | Blood group antibody Jk^a^ | |
| 85997007 | Oncogene protein mas | |
| 85998002 | Blood group antibody Ull | |
| 86001006 | HLA-DPw2 antigen | |
| 86026002 | Hemoglobin Stanmore | |
| 86027006 | Argon isotope | |
| 86054009 | Riboflavinase | |
| 86076000 | Lymphocyte antigen CD45RO | |
| 86083007 | Blood group antigen Pantaysh | |
| 86108002 | mRNA (O^2^'-methyladenosine-N^6^)-methyltransferase | |
| 86120005 | Phosphoribulokinase | |
| 86132009 | Hemoglobin A>2< Honai | |
| 86141004 | UTP-glucose-1-phosphate uridylyltransferase | |
| 86155007 | Lanosterol | |
| 86180007 | Serpentine asbestos | |
| 86186001 | ^37^Argon | |
| 86202008 | NAD^+^ pyrophosphatase | |
| 86205005 | Carbon oxysulfide | |
| 86211008 | Free thyroxin | |
| 86218002 | Cantharidin | |
| 86223002 | Carboxypeptidase B | |
| 86227001 | Ytterbium | |
| 86233005 | Sulfur dioxide | |
| 86239009 | Galactoside 3(4)-L-fucosyltransferase | |
| 86241005 | ^66^Germanium | |
| 86243008 | ^109^Cadmium | |
| 86254003 | Blood group antigen Tichmeyer | |
| 86257005 | Ritodrine hydrochloride | |
| 86261004 | Decay accelerating factor | |
| 86272009 | HLA-Dw8 antigen | |
| 86281003 | 2-Nitropropane | |
| 86301004 | Posterior pituitary hormone | |
| 86315002 | Dibutyl succinate | |
| 86320002 | Fibrinogen Milano I | |
| 86332003 | Blood group antigen Yt^b^ | |
| 86336000 | Hemoglobin Chiapas | |
| 86340009 | Glucose 1-phosphate thymidylyltransferase | |
| 86355000 | Electrolyte | |
| 86383003 | Coccidioidin | |
| 86388007 | Mercuric oxide | |
| 86399009 | Nickel isotope | |
| 86416000 | Potassium arsenite | |
| 86420001 | Biotin-[propionyl-CoA-carboxylase,(ATP-hydrolysing)] ligase | |
| 86430005 | L-Iduronidase | |
| 86431009 | Pantothenic acid | |
| 86436004 | Ethyl nitrophenyl benzene thiophosphonate | |
| 86447006 | Phosphoglyceride | |
| 86460000 | D-Methionine-pyruvate aminotransferase | |
| 86461001 | Plant diterpene | |
| 86471004 | Tribasic copper sulfate | |
| 86478005 | Diisopropylamine | |
| 86506005 | Mercury (II) reductase | |
| 86518001 | Steroid sulfotransferase | |
| 86520003 | Hemoglobin J-Chicago | |
| 86521004 | ^77^Bromine | |
| 86526009 | Deoxyguanylic acid | |
| 86529002 | N-Sulfoglucosamine-3-sulfatase | |
| 86530007 | Blood group antibody Hu | |
| 86532004 | Blood group antibody Sj | |
| 86537005 | Penicillium roqueforti neutral proteinase | |
| 86541009 | Brilliant crocein stain (substance) | |
| 86549006 | Hypothalamic or pituitary hormone (substance) | |
| 86551005 | Hemoglobin Chad | |
| 86575005 | Nitrogen isotope | |
| 86579004 | Nitrogen gas | |
| 86584005 | Iodoalphionic acid (substance) | |
| 86600008 | Fish toxin | |
| 86609009 | Wood preservative | |
| 86613002 | Sarcosine oxidase | |
| 86621008 | Hamamelose kinase | |
| 86622001 | Blood group antibody Taur | |
| 86627007 | Haemoglobin F-Ube | |
| 86633003 | Cadmium salt | |
| 86637002 | ^81^Rubidium | |
| 86640002 | 3-Demethylubiquinone-9 3-methyltransferase | |
| 86659000 | Thiethylperazine malate | |
| 86668003 | Blood group antigen Barrett | |
| 86692006 | ^206^Thallium | |
| 86697000 | HLA-Aw36 antigen | |
| 86701002 | Nucleoside-triphosphate pyrophosphatase | |
| 86710005 | Nitrogen radioisotope | |
| 86712002 | (S)-2-Hydroxy-fatty-acid dehydrogenase | |
| 86739005 | Zinc | |
| 86742004 | Deoxycytidylate hydroxymethyltransferase | |
| 86750008 | Nitrazine yellow stain (substance) | |
| 86754004 | ^197^Platinum | |
| 86756002 | Tincture of green soap | |
| 86759009 | Blood group antibody Gallner | |
| 86778009 | Polyribonucleotide synthase (ATP) | |
| 86783001 | L-Galactonolactone oxidase | |
| 86790006 | Blood group antibody JL | |
| 86813000 | Oxalomalate lyase | |
| 86822004 | Neurine | |
| 86836009 | Hemoglobin J-Baltimore | |
| 86848007 | Penicillin amidase | |
| 86852007 | ^196m>2<^Gold | |
| 86865003 | ^65^Nickel | |
| 86878003 | Retinal dehydrogenase | |
| 86884000 | 2,4,5-Trichlorophenoxyacetic acid | |
| 86887007 | Hemoglobin I-Interlaken | |
| 86904001 | Cholestenone 5alpha-reductase | |
| 86913004 | Blood group antibody Milne | |
| 86922003 | Plant cardiac glycoside | |
| 86928004 | Sulfur tetrafluoride | |
| 86935007 | Blood group antigen An^a^ | |
| 86946005 | Trichlorophenoxy ethyl sulfate | |
| 86951004 | Blood group antibody Hands | |
| 86953001 | Zinc salt | |
| 86955008 | Glycobiarsol | |
| 86960007 | Epidermal growth factor-urogastrone receptor | |
| 86963009 | Lower respiratory tract mucus | |
| 86973006 | ^133m^Barium | |
| 86988001 | Ergotoxine | |
| 86990000 | Deoxycytidine kinase | |
| 86994009 | HLA-B38 antigen | |
| 87028007 | Hemp fiber | |
| 87032001 | Dipeptidyl peptidase II | |
| 87033006 | Itaconyl-CoA hydratase | |
| 87036003 | Blood group antibody R1^a^ | |
| 87039005 | Carbamoyl-serine ammonia-lyase | |
| 87044003 | Palmitic acid | |
| 87067001 | Sublimed sulfur | |
| 87090006 | Flavoxate hydrochloride | |
| 87097009 | Nitrofurazone (substance) | |
| 87112000 | Blood group antigen Zaw | |
| 87116002 | 5,25-Dihydroxy cholecalciferol | |
| 87122006 | Blood group antibody Covas | |
| 87136001 | Asparagine | |
| 87148003 | Amphetamine sulfate | |
| 87151005 | Neostigmine methylsulfate | |
| 87154002 | Cystine reductase (NADH) | |
| 87167004 | Oncogene protein int-2 | |
| 87171001 | ^127m^Tellurium | |
| 87174009 | Guaifenesin | |
| 87200008 | Lower respiratory fluids | |
| 87205003 | Malathion | |
| 87212007 | Lysine-tRNA ligase | |
| 87222001 | Citrate(si)-synthase | |
| 87236006 | Dihydroxyphenylalanine ammonia-lyase | |
| 87251002 | 4-Methoxyamphetamine | |
| 87283008 | Clidinium bromide | |
| 87300005 | 2,4-Dichlorophenol 6-monooxygenase | |
| 87303007 | Cephapirin (substance) | |
| 87304001 | Acetylglutamate kinase | |
| 87312009 | Colony-stimulating factor, multiple | |
| 87316007 | Immunoglobulin, light chain | |
| 87332005 | Homogentisic acid | |
| 87336008 | Alcohol dehydrogenase | |
| 87337004 | Sulfur iodide | |
| 87344008 | Pantothenate kinase | |
| 87347001 | Urocanic acid | |
| 87368000 | Blood group antibody En^a^FR | |
| 87371008 | Phosphoribosyl pyrophosphate | |
| 87399004 | Apolipoprotein A | |
| 87401005 | ^212^Lead | |
| 87403008 | Heptane | |
| 87410002 | Technetium Tc^99^ N-substituted iminodiacetate | |
| 87437000 | ^73^Selenium | |
| 87440000 | Tryptophan 5-monooxygenase | |
| 87444009 | Immunoglobulin, GM>12< allotype | |
| 87445005 | Ipodate | |
| 87452007 | Light metal compound | |
| 87453002 | Carbon | |
| 87468001 | Magnesium bromide | |
| 87472002 | Vecuronium bromide | |
| 87477008 | Phytanic acid | |
| 87478003 | ^239^Plutonium | |
| 87485004 | Strontium bromide | |
| 87499000 | Blood group antigen Mckeever | |
| 87504000 | Enoyl-CoA hydratase | |
| 87524001 | Immunoglobulin, hypervariable region | |
| 87526004 | Bilirubin oxidase | |
| 87542006 | Blood group antigen Rh33 | |
| 87549002 | Blood group antigen Gd | |
| 87568004 | Hormone | |
| 87574004 | o-Aminophenol oxidase | |
| 87585002 | ^41^Calcium | |
| 87593002 | Blood group antibody Er^a^ | |
| 87599003 | Metaxalone | |
| 87609004 | Hexokinase | |
| 87610009 | Aflatoxin B | |
| 87612001 | Blood | |
| 87624008 | L-Iditol dehydrogenase | |
| 87625009 | 4-Hydroxy-2-oxoglutarate aldolase | |
| 87629003 | Coagulation factor X variant | |
| 87645001 | Hexylene glycol | |
| 87657005 | Blood group antibody E. Amos | |
| 87661004 | Lymphocyte antigen CD59 | |
| 87664007 | Hemoglobin A>2< NYU | |
| 87672009 | Blood group antigen Mateen | |
| 87692002 | Wax-ester hydrolase | |
| 87708000 | Vitamin | |
| 87714007 | ^185^Iridium | |
| 87718005 | Acetyl-CoA carboxylase-phosphatase | |
| 87723005 | Cholestenone 5beta-reductase | |
| 87729009 | Sulfite oxidase | |
| 87738006 | Isopropyl cresol | |
| 87741002 | Hemoglobin D-Bushman | |
| 87744005 | Calcium arsenate | |
| 87802005 | ^33^Phosphorus | |
| 87805007 | Deoxycytidine deaminase | |
| 87811005 | Injectable fibrinolysin | |
| 87817009 | Glycerol-3-phosphate dehydrogenase (NAD^+^) | |
| 87831009 | Trimipramine maleate | |
| 87835000 | Blood group antibody Dantu | |
| 87847006 | Promoxolane | |
| 87853006 | Technetium Tc^99m^ iron ascorbate | |
| 87869004 | Manganese | |
| 87873001 | Ribonuclease U>2< | |
| 87882007 | 3-Isopropylmalate dehydratase | |
| 87889003 | Hemoglobin Chapel Hill | |
| 87896001 | Creosote | |
| 87897005 | Human antihemophilic plasma | |
| 87901004 | Catechol l,2 dioxygenase | |
| 87918000 | Mineral | |
| 87924006 | N-Acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase | |
| 87925007 | Biotin-CoA ligase | |
| 87926008 | dTDP4-amino-4,6-dideoxy-D-glucose aminotransferase | |
| 87929001 | Ribose dehydrogenase (NADP^+^) | |
| 87930006 | Fibrinogen Baltimore I | |
| 87931005 | Mimosine | |
| 87940009 | ^179^Tantalum | |
| 87946003 | Blood group antigen U^x^ | |
| 87954001 | Guanosine deaminase | |
| 87957008 | Calotropin | |
| 87958003 | Ferrous citrate Fe^59^ | |
| 87972007 | Blood group antibody Sadler | |
| 87981001 | o-Pyrocatechuate decarboxylase | |
| 87983003 | Rhodium salt | |
| 87990008 | Phospho-N-acetylmuramoyl-pentapeptide-transferase | |
| 88001004 | Chlorpropham | |
| 88005008 | Hemoglobin Helsinki | |
| 88007000 | Sodium tetrahydride | |
| 88014003 | Beryllium | |
| 88020002 | Ketoacid | |
| 88023000 | LYT antigen | |
| 88025007 | Silvex | |
| 88038004 | Fructuronate reductase | |
| 88043006 | Allose kinase | |
| 88064005 | Hemoglobin F-Forest Park | |
| 88074008 | Cytokinins | |
| 88087002 | Dodecylguanidine monoacetate | |
| 88090008 | Tellurium isotope | |
| 88097006 | Tin compound | |
| 88122008 | Passiflorine | |
| 88131008 | HLA-DRw12 antigen | |
| 88166005 | Copper^64^ versenate | |
| 88171003 | Cytidine deaminase | |
| 88179001 | Robin | |
| 88184007 | Acetyl chloride | |
| 88194002 | Clofenotane | |
| 88204001 | Antigen in Kidd (JK) blood group system | |
| 88222003 | Phosphatidylcholine 12-monooxygenase | |
| 88236008 | Phosphine | |
| 88237004 | ^82m^Rubidium | |
| 88245009 | Bacillus subtilis ribonuclease (substance) | |
| 88262004 | Phenylphosphine | |
| 88287006 | Sulfur radioisotope | |
| 88292008 | Blood group antigen Zt^a^ | |
| 88304003 | Lymphocyte antigen CD48 | |
| 88319002 | Prompt zinc insulin | |
| 88325003 | Calcium undecylenate | |
| 88330004 | Cevine | |
| 88337001 | Maleylacetoacetate isomerase | |
| 88341002 | Blood group antibody k | |
| 88342009 | HLA-D antigen | |
| 88352008 | Bromindione | |
| 88368002 | Angiotensin I | |
| 88375001 | Blood group antibody Van Buggenhout | |
| 88376000 | Carcinogen | |
| 88381009 | Methyl chloride | |
| 88383007 | Phosphoglucokinase | |
| 88404004 | alpha>2< Neuramino glycoprotein | |
| 88406002 | Chymotrypsin C | |
| 88408001 | D-Amino-acid oxidase | |
| 88426003 | Oncogene protein N-MYC | |
| 88427007 | Methyl acetylene | |
| 88432008 | Arabinose isomerase | |
| 88452009 | Steroid delta-isomerase | |
| 88453004 | Platelet antigen HPA-1a | |
| 88457003 | ^198^Lead | |
| 88462002 | HLA-Aw33 antigen | |
| 88468003 | Magnesium silicate | |
| 88473009 | Selenomethionine Se^75^ (substance) | |
| 88476001 | Urate | |
| 88480006 | Potassium | |
| 88485001 | Etidocaine | |
| 88486000 | Poly (ribitol-phosphate) beta-glucosyltransferase | |
| 88488004 | Lead | |
| 88502003 | Behenic acid | |
| 88525002 | 2-Coumarate O-beta-glucosyltransferase | |
| 88543003 | Hydroxyphenamate (substance) | |
| 88546006 | Sarcosine | |
| 88551000 | 5-Azacytidine | |
| 88555009 | Aminodeoxygluconate dehydratase | |
| 88557001 | Phosphatidylcholine-sterol acyltransferase | |
| 88574001 | Otic sulfonamide preparation | |
| 88583006 | Creatinine deiminase | |
| 88585004 | Chlorprothixene hydrochloride | |
| 88589005 | Cyclocumarol | |
| 88602005 | Glucagon-like peptide 2 | |
| 88605007 | ^224^Radium | |
| 88617009 | Magnesium isotope | |
| 88625006 | Water soluble aniline blue stain (substance) | |
| 88631009 | beta Sitosterol | |
| 88637008 | Hemoglobin A>2< Babinga | |
| 88640008 | Deoxyribodipyrimidine endonucleosidase | |
| 88660000 | Fast sulfon black F stain (substance) | |
| 88661001 | Platelet antibody HPA-4a | |
| 88662008 | Pyridoxine 5-dehydrogenase | |
| 88683002 | Active C4b2a3b | |
| 88689003 | Long-chain-alcohol dehydrogenase | |
| 88704000 | Bacterial insecticide | |
| 88709005 | dTMP kinase | |
| 88710000 | alpha-1,3-Mannosyl-glycoprotein beta-1,2-N-acetylglucosaminyltransferase | |
| 88724001 | Ptomatropine | |
| 88730001 | Fibrinogen Paris IV | |
| 88736007 | Betamethasone dipropionate | |
| 88754006 | alpha-Naphthyl thiourea | |
| 88757004 | Sulfisoxazole acetyl (substance) | |
| 88770008 | Indole-3-acetaldehyde reductase (NADH) | |
| 88781006 | Americium (substance) | |
| 88785002 | Nitroso dye | |
| 88792007 | Peptidoglycan glycosyltransferase | |
| 88802007 | Chlorazanil | |
| 88811007 | Witch hazel | |
| 88832004 | 3alpha-Hydroxycholanate dehydrogenase | |
| 88863000 | tert-Butyl alcohol | |
| 88864006 | ^250^Californium | |
| 88878007 | Protein | |
| 88881002 | Blood group antigen H | |
| 88896003 | Threonine racemase | |
| 88913006 | Blood group antigen Milano | |
| 88919005 | Fibroblast growth factor | |
| 88921000 | Fibril | |
| 88941005 | Hemoglobin Thailand | |
| 88949007 | 2-Alkyn-1-ol dehydrogenase | |
| 88954003 | ^55^Iron | |
| 88958000 | Blood group antibody Mo^a^ | |
| 88970001 | Eudermol | |
| 88983000 | Lymphocyte antigen CD61 | |
| 89006002 | Vipera russelli proteinase | |
| 89009009 | Methylphosphothioglycerate phosphatase | |
| 89015009 | Choleretic agent (substance) | |
| 89025004 | MCPA sodium salt | |
| 89028002 | Curcumin stain (substance) | |
| 89033003 | Blood-group-substance endo-1,4-beta-galactosidase | |
| 89041003 | Blood group antigen Sk^a^ | |
| 89043000 | Blood group antibody Geslin | |
| 89048009 | Collagen type IV | |
| 89055006 | Benzylpenicillin sodium | |
| 89064001 | Oncogene protein met | |
| 89067008 | Cinchonidine | |
| 89071006 | Phenylpyruvic acid | |
| 89074003 | Blood group antigen Wolfe | |
| 89086000 | Fibrin degradation product | |
| 89094007 | Thrombospondin | |
| 89095008 | Takabrucem salicylanilide | |
| 89119000 | Nitrate salt | |
| 89128004 | Xanthates | |
| 89139001 | Light green SF stain (substance) | |
| 89148006 | Fast garnet GBC salt stain (substance) | |
| 89152006 | Dynein ATPase | |
| 89177007 | Proton | |
| 89184004 | Vinbarbital | |
| 89189009 | Neurohumoral receptor | |
| 89191001 | 15-Hydroperoxy-5,8,11,13-eicosatetraenoic acid | |
| 89195005 | Octamethyl pyrophosphoramide | |
| 89197002 | Germanium compound | |
| 89201002 | Carbonyl reductase (NADPH) | |
| 89203004 | Acetolactate decarboxylase | |
| 89214001 | Chlorotoloxyacetic acid | |
| 89219006 | Potassium gluconate | |
| 89224009 | Glucan 1,6-alpha-glucosidase | |
| 89227002 | Paracrine substance | |
| 89249008 | Dipyrrole | |
| 89256002 | Formate dehydrogenase | |
| 89263002 | Glucose-1-phosphate cytidylyltransferase | |
| 89264008 | rRNA (adenine-N^6^)-methyltransferase | |
| 89272005 | ^58^Cobalt | |
| 89284007 | N^6^-Methyl-lysine oxidase | |
| 89289002 | [Hydroxymethylglutaryl-CoA reductase (NADPH)]-phosphatase | |
| 89301000 | 2-Oxoadipate reductase | |
| 89306005 | Imidazoleacetate-phosphoribosyldiphosphate ligase | |
| 89307001 | 15-Hydroxyprostaglandin dehydrogenase (NAD^+^) | |
| 89309003 | Organic sulfur compound | |
| 89326009 | Glucosulfone sodium | |
| 89335002 | Copper undecylenate | |
| 89336001 | Caffeate 3,4-dioxygenase | |
| 89349006 | Hexachloroacetone | |
| 89350006 | Blood group antibody O'Connor | |
| 89351005 | Potassium iodide | |
| 89364006 | Leucine dehydrogenase | |
| 89371001 | 5-Oxoprolyl-peptidase | |
| 89401004 | Potassium guaiacolsulfonate | |
| 89422005 | Allobarbital | |
| 89436000 | Blood group antigen Rich | |
| 89453007 | Citryl-CoA lyase | |
| 89457008 | Radioactive isotope | |
| 89468008 | Coagulation factor IX Seattle variant | |
| 89482008 | Histidinol-phosphate aminotransferase | |
| 89506006 | Oxalic acid | |
| 89515004 | Hypochlorite salt | |
| 89518002 | N-octylbicycloheptene dicarboximide | |
| 89526005 | HLA-B18 antigen | |
| 89543008 | Blood group antibody V | |
| 89553009 | Sulfite reductase (ferredoxin) | |
| 89564007 | Blood group antigen Cameron | |
| 89577003 | Pontamine sky blue 5BX stain (substance) | |
| 89588009 | Aryl-aldehyde dehydrogenase (NADP^+^) | |
| 89592002 | Blood group antibody Be^a^ | |
| 89595000 | Iodized oil | |
| 89612008 | Petrichloral | |
| 89619004 | Ubiquinol-cytochrome-c reductase | |
| 89632009 | ^227^Thorium | |
| 89668004 | Blood group antigen Terschurr | |
| 89669007 | Carboxypeptidase S | |
| 89678001 | Cefuroxime axetil | |
| 89701003 | Dithiazanine iodide | |
| 89702005 | Selenium salt | |
| 89707004 | Sesame oil | |
| 89717009 | Bilirubin Z transport protein | |
| 89735000 | Blood group antibody Kenneddy | |
| 89745003 | Somatotropin receptor (substance) | |
| 89750009 | Adonidin | |
| 89767002 | Blood group antibody Mateen | |
| 89771004 | Lymphocyte antigen CD34 | |
| 89772006 | Tranylcypromine sulfate | |
| 89775008 | Pipamazine | |
| 89781000 | Hydroxymandelonitrile lyase | |
| 89803009 | Blood group antigen Mackin | |
| 89811004 | Gluten | |
| 89818005 | Technetium Tc^99^ tagged red cells | |
| 89822000 | 4-Nitroso dimethylamine | |
| 89829009 | Etioporphyrin | |
| 89838006 | Coagulation factor IX Hilo variant | |
| 89841002 | Blood group antibody AY | |
| 89848008 | (S)-Norlaudanosoline synthase | |
| 89851001 | Thebaine | |
| 89853003 | Cortilymph | |
| 89856006 | Ponceau S stain (substance) | |
| 89864000 | Entomophthora collagenolytic proteinase | |
| 89866003 | Plotospasmin toxin | |
| 89867007 | Triorthocresyl phosphate | |
| 89875001 | Serogically-defined antigen | |
| 89889006 | Cotton fiber | |
| 89920007 | Blood group antibody Pr>1d< | |
| 89926001 | ^236^Uranium | |
| 89952007 | Blood group antigen s^D^ | |
| 89981008 | Nucleoside ribosyltransferase | |
| 90011005 | CDPglycerol pyrophosphatase | |
| 90018004 | 6-Phospho-beta-glucosidase | |
| 90019007 | (N-Acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase | |
| 90025006 | ^95^Zirconium | |
| 90026007 | Ajacine | |
| 90029000 | Tyrosine carboxypeptidase | |
| 90047006 | Aminobenzoate decarboxylase | |
| 90058002 | Bauxite fumes | |
| 90059005 | ^79^Krypton | |
| 90066006 | Oxalyl-CoA decarboxylase | |
| 90077000 | Progesterone monooxygenase | |
| 90086005 | Sphingosine | |
| 90088006 | HLA-B39 antigen | |
| 90095002 | Oil of angelica | |
| 90100000 | Isopropanol dehydrogenase (NADP^+^) | |
| 90106006 | Blood group antibody En^a^FS | |
| 90107002 | Alkylglycerone kinase | |
| 90118002 | Dobutamine hydrochloride | |
| 90136002 | Pink wine | |
| 90142003 | Calcium caseinate | |
| 90148004 | Succinate-hydroxymethylglutarate CoA-transferase | |
| 90150007 | ^117m^Tin | |
| 90156001 | Blood group antigen Becker | |
| 90160003 | Blood group antibody Bell | |
| 90170001 | Propargyl alcohol (substance) | |
| 90192002 | Aspergillus oryzae neutral proteinase | |
| 90193007 | Agmatine 4-coumaroyltransferase | |
| 90209005 | ^100^Rhodium | |
| 90220005 | Novobiocin | |
| 90234005 | Candicin toxin | |
| 90247000 | Blood group antibody Gould | |
| 90260006 | Allergen | |
| 90266000 | Hemoglobin D | |
| 90296005 | Blood group antibody Fy4 | |
| 90299003 | Blood group antigen U^z^ | |
| 90304002 | Blood group antibody Wetz | |
| 90311003 | Lymphocyte chemotactic factor | |
| 90317004 | Helium | |
| 90339002 | Germicide | |
| 90342008 | Carbazochrome salicylate | |
| 90344009 | Etazocine | |
| 90350004 | 1-Pyrroline-4-hydroxy-2-carboxylate deaminase | |
| 90355009 | Carbon radioisotope | |
| 90404003 | Fibrinogen Barcelona I | |
| 90495007 | Plant alcoholic oil | |
| 90529007 | ^77^Germanium | |
| 90534006 | (R)-Dehydropantoate dehydrogenase | |
| 90537004 | ^232^Plutonium | |
| 90544008 | Iodine monochloride | |
| 90567005 | Iron isotope | |
| 90581007 | Carbamide peroxide | |
| 90582000 | Cytidine triphosphate (substance) | |
| 90595005 | Silver bromide | |
| 90615000 | HLA-Bw61 antigen | |
| 90617008 | Indium^113^ bleomycin | |
| 90618003 | Gold compound | |
| 90624009 | Blood group antigen Mo^a^ | |
| 90633006 | Azobilirubin pigment | |
| 90644003 | L-Gulonate dehydrogenase | |
| 90656002 | Blood group antigen LW^a^ | |
| 90664008 | ^127^Tin | |
| 90666005 | Glyoxylate reductase (NADP^+^) | |
| 90667001 | Lymphocyte antigen CD72 | |
| 90668006 | Enzyme | |
| 90670002 | Deltamethrin | |
| 90671003 | Potassium thiocyanate | |
| 90677004 | Mustard white | |
| 90694002 | Asparagine synthase (glutamine-hydrolysing) | |
| 90696000 | Neosaxitonin | |
| 90698004 | Chondro-6-sulfatase | |
| 90714008 | HLA-Aw74 antigen | |
| 90720009 | Cytoplasmic antibody | |
| 90724000 | 3-Hydroxymethylcephem carbamoyltransferase | |
| 90733003 | Metrizamide | |
| 90737002 | Leaves | |
| 90743000 | Deoxycytidine triphosphate deaminase (substance) | |
| 90745007 | Bunamiodyl | |
| 90758008 | Coparaffinate | |
| 90762002 | Blood group antibody Jk3 | |
| 90812004 | Hot liquid | |
| 90836000 | Blood group antigen Reiter | |
| 90841008 | Thallium radioisotope | |
| 90847007 | Guanine tRNA-ribosyltransferase | |
| 90851009 | Coagulation factor Va | |
| 90865006 | Hemoglobin J-Cambridge | |
| 90867003 | Cytochrome-b>5< reductase | |
| 90872007 | Ephedrine dehydrogenase | |
| 90873002 | Malate dehydrogenase (acceptor) | |
| 90875009 | Doxorubicin hydrochloride | |
| 90879003 | Thorium compound | |
| 90902007 | (S)-2-Hydroxy-acid oxidase | |
| 90922006 | Protopine | |
| 90936001 | Hemoglobin Crete | |
| 90943007 | Carnitine dehydrogenase | |
| 90944001 | Coumarinic anhydride | |
| 90945000 | beta 2 microglobulin | |
| 90953008 | Gallium compound | |
| 90957009 | Thiosulfate sulfurtransferase | |
| 90960002 | Tartrate dehydrogenase | |
| 90971001 | beta-2 Adrenergic receptor | |
| 90977002 | Blood group antibody Driver | |
| 91004000 | Organic dust | |
| 91007007 | Sodium selenate | |
| 91013003 | Pentazocine hydrochloride | |
| 91016006 | Polydeoxyribonucleotide synthase (ATP) | |
| 91018007 | Cresylic acid | |
| 91023007 | Alverine citrate | |
| 91026004 | Sodium isopropyl xanthate | |
| 91067009 | Prostaglandin-E>2< 9-ketoreductase | |
| 91100006 | Allantoin racemase | |
| 91103008 | Blood group antigen IP | |
| 91132006 | Curcin | |
| 91137000 | Deuterium | |
| 91163005 | ^242^Californium | |
| 91166002 | Monoiodotyrosine | |
| 91171009 | Pesticide adjuvant | |
| 91185004 | Active C1q | |
| 91190001 | Dextran 1,6-alpha-isomaltotriosidase | |
| 91194005 | Cellulose synthase (GDP-forming) | |
| 91205007 | dTDPgalactose dehydrogenase | |
| 91215001 | Acetylene tetrabromite | |
| 91239006 | ^111m^Silver | |
| 91245003 | Oncogene protein C-MYC | |
| 91254000 | gamma-Glutamylcyclotransferase | |
| 91255004 | Copper fumes | |
| 91262008 | Guanosine triphosphate | |
| 91263003 | Blood group antigen Th^a^ | |
| 91266006 | Sulfoxone | |
| 91279002 | ^77^Krypton | |
| 91283002 | Glutathione peroxidase | |
| 91295002 | Fast blue BB salt stain (substance) | |
| 91306006 | Unclassified vasodilating agent | |
| 91309004 | Acute phase reactant | |
| 91312001 | Hemoglobin St. Etienne | |
| 91314000 | Furazolidone | |
| 91319005 | Levanase | |
| 91351006 | Hemoglobin Kenitra | |
| 91353009 | Cephalotoxin | |
| 91370001 | Peroxyacetic acid | |
| 91384006 | Dibenzoxepin derivative | |
| 91403002 | Lobeline | |
| 91410008 | Silicon compound | |
| 91423001 | Coagulation factor II Quick variant | |
| 91424007 | Nitrogen dioxide | |
| 91426009 | Antigen in Duffy (FY) blood group system | |
| 91455001 | Wood tar | |
| 91464006 | Lymphocyte antigen CD36 | |
| 91495004 | Palladium isotope | |
| 91518003 | Polybrominated biphenyl | |
| 91521001 | Corticosterone | |
| 91542004 | Blood group antibody Peretz | |
| 91543009 | Serine palmitoyltransferase | |
| 91548000 | Mandelate 4-monooxygenase | |
| 91560004 | Isopropyl benzene | |
| 91572005 | Blood group antibody rr-35 | |
| 91574006 | Hemoglobin British Columbia | |
| 91577004 | Fibrinogen Chapel Hill III | |
| 91594002 | Methohexital sodium | |
| 91598004 | Benzoyl peroxide | |
| 91606004 | Cochineal stain (substance) | |
| 91611002 | Iodide peroxidase | |
| 91616007 | Arsenic trisulfide | |
| 91619000 | Andirine | |
| 91626000 | Blood group antigen Sharp | |
| 91638009 | Hemoglobin Miyashiro | |
| 91639001 | Cold cream | |
| 91645009 | Thymine | |
| 91665002 | ^26^Aluminum | |
| 91668000 | Orcinol 2-monooxygenase | |
| 91677007 | Aplysiatoxin | |
| 91680008 | Formiminoglutamase (substance) | |
| 91720002 | Body substance | |
| 95969004 | Organic acid | |
| 95970003 | Trace element | |
| 95971004 | Urea nitrogen | |
| 95972006 | Ammonia nitrogen | |
| 95973001 | Protein nitrogen | |
| 95974007 | alpha-Amino acid nitrogen | |
| 95975008 | Inorganic sulfate | |
| 95976009 | Aluminum stearate | |
| 95977000 | Chelated iron | |
| 95978005 | Spot remover | |
| 95979002 | Trichloroethyl alcohol | |
| 95980004 | Creosol | |
| 95981000 | Paradimethylaminobenzaldehyde | |
| 95982007 | Methoxyacetate | |
| 95983002 | Adipic acid | |
| 95984008 | alpha-Aminoadipic acid | |
| 95985009 | 2,4 Toluenediamine | |
| 95986005 | 2,6 Toluenediamine | |
| 95987001 | Chloramine B | |
| 95988006 | Poloxalene | |
| 95989003 | Organic chloride compound | |
| 95990007 | Grubicide | |
| 95991006 | Famphur | |
| 95992004 | Cythioate | |
| 95993009 | Bromadiolone | |
| 95994003 | Camptothecin | |
| 95995002 | Capsaicin | |
| 95996001 | Kapok | |
| 95997005 | Capsanthin | |
| 95999008 | Bacterial enterotoxin | |
| 96001009 | Clostridium difficile toxin B | |
| 96002002 | Verotoxin 1 | |
| 96003007 | Verotoxin 2 | |
| 96004001 | Escherichia coli toxin | |
| 96007008 | Tazobactam | |
| 96008003 | Sulbactam | |
| 96009006 | Bacitracin methylene disalicylate | |
| 96010001 | Sulfomyxin | |
| 96012009 | Carbomycin A | |
| 96013004 | Carbomycin B | |
| 96016007 | Carbadox | |
| 96017003 | Thiostrepton | |
| 96019000 | Tiamulin fumarate | |
| 96021005 | Tylosin phosphate | |
| 96022003 | Tylosin tartrate | |
| 96024002 | Tilmicosin phosphate | |
| 96025001 | Butirosin | |
| 96026000 | Neomycin palmitate | |
| 96027009 | Neomycin undecylenate | |
| 96028004 | Dihydrostreptomycin sulfate | |
| 96030002 | Apramycin sulphate | |
| 96031003 | Sisomicin | |
| 96032005 | Erythromycin phosphate | |
| 96033000 | Erythromycin thiocyanate | |
| 96035007 | Dirithromycin | |
| 96036008 | Miokamycin | |
| 96037004 | Roxithromycin | |
| 96039001 | Mercaptobenzothiazole | |
| 96040004 | Mercaptobenzothiazole zinc | |
| 96041000 | Mercaptobenzothiazole sodium | |
| 96042007 | Cephalonium | |
| 96043002 | Cephapirin benzathine (substance) | |
| 96045009 | Ceftiofur sodium | |
| 96046005 | Ceftiofur hydrochloride | |
| 96048006 | Cefepime | |
| 96050003 | Cefpodoxime proxetil | |
| 96056009 | Cefatrizine (substance) | |
| 96058005 | Cilastatin | |
| 96059002 | Cefmetazole | |
| 96061006 | Loracarbef | |
| 96066001 | Cloxacillin benzathine | |
| 96068000 | Amoxicillin trihydrate (substance) | |
| 96070009 | Ampicillin sodium | |
| 96071008 | Ampicillin trihydrate | |
| 96075004 | Tetracycline phosphate complex | |
| 96076003 | Rolitetracycline | |
| 96078002 | Ormetoprin | |
| 96079005 | Pipemidic acid | |
| 96080008 | Enrofloxacin | |
| 96082000 | Sarafloxacin | |
| 96083005 | Clinafloxacin | |
| 96085003 | Fleroxacin | |
| 96089009 | Pefloxacin | |
| 96092008 | Trovafloxacin | |
| 96094009 | Sulfabromomethazine sodium | |
| 96095005 | Sulfaethoxypyridazine | |
| 96096006 | Sulfaquinoxaline | |
| 96098007 | Valacyclovir (substance) | |
| 96100007 | Foscarnet sodium | |
| 96101006 | Pirlimycin hydrochloride | |
| 96102004 | Carnidazole |
See the full registry of value sets defined as part of FHIR.
Explanation of the columns that may appear on this page:
| Level | A few code lists that FHIR defines are hierarchical - each code is assigned a level. In this scheme, some codes are under other codes, and imply that the code they are under also applies |
| Source | The source of the definition of the code (when the value set draws in codes defined elsewhere) |
| Code | The code (used as the code in the resource instance) |
| Display | The display (used in the display element of a Coding). If there is no display, implementers should not simply display the code, but map the concept into their application |
| Definition | An explanation of the meaning of the concept |
| Comments | Additional notes about how to use the code |